diff options
| author | Dion Dokter <[email protected]> | 2023-10-20 14:17:55 +0200 |
|---|---|---|
| committer | Dion Dokter <[email protected]> | 2023-10-20 14:17:55 +0200 |
| commit | 5b3f75dc726afaf21b6c957b88f8eeb0c9ae322c (patch) | |
| tree | c2b2920f63d83e32dd7f3f2ef18c64d73b997557 | |
| parent | 6f2995cd4c70a2b6c977f553a2d5efcd8216bba7 (diff) | |
| parent | 88ada521461031b7241b09e40aa56f4e64827967 (diff) | |
Merge branch 'master' into center-align
433 files changed, 6902 insertions, 7005 deletions
| @@ -62,9 +62,9 @@ async fn blink(pin: AnyPin) { | |||
| 62 | loop { | 62 | loop { |
| 63 | // Timekeeping is globally available, no need to mess with hardware timers. | 63 | // Timekeeping is globally available, no need to mess with hardware timers. |
| 64 | led.set_high(); | 64 | led.set_high(); |
| 65 | Timer::after(Duration::from_millis(150)).await; | 65 | Timer::after_millis(150).await; |
| 66 | led.set_low(); | 66 | led.set_low(); |
| 67 | Timer::after(Duration::from_millis(150)).await; | 67 | Timer::after_millis(150).await; |
| 68 | } | 68 | } |
| 69 | } | 69 | } |
| 70 | 70 | ||
| @@ -1,9 +1,12 @@ | |||
| 1 | #!/bin/bash | 1 | #!/bin/bash |
| 2 | 2 | ||
| 3 | set -euo pipefail | 3 | set -eo pipefail |
| 4 | 4 | ||
| 5 | export RUSTFLAGS=-Dwarnings | 5 | export RUSTFLAGS=-Dwarnings |
| 6 | export DEFMT_LOG=trace,embassy_hal_internal=debug,embassy_net_esp_hosted=debug,cyw43=info,cyw43_pio=info,smoltcp=info | 6 | export DEFMT_LOG=trace,embassy_hal_internal=debug,embassy_net_esp_hosted=debug,cyw43=info,cyw43_pio=info,smoltcp=info |
| 7 | if [[ -z "${CARGO_TARGET_DIR}" ]]; then | ||
| 8 | export CARGO_TARGET_DIR=target_ci | ||
| 9 | fi | ||
| 7 | 10 | ||
| 8 | TARGET=$(rustc -vV | sed -n 's|host: ||p') | 11 | TARGET=$(rustc -vV | sed -n 's|host: ||p') |
| 9 | 12 | ||
| @@ -36,7 +39,7 @@ cargo batch \ | |||
| 36 | --- build --release --manifest-path embassy-time/Cargo.toml --target thumbv6m-none-eabi --features nightly,defmt,defmt-timestamp-uptime,tick-hz-32_768,generic-queue-8 \ | 39 | --- build --release --manifest-path embassy-time/Cargo.toml --target thumbv6m-none-eabi --features nightly,defmt,defmt-timestamp-uptime,tick-hz-32_768,generic-queue-8 \ |
| 37 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv4,medium-ethernet \ | 40 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv4,medium-ethernet \ |
| 38 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,dhcpv4,medium-ethernet \ | 41 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,dhcpv4,medium-ethernet \ |
| 39 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,dhcpv4,medium-ethernet,nightly \ | 42 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,dhcpv4,medium-ethernet,nightly,dhcpv4-hostname \ |
| 40 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ethernet \ | 43 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ethernet \ |
| 41 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ieee802154 \ | 44 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ieee802154 \ |
| 42 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ethernet,medium-ieee802154 \ | 45 | --- build --release --manifest-path embassy-net/Cargo.toml --target thumbv7em-none-eabi --features defmt,tcp,udp,dns,proto-ipv6,medium-ethernet,medium-ieee802154 \ |
| @@ -66,49 +69,68 @@ cargo batch \ | |||
| 66 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly \ | 69 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly \ |
| 67 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly,intrinsics \ | 70 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly,intrinsics \ |
| 68 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly,qspi-as-gpio \ | 71 | --- build --release --manifest-path embassy-rp/Cargo.toml --target thumbv6m-none-eabi --features nightly,qspi-as-gpio \ |
| 69 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,time-driver-any,unstable-traits \ | 72 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,time-driver-any,unstable-traits,time \ |
| 70 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,time-driver-any \ | 73 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,time-driver-any,time \ |
| 71 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,time-driver-any \ | 74 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,time-driver-any,time \ |
| 72 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,time-driver-any,unstable-traits \ | 75 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,time-driver-any,unstable-traits,time \ |
| 73 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti \ | 76 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,time \ |
| 74 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,unstable-traits \ | 77 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,exti,unstable-traits,time \ |
| 75 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt \ | 78 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,defmt,time \ |
| 76 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,time-driver-any,unstable-traits \ | 79 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,time-driver-any,unstable-traits,time \ |
| 77 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,time-driver-any \ | 80 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,time-driver-any,time \ |
| 78 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,time-driver-any \ | 81 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,time-driver-any,time \ |
| 79 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,time-driver-any,unstable-traits \ | 82 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,time-driver-any,unstable-traits,time \ |
| 83 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,time \ | ||
| 84 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,unstable-traits,time \ | ||
| 85 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,time \ | ||
| 80 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti \ | 86 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti \ |
| 81 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,unstable-traits \ | 87 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt,exti,unstable-traits \ |
| 82 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt \ | 88 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze,nightly,defmt \ |
| 83 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f410tb,defmt,exti,time-driver-any,unstable-traits \ | 89 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f401ve,defmt,exti,time-driver-any,unstable-traits \ |
| 84 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f411ce,defmt,exti,time-driver-any,unstable-traits \ | 90 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f405zg,defmt,exti,time-driver-any,unstable-traits \ |
| 85 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f413vh,defmt,exti,time-driver-any,unstable-traits \ | 91 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f407zg,defmt,exti,time-driver-any,unstable-traits \ |
| 86 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f429zi,log,exti,time-driver-any,unstable-traits,embedded-sdmmc \ | 92 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f401ve,defmt,exti,time-driver-any,unstable-traits,time \ |
| 87 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f730i8,defmt,exti,time-driver-any,unstable-traits \ | 93 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f405zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 88 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h753zi,defmt,exti,time-driver-any,unstable-traits \ | 94 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f407zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 89 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h735zg,defmt,exti,time-driver-any,unstable-traits \ | 95 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f410tb,defmt,exti,time-driver-any,unstable-traits,time \ |
| 90 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h755zi-cm7,defmt,exti,time-driver-any,unstable-traits \ | 96 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f411ce,defmt,exti,time-driver-any,unstable-traits,time \ |
| 91 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h7b3ai,defmt,exti,time-driver-any,unstable-traits \ | 97 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f412zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 92 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32l476vg,defmt,exti,time-driver-any,unstable-traits \ | 98 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f413vh,defmt,exti,time-driver-any,unstable-traits,time \ |
| 93 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32l422cb,defmt,exti,time-driver-any,unstable-traits \ | 99 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f415zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 94 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32wb15cc,defmt,exti,time-driver-any,unstable-traits \ | 100 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f417zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 95 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l072cz,defmt,exti,time-driver-any,unstable-traits \ | 101 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f423zh,defmt,exti,time-driver-any,unstable-traits,time \ |
| 96 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l041f6,defmt,exti,time-driver-any,unstable-traits \ | 102 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f427zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 97 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l073cz,defmt,exti,time-driver-any,unstable-traits,low-power \ | 103 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f429zi,log,exti,time-driver-any,unstable-traits,embedded-sdmmc,time \ |
| 98 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32l151cb-a,defmt,exti,time-driver-any,unstable-traits \ | 104 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f437zi,log,exti,time-driver-any,unstable-traits,time \ |
| 99 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f398ve,defmt,exti,time-driver-any,unstable-traits \ | 105 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f439zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 100 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f378cc,defmt,exti,time-driver-any,unstable-traits \ | 106 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f446ze,defmt,exti,time-driver-any,unstable-traits,time \ |
| 101 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32g0c1ve,defmt,exti,time-driver-any,unstable-traits \ | 107 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f469zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 102 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f217zg,defmt,exti,time-driver-any,unstable-traits \ | 108 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f479zi,defmt,exti,time-driver-any,unstable-traits,embedded-sdmmc,time \ |
| 103 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features nightly,stm32l552ze,defmt,exti,time-driver-any,unstable-traits \ | 109 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32f730i8,defmt,exti,time-driver-any,unstable-traits,time \ |
| 104 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32wl54jc-cm0p,defmt,exti,time-driver-any,unstable-traits \ | 110 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h753zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 105 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32wle5jb,defmt,exti,time-driver-any,unstable-traits \ | 111 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h735zg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 106 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32g474pe,defmt,exti,time-driver-any,unstable-traits \ | 112 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h755zi-cm7,defmt,exti,time-driver-any,unstable-traits,time \ |
| 107 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f107vc,defmt,exti,time-driver-any,unstable-traits \ | 113 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32h7b3ai,defmt,exti,time-driver-any,unstable-traits,time \ |
| 108 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f103re,defmt,exti,time-driver-any,unstable-traits \ | 114 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32l476vg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 109 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f100c4,defmt,exti,time-driver-any,unstable-traits \ | 115 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32l422cb,defmt,exti,time-driver-any,unstable-traits,time \ |
| 110 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32h503rb,defmt,exti,time-driver-any,unstable-traits \ | 116 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32wb15cc,defmt,exti,time-driver-any,unstable-traits,time \ |
| 111 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32h562ag,defmt,exti,time-driver-any,unstable-traits \ | 117 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l072cz,defmt,exti,time-driver-any,unstable-traits,time \ |
| 118 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l041f6,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 119 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32l073cz,defmt,exti,time-driver-any,unstable-traits,low-power,time \ | ||
| 120 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32l151cb-a,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 121 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f398ve,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 122 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f378cc,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 123 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32g0c1ve,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 124 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f217zg,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 125 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features nightly,stm32l552ze,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 126 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features nightly,stm32wl54jc-cm0p,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 127 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32wle5jb,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 128 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features nightly,stm32g474pe,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 129 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f107vc,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 130 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f103re,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 131 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32f100c4,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 132 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32h503rb,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 133 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features nightly,stm32h562ag,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 112 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features ''\ | 134 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features ''\ |
| 113 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features 'log' \ | 135 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features 'log' \ |
| 114 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features 'defmt' \ | 136 | --- build --release --manifest-path cyw43/Cargo.toml --target thumbv6m-none-eabi --features 'defmt' \ |
| @@ -178,12 +200,20 @@ cargo batch \ | |||
| 178 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4a6zg --out-dir out/tests/stm32l4a6zg \ | 200 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4a6zg --out-dir out/tests/stm32l4a6zg \ |
| 179 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4r5zi --out-dir out/tests/stm32l4r5zi \ | 201 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4r5zi --out-dir out/tests/stm32l4r5zi \ |
| 180 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze --out-dir out/tests/stm32l552ze \ | 202 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv8m.main-none-eabihf --features stm32l552ze --out-dir out/tests/stm32l552ze \ |
| 203 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f767zi --out-dir out/tests/stm32f767zi \ | ||
| 204 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f207zg --out-dir out/tests/stm32f207zg \ | ||
| 205 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f303ze --out-dir out/tests/stm32f303ze \ | ||
| 206 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l496zg --out-dir out/tests/stm32l496zg \ | ||
| 207 | --- build --release --manifest-path tests/stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wl55jc --out-dir out/tests/stm32wl55jc \ | ||
| 181 | --- build --release --manifest-path tests/rp/Cargo.toml --target thumbv6m-none-eabi --out-dir out/tests/rpi-pico \ | 208 | --- build --release --manifest-path tests/rp/Cargo.toml --target thumbv6m-none-eabi --out-dir out/tests/rpi-pico \ |
| 182 | --- build --release --manifest-path tests/nrf/Cargo.toml --target thumbv7em-none-eabi --out-dir out/tests/nrf52840-dk \ | 209 | --- build --release --manifest-path tests/nrf/Cargo.toml --target thumbv7em-none-eabi --out-dir out/tests/nrf52840-dk \ |
| 183 | --- build --release --manifest-path tests/riscv32/Cargo.toml --target riscv32imac-unknown-none-elf \ | 210 | --- build --release --manifest-path tests/riscv32/Cargo.toml --target riscv32imac-unknown-none-elf \ |
| 184 | $BUILD_EXTRA | 211 | $BUILD_EXTRA |
| 185 | 212 | ||
| 186 | rm out/tests/nrf52840-dk/wifi_esp_hosted_perf | 213 | |
| 214 | rm out/tests/stm32wb55rg/wpan_mac | ||
| 215 | rm out/tests/stm32wb55rg/wpan_ble | ||
| 216 | rm out/tests/stm32f207zg/eth | ||
| 187 | 217 | ||
| 188 | if [[ -z "${TELEPROBE_TOKEN-}" ]]; then | 218 | if [[ -z "${TELEPROBE_TOKEN-}" ]]; then |
| 189 | echo No teleprobe token found, skipping running HIL tests | 219 | echo No teleprobe token found, skipping running HIL tests |
diff --git a/ci_stable.sh b/ci_stable.sh index 4ee5f4106..1fe4e3a1e 100755 --- a/ci_stable.sh +++ b/ci_stable.sh | |||
| @@ -40,33 +40,38 @@ cargo batch \ | |||
| 40 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u585zi,defmt,exti,time-driver-any,unstable-traits \ | 40 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u585zi,defmt,exti,time-driver-any,unstable-traits \ |
| 41 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wb55vy,defmt,exti,time-driver-any,unstable-traits \ | 41 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wb55vy,defmt,exti,time-driver-any,unstable-traits \ |
| 42 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wl55cc-cm4,defmt,exti,time-driver-any,unstable-traits \ | 42 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wl55cc-cm4,defmt,exti,time-driver-any,unstable-traits \ |
| 43 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4r9zi,defmt,exti,time-driver-any,unstable-traits \ | 43 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32g473cc,defmt,exti,time-driver-any,unstable-traits,time \ |
| 44 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f303vc,defmt,exti,time-driver-any,unstable-traits \ | 44 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32g491re,defmt,exti,time-driver-any,unstable-traits,time \ |
| 45 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f411ce,defmt,time-driver-any \ | 45 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32u585zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 46 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f411ce,defmt,time-driver-any,unstable-traits \ | 46 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wb55vy,defmt,exti,time-driver-any,unstable-traits,time \ |
| 47 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,time-driver-any \ | 47 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32wl55cc-cm4,defmt,exti,time-driver-any,unstable-traits,time \ |
| 48 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,time-driver-any,unstable-traits \ | 48 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l4r9zi,defmt,exti,time-driver-any,unstable-traits,time \ |
| 49 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,time-driver-any \ | 49 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f303vc,defmt,exti,time-driver-any,unstable-traits,time \ |
| 50 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,time-driver-any,unstable-traits \ | 50 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f411ce,defmt,time-driver-any,time \ |
| 51 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,time-driver-any \ | 51 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f411ce,defmt,time-driver-any,unstable-traits,time \ |
| 52 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,time-driver-any,unstable-traits \ | 52 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,time-driver-any,time \ |
| 53 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,time-driver-any \ | 53 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,time-driver-any,unstable-traits,time \ |
| 54 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,time-driver-any,unstable-traits \ | 54 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,time-driver-any,time \ |
| 55 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,time-driver-any \ | 55 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,time-driver-any,unstable-traits,time \ |
| 56 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,time-driver-any,unstable-traits \ | 56 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,time-driver-any,time \ |
| 57 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f410tb,defmt,exti,time-driver-any \ | 57 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,time-driver-any,unstable-traits,time \ |
| 58 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f410tb,defmt,exti,time-driver-any,unstable-traits \ | 58 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,time-driver-any,time \ |
| 59 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,exti,time-driver-any \ | 59 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,time-driver-any,unstable-traits,time \ |
| 60 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,exti,time-driver-any,unstable-traits \ | 60 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,time-driver-any,time \ |
| 61 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,exti,time-driver-any \ | 61 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,time-driver-any,unstable-traits,time \ |
| 62 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,exti,time-driver-any,unstable-traits \ | 62 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f410tb,defmt,exti,time-driver-any,time \ |
| 63 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,exti,time-driver-any \ | 63 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f410tb,defmt,exti,time-driver-any,unstable-traits,time \ |
| 64 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,exti,time-driver-any,unstable-traits \ | 64 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,exti,time-driver-any,time \ |
| 65 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,exti,time-driver-any \ | 65 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32f429zi,log,exti,time-driver-any,unstable-traits,time \ |
| 66 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,exti,time-driver-any,unstable-traits \ | 66 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,exti,time-driver-any,time \ |
| 67 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,exti,time-driver-any \ | 67 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32h755zi-cm7,defmt,exti,time-driver-any,unstable-traits,time \ |
| 68 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,exti,time-driver-any,unstable-traits \ | 68 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,exti,time-driver-any,time \ |
| 69 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f217zg,defmt,exti,time-driver-any \ | 69 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7em-none-eabi --features stm32l476vg,defmt,exti,time-driver-any,unstable-traits,time \ |
| 70 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f217zg,defmt,exti,time-driver-any,unstable-traits \ | 70 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,exti,time-driver-any,time \ |
| 71 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv6m-none-eabi --features stm32l072cz,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 72 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,exti,time-driver-any,time \ | ||
| 73 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32l151cb-a,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 74 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f217zg,defmt,exti,time-driver-any,time \ | ||
| 75 | --- build --release --manifest-path embassy-stm32/Cargo.toml --target thumbv7m-none-eabi --features stm32f217zg,defmt,exti,time-driver-any,unstable-traits,time \ | ||
| 71 | --- build --release --manifest-path examples/nrf52840/Cargo.toml --target thumbv7em-none-eabi --no-default-features --out-dir out/examples/nrf52840 --bin raw_spawn \ | 76 | --- build --release --manifest-path examples/nrf52840/Cargo.toml --target thumbv7em-none-eabi --no-default-features --out-dir out/examples/nrf52840 --bin raw_spawn \ |
| 72 | --- build --release --manifest-path examples/stm32l0/Cargo.toml --target thumbv6m-none-eabi --no-default-features --out-dir out/examples/stm32l0 --bin raw_spawn \ | 77 | --- build --release --manifest-path examples/stm32l0/Cargo.toml --target thumbv6m-none-eabi --no-default-features --out-dir out/examples/stm32l0 --bin raw_spawn \ |
diff --git a/cyw43/Cargo.toml b/cyw43/Cargo.toml index dae7419c1..b19cabfe0 100644 --- a/cyw43/Cargo.toml +++ b/cyw43/Cargo.toml | |||
| @@ -11,11 +11,10 @@ log = ["dep:log"] | |||
| 11 | firmware-logs = [] | 11 | firmware-logs = [] |
| 12 | 12 | ||
| 13 | [dependencies] | 13 | [dependencies] |
| 14 | embassy-time = { version = "0.1.3", path = "../embassy-time"} | 14 | embassy-time = { version = "0.1.5", path = "../embassy-time"} |
| 15 | embassy-sync = { version = "0.3.0", path = "../embassy-sync"} | 15 | embassy-sync = { version = "0.3.0", path = "../embassy-sync"} |
| 16 | embassy-futures = { version = "0.1.0", path = "../embassy-futures"} | 16 | embassy-futures = { version = "0.1.0", path = "../embassy-futures"} |
| 17 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"} | 17 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"} |
| 18 | atomic-polyfill = "0.1.5" | ||
| 19 | 18 | ||
| 20 | defmt = { version = "0.3", optional = true } | 19 | defmt = { version = "0.3", optional = true } |
| 21 | log = { version = "0.4.17", optional = true } | 20 | log = { version = "0.4.17", optional = true } |
diff --git a/cyw43/src/bus.rs b/cyw43/src/bus.rs index 0b5632cf8..014109038 100644 --- a/cyw43/src/bus.rs +++ b/cyw43/src/bus.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | use embassy_futures::yield_now; | 1 | use embassy_futures::yield_now; |
| 2 | use embassy_time::{Duration, Timer}; | 2 | use embassy_time::Timer; |
| 3 | use embedded_hal_1::digital::OutputPin; | 3 | use embedded_hal_1::digital::OutputPin; |
| 4 | use futures::FutureExt; | 4 | use futures::FutureExt; |
| 5 | 5 | ||
| @@ -51,9 +51,9 @@ where | |||
| 51 | pub async fn init(&mut self) { | 51 | pub async fn init(&mut self) { |
| 52 | // Reset | 52 | // Reset |
| 53 | self.pwr.set_low().unwrap(); | 53 | self.pwr.set_low().unwrap(); |
| 54 | Timer::after(Duration::from_millis(20)).await; | 54 | Timer::after_millis(20).await; |
| 55 | self.pwr.set_high().unwrap(); | 55 | self.pwr.set_high().unwrap(); |
| 56 | Timer::after(Duration::from_millis(250)).await; | 56 | Timer::after_millis(250).await; |
| 57 | 57 | ||
| 58 | while self | 58 | while self |
| 59 | .read32_swapped(REG_BUS_TEST_RO) | 59 | .read32_swapped(REG_BUS_TEST_RO) |
diff --git a/cyw43/src/control.rs b/cyw43/src/control.rs index a6d1f0bf5..d2709304c 100644 --- a/cyw43/src/control.rs +++ b/cyw43/src/control.rs | |||
| @@ -1,8 +1,8 @@ | |||
| 1 | use core::cmp::{max, min}; | 1 | use core::cmp::{max, min}; |
| 2 | 2 | ||
| 3 | use ch::driver::LinkState; | ||
| 4 | use embassy_net_driver_channel as ch; | 3 | use embassy_net_driver_channel as ch; |
| 5 | use embassy_time::{Duration, Timer}; | 4 | use embassy_net_driver_channel::driver::{HardwareAddress, LinkState}; |
| 5 | use embassy_time::Timer; | ||
| 6 | 6 | ||
| 7 | pub use crate::bus::SpiBusCyw43; | 7 | pub use crate::bus::SpiBusCyw43; |
| 8 | use crate::consts::*; | 8 | use crate::consts::*; |
| @@ -87,22 +87,22 @@ impl<'a> Control<'a> { | |||
| 87 | self.set_iovar("country", &country_info.to_bytes()).await; | 87 | self.set_iovar("country", &country_info.to_bytes()).await; |
| 88 | 88 | ||
| 89 | // set country takes some time, next ioctls fail if we don't wait. | 89 | // set country takes some time, next ioctls fail if we don't wait. |
| 90 | Timer::after(Duration::from_millis(100)).await; | 90 | Timer::after_millis(100).await; |
| 91 | 91 | ||
| 92 | // Set antenna to chip antenna | 92 | // Set antenna to chip antenna |
| 93 | self.ioctl_set_u32(IOCTL_CMD_ANTDIV, 0, 0).await; | 93 | self.ioctl_set_u32(IOCTL_CMD_ANTDIV, 0, 0).await; |
| 94 | 94 | ||
| 95 | self.set_iovar_u32("bus:txglom", 0).await; | 95 | self.set_iovar_u32("bus:txglom", 0).await; |
| 96 | Timer::after(Duration::from_millis(100)).await; | 96 | Timer::after_millis(100).await; |
| 97 | //self.set_iovar_u32("apsta", 1).await; // this crashes, also we already did it before...?? | 97 | //self.set_iovar_u32("apsta", 1).await; // this crashes, also we already did it before...?? |
| 98 | //Timer::after(Duration::from_millis(100)).await; | 98 | //Timer::after_millis(100).await; |
| 99 | self.set_iovar_u32("ampdu_ba_wsize", 8).await; | 99 | self.set_iovar_u32("ampdu_ba_wsize", 8).await; |
| 100 | Timer::after(Duration::from_millis(100)).await; | 100 | Timer::after_millis(100).await; |
| 101 | self.set_iovar_u32("ampdu_mpdu", 4).await; | 101 | self.set_iovar_u32("ampdu_mpdu", 4).await; |
| 102 | Timer::after(Duration::from_millis(100)).await; | 102 | Timer::after_millis(100).await; |
| 103 | //self.set_iovar_u32("ampdu_rx_factor", 0).await; // this crashes | 103 | //self.set_iovar_u32("ampdu_rx_factor", 0).await; // this crashes |
| 104 | 104 | ||
| 105 | //Timer::after(Duration::from_millis(100)).await; | 105 | //Timer::after_millis(100).await; |
| 106 | 106 | ||
| 107 | // evts | 107 | // evts |
| 108 | let mut evts = EventMask { | 108 | let mut evts = EventMask { |
| @@ -121,19 +121,19 @@ impl<'a> Control<'a> { | |||
| 121 | 121 | ||
| 122 | self.set_iovar("bsscfg:event_msgs", &evts.to_bytes()).await; | 122 | self.set_iovar("bsscfg:event_msgs", &evts.to_bytes()).await; |
| 123 | 123 | ||
| 124 | Timer::after(Duration::from_millis(100)).await; | 124 | Timer::after_millis(100).await; |
| 125 | 125 | ||
| 126 | // set wifi up | 126 | // set wifi up |
| 127 | self.up().await; | 127 | self.up().await; |
| 128 | 128 | ||
| 129 | Timer::after(Duration::from_millis(100)).await; | 129 | Timer::after_millis(100).await; |
| 130 | 130 | ||
| 131 | self.ioctl_set_u32(110, 0, 1).await; // SET_GMODE = auto | 131 | self.ioctl_set_u32(110, 0, 1).await; // SET_GMODE = auto |
| 132 | self.ioctl_set_u32(142, 0, 0).await; // SET_BAND = any | 132 | self.ioctl_set_u32(142, 0, 0).await; // SET_BAND = any |
| 133 | 133 | ||
| 134 | Timer::after(Duration::from_millis(100)).await; | 134 | Timer::after_millis(100).await; |
| 135 | 135 | ||
| 136 | self.state_ch.set_ethernet_address(mac_addr); | 136 | self.state_ch.set_hardware_address(HardwareAddress::Ethernet(mac_addr)); |
| 137 | 137 | ||
| 138 | debug!("INIT DONE"); | 138 | debug!("INIT DONE"); |
| 139 | } | 139 | } |
| @@ -185,7 +185,7 @@ impl<'a> Control<'a> { | |||
| 185 | self.set_iovar_u32x2("bsscfg:sup_wpa2_eapver", 0, 0xFFFF_FFFF).await; | 185 | self.set_iovar_u32x2("bsscfg:sup_wpa2_eapver", 0, 0xFFFF_FFFF).await; |
| 186 | self.set_iovar_u32x2("bsscfg:sup_wpa_tmo", 0, 2500).await; | 186 | self.set_iovar_u32x2("bsscfg:sup_wpa_tmo", 0, 2500).await; |
| 187 | 187 | ||
| 188 | Timer::after(Duration::from_millis(100)).await; | 188 | Timer::after_millis(100).await; |
| 189 | 189 | ||
| 190 | let mut pfi = PassphraseInfo { | 190 | let mut pfi = PassphraseInfo { |
| 191 | len: passphrase.len() as _, | 191 | len: passphrase.len() as _, |
| @@ -297,7 +297,7 @@ impl<'a> Control<'a> { | |||
| 297 | if security != Security::OPEN { | 297 | if security != Security::OPEN { |
| 298 | self.set_iovar_u32x2("bsscfg:wpa_auth", 0, 0x0084).await; // wpa_auth = WPA2_AUTH_PSK | WPA_AUTH_PSK | 298 | self.set_iovar_u32x2("bsscfg:wpa_auth", 0, 0x0084).await; // wpa_auth = WPA2_AUTH_PSK | WPA_AUTH_PSK |
| 299 | 299 | ||
| 300 | Timer::after(Duration::from_millis(100)).await; | 300 | Timer::after_millis(100).await; |
| 301 | 301 | ||
| 302 | // Set passphrase | 302 | // Set passphrase |
| 303 | let mut pfi = PassphraseInfo { | 303 | let mut pfi = PassphraseInfo { |
diff --git a/cyw43/src/runner.rs b/cyw43/src/runner.rs index 1c187faa5..83aee6b40 100644 --- a/cyw43/src/runner.rs +++ b/cyw43/src/runner.rs | |||
| @@ -555,14 +555,14 @@ where | |||
| 555 | 555 | ||
| 556 | self.bus.bp_write8(base + AI_RESETCTRL_OFFSET, 0).await; | 556 | self.bus.bp_write8(base + AI_RESETCTRL_OFFSET, 0).await; |
| 557 | 557 | ||
| 558 | Timer::after(Duration::from_millis(1)).await; | 558 | Timer::after_millis(1).await; |
| 559 | 559 | ||
| 560 | self.bus | 560 | self.bus |
| 561 | .bp_write8(base + AI_IOCTRL_OFFSET, AI_IOCTRL_BIT_CLOCK_EN) | 561 | .bp_write8(base + AI_IOCTRL_OFFSET, AI_IOCTRL_BIT_CLOCK_EN) |
| 562 | .await; | 562 | .await; |
| 563 | let _ = self.bus.bp_read8(base + AI_IOCTRL_OFFSET).await; | 563 | let _ = self.bus.bp_read8(base + AI_IOCTRL_OFFSET).await; |
| 564 | 564 | ||
| 565 | Timer::after(Duration::from_millis(1)).await; | 565 | Timer::after_millis(1).await; |
| 566 | } | 566 | } |
| 567 | 567 | ||
| 568 | async fn core_is_up(&mut self, core: Core) -> bool { | 568 | async fn core_is_up(&mut self, core: Core) -> bool { |
diff --git a/docs/modules/ROOT/examples/basic/Cargo.toml b/docs/modules/ROOT/examples/basic/Cargo.toml index e94358a92..527ce2eda 100644 --- a/docs/modules/ROOT/examples/basic/Cargo.toml +++ b/docs/modules/ROOT/examples/basic/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | 7 | ||
| 8 | [dependencies] | 8 | [dependencies] |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../../embassy-executor", features = ["defmt", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../../embassy-executor", features = ["defmt", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } |
| 10 | embassy-time = { version = "0.1.0", path = "../../../../../embassy-time", features = ["defmt", "nightly"] } | 10 | embassy-time = { version = "0.1.4", path = "../../../../../embassy-time", features = ["defmt", "nightly"] } |
| 11 | embassy-nrf = { version = "0.1.0", path = "../../../../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "nightly"] } | 11 | embassy-nrf = { version = "0.1.0", path = "../../../../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "nightly"] } |
| 12 | 12 | ||
| 13 | defmt = "0.3" | 13 | defmt = "0.3" |
diff --git a/docs/modules/ROOT/nav.adoc b/docs/modules/ROOT/nav.adoc index 261a3c19c..ee559a821 100644 --- a/docs/modules/ROOT/nav.adoc +++ b/docs/modules/ROOT/nav.adoc | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | * xref:getting_started.adoc[Getting started] | 1 | * xref:getting_started.adoc[Getting started] |
| 2 | ** xref:basic_application.adoc[Basic application] | 2 | ** xref:basic_application.adoc[Basic application] |
| 3 | ** xref:layer_by_layer.adoc[Layer by Layer] | 3 | * xref:layer_by_layer.adoc[Bare metal to async] |
| 4 | * xref:runtime.adoc[Executor] | 4 | * xref:runtime.adoc[Executor] |
| 5 | * xref:hal.adoc[HAL] | 5 | * xref:hal.adoc[HAL] |
| 6 | ** xref:nrf.adoc[nRF] | 6 | ** xref:nrf.adoc[nRF] |
| @@ -9,4 +9,4 @@ | |||
| 9 | 9 | ||
| 10 | * xref:examples.adoc[Examples] | 10 | * xref:examples.adoc[Examples] |
| 11 | * xref:developer.adoc[Developer] | 11 | * xref:developer.adoc[Developer] |
| 12 | ** xref:developer_stm32.adoc[Developer: STM32] \ No newline at end of file | 12 | ** xref:developer_stm32.adoc[Developer: STM32] |
diff --git a/docs/modules/ROOT/pages/basic_application.adoc b/docs/modules/ROOT/pages/basic_application.adoc index 3f4f16e28..73774c71b 100644 --- a/docs/modules/ROOT/pages/basic_application.adoc +++ b/docs/modules/ROOT/pages/basic_application.adoc | |||
| @@ -48,7 +48,7 @@ The `Spawner` is the way the main application spawns other tasks. The `Periphera | |||
| 48 | include::example$basic/src/main.rs[lines="22..-1"] | 48 | include::example$basic/src/main.rs[lines="22..-1"] |
| 49 | ---- | 49 | ---- |
| 50 | 50 | ||
| 51 | What happens when the `blinker` task has been spawned and main returns? Well, the main entry point is actually just like any other task, except that you can only have one and it takes some specific type arguments. The magic lies within the `#[embassy::main]` macro. The macro does the following: | 51 | What happens when the `blinker` task has been spawned and main returns? Well, the main entry point is actually just like any other task, except that you can only have one and it takes some specific type arguments. The magic lies within the `#[embassy_executor::main]` macro. The macro does the following: |
| 52 | 52 | ||
| 53 | . Creates an Embassy Executor | 53 | . Creates an Embassy Executor |
| 54 | . Initializes the microcontroller HAL to get the `Peripherals` | 54 | . Initializes the microcontroller HAL to get the `Peripherals` |
diff --git a/docs/modules/ROOT/pages/getting_started.adoc b/docs/modules/ROOT/pages/getting_started.adoc index 881e449b6..2c6f4b1ee 100644 --- a/docs/modules/ROOT/pages/getting_started.adoc +++ b/docs/modules/ROOT/pages/getting_started.adoc | |||
| @@ -3,7 +3,7 @@ | |||
| 3 | So you want to try Embassy, great! To get started, there are a few tools you need to install: | 3 | So you want to try Embassy, great! To get started, there are a few tools you need to install: |
| 4 | 4 | ||
| 5 | * link:https://rustup.rs/[rustup] - the Rust toolchain is needed to compile Rust code. | 5 | * link:https://rustup.rs/[rustup] - the Rust toolchain is needed to compile Rust code. |
| 6 | * link:https://crates.io/crates/probe-run[probe-run] - to flash the firmware on your device. If you already have other tools like `OpenOCD` setup, you can use that as well. | 6 | * link:https://crates.io/crates/probe-rs[probe-rs] - to flash the firmware on your device. If you already have other tools like `OpenOCD` setup, you can use that as well. |
| 7 | 7 | ||
| 8 | If you don't have any supported board, don't worry: you can also run embassy on your PC using the `std` examples. | 8 | If you don't have any supported board, don't worry: you can also run embassy on your PC using the `std` examples. |
| 9 | 9 | ||
| @@ -30,6 +30,10 @@ Embassy supports many microcontroller families, but the easiest ways to get star | |||
| 30 | 30 | ||
| 31 | * link:https://www.raspberrypi.com/products/raspberry-pi-pico/[Raspberry Pi Pico] | 31 | * link:https://www.raspberrypi.com/products/raspberry-pi-pico/[Raspberry Pi Pico] |
| 32 | 32 | ||
| 33 | === ESP32 | ||
| 34 | |||
| 35 | * link:https://github.com/esp-rs/esp-rust-board[ESP32C3] | ||
| 36 | |||
| 33 | == Running an example | 37 | == Running an example |
| 34 | 38 | ||
| 35 | First you need to clone the [github repository]; | 39 | First you need to clone the [github repository]; |
| @@ -38,7 +42,6 @@ First you need to clone the [github repository]; | |||
| 38 | ---- | 42 | ---- |
| 39 | git clone https://github.com/embassy-rs/embassy.git | 43 | git clone https://github.com/embassy-rs/embassy.git |
| 40 | cd embassy | 44 | cd embassy |
| 41 | git submodule update --init | ||
| 42 | ---- | 45 | ---- |
| 43 | 46 | ||
| 44 | You can run an example by opening a terminal and entering the following commands: | 47 | You can run an example by opening a terminal and entering the following commands: |
diff --git a/docs/modules/ROOT/pages/hal.adoc b/docs/modules/ROOT/pages/hal.adoc index de4ab33be..b1382e8e5 100644 --- a/docs/modules/ROOT/pages/hal.adoc +++ b/docs/modules/ROOT/pages/hal.adoc | |||
| @@ -7,4 +7,6 @@ Embassy provides HALs for several microcontroller families: | |||
| 7 | * `embassy-rp` for the Raspberry Pi RP2040 microcontrollers | 7 | * `embassy-rp` for the Raspberry Pi RP2040 microcontrollers |
| 8 | 8 | ||
| 9 | These HALs implement async/await functionality for most peripherals while also implementing the | 9 | These HALs implement async/await functionality for most peripherals while also implementing the |
| 10 | async traits in `embedded-hal-async`. You can also use these HALs with another executor. | 10 | async traits in `embedded-hal` and `embedded-hal-async`. You can also use these HALs with another executor. |
| 11 | |||
| 12 | For the ESP32 series, there is an link:https://github.com/esp-rs/esp-hal[esp-hal] which you can use. | ||
diff --git a/docs/modules/ROOT/pages/index.adoc b/docs/modules/ROOT/pages/index.adoc index 805a1e70e..c6dead464 100644 --- a/docs/modules/ROOT/pages/index.adoc +++ b/docs/modules/ROOT/pages/index.adoc | |||
| @@ -17,13 +17,26 @@ The Embassy project consists of several crates that you can use together or inde | |||
| 17 | * **Hardware Abstraction Layers** - HALs implement safe, idiomatic Rust APIs to use the hardware capabilities, so raw register manipulation is not needed. The Embassy project maintains HALs for select hardware, but you can still use HALs from other projects with Embassy. | 17 | * **Hardware Abstraction Layers** - HALs implement safe, idiomatic Rust APIs to use the hardware capabilities, so raw register manipulation is not needed. The Embassy project maintains HALs for select hardware, but you can still use HALs from other projects with Embassy. |
| 18 | ** link:https://docs.embassy.dev/embassy-stm32/[embassy-stm32], for all STM32 microcontroller families. | 18 | ** link:https://docs.embassy.dev/embassy-stm32/[embassy-stm32], for all STM32 microcontroller families. |
| 19 | ** link:https://docs.embassy.dev/embassy-nrf/[embassy-nrf], for the Nordic Semiconductor nRF52, nRF53, nRF91 series. | 19 | ** link:https://docs.embassy.dev/embassy-nrf/[embassy-nrf], for the Nordic Semiconductor nRF52, nRF53, nRF91 series. |
| 20 | ** link:https://docs.embassy.dev/embassy-rp/[embassy-rp], for the Raspberry Pi RP2040 microcontroller. | ||
| 21 | ** link:https://github.com/esp-rs[esp-rs], for the Espressif Systems ESP32 series of chips. | ||
| 22 | + | ||
| 23 | NOTE: A common question is if one can use the Embassy HALs standalone. Yes, it is possible! There are no dependency on the executor within the HALs. You can even use them without async, | ||
| 24 | as they implement both the link:https://github.com/rust-embedded/embedded-hal[Embedded HAL] blocking and async traits. | ||
| 20 | 25 | ||
| 21 | * **Networking** - The link:https://docs.embassy.dev/embassy-net/[embassy-net] network stack implements extensive networking functionality, including Ethernet, IP, TCP, UDP, ICMP and DHCP. Async drastically simplifies managing timeouts and serving multiple connections concurrently. | 26 | * **Networking** - The link:https://docs.embassy.dev/embassy-net/[embassy-net] network stack implements extensive networking functionality, including Ethernet, IP, TCP, UDP, ICMP and DHCP. Async drastically simplifies managing timeouts and serving multiple connections concurrently. Several drivers for WiFi and Ethernet chips can be found. |
| 22 | 27 | ||
| 23 | * **Bluetooth** - The link:https://github.com/embassy-rs/nrf-softdevice[nrf-softdevice] crate provides Bluetooth Low Energy 4.x and 5.x support for nRF52 microcontrollers. | 28 | * **Bluetooth** - The link:https://github.com/embassy-rs/nrf-softdevice[nrf-softdevice] crate provides Bluetooth Low Energy 4.x and 5.x support for nRF52 microcontrollers. |
| 24 | 29 | ||
| 25 | * **LoRa** - link:https://docs.embassy.dev/embassy-lora/[embassy-lora] supports LoRa networking on STM32WL wireless microcontrollers and Semtech SX127x transceivers. | 30 | * **LoRa** - link:https://github.com/embassy-rs/lora-phy[lora-phy] and link:https://docs.embassy.dev/embassy-lora/[embassy-lora] supports LoRa networking on a wide range of LoRa radios, fully integrated with a Rust link:https://github.com/ivajloip/rust-lorawan[LoRaWAN] implementation. |
| 26 | 31 | ||
| 27 | * **USB** - link:https://docs.embassy.dev/embassy-usb/[embassy-usb] implements a device-side USB stack. Implementations for common classes such as USB serial (CDC ACM) and USB HID are available, and a rich builder API allows building your own. | 32 | * **USB** - link:https://docs.embassy.dev/embassy-usb/[embassy-usb] implements a device-side USB stack. Implementations for common classes such as USB serial (CDC ACM) and USB HID are available, and a rich builder API allows building your own. |
| 28 | 33 | ||
| 29 | * **Bootloader and DFU** - link:https://github.com/embassy-rs/embassy/tree/master/embassy-boot[embassy-boot] is a lightweight bootloader supporting firmware application upgrades in a power-fail-safe way, with trial boots and rollbacks. | 34 | * **Bootloader and DFU** - link:https://github.com/embassy-rs/embassy/tree/master/embassy-boot[embassy-boot] is a lightweight bootloader supporting firmware application upgrades in a power-fail-safe way, with trial boots and rollbacks. |
| 35 | |||
| 36 | == Resources | ||
| 37 | |||
| 38 | For more reading material on async Rust and Embassy: | ||
| 39 | |||
| 40 | * link:https://tweedegolf.nl/en/blog/65/async-rust-vs-rtos-showdown[Comparsion of FreeRTOS and Embassy] | ||
| 41 | * link:https://dev.to/apollolabsbin/series/20707[Tutorials] | ||
| 42 | * link:https://blog.drogue.io/firmware-updates-part-1/[Firmware Updates with Embassy] | ||
diff --git a/docs/modules/ROOT/pages/layer_by_layer.adoc b/docs/modules/ROOT/pages/layer_by_layer.adoc index a78a64a97..1d7bdc89b 100644 --- a/docs/modules/ROOT/pages/layer_by_layer.adoc +++ b/docs/modules/ROOT/pages/layer_by_layer.adoc | |||
| @@ -1,4 +1,4 @@ | |||
| 1 | = Embassy layer by layer | 1 | = From bare metal to async Rust |
| 2 | 2 | ||
| 3 | If you're new to Embassy, it can be overwhelming to grasp all the terminology and concepts. This guide aims to clarify the different layers in Embassy, which problem each layer solves for the application writer. | 3 | If you're new to Embassy, it can be overwhelming to grasp all the terminology and concepts. This guide aims to clarify the different layers in Embassy, which problem each layer solves for the application writer. |
| 4 | 4 | ||
| @@ -8,8 +8,7 @@ The application we'll write is a simple 'push button, blink led' application, wh | |||
| 8 | 8 | ||
| 9 | == PAC version | 9 | == PAC version |
| 10 | 10 | ||
| 11 | The PAC is the lowest API for accessing peripherals and registers, if you don't count reading/writing directly to memory addresses. It provides distinct types | 11 | The PAC is the lowest API for accessing peripherals and registers, if you don't count reading/writing directly to memory addresses. It provides distinct types to make accessing peripheral registers easier, but it does not prevent you from writing unsafe code. |
| 12 | to make accessing peripheral registers easier, but it does not prevent you from writing unsafe code. | ||
| 13 | 12 | ||
| 14 | Writing an application using the PAC directly is therefore not recommended, but if the functionality you want to use is not exposed in the upper layers, that's what you need to use. | 13 | Writing an application using the PAC directly is therefore not recommended, but if the functionality you want to use is not exposed in the upper layers, that's what you need to use. |
| 15 | 14 | ||
diff --git a/docs/modules/ROOT/pages/nrf.adoc b/docs/modules/ROOT/pages/nrf.adoc index 10fe54b47..1706087ae 100644 --- a/docs/modules/ROOT/pages/nrf.adoc +++ b/docs/modules/ROOT/pages/nrf.adoc | |||
| @@ -8,7 +8,7 @@ The nRF timer driver operates at 32768 Hz by default. | |||
| 8 | 8 | ||
| 9 | == Peripherals | 9 | == Peripherals |
| 10 | 10 | ||
| 11 | The following peripherals have a HAL implementation at present: | 11 | The following peripherals have a HAL implementation at present |
| 12 | 12 | ||
| 13 | * PWM | 13 | * PWM |
| 14 | * SPIM | 14 | * SPIM |
| @@ -23,3 +23,7 @@ The following peripherals have a HAL implementation at present: | |||
| 23 | * UARTE | 23 | * UARTE |
| 24 | * TWIM | 24 | * TWIM |
| 25 | * SAADC | 25 | * SAADC |
| 26 | |||
| 27 | == Bluetooth | ||
| 28 | |||
| 29 | For bluetooth, you can use the link:https://github.com/embassy-rs/nrf-softdevice[nrf-softdevice] crate. | ||
diff --git a/docs/modules/ROOT/pages/runtime.adoc b/docs/modules/ROOT/pages/runtime.adoc index 5096f5a43..8f4921f67 100644 --- a/docs/modules/ROOT/pages/runtime.adoc +++ b/docs/modules/ROOT/pages/runtime.adoc | |||
| @@ -6,11 +6,11 @@ The Embassy executor is an async/await executor designed for embedded usage alon | |||
| 6 | 6 | ||
| 7 | * No `alloc`, no heap needed. Task are statically allocated. | 7 | * No `alloc`, no heap needed. Task are statically allocated. |
| 8 | * No "fixed capacity" data structures, executor works with 1 or 1000 tasks without needing config/tuning. | 8 | * No "fixed capacity" data structures, executor works with 1 or 1000 tasks without needing config/tuning. |
| 9 | * Integrated timer queue: sleeping is easy, just do `Timer::after(Duration::from_secs(1)).await;`. | 9 | * Integrated timer queue: sleeping is easy, just do `Timer::after_secs(1).await;`. |
| 10 | * No busy-loop polling: CPU sleeps when there's no work to do, using interrupts or `WFE/SEV`. | 10 | * No busy-loop polling: CPU sleeps when there's no work to do, using interrupts or `WFE/SEV`. |
| 11 | * Efficient polling: a wake will only poll the woken task, not all of them. | 11 | * Efficient polling: a wake will only poll the woken task, not all of them. |
| 12 | * Fair: a task can't monopolize CPU time even if it's constantly being woken. All other tasks get a chance to run before a given task gets polled for the second time. | 12 | * Fair: a task can't monopolize CPU time even if it's constantly being woken. All other tasks get a chance to run before a given task gets polled for the second time. |
| 13 | * Creating multiple executor instances is supported, to run tasks with multiple priority levels. This allows higher-priority tasks to preempt lower-priority tasks. | 13 | * Creating multiple executor instances is supported, to run tasks at different priority levels. This allows higher-priority tasks to preempt lower-priority tasks. |
| 14 | 14 | ||
| 15 | == Executor | 15 | == Executor |
| 16 | 16 | ||
diff --git a/embassy-embedded-hal/Cargo.toml b/embassy-embedded-hal/Cargo.toml index 62a95ed91..55ef734e0 100644 --- a/embassy-embedded-hal/Cargo.toml +++ b/embassy-embedded-hal/Cargo.toml | |||
| @@ -21,7 +21,7 @@ default = ["time"] | |||
| 21 | [dependencies] | 21 | [dependencies] |
| 22 | embassy-futures = { version = "0.1.0", path = "../embassy-futures", optional = true } | 22 | embassy-futures = { version = "0.1.0", path = "../embassy-futures", optional = true } |
| 23 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 23 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 24 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true } | 24 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true } |
| 25 | embedded-hal-02 = { package = "embedded-hal", version = "0.2.6", features = [ | 25 | embedded-hal-02 = { package = "embedded-hal", version = "0.2.6", features = [ |
| 26 | "unproven", | 26 | "unproven", |
| 27 | ] } | 27 | ] } |
diff --git a/embassy-embedded-hal/src/flash/partition/mod.rs b/embassy-embedded-hal/src/flash/partition/mod.rs index a12e49ce1..42c8a308d 100644 --- a/embassy-embedded-hal/src/flash/partition/mod.rs +++ b/embassy-embedded-hal/src/flash/partition/mod.rs | |||
| @@ -11,7 +11,7 @@ pub use asynch::Partition; | |||
| 11 | pub use blocking::BlockingPartition; | 11 | pub use blocking::BlockingPartition; |
| 12 | 12 | ||
| 13 | /// Partition error | 13 | /// Partition error |
| 14 | #[derive(Debug)] | 14 | #[derive(Debug, PartialEq, Eq)] |
| 15 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 15 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 16 | pub enum Error<T> { | 16 | pub enum Error<T> { |
| 17 | /// The requested flash area is outside the partition | 17 | /// The requested flash area is outside the partition |
diff --git a/embassy-embedded-hal/src/lib.rs b/embassy-embedded-hal/src/lib.rs index 3aad838bd..ee964e404 100644 --- a/embassy-embedded-hal/src/lib.rs +++ b/embassy-embedded-hal/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![cfg_attr(not(feature = "std"), no_std)] | 1 | #![cfg_attr(not(feature = "std"), no_std)] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections, try_blocks))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, try_blocks))] |
| 3 | #![warn(missing_docs)] | 3 | #![warn(missing_docs)] |
| 4 | 4 | ||
| 5 | //! Utilities to use `embedded-hal` traits with Embassy. | 5 | //! Utilities to use `embedded-hal` traits with Embassy. |
| @@ -26,6 +26,18 @@ pub trait SetConfig { | |||
| 26 | /// The configuration type used by this driver. | 26 | /// The configuration type used by this driver. |
| 27 | type Config; | 27 | type Config; |
| 28 | 28 | ||
| 29 | /// The error type that can occur if `set_config` fails. | ||
| 30 | type ConfigError; | ||
| 31 | |||
| 29 | /// Set the configuration of the driver. | 32 | /// Set the configuration of the driver. |
| 30 | fn set_config(&mut self, config: &Self::Config); | 33 | fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError>; |
| 34 | } | ||
| 35 | |||
| 36 | /// Get the configuration of a peripheral driver. | ||
| 37 | pub trait GetConfig { | ||
| 38 | /// The configuration type used by this driver. | ||
| 39 | type Config; | ||
| 40 | |||
| 41 | /// Get the configuration of the driver. | ||
| 42 | fn get_config(&self) -> Self::Config; | ||
| 31 | } | 43 | } |
diff --git a/embassy-embedded-hal/src/shared_bus/asynch/i2c.rs b/embassy-embedded-hal/src/shared_bus/asynch/i2c.rs index 87e8a4304..1053d3849 100644 --- a/embassy-embedded-hal/src/shared_bus/asynch/i2c.rs +++ b/embassy-embedded-hal/src/shared_bus/asynch/i2c.rs | |||
| @@ -125,14 +125,14 @@ where | |||
| 125 | { | 125 | { |
| 126 | async fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), I2cDeviceError<BUS::Error>> { | 126 | async fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), I2cDeviceError<BUS::Error>> { |
| 127 | let mut bus = self.bus.lock().await; | 127 | let mut bus = self.bus.lock().await; |
| 128 | bus.set_config(&self.config); | 128 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 129 | bus.read(address, buffer).await.map_err(I2cDeviceError::I2c)?; | 129 | bus.read(address, buffer).await.map_err(I2cDeviceError::I2c)?; |
| 130 | Ok(()) | 130 | Ok(()) |
| 131 | } | 131 | } |
| 132 | 132 | ||
| 133 | async fn write(&mut self, address: u8, bytes: &[u8]) -> Result<(), I2cDeviceError<BUS::Error>> { | 133 | async fn write(&mut self, address: u8, bytes: &[u8]) -> Result<(), I2cDeviceError<BUS::Error>> { |
| 134 | let mut bus = self.bus.lock().await; | 134 | let mut bus = self.bus.lock().await; |
| 135 | bus.set_config(&self.config); | 135 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 136 | bus.write(address, bytes).await.map_err(I2cDeviceError::I2c)?; | 136 | bus.write(address, bytes).await.map_err(I2cDeviceError::I2c)?; |
| 137 | Ok(()) | 137 | Ok(()) |
| 138 | } | 138 | } |
| @@ -144,7 +144,7 @@ where | |||
| 144 | rd_buffer: &mut [u8], | 144 | rd_buffer: &mut [u8], |
| 145 | ) -> Result<(), I2cDeviceError<BUS::Error>> { | 145 | ) -> Result<(), I2cDeviceError<BUS::Error>> { |
| 146 | let mut bus = self.bus.lock().await; | 146 | let mut bus = self.bus.lock().await; |
| 147 | bus.set_config(&self.config); | 147 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 148 | bus.write_read(address, wr_buffer, rd_buffer) | 148 | bus.write_read(address, wr_buffer, rd_buffer) |
| 149 | .await | 149 | .await |
| 150 | .map_err(I2cDeviceError::I2c)?; | 150 | .map_err(I2cDeviceError::I2c)?; |
| @@ -153,7 +153,7 @@ where | |||
| 153 | 153 | ||
| 154 | async fn transaction(&mut self, address: u8, operations: &mut [i2c::Operation<'_>]) -> Result<(), Self::Error> { | 154 | async fn transaction(&mut self, address: u8, operations: &mut [i2c::Operation<'_>]) -> Result<(), Self::Error> { |
| 155 | let mut bus = self.bus.lock().await; | 155 | let mut bus = self.bus.lock().await; |
| 156 | bus.set_config(&self.config); | 156 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 157 | bus.transaction(address, operations) | 157 | bus.transaction(address, operations) |
| 158 | .await | 158 | .await |
| 159 | .map_err(I2cDeviceError::I2c)?; | 159 | .map_err(I2cDeviceError::I2c)?; |
diff --git a/embassy-embedded-hal/src/shared_bus/asynch/spi.rs b/embassy-embedded-hal/src/shared_bus/asynch/spi.rs index 030392183..5d3cf658a 100644 --- a/embassy-embedded-hal/src/shared_bus/asynch/spi.rs +++ b/embassy-embedded-hal/src/shared_bus/asynch/spi.rs | |||
| @@ -76,9 +76,7 @@ where | |||
| 76 | #[cfg(not(feature = "time"))] | 76 | #[cfg(not(feature = "time"))] |
| 77 | Operation::DelayUs(_) => return Err(SpiDeviceError::DelayUsNotSupported), | 77 | Operation::DelayUs(_) => return Err(SpiDeviceError::DelayUsNotSupported), |
| 78 | #[cfg(feature = "time")] | 78 | #[cfg(feature = "time")] |
| 79 | Operation::DelayUs(us) => { | 79 | Operation::DelayUs(us) => embassy_time::Timer::after_micros(*us as _).await, |
| 80 | embassy_time::Timer::after(embassy_time::Duration::from_micros(*us as _)).await | ||
| 81 | } | ||
| 82 | } | 80 | } |
| 83 | } | 81 | } |
| 84 | }; | 82 | }; |
| @@ -130,7 +128,7 @@ where | |||
| 130 | { | 128 | { |
| 131 | async fn transaction(&mut self, operations: &mut [spi::Operation<'_, u8>]) -> Result<(), Self::Error> { | 129 | async fn transaction(&mut self, operations: &mut [spi::Operation<'_, u8>]) -> Result<(), Self::Error> { |
| 132 | let mut bus = self.bus.lock().await; | 130 | let mut bus = self.bus.lock().await; |
| 133 | bus.set_config(&self.config); | 131 | bus.set_config(&self.config).map_err(|_| SpiDeviceError::Config)?; |
| 134 | self.cs.set_low().map_err(SpiDeviceError::Cs)?; | 132 | self.cs.set_low().map_err(SpiDeviceError::Cs)?; |
| 135 | 133 | ||
| 136 | let op_res: Result<(), BUS::Error> = try { | 134 | let op_res: Result<(), BUS::Error> = try { |
| @@ -143,9 +141,7 @@ where | |||
| 143 | #[cfg(not(feature = "time"))] | 141 | #[cfg(not(feature = "time"))] |
| 144 | Operation::DelayUs(_) => return Err(SpiDeviceError::DelayUsNotSupported), | 142 | Operation::DelayUs(_) => return Err(SpiDeviceError::DelayUsNotSupported), |
| 145 | #[cfg(feature = "time")] | 143 | #[cfg(feature = "time")] |
| 146 | Operation::DelayUs(us) => { | 144 | Operation::DelayUs(us) => embassy_time::Timer::after_micros(*us as _).await, |
| 147 | embassy_time::Timer::after(embassy_time::Duration::from_micros(*us as _)).await | ||
| 148 | } | ||
| 149 | } | 145 | } |
| 150 | } | 146 | } |
| 151 | }; | 147 | }; |
diff --git a/embassy-embedded-hal/src/shared_bus/blocking/i2c.rs b/embassy-embedded-hal/src/shared_bus/blocking/i2c.rs index af73df059..233c9e1fd 100644 --- a/embassy-embedded-hal/src/shared_bus/blocking/i2c.rs +++ b/embassy-embedded-hal/src/shared_bus/blocking/i2c.rs | |||
| @@ -148,7 +148,7 @@ where | |||
| 148 | fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), Self::Error> { | 148 | fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), Self::Error> { |
| 149 | self.bus.lock(|bus| { | 149 | self.bus.lock(|bus| { |
| 150 | let mut bus = bus.borrow_mut(); | 150 | let mut bus = bus.borrow_mut(); |
| 151 | bus.set_config(&self.config); | 151 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 152 | bus.read(address, buffer).map_err(I2cDeviceError::I2c) | 152 | bus.read(address, buffer).map_err(I2cDeviceError::I2c) |
| 153 | }) | 153 | }) |
| 154 | } | 154 | } |
| @@ -156,7 +156,7 @@ where | |||
| 156 | fn write(&mut self, address: u8, bytes: &[u8]) -> Result<(), Self::Error> { | 156 | fn write(&mut self, address: u8, bytes: &[u8]) -> Result<(), Self::Error> { |
| 157 | self.bus.lock(|bus| { | 157 | self.bus.lock(|bus| { |
| 158 | let mut bus = bus.borrow_mut(); | 158 | let mut bus = bus.borrow_mut(); |
| 159 | bus.set_config(&self.config); | 159 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 160 | bus.write(address, bytes).map_err(I2cDeviceError::I2c) | 160 | bus.write(address, bytes).map_err(I2cDeviceError::I2c) |
| 161 | }) | 161 | }) |
| 162 | } | 162 | } |
| @@ -164,7 +164,7 @@ where | |||
| 164 | fn write_read(&mut self, address: u8, wr_buffer: &[u8], rd_buffer: &mut [u8]) -> Result<(), Self::Error> { | 164 | fn write_read(&mut self, address: u8, wr_buffer: &[u8], rd_buffer: &mut [u8]) -> Result<(), Self::Error> { |
| 165 | self.bus.lock(|bus| { | 165 | self.bus.lock(|bus| { |
| 166 | let mut bus = bus.borrow_mut(); | 166 | let mut bus = bus.borrow_mut(); |
| 167 | bus.set_config(&self.config); | 167 | bus.set_config(&self.config).map_err(|_| I2cDeviceError::Config)?; |
| 168 | bus.write_read(address, wr_buffer, rd_buffer) | 168 | bus.write_read(address, wr_buffer, rd_buffer) |
| 169 | .map_err(I2cDeviceError::I2c) | 169 | .map_err(I2cDeviceError::I2c) |
| 170 | }) | 170 | }) |
diff --git a/embassy-embedded-hal/src/shared_bus/blocking/spi.rs b/embassy-embedded-hal/src/shared_bus/blocking/spi.rs index 6d03d6263..feb0f5b7d 100644 --- a/embassy-embedded-hal/src/shared_bus/blocking/spi.rs +++ b/embassy-embedded-hal/src/shared_bus/blocking/spi.rs | |||
| @@ -163,7 +163,7 @@ where | |||
| 163 | fn transaction(&mut self, operations: &mut [Operation<'_, u8>]) -> Result<(), Self::Error> { | 163 | fn transaction(&mut self, operations: &mut [Operation<'_, u8>]) -> Result<(), Self::Error> { |
| 164 | self.bus.lock(|bus| { | 164 | self.bus.lock(|bus| { |
| 165 | let mut bus = bus.borrow_mut(); | 165 | let mut bus = bus.borrow_mut(); |
| 166 | bus.set_config(&self.config); | 166 | bus.set_config(&self.config).map_err(|_| SpiDeviceError::Config)?; |
| 167 | self.cs.set_low().map_err(SpiDeviceError::Cs)?; | 167 | self.cs.set_low().map_err(SpiDeviceError::Cs)?; |
| 168 | 168 | ||
| 169 | let op_res = operations.iter_mut().try_for_each(|op| match op { | 169 | let op_res = operations.iter_mut().try_for_each(|op| match op { |
diff --git a/embassy-embedded-hal/src/shared_bus/mod.rs b/embassy-embedded-hal/src/shared_bus/mod.rs index 79a90bd52..b0159ac09 100644 --- a/embassy-embedded-hal/src/shared_bus/mod.rs +++ b/embassy-embedded-hal/src/shared_bus/mod.rs | |||
| @@ -14,6 +14,8 @@ pub mod blocking; | |||
| 14 | pub enum I2cDeviceError<BUS> { | 14 | pub enum I2cDeviceError<BUS> { |
| 15 | /// An operation on the inner I2C bus failed. | 15 | /// An operation on the inner I2C bus failed. |
| 16 | I2c(BUS), | 16 | I2c(BUS), |
| 17 | /// Configuration of the inner I2C bus failed. | ||
| 18 | Config, | ||
| 17 | } | 19 | } |
| 18 | 20 | ||
| 19 | impl<BUS> i2c::Error for I2cDeviceError<BUS> | 21 | impl<BUS> i2c::Error for I2cDeviceError<BUS> |
| @@ -23,6 +25,7 @@ where | |||
| 23 | fn kind(&self) -> i2c::ErrorKind { | 25 | fn kind(&self) -> i2c::ErrorKind { |
| 24 | match self { | 26 | match self { |
| 25 | Self::I2c(e) => e.kind(), | 27 | Self::I2c(e) => e.kind(), |
| 28 | Self::Config => i2c::ErrorKind::Other, | ||
| 26 | } | 29 | } |
| 27 | } | 30 | } |
| 28 | } | 31 | } |
| @@ -38,6 +41,8 @@ pub enum SpiDeviceError<BUS, CS> { | |||
| 38 | Cs(CS), | 41 | Cs(CS), |
| 39 | /// DelayUs operations are not supported when the `time` Cargo feature is not enabled. | 42 | /// DelayUs operations are not supported when the `time` Cargo feature is not enabled. |
| 40 | DelayUsNotSupported, | 43 | DelayUsNotSupported, |
| 44 | /// The SPI bus could not be configured. | ||
| 45 | Config, | ||
| 41 | } | 46 | } |
| 42 | 47 | ||
| 43 | impl<BUS, CS> spi::Error for SpiDeviceError<BUS, CS> | 48 | impl<BUS, CS> spi::Error for SpiDeviceError<BUS, CS> |
| @@ -50,6 +55,7 @@ where | |||
| 50 | Self::Spi(e) => e.kind(), | 55 | Self::Spi(e) => e.kind(), |
| 51 | Self::Cs(_) => spi::ErrorKind::Other, | 56 | Self::Cs(_) => spi::ErrorKind::Other, |
| 52 | Self::DelayUsNotSupported => spi::ErrorKind::Other, | 57 | Self::DelayUsNotSupported => spi::ErrorKind::Other, |
| 58 | Self::Config => spi::ErrorKind::Other, | ||
| 53 | } | 59 | } |
| 54 | } | 60 | } |
| 55 | } | 61 | } |
diff --git a/embassy-executor/Cargo.toml b/embassy-executor/Cargo.toml index 35944625f..a793a1980 100644 --- a/embassy-executor/Cargo.toml +++ b/embassy-executor/Cargo.toml | |||
| @@ -59,7 +59,7 @@ rtos-trace = { version = "0.1.2", optional = true } | |||
| 59 | 59 | ||
| 60 | futures-util = { version = "0.3.17", default-features = false } | 60 | futures-util = { version = "0.3.17", default-features = false } |
| 61 | embassy-macros = { version = "0.2.1", path = "../embassy-macros" } | 61 | embassy-macros = { version = "0.2.1", path = "../embassy-macros" } |
| 62 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true} | 62 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true} |
| 63 | atomic-polyfill = "1.0.1" | 63 | atomic-polyfill = "1.0.1" |
| 64 | critical-section = "1.1" | 64 | critical-section = "1.1" |
| 65 | static_cell = "1.1" | 65 | static_cell = "1.1" |
diff --git a/embassy-executor/README.md b/embassy-executor/README.md index 47d0cb8a2..3c1448a18 100644 --- a/embassy-executor/README.md +++ b/embassy-executor/README.md | |||
| @@ -4,7 +4,7 @@ An async/await executor designed for embedded usage. | |||
| 4 | 4 | ||
| 5 | - No `alloc`, no heap needed. Task futures are statically allocated. | 5 | - No `alloc`, no heap needed. Task futures are statically allocated. |
| 6 | - No "fixed capacity" data structures, executor works with 1 or 1000 tasks without needing config/tuning. | 6 | - No "fixed capacity" data structures, executor works with 1 or 1000 tasks without needing config/tuning. |
| 7 | - Integrated timer queue: sleeping is easy, just do `Timer::after(Duration::from_secs(1)).await;`. | 7 | - Integrated timer queue: sleeping is easy, just do `Timer::after_secs(1).await;`. |
| 8 | - No busy-loop polling: CPU sleeps when there's no work to do, using interrupts or `WFE/SEV`. | 8 | - No busy-loop polling: CPU sleeps when there's no work to do, using interrupts or `WFE/SEV`. |
| 9 | - Efficient polling: a wake will only poll the woken task, not all of them. | 9 | - Efficient polling: a wake will only poll the woken task, not all of them. |
| 10 | - Fair: a task can't monopolize CPU time even if it's constantly being woken. All other tasks get a chance to run before a given task gets polled for the second time. | 10 | - Fair: a task can't monopolize CPU time even if it's constantly being woken. All other tasks get a chance to run before a given task gets polled for the second time. |
diff --git a/embassy-hal-internal/README.md b/embassy-hal-internal/README.md index d6539701b..6b060d1c0 100644 --- a/embassy-hal-internal/README.md +++ b/embassy-hal-internal/README.md | |||
| @@ -1,4 +1,4 @@ | |||
| 1 | # embassy-macros | 1 | # embassy-hal-internal |
| 2 | 2 | ||
| 3 | An [Embassy](https://embassy.dev) project. | 3 | An [Embassy](https://embassy.dev) project. |
| 4 | 4 | ||
diff --git a/embassy-hal-internal/src/interrupt.rs b/embassy-hal-internal/src/interrupt.rs index b970aa2cd..19dabcf6f 100644 --- a/embassy-hal-internal/src/interrupt.rs +++ b/embassy-hal-internal/src/interrupt.rs | |||
| @@ -4,6 +4,7 @@ use core::sync::atomic::{compiler_fence, Ordering}; | |||
| 4 | 4 | ||
| 5 | use cortex_m::interrupt::InterruptNumber; | 5 | use cortex_m::interrupt::InterruptNumber; |
| 6 | use cortex_m::peripheral::NVIC; | 6 | use cortex_m::peripheral::NVIC; |
| 7 | use critical_section::CriticalSection; | ||
| 7 | 8 | ||
| 8 | /// Generate a standard `mod interrupt` for a HAL. | 9 | /// Generate a standard `mod interrupt` for a HAL. |
| 9 | #[macro_export] | 10 | #[macro_export] |
| @@ -91,6 +92,12 @@ macro_rules! interrupt_mod { | |||
| 91 | fn set_priority(prio: crate::interrupt::Priority) { | 92 | fn set_priority(prio: crate::interrupt::Priority) { |
| 92 | Self::IRQ.set_priority(prio) | 93 | Self::IRQ.set_priority(prio) |
| 93 | } | 94 | } |
| 95 | |||
| 96 | /// Set the interrupt priority with an already-acquired critical section | ||
| 97 | #[inline] | ||
| 98 | fn set_priority_with_cs(cs: critical_section::CriticalSection, prio: crate::interrupt::Priority) { | ||
| 99 | Self::IRQ.set_priority_with_cs(cs, prio) | ||
| 100 | } | ||
| 94 | } | 101 | } |
| 95 | 102 | ||
| 96 | $( | 103 | $( |
| @@ -195,10 +202,29 @@ pub unsafe trait InterruptExt: InterruptNumber + Copy { | |||
| 195 | /// Set the interrupt priority. | 202 | /// Set the interrupt priority. |
| 196 | #[inline] | 203 | #[inline] |
| 197 | fn set_priority(self, prio: Priority) { | 204 | fn set_priority(self, prio: Priority) { |
| 198 | critical_section::with(|_| unsafe { | 205 | unsafe { |
| 206 | let mut nvic: cortex_m::peripheral::NVIC = mem::transmute(()); | ||
| 207 | |||
| 208 | // On thumbv6, set_priority must do a RMW to change 8bit in a 32bit reg. | ||
| 209 | #[cfg(armv6m)] | ||
| 210 | critical_section::with(|_| nvic.set_priority(self, prio.into())); | ||
| 211 | // On thumbv7+, set_priority does an atomic 8bit write, so no CS needed. | ||
| 212 | #[cfg(not(armv6m))] | ||
| 213 | nvic.set_priority(self, prio.into()); | ||
| 214 | } | ||
| 215 | } | ||
| 216 | |||
| 217 | /// Set the interrupt priority with an already-acquired critical section | ||
| 218 | /// | ||
| 219 | /// Equivalent to `set_priority`, except you pass a `CriticalSection` to prove | ||
| 220 | /// you've already acquired a critical section. This prevents acquiring another | ||
| 221 | /// one, which saves code size. | ||
| 222 | #[inline] | ||
| 223 | fn set_priority_with_cs(self, _cs: CriticalSection, prio: Priority) { | ||
| 224 | unsafe { | ||
| 199 | let mut nvic: cortex_m::peripheral::NVIC = mem::transmute(()); | 225 | let mut nvic: cortex_m::peripheral::NVIC = mem::transmute(()); |
| 200 | nvic.set_priority(self, prio.into()) | 226 | nvic.set_priority(self, prio.into()); |
| 201 | }) | 227 | } |
| 202 | } | 228 | } |
| 203 | } | 229 | } |
| 204 | 230 | ||
diff --git a/embassy-hal-internal/src/lib.rs b/embassy-hal-internal/src/lib.rs index 3640ea184..f3d59e588 100644 --- a/embassy-hal-internal/src/lib.rs +++ b/embassy-hal-internal/src/lib.rs | |||
| @@ -10,7 +10,6 @@ pub mod drop; | |||
| 10 | mod macros; | 10 | mod macros; |
| 11 | mod peripheral; | 11 | mod peripheral; |
| 12 | pub mod ratio; | 12 | pub mod ratio; |
| 13 | pub mod ring_buffer; | ||
| 14 | pub use peripheral::{Peripheral, PeripheralRef}; | 13 | pub use peripheral::{Peripheral, PeripheralRef}; |
| 15 | 14 | ||
| 16 | #[cfg(feature = "cortex-m")] | 15 | #[cfg(feature = "cortex-m")] |
diff --git a/embassy-hal-internal/src/macros.rs b/embassy-hal-internal/src/macros.rs index 0eea4b667..97df38954 100644 --- a/embassy-hal-internal/src/macros.rs +++ b/embassy-hal-internal/src/macros.rs | |||
| @@ -48,17 +48,23 @@ macro_rules! peripherals_struct { | |||
| 48 | ///Returns all the peripherals *once* | 48 | ///Returns all the peripherals *once* |
| 49 | #[inline] | 49 | #[inline] |
| 50 | pub(crate) fn take() -> Self { | 50 | pub(crate) fn take() -> Self { |
| 51 | critical_section::with(Self::take_with_cs) | ||
| 52 | } | ||
| 51 | 53 | ||
| 54 | ///Returns all the peripherals *once* | ||
| 55 | #[inline] | ||
| 56 | pub(crate) fn take_with_cs(_cs: critical_section::CriticalSection) -> Self { | ||
| 52 | #[no_mangle] | 57 | #[no_mangle] |
| 53 | static mut _EMBASSY_DEVICE_PERIPHERALS: bool = false; | 58 | static mut _EMBASSY_DEVICE_PERIPHERALS: bool = false; |
| 54 | 59 | ||
| 55 | critical_section::with(|_| unsafe { | 60 | // safety: OK because we're inside a CS. |
| 61 | unsafe { | ||
| 56 | if _EMBASSY_DEVICE_PERIPHERALS { | 62 | if _EMBASSY_DEVICE_PERIPHERALS { |
| 57 | panic!("init called more than once!") | 63 | panic!("init called more than once!") |
| 58 | } | 64 | } |
| 59 | _EMBASSY_DEVICE_PERIPHERALS = true; | 65 | _EMBASSY_DEVICE_PERIPHERALS = true; |
| 60 | Self::steal() | 66 | Self::steal() |
| 61 | }) | 67 | } |
| 62 | } | 68 | } |
| 63 | } | 69 | } |
| 64 | 70 | ||
diff --git a/embassy-hal-internal/src/ring_buffer.rs b/embassy-hal-internal/src/ring_buffer.rs deleted file mode 100644 index fcad68bb1..000000000 --- a/embassy-hal-internal/src/ring_buffer.rs +++ /dev/null | |||
| @@ -1,136 +0,0 @@ | |||
| 1 | pub struct RingBuffer<'a> { | ||
| 2 | buf: &'a mut [u8], | ||
| 3 | start: usize, | ||
| 4 | end: usize, | ||
| 5 | empty: bool, | ||
| 6 | } | ||
| 7 | |||
| 8 | impl<'a> RingBuffer<'a> { | ||
| 9 | pub fn new(buf: &'a mut [u8]) -> Self { | ||
| 10 | Self { | ||
| 11 | buf, | ||
| 12 | start: 0, | ||
| 13 | end: 0, | ||
| 14 | empty: true, | ||
| 15 | } | ||
| 16 | } | ||
| 17 | |||
| 18 | pub fn push_buf(&mut self) -> &mut [u8] { | ||
| 19 | if self.start == self.end && !self.empty { | ||
| 20 | trace!(" ringbuf: push_buf empty"); | ||
| 21 | return &mut self.buf[..0]; | ||
| 22 | } | ||
| 23 | |||
| 24 | let n = if self.start <= self.end { | ||
| 25 | self.buf.len() - self.end | ||
| 26 | } else { | ||
| 27 | self.start - self.end | ||
| 28 | }; | ||
| 29 | |||
| 30 | trace!(" ringbuf: push_buf {:?}..{:?}", self.end, self.end + n); | ||
| 31 | &mut self.buf[self.end..self.end + n] | ||
| 32 | } | ||
| 33 | |||
| 34 | pub fn push(&mut self, n: usize) { | ||
| 35 | trace!(" ringbuf: push {:?}", n); | ||
| 36 | if n == 0 { | ||
| 37 | return; | ||
| 38 | } | ||
| 39 | |||
| 40 | self.end = self.wrap(self.end + n); | ||
| 41 | self.empty = false; | ||
| 42 | } | ||
| 43 | |||
| 44 | pub fn pop_buf(&mut self) -> &mut [u8] { | ||
| 45 | if self.empty { | ||
| 46 | trace!(" ringbuf: pop_buf empty"); | ||
| 47 | return &mut self.buf[..0]; | ||
| 48 | } | ||
| 49 | |||
| 50 | let n = if self.end <= self.start { | ||
| 51 | self.buf.len() - self.start | ||
| 52 | } else { | ||
| 53 | self.end - self.start | ||
| 54 | }; | ||
| 55 | |||
| 56 | trace!(" ringbuf: pop_buf {:?}..{:?}", self.start, self.start + n); | ||
| 57 | &mut self.buf[self.start..self.start + n] | ||
| 58 | } | ||
| 59 | |||
| 60 | pub fn pop(&mut self, n: usize) { | ||
| 61 | trace!(" ringbuf: pop {:?}", n); | ||
| 62 | if n == 0 { | ||
| 63 | return; | ||
| 64 | } | ||
| 65 | |||
| 66 | self.start = self.wrap(self.start + n); | ||
| 67 | self.empty = self.start == self.end; | ||
| 68 | } | ||
| 69 | |||
| 70 | pub fn is_full(&self) -> bool { | ||
| 71 | self.start == self.end && !self.empty | ||
| 72 | } | ||
| 73 | |||
| 74 | pub fn is_empty(&self) -> bool { | ||
| 75 | self.empty | ||
| 76 | } | ||
| 77 | |||
| 78 | pub fn clear(&mut self) { | ||
| 79 | self.start = 0; | ||
| 80 | self.end = 0; | ||
| 81 | self.empty = true; | ||
| 82 | } | ||
| 83 | |||
| 84 | fn wrap(&self, n: usize) -> usize { | ||
| 85 | assert!(n <= self.buf.len()); | ||
| 86 | if n == self.buf.len() { | ||
| 87 | 0 | ||
| 88 | } else { | ||
| 89 | n | ||
| 90 | } | ||
| 91 | } | ||
| 92 | } | ||
| 93 | |||
| 94 | #[cfg(test)] | ||
| 95 | mod tests { | ||
| 96 | use super::*; | ||
| 97 | |||
| 98 | #[test] | ||
| 99 | fn push_pop() { | ||
| 100 | let mut b = [0; 4]; | ||
| 101 | let mut rb = RingBuffer::new(&mut b); | ||
| 102 | let buf = rb.push_buf(); | ||
| 103 | assert_eq!(4, buf.len()); | ||
| 104 | buf[0] = 1; | ||
| 105 | buf[1] = 2; | ||
| 106 | buf[2] = 3; | ||
| 107 | buf[3] = 4; | ||
| 108 | rb.push(4); | ||
| 109 | |||
| 110 | let buf = rb.pop_buf(); | ||
| 111 | assert_eq!(4, buf.len()); | ||
| 112 | assert_eq!(1, buf[0]); | ||
| 113 | rb.pop(1); | ||
| 114 | |||
| 115 | let buf = rb.pop_buf(); | ||
| 116 | assert_eq!(3, buf.len()); | ||
| 117 | assert_eq!(2, buf[0]); | ||
| 118 | rb.pop(1); | ||
| 119 | |||
| 120 | let buf = rb.pop_buf(); | ||
| 121 | assert_eq!(2, buf.len()); | ||
| 122 | assert_eq!(3, buf[0]); | ||
| 123 | rb.pop(1); | ||
| 124 | |||
| 125 | let buf = rb.pop_buf(); | ||
| 126 | assert_eq!(1, buf.len()); | ||
| 127 | assert_eq!(4, buf[0]); | ||
| 128 | rb.pop(1); | ||
| 129 | |||
| 130 | let buf = rb.pop_buf(); | ||
| 131 | assert_eq!(0, buf.len()); | ||
| 132 | |||
| 133 | let buf = rb.push_buf(); | ||
| 134 | assert_eq!(4, buf.len()); | ||
| 135 | } | ||
| 136 | } | ||
diff --git a/embassy-lora/Cargo.toml b/embassy-lora/Cargo.toml index 88f815cd0..846c39199 100644 --- a/embassy-lora/Cargo.toml +++ b/embassy-lora/Cargo.toml | |||
| @@ -20,7 +20,7 @@ defmt = ["dep:defmt", "lorawan-device/defmt"] | |||
| 20 | defmt = { version = "0.3", optional = true } | 20 | defmt = { version = "0.3", optional = true } |
| 21 | log = { version = "0.4.14", optional = true } | 21 | log = { version = "0.4.14", optional = true } |
| 22 | 22 | ||
| 23 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true } | 23 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true } |
| 24 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 24 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 25 | embassy-stm32 = { version = "0.1.0", path = "../embassy-stm32", default-features = false, optional = true } | 25 | embassy-stm32 = { version = "0.1.0", path = "../embassy-stm32", default-features = false, optional = true } |
| 26 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 26 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
diff --git a/embassy-lora/src/lib.rs b/embassy-lora/src/lib.rs index c23d1d0dd..5637802bb 100644 --- a/embassy-lora/src/lib.rs +++ b/embassy-lora/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![no_std] | 1 | #![no_std] |
| 2 | #![feature(async_fn_in_trait, impl_trait_projections)] | 2 | #![feature(async_fn_in_trait)] |
| 3 | //! embassy-lora holds LoRa-specific functionality. | 3 | //! embassy-lora holds LoRa-specific functionality. |
| 4 | 4 | ||
| 5 | pub(crate) mod fmt; | 5 | pub(crate) mod fmt; |
| @@ -34,6 +34,6 @@ impl lorawan_device::async_device::radio::Timer for LoraTimer { | |||
| 34 | } | 34 | } |
| 35 | 35 | ||
| 36 | async fn delay_ms(&mut self, millis: u64) { | 36 | async fn delay_ms(&mut self, millis: u64) { |
| 37 | Timer::after(Duration::from_millis(millis)).await | 37 | Timer::after_millis(millis).await |
| 38 | } | 38 | } |
| 39 | } | 39 | } |
diff --git a/embassy-net-adin1110/Cargo.toml b/embassy-net-adin1110/Cargo.toml index 8de8eadea..a781f3bd0 100644 --- a/embassy-net-adin1110/Cargo.toml +++ b/embassy-net-adin1110/Cargo.toml | |||
| @@ -16,8 +16,8 @@ log = { version = "0.4", default-features = false, optional = true } | |||
| 16 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } | 16 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } |
| 17 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 17 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
| 18 | embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] } | 18 | embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] } |
| 19 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } | 19 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" } |
| 20 | embassy-time = { version = "0.1.3" } | 20 | embassy-time = { version = "0.1.5", path = "../embassy-time" } |
| 21 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 21 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 22 | bitfield = "0.14.0" | 22 | bitfield = "0.14.0" |
| 23 | 23 | ||
diff --git a/embassy-net-adin1110/src/lib.rs b/embassy-net-adin1110/src/lib.rs index 53f361284..edee3438b 100644 --- a/embassy-net-adin1110/src/lib.rs +++ b/embassy-net-adin1110/src/lib.rs | |||
| @@ -20,7 +20,7 @@ pub use crc32::ETH_FCS; | |||
| 20 | use crc8::crc8; | 20 | use crc8::crc8; |
| 21 | use embassy_futures::select::{select, Either}; | 21 | use embassy_futures::select::{select, Either}; |
| 22 | use embassy_net_driver_channel as ch; | 22 | use embassy_net_driver_channel as ch; |
| 23 | use embassy_time::{Duration, Timer}; | 23 | use embassy_time::Timer; |
| 24 | use embedded_hal_1::digital::OutputPin; | 24 | use embedded_hal_1::digital::OutputPin; |
| 25 | use embedded_hal_async::digital::Wait; | 25 | use embedded_hal_async::digital::Wait; |
| 26 | use embedded_hal_async::spi::{Error, Operation, SpiDevice}; | 26 | use embedded_hal_async::spi::{Error, Operation, SpiDevice}; |
| @@ -609,12 +609,12 @@ pub async fn new<const N_RX: usize, const N_TX: usize, SPI: SpiDevice, INT: Wait | |||
| 609 | reset.set_low().unwrap(); | 609 | reset.set_low().unwrap(); |
| 610 | 610 | ||
| 611 | // Wait t1: 20-43mS | 611 | // Wait t1: 20-43mS |
| 612 | Timer::after(Duration::from_millis(30)).await; | 612 | Timer::after_millis(30).await; |
| 613 | 613 | ||
| 614 | reset.set_high().unwrap(); | 614 | reset.set_high().unwrap(); |
| 615 | 615 | ||
| 616 | // Wait t3: 50mS | 616 | // Wait t3: 50mS |
| 617 | Timer::after(Duration::from_millis(50)).await; | 617 | Timer::after_millis(50).await; |
| 618 | 618 | ||
| 619 | // Create device | 619 | // Create device |
| 620 | let mut mac = ADIN1110::new(spi_dev, spi_crc, append_fcs_on_tx); | 620 | let mut mac = ADIN1110::new(spi_dev, spi_crc, append_fcs_on_tx); |
diff --git a/embassy-net-driver-channel/CHANGELOG.md b/embassy-net-driver-channel/CHANGELOG.md new file mode 100644 index 000000000..b04d0a86b --- /dev/null +++ b/embassy-net-driver-channel/CHANGELOG.md | |||
| @@ -0,0 +1,16 @@ | |||
| 1 | # Changelog | ||
| 2 | |||
| 3 | All notable changes to this project will be documented in this file. | ||
| 4 | |||
| 5 | The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), | ||
| 6 | and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). | ||
| 7 | |||
| 8 | ## 0.2.0 - 2023-10-18 | ||
| 9 | |||
| 10 | - Update `embassy-net-driver` to v0.2 | ||
| 11 | - `Runner::new` now takes an `embassy_net_driver::HardwareAddress` parameter. | ||
| 12 | - `Runner::set_ethernet_address` is now `set_hardware_address`. | ||
| 13 | |||
| 14 | ## 0.1.0 - 2023-06-29 | ||
| 15 | |||
| 16 | - First release | ||
diff --git a/embassy-net-driver-channel/Cargo.toml b/embassy-net-driver-channel/Cargo.toml index 4588af02d..2fd26a7ca 100644 --- a/embassy-net-driver-channel/Cargo.toml +++ b/embassy-net-driver-channel/Cargo.toml | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | [package] | 1 | [package] |
| 2 | name = "embassy-net-driver-channel" | 2 | name = "embassy-net-driver-channel" |
| 3 | version = "0.1.0" | 3 | version = "0.2.0" |
| 4 | edition = "2021" | 4 | edition = "2021" |
| 5 | license = "MIT OR Apache-2.0" | 5 | license = "MIT OR Apache-2.0" |
| 6 | description = "High-level channel-based driver for the `embassy-net` async TCP/IP network stack." | 6 | description = "High-level channel-based driver for the `embassy-net` async TCP/IP network stack." |
| @@ -26,4 +26,4 @@ log = { version = "0.4.14", optional = true } | |||
| 26 | 26 | ||
| 27 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 27 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 28 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 28 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 29 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } | 29 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" } |
diff --git a/embassy-net-driver-channel/README.md b/embassy-net-driver-channel/README.md index 8f904ce95..90a216388 100644 --- a/embassy-net-driver-channel/README.md +++ b/embassy-net-driver-channel/README.md | |||
| @@ -7,7 +7,9 @@ The `embassy-net-driver` trait is polling-based. To implement it, you must write | |||
| 7 | hand, and hook up the `Waker`s provided by `embassy-net` to the right interrupt handlers so that `embassy-net` | 7 | hand, and hook up the `Waker`s provided by `embassy-net` to the right interrupt handlers so that `embassy-net` |
| 8 | knows when to poll your driver again to make more progress. | 8 | knows when to poll your driver again to make more progress. |
| 9 | 9 | ||
| 10 | With `embassy-net-driver-channel` | 10 | With `embassy-net-driver-channel` you get a "channel-like" interface instead, where you can send/receive packets |
| 11 | to/from embassy-net. The intended usage is to spawn a "driver task" in the background that does this, passing | ||
| 12 | packets between the hardware and the channel. | ||
| 11 | 13 | ||
| 12 | ## A note about deadlocks | 14 | ## A note about deadlocks |
| 13 | 15 | ||
| @@ -18,19 +20,19 @@ loop { | |||
| 18 | // Wait for either.. | 20 | // Wait for either.. |
| 19 | match select( | 21 | match select( |
| 20 | // ... the chip signaling an interrupt, indicating a packet is available to receive, or | 22 | // ... the chip signaling an interrupt, indicating a packet is available to receive, or |
| 21 | irq_pin.wait_for_low(), | 23 | irq_pin.wait_for_low(), |
| 22 | // ... a TX buffer becoming available, i.e. embassy-net wants to send a packet | 24 | // ... a TX buffer becoming available, i.e. embassy-net wants to send a packet |
| 23 | tx_chan.tx_buf(), | 25 | tx_chan.tx_buf(), |
| 24 | ).await { | 26 | ).await { |
| 25 | Either::First(_) => { | 27 | Either::First(_) => { |
| 26 | // a packet is ready to be received! | 28 | // a packet is ready to be received! |
| 27 | let buf = rx_chan.rx_buf().await; // allocate a rx buf from the packet queue | 29 | let buf = rx_chan.rx_buf().await; // allocate a rx buf from the packet queue |
| 28 | let n = receive_packet_over_spi(buf).await; | 30 | let n = receive_packet_over_spi(buf).await; |
| 29 | rx_chan.rx_done(n); | 31 | rx_chan.rx_done(n); |
| 30 | } | 32 | } |
| 31 | Either::Second(buf) => { | 33 | Either::Second(buf) => { |
| 32 | // a packet is ready to be sent! | 34 | // a packet is ready to be sent! |
| 33 | send_packet_over_spi(buf).await; | 35 | send_packet_over_spi(buf).await; |
| 34 | tx_chan.tx_done(); | 36 | tx_chan.tx_done(); |
| 35 | } | 37 | } |
| 36 | } | 38 | } |
| @@ -41,7 +43,7 @@ However, this code has a latent deadlock bug. The symptom is it can hang at `rx_ | |||
| 41 | 43 | ||
| 42 | The reason is that, under load, both the TX and RX queues can get full at the same time. When this happens, the `embassy-net` task stalls trying to send because the TX queue is full, therefore it stops processing packets in the RX queue. Your driver task also stalls because the RX queue is full, therefore it stops processing packets in the TX queue. | 44 | The reason is that, under load, both the TX and RX queues can get full at the same time. When this happens, the `embassy-net` task stalls trying to send because the TX queue is full, therefore it stops processing packets in the RX queue. Your driver task also stalls because the RX queue is full, therefore it stops processing packets in the TX queue. |
| 43 | 45 | ||
| 44 | The fix is to make sure to always service the TX queue while you're waiting for space to become available in the TX queue. For example, select on either "tx_chan.tx_buf() available" or "INT is low AND rx_chan.rx_buf() available": | 46 | The fix is to make sure to always service the TX queue while you're waiting for space to become available in the RX queue. For example, select on either "tx_chan.tx_buf() available" or "INT is low AND rx_chan.rx_buf() available": |
| 45 | 47 | ||
| 46 | ```rust,ignore | 48 | ```rust,ignore |
| 47 | loop { | 49 | loop { |
| @@ -58,12 +60,12 @@ loop { | |||
| 58 | ).await { | 60 | ).await { |
| 59 | Either::First(buf) => { | 61 | Either::First(buf) => { |
| 60 | // a packet is ready to be received! | 62 | // a packet is ready to be received! |
| 61 | let n = receive_packet_over_spi(buf).await; | 63 | let n = receive_packet_over_spi(buf).await; |
| 62 | rx_chan.rx_done(n); | 64 | rx_chan.rx_done(n); |
| 63 | } | 65 | } |
| 64 | Either::Second(buf) => { | 66 | Either::Second(buf) => { |
| 65 | // a packet is ready to be sent! | 67 | // a packet is ready to be sent! |
| 66 | send_packet_over_spi(buf).await; | 68 | send_packet_over_spi(buf).await; |
| 67 | tx_chan.tx_done(); | 69 | tx_chan.tx_done(); |
| 68 | } | 70 | } |
| 69 | } | 71 | } |
| @@ -79,12 +81,10 @@ These `embassy-net` drivers are implemented using this crate. You can look at th | |||
| 79 | - [`embassy-net-wiznet`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-wiznet) for Wiznet SPI Ethernet MAC+PHY chips. | 81 | - [`embassy-net-wiznet`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-wiznet) for Wiznet SPI Ethernet MAC+PHY chips. |
| 80 | - [`embassy-net-esp-hosted`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-esp-hosted) for using ESP32 chips with the [`esp-hosted`](https://github.com/espressif/esp-hosted) firmware as WiFi adapters for another non-ESP32 MCU. | 82 | - [`embassy-net-esp-hosted`](https://github.com/embassy-rs/embassy/tree/main/embassy-net-esp-hosted) for using ESP32 chips with the [`esp-hosted`](https://github.com/espressif/esp-hosted) firmware as WiFi adapters for another non-ESP32 MCU. |
| 81 | 83 | ||
| 82 | |||
| 83 | ## Interoperability | 84 | ## Interoperability |
| 84 | 85 | ||
| 85 | This crate can run on any executor. | 86 | This crate can run on any executor. |
| 86 | 87 | ||
| 87 | |||
| 88 | ## License | 88 | ## License |
| 89 | 89 | ||
| 90 | This work is licensed under either of | 90 | This work is licensed under either of |
diff --git a/embassy-net-driver-channel/src/lib.rs b/embassy-net-driver-channel/src/lib.rs index bf7ae5217..bfb2c9c03 100644 --- a/embassy-net-driver-channel/src/lib.rs +++ b/embassy-net-driver-channel/src/lib.rs | |||
| @@ -8,9 +8,8 @@ use core::cell::RefCell; | |||
| 8 | use core::mem::MaybeUninit; | 8 | use core::mem::MaybeUninit; |
| 9 | use core::task::{Context, Poll}; | 9 | use core::task::{Context, Poll}; |
| 10 | 10 | ||
| 11 | use driver::HardwareAddress; | ||
| 12 | pub use embassy_net_driver as driver; | 11 | pub use embassy_net_driver as driver; |
| 13 | use embassy_net_driver::{Capabilities, LinkState, Medium}; | 12 | use embassy_net_driver::{Capabilities, LinkState}; |
| 14 | use embassy_sync::blocking_mutex::raw::NoopRawMutex; | 13 | use embassy_sync::blocking_mutex::raw::NoopRawMutex; |
| 15 | use embassy_sync::blocking_mutex::Mutex; | 14 | use embassy_sync::blocking_mutex::Mutex; |
| 16 | use embassy_sync::waitqueue::WakerRegistration; | 15 | use embassy_sync::waitqueue::WakerRegistration; |
| @@ -161,18 +160,10 @@ impl<'d> StateRunner<'d> { | |||
| 161 | }); | 160 | }); |
| 162 | } | 161 | } |
| 163 | 162 | ||
| 164 | pub fn set_ethernet_address(&self, address: [u8; 6]) { | 163 | pub fn set_hardware_address(&self, address: driver::HardwareAddress) { |
| 165 | self.shared.lock(|s| { | 164 | self.shared.lock(|s| { |
| 166 | let s = &mut *s.borrow_mut(); | 165 | let s = &mut *s.borrow_mut(); |
| 167 | s.hardware_address = driver::HardwareAddress::Ethernet(address); | 166 | s.hardware_address = address; |
| 168 | s.waker.wake(); | ||
| 169 | }); | ||
| 170 | } | ||
| 171 | |||
| 172 | pub fn set_ieee802154_address(&self, address: [u8; 8]) { | ||
| 173 | self.shared.lock(|s| { | ||
| 174 | let s = &mut *s.borrow_mut(); | ||
| 175 | s.hardware_address = driver::HardwareAddress::Ieee802154(address); | ||
| 176 | s.waker.wake(); | 167 | s.waker.wake(); |
| 177 | }); | 168 | }); |
| 178 | } | 169 | } |
| @@ -232,11 +223,6 @@ pub fn new<'d, const MTU: usize, const N_RX: usize, const N_TX: usize>( | |||
| 232 | ) -> (Runner<'d, MTU>, Device<'d, MTU>) { | 223 | ) -> (Runner<'d, MTU>, Device<'d, MTU>) { |
| 233 | let mut caps = Capabilities::default(); | 224 | let mut caps = Capabilities::default(); |
| 234 | caps.max_transmission_unit = MTU; | 225 | caps.max_transmission_unit = MTU; |
| 235 | caps.medium = match &hardware_address { | ||
| 236 | HardwareAddress::Ethernet(_) => Medium::Ethernet, | ||
| 237 | HardwareAddress::Ieee802154(_) => Medium::Ieee802154, | ||
| 238 | HardwareAddress::Ip => Medium::Ip, | ||
| 239 | }; | ||
| 240 | 226 | ||
| 241 | // safety: this is a self-referential struct, however: | 227 | // safety: this is a self-referential struct, however: |
| 242 | // - it can't move while the `'d` borrow is active. | 228 | // - it can't move while the `'d` borrow is active. |
diff --git a/embassy-net-driver/CHANGELOG.md b/embassy-net-driver/CHANGELOG.md new file mode 100644 index 000000000..165461eff --- /dev/null +++ b/embassy-net-driver/CHANGELOG.md | |||
| @@ -0,0 +1,17 @@ | |||
| 1 | # Changelog | ||
| 2 | |||
| 3 | All notable changes to this project will be documented in this file. | ||
| 4 | |||
| 5 | The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), | ||
| 6 | and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). | ||
| 7 | |||
| 8 | ## 0.2.0 - 2023-10-18 | ||
| 9 | |||
| 10 | - Added support for IEEE 802.15.4 mediums. | ||
| 11 | - Added `Driver::hardware_address()`, `HardwareAddress`. | ||
| 12 | - Removed `Medium` enum. The medium is deduced out of the hardware address. | ||
| 13 | - Removed `Driver::ethernet_address()`. Replacement is `hardware_address()`. | ||
| 14 | |||
| 15 | ## 0.1.0 - 2023-06-29 | ||
| 16 | |||
| 17 | - First release | ||
diff --git a/embassy-net-driver/Cargo.toml b/embassy-net-driver/Cargo.toml index e25950b6b..9cd6a2eaa 100644 --- a/embassy-net-driver/Cargo.toml +++ b/embassy-net-driver/Cargo.toml | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | [package] | 1 | [package] |
| 2 | name = "embassy-net-driver" | 2 | name = "embassy-net-driver" |
| 3 | version = "0.1.0" | 3 | version = "0.2.0" |
| 4 | edition = "2021" | 4 | edition = "2021" |
| 5 | license = "MIT OR Apache-2.0" | 5 | license = "MIT OR Apache-2.0" |
| 6 | description = "Driver trait for the `embassy-net` async TCP/IP network stack." | 6 | description = "Driver trait for the `embassy-net` async TCP/IP network stack." |
diff --git a/embassy-net-driver/src/lib.rs b/embassy-net-driver/src/lib.rs index b64c10000..87f9f6ed1 100644 --- a/embassy-net-driver/src/lib.rs +++ b/embassy-net-driver/src/lib.rs | |||
| @@ -7,12 +7,23 @@ use core::task::Context; | |||
| 7 | /// Representation of an hardware address, such as an Ethernet address or an IEEE802.15.4 address. | 7 | /// Representation of an hardware address, such as an Ethernet address or an IEEE802.15.4 address. |
| 8 | #[derive(Debug, Clone, Copy, PartialEq, Eq)] | 8 | #[derive(Debug, Clone, Copy, PartialEq, Eq)] |
| 9 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 9 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 10 | #[non_exhaustive] | ||
| 10 | pub enum HardwareAddress { | 11 | pub enum HardwareAddress { |
| 11 | /// A six-octet Ethernet address | 12 | /// Ethernet medium, with a A six-octet Ethernet address. |
| 13 | /// | ||
| 14 | /// Devices of this type send and receive Ethernet frames, | ||
| 15 | /// and interfaces using it must do neighbor discovery via ARP or NDISC. | ||
| 16 | /// | ||
| 17 | /// Examples of devices of this type are Ethernet, WiFi (802.11), Linux `tap`, and VPNs in tap (layer 2) mode. | ||
| 12 | Ethernet([u8; 6]), | 18 | Ethernet([u8; 6]), |
| 13 | /// An eight-octet IEEE802.15.4 address | 19 | /// 6LoWPAN over IEEE802.15.4, with an eight-octet address. |
| 14 | Ieee802154([u8; 8]), | 20 | Ieee802154([u8; 8]), |
| 15 | /// Indicates that a Driver is IP-native, and has no hardware address | 21 | /// Indicates that a Driver is IP-native, and has no hardware address. |
| 22 | /// | ||
| 23 | /// Devices of this type send and receive IP frames, without an | ||
| 24 | /// Ethernet header. MAC addresses are not used, and no neighbor discovery (ARP, NDISC) is done. | ||
| 25 | /// | ||
| 26 | /// Examples of devices of this type are the Linux `tun`, PPP interfaces, VPNs in tun (layer 3) mode. | ||
| 16 | Ip, | 27 | Ip, |
| 17 | } | 28 | } |
| 18 | 29 | ||
| @@ -64,6 +75,10 @@ pub trait Driver { | |||
| 64 | fn capabilities(&self) -> Capabilities; | 75 | fn capabilities(&self) -> Capabilities; |
| 65 | 76 | ||
| 66 | /// Get the device's hardware address. | 77 | /// Get the device's hardware address. |
| 78 | /// | ||
| 79 | /// The returned hardware address also determines the "medium" of this driver. This indicates | ||
| 80 | /// what kind of packet the sent/received bytes are, and determines some behaviors of | ||
| 81 | /// the interface. For example, ARP/NDISC address resolution is only done for Ethernet mediums. | ||
| 67 | fn hardware_address(&self) -> HardwareAddress; | 82 | fn hardware_address(&self) -> HardwareAddress; |
| 68 | } | 83 | } |
| 69 | 84 | ||
| @@ -124,13 +139,6 @@ pub trait TxToken { | |||
| 124 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 139 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 125 | #[non_exhaustive] | 140 | #[non_exhaustive] |
| 126 | pub struct Capabilities { | 141 | pub struct Capabilities { |
| 127 | /// Medium of the device. | ||
| 128 | /// | ||
| 129 | /// This indicates what kind of packet the sent/received bytes are, and determines | ||
| 130 | /// some behaviors of Interface. For example, ARP/NDISC address resolution is only done | ||
| 131 | /// for Ethernet mediums. | ||
| 132 | pub medium: Medium, | ||
| 133 | |||
| 134 | /// Maximum transmission unit. | 142 | /// Maximum transmission unit. |
| 135 | /// | 143 | /// |
| 136 | /// The network device is unable to send or receive frames larger than the value returned | 144 | /// The network device is unable to send or receive frames larger than the value returned |
| @@ -161,32 +169,6 @@ pub struct Capabilities { | |||
| 161 | pub checksum: ChecksumCapabilities, | 169 | pub checksum: ChecksumCapabilities, |
| 162 | } | 170 | } |
| 163 | 171 | ||
| 164 | /// Type of medium of a device. | ||
| 165 | #[derive(Debug, Eq, PartialEq, Copy, Clone)] | ||
| 166 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | ||
| 167 | pub enum Medium { | ||
| 168 | /// Ethernet medium. Devices of this type send and receive Ethernet frames, | ||
| 169 | /// and interfaces using it must do neighbor discovery via ARP or NDISC. | ||
| 170 | /// | ||
| 171 | /// Examples of devices of this type are Ethernet, WiFi (802.11), Linux `tap`, and VPNs in tap (layer 2) mode. | ||
| 172 | Ethernet, | ||
| 173 | |||
| 174 | /// IP medium. Devices of this type send and receive IP frames, without an | ||
| 175 | /// Ethernet header. MAC addresses are not used, and no neighbor discovery (ARP, NDISC) is done. | ||
| 176 | /// | ||
| 177 | /// Examples of devices of this type are the Linux `tun`, PPP interfaces, VPNs in tun (layer 3) mode. | ||
| 178 | Ip, | ||
| 179 | |||
| 180 | /// IEEE 802_15_4 medium | ||
| 181 | Ieee802154, | ||
| 182 | } | ||
| 183 | |||
| 184 | impl Default for Medium { | ||
| 185 | fn default() -> Medium { | ||
| 186 | Medium::Ethernet | ||
| 187 | } | ||
| 188 | } | ||
| 189 | |||
| 190 | /// A description of checksum behavior for every supported protocol. | 172 | /// A description of checksum behavior for every supported protocol. |
| 191 | #[derive(Debug, Clone, Default)] | 173 | #[derive(Debug, Clone, Default)] |
| 192 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 174 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
diff --git a/embassy-net-enc28j60/Cargo.toml b/embassy-net-enc28j60/Cargo.toml index 161d055c0..ea2ed1f77 100644 --- a/embassy-net-enc28j60/Cargo.toml +++ b/embassy-net-enc28j60/Cargo.toml | |||
| @@ -10,8 +10,8 @@ edition = "2021" | |||
| 10 | [dependencies] | 10 | [dependencies] |
| 11 | embedded-hal = { version = "1.0.0-rc.1" } | 11 | embedded-hal = { version = "1.0.0-rc.1" } |
| 12 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 12 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
| 13 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } | 13 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" } |
| 14 | embassy-time = { version = "0.1.3", path = "../embassy-time" } | 14 | embassy-time = { version = "0.1.5", path = "../embassy-time" } |
| 15 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 15 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 16 | 16 | ||
| 17 | defmt = { version = "0.3", optional = true } | 17 | defmt = { version = "0.3", optional = true } |
diff --git a/embassy-net-enc28j60/src/lib.rs b/embassy-net-enc28j60/src/lib.rs index f96a6ff14..f18134927 100644 --- a/embassy-net-enc28j60/src/lib.rs +++ b/embassy-net-enc28j60/src/lib.rs | |||
| @@ -19,7 +19,7 @@ mod traits; | |||
| 19 | use core::cmp; | 19 | use core::cmp; |
| 20 | use core::convert::TryInto; | 20 | use core::convert::TryInto; |
| 21 | 21 | ||
| 22 | use embassy_net_driver::{Capabilities, HardwareAddress, LinkState, Medium}; | 22 | use embassy_net_driver::{Capabilities, HardwareAddress, LinkState}; |
| 23 | use embassy_time::Duration; | 23 | use embassy_time::Duration; |
| 24 | use embedded_hal::digital::OutputPin; | 24 | use embedded_hal::digital::OutputPin; |
| 25 | use embedded_hal::spi::{Operation, SpiDevice}; | 25 | use embedded_hal::spi::{Operation, SpiDevice}; |
| @@ -671,7 +671,6 @@ where | |||
| 671 | fn capabilities(&self) -> Capabilities { | 671 | fn capabilities(&self) -> Capabilities { |
| 672 | let mut caps = Capabilities::default(); | 672 | let mut caps = Capabilities::default(); |
| 673 | caps.max_transmission_unit = MTU; | 673 | caps.max_transmission_unit = MTU; |
| 674 | caps.medium = Medium::Ethernet; | ||
| 675 | caps | 674 | caps |
| 676 | } | 675 | } |
| 677 | 676 | ||
diff --git a/embassy-net-esp-hosted/Cargo.toml b/embassy-net-esp-hosted/Cargo.toml index 54cd8859f..5f901bb91 100644 --- a/embassy-net-esp-hosted/Cargo.toml +++ b/embassy-net-esp-hosted/Cargo.toml | |||
| @@ -7,10 +7,10 @@ edition = "2021" | |||
| 7 | defmt = { version = "0.3", optional = true } | 7 | defmt = { version = "0.3", optional = true } |
| 8 | log = { version = "0.4.14", optional = true } | 8 | log = { version = "0.4.14", optional = true } |
| 9 | 9 | ||
| 10 | embassy-time = { version = "0.1.3", path = "../embassy-time" } | 10 | embassy-time = { version = "0.1.5", path = "../embassy-time" } |
| 11 | embassy-sync = { version = "0.3.0", path = "../embassy-sync"} | 11 | embassy-sync = { version = "0.3.0", path = "../embassy-sync"} |
| 12 | embassy-futures = { version = "0.1.0", path = "../embassy-futures"} | 12 | embassy-futures = { version = "0.1.0", path = "../embassy-futures"} |
| 13 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel"} | 13 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel"} |
| 14 | 14 | ||
| 15 | embedded-hal = { version = "1.0.0-rc.1" } | 15 | embedded-hal = { version = "1.0.0-rc.1" } |
| 16 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 16 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
diff --git a/embassy-net-esp-hosted/src/control.rs b/embassy-net-esp-hosted/src/control.rs index a4996b584..50030f431 100644 --- a/embassy-net-esp-hosted/src/control.rs +++ b/embassy-net-esp-hosted/src/control.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | use ch::driver::LinkState; | ||
| 2 | use embassy_net_driver_channel as ch; | 1 | use embassy_net_driver_channel as ch; |
| 2 | use embassy_net_driver_channel::driver::{HardwareAddress, LinkState}; | ||
| 3 | use heapless::String; | 3 | use heapless::String; |
| 4 | 4 | ||
| 5 | use crate::ioctl::Shared; | 5 | use crate::ioctl::Shared; |
| @@ -77,7 +77,7 @@ impl<'a> Control<'a> { | |||
| 77 | 77 | ||
| 78 | let mac_addr = self.get_mac_addr().await?; | 78 | let mac_addr = self.get_mac_addr().await?; |
| 79 | debug!("mac addr: {:02x}", mac_addr); | 79 | debug!("mac addr: {:02x}", mac_addr); |
| 80 | self.state_ch.set_ethernet_address(mac_addr); | 80 | self.state_ch.set_hardware_address(HardwareAddress::Ethernet(mac_addr)); |
| 81 | 81 | ||
| 82 | Ok(()) | 82 | Ok(()) |
| 83 | } | 83 | } |
diff --git a/embassy-net-esp-hosted/src/lib.rs b/embassy-net-esp-hosted/src/lib.rs index 4a318b20d..d61eaef3a 100644 --- a/embassy-net-esp-hosted/src/lib.rs +++ b/embassy-net-esp-hosted/src/lib.rs | |||
| @@ -169,9 +169,9 @@ where | |||
| 169 | pub async fn run(mut self) -> ! { | 169 | pub async fn run(mut self) -> ! { |
| 170 | debug!("resetting..."); | 170 | debug!("resetting..."); |
| 171 | self.reset.set_low().unwrap(); | 171 | self.reset.set_low().unwrap(); |
| 172 | Timer::after(Duration::from_millis(100)).await; | 172 | Timer::after_millis(100).await; |
| 173 | self.reset.set_high().unwrap(); | 173 | self.reset.set_high().unwrap(); |
| 174 | Timer::after(Duration::from_millis(1000)).await; | 174 | Timer::after_millis(1000).await; |
| 175 | 175 | ||
| 176 | let mut tx_buf = [0u8; MAX_SPI_BUFFER_SIZE]; | 176 | let mut tx_buf = [0u8; MAX_SPI_BUFFER_SIZE]; |
| 177 | let mut rx_buf = [0u8; MAX_SPI_BUFFER_SIZE]; | 177 | let mut rx_buf = [0u8; MAX_SPI_BUFFER_SIZE]; |
diff --git a/embassy-net-ppp/Cargo.toml b/embassy-net-ppp/Cargo.toml index da09f780e..bd992de06 100644 --- a/embassy-net-ppp/Cargo.toml +++ b/embassy-net-ppp/Cargo.toml | |||
| @@ -15,8 +15,8 @@ log = ["dep:log", "ppproto/log"] | |||
| 15 | defmt = { version = "0.3", optional = true } | 15 | defmt = { version = "0.3", optional = true } |
| 16 | log = { version = "0.4.14", optional = true } | 16 | log = { version = "0.4.14", optional = true } |
| 17 | 17 | ||
| 18 | embedded-io-async = { version = "0.5.0" } | 18 | embedded-io-async = { version = "0.6.0" } |
| 19 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } | 19 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" } |
| 20 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 20 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 21 | ppproto = { version = "0.1.2"} | 21 | ppproto = { version = "0.1.2"} |
| 22 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 22 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
diff --git a/embassy-net-ppp/src/lib.rs b/embassy-net-ppp/src/lib.rs index 66496ee0a..54a98c95f 100644 --- a/embassy-net-ppp/src/lib.rs +++ b/embassy-net-ppp/src/lib.rs | |||
| @@ -11,7 +11,7 @@ use core::mem::MaybeUninit; | |||
| 11 | use embassy_futures::select::{select, Either}; | 11 | use embassy_futures::select::{select, Either}; |
| 12 | use embassy_net_driver_channel as ch; | 12 | use embassy_net_driver_channel as ch; |
| 13 | use embassy_net_driver_channel::driver::LinkState; | 13 | use embassy_net_driver_channel::driver::LinkState; |
| 14 | use embedded_io_async::{BufRead, Write, WriteAllError}; | 14 | use embedded_io_async::{BufRead, Write}; |
| 15 | use ppproto::pppos::{BufferFullError, PPPoS, PPPoSAction}; | 15 | use ppproto::pppos::{BufferFullError, PPPoS, PPPoSAction}; |
| 16 | pub use ppproto::{Config, Ipv4Status}; | 16 | pub use ppproto::{Config, Ipv4Status}; |
| 17 | 17 | ||
| @@ -49,23 +49,12 @@ pub enum RunError<E> { | |||
| 49 | Read(E), | 49 | Read(E), |
| 50 | /// Writing to the serial port failed. | 50 | /// Writing to the serial port failed. |
| 51 | Write(E), | 51 | Write(E), |
| 52 | /// Writing to the serial port wrote zero bytes, indicating it can't accept more data. | ||
| 53 | WriteZero, | ||
| 54 | /// Writing to the serial got EOF. | 52 | /// Writing to the serial got EOF. |
| 55 | Eof, | 53 | Eof, |
| 56 | /// PPP protocol was terminated by the peer | 54 | /// PPP protocol was terminated by the peer |
| 57 | Terminated, | 55 | Terminated, |
| 58 | } | 56 | } |
| 59 | 57 | ||
| 60 | impl<E> From<WriteAllError<E>> for RunError<E> { | ||
| 61 | fn from(value: WriteAllError<E>) -> Self { | ||
| 62 | match value { | ||
| 63 | WriteAllError::Other(e) => Self::Write(e), | ||
| 64 | WriteAllError::WriteZero => Self::WriteZero, | ||
| 65 | } | ||
| 66 | } | ||
| 67 | } | ||
| 68 | |||
| 69 | impl<'d> Runner<'d> { | 58 | impl<'d> Runner<'d> { |
| 70 | /// You must call this in a background task for the driver to operate. | 59 | /// You must call this in a background task for the driver to operate. |
| 71 | /// | 60 | /// |
| @@ -125,7 +114,7 @@ impl<'d> Runner<'d> { | |||
| 125 | buf[..pkt.len()].copy_from_slice(pkt); | 114 | buf[..pkt.len()].copy_from_slice(pkt); |
| 126 | rx_chan.rx_done(pkt.len()); | 115 | rx_chan.rx_done(pkt.len()); |
| 127 | } | 116 | } |
| 128 | PPPoSAction::Transmit(n) => rw.write_all(&tx_buf[..n]).await?, | 117 | PPPoSAction::Transmit(n) => rw.write_all(&tx_buf[..n]).await.map_err(RunError::Write)?, |
| 129 | } | 118 | } |
| 130 | 119 | ||
| 131 | let status = ppp.status(); | 120 | let status = ppp.status(); |
| @@ -148,7 +137,7 @@ impl<'d> Runner<'d> { | |||
| 148 | } | 137 | } |
| 149 | Either::Second(pkt) => { | 138 | Either::Second(pkt) => { |
| 150 | match ppp.send(pkt, &mut tx_buf) { | 139 | match ppp.send(pkt, &mut tx_buf) { |
| 151 | Ok(n) => rw.write_all(&tx_buf[..n]).await?, | 140 | Ok(n) => rw.write_all(&tx_buf[..n]).await.map_err(RunError::Write)?, |
| 152 | Err(BufferFullError) => unreachable!(), | 141 | Err(BufferFullError) => unreachable!(), |
| 153 | } | 142 | } |
| 154 | tx_chan.tx_done(); | 143 | tx_chan.tx_done(); |
diff --git a/embassy-net-tuntap/Cargo.toml b/embassy-net-tuntap/Cargo.toml index 08d309680..4e374c365 100644 --- a/embassy-net-tuntap/Cargo.toml +++ b/embassy-net-tuntap/Cargo.toml | |||
| @@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0" | |||
| 8 | edition = "2021" | 8 | edition = "2021" |
| 9 | 9 | ||
| 10 | [dependencies] | 10 | [dependencies] |
| 11 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } | 11 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" } |
| 12 | async-io = "1.6.0" | 12 | async-io = "1.6.0" |
| 13 | log = "0.4.14" | 13 | log = "0.4.14" |
| 14 | libc = "0.2.101" | 14 | libc = "0.2.101" |
diff --git a/embassy-net-wiznet/Cargo.toml b/embassy-net-wiznet/Cargo.toml index afa0d5cd5..0cc086b7e 100644 --- a/embassy-net-wiznet/Cargo.toml +++ b/embassy-net-wiznet/Cargo.toml | |||
| @@ -10,8 +10,8 @@ edition = "2021" | |||
| 10 | [dependencies] | 10 | [dependencies] |
| 11 | embedded-hal = { version = "1.0.0-rc.1" } | 11 | embedded-hal = { version = "1.0.0-rc.1" } |
| 12 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 12 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
| 13 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } | 13 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" } |
| 14 | embassy-time = { version = "0.1.3", path = "../embassy-time" } | 14 | embassy-time = { version = "0.1.5", path = "../embassy-time" } |
| 15 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 15 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 16 | defmt = { version = "0.3", optional = true } | 16 | defmt = { version = "0.3", optional = true } |
| 17 | 17 | ||
diff --git a/embassy-net-wiznet/src/lib.rs b/embassy-net-wiznet/src/lib.rs index 3030dfb90..afdb6729c 100644 --- a/embassy-net-wiznet/src/lib.rs +++ b/embassy-net-wiznet/src/lib.rs | |||
| @@ -1,14 +1,14 @@ | |||
| 1 | //! [`embassy-net`](https://crates.io/crates/embassy-net) driver for WIZnet ethernet chips. | ||
| 2 | #![no_std] | 1 | #![no_std] |
| 3 | #![feature(async_fn_in_trait)] | 2 | #![feature(async_fn_in_trait)] |
| 3 | #![doc = include_str!("../README.md")] | ||
| 4 | 4 | ||
| 5 | pub mod chip; | 5 | pub mod chip; |
| 6 | mod device; | 6 | mod device; |
| 7 | 7 | ||
| 8 | use embassy_futures::select::{select, Either}; | 8 | use embassy_futures::select::{select3, Either3}; |
| 9 | use embassy_net_driver_channel as ch; | 9 | use embassy_net_driver_channel as ch; |
| 10 | use embassy_net_driver_channel::driver::LinkState; | 10 | use embassy_net_driver_channel::driver::LinkState; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::{Duration, Ticker, Timer}; |
| 12 | use embedded_hal::digital::OutputPin; | 12 | use embedded_hal::digital::OutputPin; |
| 13 | use embedded_hal_async::digital::Wait; | 13 | use embedded_hal_async::digital::Wait; |
| 14 | use embedded_hal_async::spi::SpiDevice; | 14 | use embedded_hal_async::spi::SpiDevice; |
| @@ -49,32 +49,34 @@ pub struct Runner<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> { | |||
| 49 | impl<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> Runner<'d, C, SPI, INT, RST> { | 49 | impl<'d, C: Chip, SPI: SpiDevice, INT: Wait, RST: OutputPin> Runner<'d, C, SPI, INT, RST> { |
| 50 | pub async fn run(mut self) -> ! { | 50 | pub async fn run(mut self) -> ! { |
| 51 | let (state_chan, mut rx_chan, mut tx_chan) = self.ch.split(); | 51 | let (state_chan, mut rx_chan, mut tx_chan) = self.ch.split(); |
| 52 | let mut tick = Ticker::every(Duration::from_millis(500)); | ||
| 52 | loop { | 53 | loop { |
| 53 | if self.mac.is_link_up().await { | 54 | match select3( |
| 54 | state_chan.set_link_state(LinkState::Up); | 55 | async { |
| 55 | loop { | 56 | self.int.wait_for_low().await.ok(); |
| 56 | match select( | 57 | rx_chan.rx_buf().await |
| 57 | async { | 58 | }, |
| 58 | self.int.wait_for_low().await.ok(); | 59 | tx_chan.tx_buf(), |
| 59 | rx_chan.rx_buf().await | 60 | tick.next(), |
| 60 | }, | 61 | ) |
| 61 | tx_chan.tx_buf(), | 62 | .await |
| 62 | ) | 63 | { |
| 63 | .await | 64 | Either3::First(p) => { |
| 64 | { | 65 | if let Ok(n) = self.mac.read_frame(p).await { |
| 65 | Either::First(p) => { | 66 | rx_chan.rx_done(n); |
| 66 | if let Ok(n) = self.mac.read_frame(p).await { | 67 | } |
| 67 | rx_chan.rx_done(n); | 68 | } |
| 68 | } | 69 | Either3::Second(p) => { |
| 69 | } | 70 | self.mac.write_frame(p).await.ok(); |
| 70 | Either::Second(p) => { | 71 | tx_chan.tx_done(); |
| 71 | self.mac.write_frame(p).await.ok(); | 72 | } |
| 72 | tx_chan.tx_done(); | 73 | Either3::Third(()) => { |
| 73 | } | 74 | if self.mac.is_link_up().await { |
| 75 | state_chan.set_link_state(LinkState::Up); | ||
| 76 | } else { | ||
| 77 | state_chan.set_link_state(LinkState::Down); | ||
| 74 | } | 78 | } |
| 75 | } | 79 | } |
| 76 | } else { | ||
| 77 | state_chan.set_link_state(LinkState::Down); | ||
| 78 | } | 80 | } |
| 79 | } | 81 | } |
| 80 | } | 82 | } |
| @@ -95,12 +97,12 @@ pub async fn new<'a, const N_RX: usize, const N_TX: usize, C: Chip, SPI: SpiDevi | |||
| 95 | // Reset the chip. | 97 | // Reset the chip. |
| 96 | reset.set_low().ok(); | 98 | reset.set_low().ok(); |
| 97 | // Ensure the reset is registered. | 99 | // Ensure the reset is registered. |
| 98 | Timer::after(Duration::from_millis(1)).await; | 100 | Timer::after_millis(1).await; |
| 99 | reset.set_high().ok(); | 101 | reset.set_high().ok(); |
| 100 | 102 | ||
| 101 | // Wait for PLL lock. Some chips are slower than others. | 103 | // Wait for PLL lock. Some chips are slower than others. |
| 102 | // Slowest is w5100s which is 100ms, so let's just wait that. | 104 | // Slowest is w5100s which is 100ms, so let's just wait that. |
| 103 | Timer::after(Duration::from_millis(100)).await; | 105 | Timer::after_millis(100).await; |
| 104 | 106 | ||
| 105 | let mac = WiznetDevice::new(spi_dev, mac_addr).await.unwrap(); | 107 | let mac = WiznetDevice::new(spi_dev, mac_addr).await.unwrap(); |
| 106 | 108 | ||
diff --git a/embassy-net/CHANGELOG.md b/embassy-net/CHANGELOG.md new file mode 100644 index 000000000..7b91b844b --- /dev/null +++ b/embassy-net/CHANGELOG.md | |||
| @@ -0,0 +1,29 @@ | |||
| 1 | # Changelog | ||
| 2 | |||
| 3 | All notable changes to this project will be documented in this file. | ||
| 4 | |||
| 5 | The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), | ||
| 6 | and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). | ||
| 7 | |||
| 8 | ## 0.2.0 - 2023-10-18 | ||
| 9 | |||
| 10 | - Re-export `smoltcp::wire::IpEndpoint` | ||
| 11 | - Add poll functions on UdpSocket | ||
| 12 | - Make dual-stack work in embassy-net | ||
| 13 | - Fix multicast support | ||
| 14 | - Allow ethernet and 802.15.4 to coexist | ||
| 15 | - Add IEEE802.15.4 address to embassy net Stack | ||
| 16 | - Use HardwareAddress in Driver | ||
| 17 | - Add async versions of smoltcp's `send` and `recv` closure based API | ||
| 18 | - add error translation to tcp errors | ||
| 19 | - Forward TCP/UDP socket capacity impls | ||
| 20 | - allow changing IP config at runtime | ||
| 21 | - allow non-'static drivers | ||
| 22 | - Remove impl_trait_projections | ||
| 23 | - update embedded-io, embedded-nal-async | ||
| 24 | - add support for dhcp hostname option | ||
| 25 | - Wake stack's task after queueing a DNS query | ||
| 26 | |||
| 27 | ## 0.1.0 - 2023-06-29 | ||
| 28 | |||
| 29 | - First release | ||
diff --git a/embassy-net/Cargo.toml b/embassy-net/Cargo.toml index 8aca92a68..573d20fb7 100644 --- a/embassy-net/Cargo.toml +++ b/embassy-net/Cargo.toml | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | [package] | 1 | [package] |
| 2 | name = "embassy-net" | 2 | name = "embassy-net" |
| 3 | version = "0.1.0" | 3 | version = "0.2.0" |
| 4 | edition = "2021" | 4 | edition = "2021" |
| 5 | license = "MIT OR Apache-2.0" | 5 | license = "MIT OR Apache-2.0" |
| 6 | description = "Async TCP/IP network stack for embedded systems" | 6 | description = "Async TCP/IP network stack for embedded systems" |
| @@ -33,6 +33,7 @@ udp = ["smoltcp/socket-udp"] | |||
| 33 | tcp = ["smoltcp/socket-tcp"] | 33 | tcp = ["smoltcp/socket-tcp"] |
| 34 | dns = ["smoltcp/socket-dns", "smoltcp/proto-dns"] | 34 | dns = ["smoltcp/socket-dns", "smoltcp/proto-dns"] |
| 35 | dhcpv4 = ["proto-ipv4", "medium-ethernet", "smoltcp/socket-dhcpv4"] | 35 | dhcpv4 = ["proto-ipv4", "medium-ethernet", "smoltcp/socket-dhcpv4"] |
| 36 | dhcpv4-hostname = ["dhcpv4"] | ||
| 36 | proto-ipv4 = ["smoltcp/proto-ipv4"] | 37 | proto-ipv4 = ["smoltcp/proto-ipv4"] |
| 37 | proto-ipv6 = ["smoltcp/proto-ipv6"] | 38 | proto-ipv6 = ["smoltcp/proto-ipv6"] |
| 38 | medium-ethernet = ["smoltcp/medium-ethernet"] | 39 | medium-ethernet = ["smoltcp/medium-ethernet"] |
| @@ -50,10 +51,10 @@ smoltcp = { version = "0.10.0", default-features = false, features = [ | |||
| 50 | "async", | 51 | "async", |
| 51 | ] } | 52 | ] } |
| 52 | 53 | ||
| 53 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } | 54 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" } |
| 54 | embassy-time = { version = "0.1.3", path = "../embassy-time" } | 55 | embassy-time = { version = "0.1.5", path = "../embassy-time" } |
| 55 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 56 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 56 | embedded-io-async = { version = "0.5.0", optional = true } | 57 | embedded-io-async = { version = "0.6.0", optional = true } |
| 57 | 58 | ||
| 58 | managed = { version = "0.8.0", default-features = false, features = [ "map" ] } | 59 | managed = { version = "0.8.0", default-features = false, features = [ "map" ] } |
| 59 | heapless = { version = "0.7.5", default-features = false } | 60 | heapless = { version = "0.7.5", default-features = false } |
| @@ -62,5 +63,4 @@ generic-array = { version = "0.14.4", default-features = false } | |||
| 62 | stable_deref_trait = { version = "1.2.0", default-features = false } | 63 | stable_deref_trait = { version = "1.2.0", default-features = false } |
| 63 | futures = { version = "0.3.17", default-features = false, features = [ "async-await" ] } | 64 | futures = { version = "0.3.17", default-features = false, features = [ "async-await" ] } |
| 64 | atomic-pool = "1.0" | 65 | atomic-pool = "1.0" |
| 65 | embedded-nal-async = { version = "0.5.0", optional = true } | 66 | embedded-nal-async = { version = "0.6.0", optional = true } |
| 66 | atomic-polyfill = { version = "1.0" } | ||
diff --git a/embassy-net/src/device.rs b/embassy-net/src/device.rs index 8c2b7d31a..54a0c47e8 100644 --- a/embassy-net/src/device.rs +++ b/embassy-net/src/device.rs | |||
| @@ -1,7 +1,7 @@ | |||
| 1 | use core::task::Context; | 1 | use core::task::Context; |
| 2 | 2 | ||
| 3 | use embassy_net_driver::{Capabilities, Checksum, Driver, Medium, RxToken, TxToken}; | 3 | use embassy_net_driver::{Capabilities, Checksum, Driver, RxToken, TxToken}; |
| 4 | use smoltcp::phy; | 4 | use smoltcp::phy::{self, Medium}; |
| 5 | use smoltcp::time::Instant; | 5 | use smoltcp::time::Instant; |
| 6 | 6 | ||
| 7 | pub(crate) struct DriverAdapter<'d, 'c, T> | 7 | pub(crate) struct DriverAdapter<'d, 'c, T> |
| @@ -11,6 +11,7 @@ where | |||
| 11 | // must be Some when actually using this to rx/tx | 11 | // must be Some when actually using this to rx/tx |
| 12 | pub cx: Option<&'d mut Context<'c>>, | 12 | pub cx: Option<&'d mut Context<'c>>, |
| 13 | pub inner: &'d mut T, | 13 | pub inner: &'d mut T, |
| 14 | pub medium: Medium, | ||
| 14 | } | 15 | } |
| 15 | 16 | ||
| 16 | impl<'d, 'c, T> phy::Device for DriverAdapter<'d, 'c, T> | 17 | impl<'d, 'c, T> phy::Device for DriverAdapter<'d, 'c, T> |
| @@ -46,19 +47,7 @@ where | |||
| 46 | 47 | ||
| 47 | smolcaps.max_transmission_unit = caps.max_transmission_unit; | 48 | smolcaps.max_transmission_unit = caps.max_transmission_unit; |
| 48 | smolcaps.max_burst_size = caps.max_burst_size; | 49 | smolcaps.max_burst_size = caps.max_burst_size; |
| 49 | smolcaps.medium = match caps.medium { | 50 | smolcaps.medium = self.medium; |
| 50 | #[cfg(feature = "medium-ethernet")] | ||
| 51 | Medium::Ethernet => phy::Medium::Ethernet, | ||
| 52 | #[cfg(feature = "medium-ip")] | ||
| 53 | Medium::Ip => phy::Medium::Ip, | ||
| 54 | #[cfg(feature = "medium-ieee802154")] | ||
| 55 | Medium::Ieee802154 => phy::Medium::Ieee802154, | ||
| 56 | #[allow(unreachable_patterns)] | ||
| 57 | _ => panic!( | ||
| 58 | "Unsupported medium {:?}. Make sure to enable it in embassy-net's Cargo features.", | ||
| 59 | caps.medium | ||
| 60 | ), | ||
| 61 | }; | ||
| 62 | smolcaps.checksum.ipv4 = convert(caps.checksum.ipv4); | 51 | smolcaps.checksum.ipv4 = convert(caps.checksum.ipv4); |
| 63 | smolcaps.checksum.tcp = convert(caps.checksum.tcp); | 52 | smolcaps.checksum.tcp = convert(caps.checksum.tcp); |
| 64 | smolcaps.checksum.udp = convert(caps.checksum.udp); | 53 | smolcaps.checksum.udp = convert(caps.checksum.udp); |
diff --git a/embassy-net/src/lib.rs b/embassy-net/src/lib.rs index 0d7ac47a2..c41faee2f 100644 --- a/embassy-net/src/lib.rs +++ b/embassy-net/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![cfg_attr(not(feature = "std"), no_std)] | 1 | #![cfg_attr(not(feature = "std"), no_std)] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait))] |
| 3 | #![warn(missing_docs)] | 3 | #![warn(missing_docs)] |
| 4 | #![doc = include_str!("../README.md")] | 4 | #![doc = include_str!("../README.md")] |
| 5 | 5 | ||
| @@ -33,13 +33,14 @@ use heapless::Vec; | |||
| 33 | pub use smoltcp::iface::MulticastError; | 33 | pub use smoltcp::iface::MulticastError; |
| 34 | #[allow(unused_imports)] | 34 | #[allow(unused_imports)] |
| 35 | use smoltcp::iface::{Interface, SocketHandle, SocketSet, SocketStorage}; | 35 | use smoltcp::iface::{Interface, SocketHandle, SocketSet, SocketStorage}; |
| 36 | use smoltcp::phy::Medium; | ||
| 36 | #[cfg(feature = "dhcpv4")] | 37 | #[cfg(feature = "dhcpv4")] |
| 37 | use smoltcp::socket::dhcpv4::{self, RetryConfig}; | 38 | use smoltcp::socket::dhcpv4::{self, RetryConfig}; |
| 38 | #[cfg(feature = "medium-ethernet")] | 39 | #[cfg(feature = "medium-ethernet")] |
| 39 | pub use smoltcp::wire::EthernetAddress; | 40 | pub use smoltcp::wire::EthernetAddress; |
| 40 | #[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154", feature = "medium-ip"))] | 41 | #[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154", feature = "medium-ip"))] |
| 41 | pub use smoltcp::wire::HardwareAddress; | 42 | pub use smoltcp::wire::HardwareAddress; |
| 42 | #[cfg(feature = "udp")] | 43 | #[cfg(any(feature = "udp", feature = "tcp"))] |
| 43 | pub use smoltcp::wire::IpListenEndpoint; | 44 | pub use smoltcp::wire::IpListenEndpoint; |
| 44 | #[cfg(feature = "medium-ieee802154")] | 45 | #[cfg(feature = "medium-ieee802154")] |
| 45 | pub use smoltcp::wire::{Ieee802154Address, Ieee802154Frame}; | 46 | pub use smoltcp::wire::{Ieee802154Address, Ieee802154Frame}; |
| @@ -56,12 +57,22 @@ const LOCAL_PORT_MIN: u16 = 1025; | |||
| 56 | const LOCAL_PORT_MAX: u16 = 65535; | 57 | const LOCAL_PORT_MAX: u16 = 65535; |
| 57 | #[cfg(feature = "dns")] | 58 | #[cfg(feature = "dns")] |
| 58 | const MAX_QUERIES: usize = 4; | 59 | const MAX_QUERIES: usize = 4; |
| 60 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 61 | const MAX_HOSTNAME_LEN: usize = 32; | ||
| 59 | 62 | ||
| 60 | /// Memory resources needed for a network stack. | 63 | /// Memory resources needed for a network stack. |
| 61 | pub struct StackResources<const SOCK: usize> { | 64 | pub struct StackResources<const SOCK: usize> { |
| 62 | sockets: [SocketStorage<'static>; SOCK], | 65 | sockets: [SocketStorage<'static>; SOCK], |
| 63 | #[cfg(feature = "dns")] | 66 | #[cfg(feature = "dns")] |
| 64 | queries: [Option<dns::DnsQuery>; MAX_QUERIES], | 67 | queries: [Option<dns::DnsQuery>; MAX_QUERIES], |
| 68 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 69 | hostname: core::cell::UnsafeCell<HostnameResources>, | ||
| 70 | } | ||
| 71 | |||
| 72 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 73 | struct HostnameResources { | ||
| 74 | option: smoltcp::wire::DhcpOption<'static>, | ||
| 75 | data: [u8; MAX_HOSTNAME_LEN], | ||
| 65 | } | 76 | } |
| 66 | 77 | ||
| 67 | impl<const SOCK: usize> StackResources<SOCK> { | 78 | impl<const SOCK: usize> StackResources<SOCK> { |
| @@ -73,6 +84,11 @@ impl<const SOCK: usize> StackResources<SOCK> { | |||
| 73 | sockets: [SocketStorage::EMPTY; SOCK], | 84 | sockets: [SocketStorage::EMPTY; SOCK], |
| 74 | #[cfg(feature = "dns")] | 85 | #[cfg(feature = "dns")] |
| 75 | queries: [INIT; MAX_QUERIES], | 86 | queries: [INIT; MAX_QUERIES], |
| 87 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 88 | hostname: core::cell::UnsafeCell::new(HostnameResources { | ||
| 89 | option: smoltcp::wire::DhcpOption { kind: 0, data: &[] }, | ||
| 90 | data: [0; MAX_HOSTNAME_LEN], | ||
| 91 | }), | ||
| 76 | } | 92 | } |
| 77 | } | 93 | } |
| 78 | } | 94 | } |
| @@ -104,6 +120,7 @@ pub struct StaticConfigV6 { | |||
| 104 | /// DHCP configuration. | 120 | /// DHCP configuration. |
| 105 | #[cfg(feature = "dhcpv4")] | 121 | #[cfg(feature = "dhcpv4")] |
| 106 | #[derive(Debug, Clone, PartialEq, Eq)] | 122 | #[derive(Debug, Clone, PartialEq, Eq)] |
| 123 | #[non_exhaustive] | ||
| 107 | pub struct DhcpConfig { | 124 | pub struct DhcpConfig { |
| 108 | /// Maximum lease duration. | 125 | /// Maximum lease duration. |
| 109 | /// | 126 | /// |
| @@ -120,6 +137,9 @@ pub struct DhcpConfig { | |||
| 120 | pub server_port: u16, | 137 | pub server_port: u16, |
| 121 | /// Client port. This is almost always 68. Do not change unless you know what you're doing. | 138 | /// Client port. This is almost always 68. Do not change unless you know what you're doing. |
| 122 | pub client_port: u16, | 139 | pub client_port: u16, |
| 140 | /// Our hostname. This will be sent to the DHCP server as Option 12. | ||
| 141 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 142 | pub hostname: Option<heapless::String<MAX_HOSTNAME_LEN>>, | ||
| 123 | } | 143 | } |
| 124 | 144 | ||
| 125 | #[cfg(feature = "dhcpv4")] | 145 | #[cfg(feature = "dhcpv4")] |
| @@ -131,6 +151,8 @@ impl Default for DhcpConfig { | |||
| 131 | ignore_naks: Default::default(), | 151 | ignore_naks: Default::default(), |
| 132 | server_port: smoltcp::wire::DHCP_SERVER_PORT, | 152 | server_port: smoltcp::wire::DHCP_SERVER_PORT, |
| 133 | client_port: smoltcp::wire::DHCP_CLIENT_PORT, | 153 | client_port: smoltcp::wire::DHCP_CLIENT_PORT, |
| 154 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 155 | hostname: None, | ||
| 134 | } | 156 | } |
| 135 | } | 157 | } |
| 136 | } | 158 | } |
| @@ -232,6 +254,8 @@ struct Inner<D: Driver> { | |||
| 232 | dns_socket: SocketHandle, | 254 | dns_socket: SocketHandle, |
| 233 | #[cfg(feature = "dns")] | 255 | #[cfg(feature = "dns")] |
| 234 | dns_waker: WakerRegistration, | 256 | dns_waker: WakerRegistration, |
| 257 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 258 | hostname: &'static mut core::cell::UnsafeCell<HostnameResources>, | ||
| 235 | } | 259 | } |
| 236 | 260 | ||
| 237 | pub(crate) struct SocketStack { | 261 | pub(crate) struct SocketStack { |
| @@ -241,14 +265,17 @@ pub(crate) struct SocketStack { | |||
| 241 | next_local_port: u16, | 265 | next_local_port: u16, |
| 242 | } | 266 | } |
| 243 | 267 | ||
| 244 | fn to_smoltcp_hardware_address(addr: driver::HardwareAddress) -> HardwareAddress { | 268 | fn to_smoltcp_hardware_address(addr: driver::HardwareAddress) -> (HardwareAddress, Medium) { |
| 245 | match addr { | 269 | match addr { |
| 246 | #[cfg(feature = "medium-ethernet")] | 270 | #[cfg(feature = "medium-ethernet")] |
| 247 | driver::HardwareAddress::Ethernet(eth) => HardwareAddress::Ethernet(EthernetAddress(eth)), | 271 | driver::HardwareAddress::Ethernet(eth) => (HardwareAddress::Ethernet(EthernetAddress(eth)), Medium::Ethernet), |
| 248 | #[cfg(feature = "medium-ieee802154")] | 272 | #[cfg(feature = "medium-ieee802154")] |
| 249 | driver::HardwareAddress::Ieee802154(ieee) => HardwareAddress::Ieee802154(Ieee802154Address::Extended(ieee)), | 273 | driver::HardwareAddress::Ieee802154(ieee) => ( |
| 274 | HardwareAddress::Ieee802154(Ieee802154Address::Extended(ieee)), | ||
| 275 | Medium::Ieee802154, | ||
| 276 | ), | ||
| 250 | #[cfg(feature = "medium-ip")] | 277 | #[cfg(feature = "medium-ip")] |
| 251 | driver::HardwareAddress::Ip => HardwareAddress::Ip, | 278 | driver::HardwareAddress::Ip => (HardwareAddress::Ip, Medium::Ip), |
| 252 | 279 | ||
| 253 | #[allow(unreachable_patterns)] | 280 | #[allow(unreachable_patterns)] |
| 254 | _ => panic!( | 281 | _ => panic!( |
| @@ -266,7 +293,8 @@ impl<D: Driver> Stack<D> { | |||
| 266 | resources: &'static mut StackResources<SOCK>, | 293 | resources: &'static mut StackResources<SOCK>, |
| 267 | random_seed: u64, | 294 | random_seed: u64, |
| 268 | ) -> Self { | 295 | ) -> Self { |
| 269 | let mut iface_cfg = smoltcp::iface::Config::new(to_smoltcp_hardware_address(device.hardware_address())); | 296 | let (hardware_addr, medium) = to_smoltcp_hardware_address(device.hardware_address()); |
| 297 | let mut iface_cfg = smoltcp::iface::Config::new(hardware_addr); | ||
| 270 | iface_cfg.random_seed = random_seed; | 298 | iface_cfg.random_seed = random_seed; |
| 271 | 299 | ||
| 272 | let iface = Interface::new( | 300 | let iface = Interface::new( |
| @@ -274,6 +302,7 @@ impl<D: Driver> Stack<D> { | |||
| 274 | &mut DriverAdapter { | 302 | &mut DriverAdapter { |
| 275 | inner: &mut device, | 303 | inner: &mut device, |
| 276 | cx: None, | 304 | cx: None, |
| 305 | medium, | ||
| 277 | }, | 306 | }, |
| 278 | instant_to_smoltcp(Instant::now()), | 307 | instant_to_smoltcp(Instant::now()), |
| 279 | ); | 308 | ); |
| @@ -307,6 +336,8 @@ impl<D: Driver> Stack<D> { | |||
| 307 | )), | 336 | )), |
| 308 | #[cfg(feature = "dns")] | 337 | #[cfg(feature = "dns")] |
| 309 | dns_waker: WakerRegistration::new(), | 338 | dns_waker: WakerRegistration::new(), |
| 339 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 340 | hostname: &mut resources.hostname, | ||
| 310 | }; | 341 | }; |
| 311 | 342 | ||
| 312 | #[cfg(feature = "proto-ipv4")] | 343 | #[cfg(feature = "proto-ipv4")] |
| @@ -331,7 +362,7 @@ impl<D: Driver> Stack<D> { | |||
| 331 | 362 | ||
| 332 | /// Get the hardware address of the network interface. | 363 | /// Get the hardware address of the network interface. |
| 333 | pub fn hardware_address(&self) -> HardwareAddress { | 364 | pub fn hardware_address(&self) -> HardwareAddress { |
| 334 | self.with(|_s, i| to_smoltcp_hardware_address(i.device.hardware_address())) | 365 | self.with(|_s, i| to_smoltcp_hardware_address(i.device.hardware_address()).0) |
| 335 | } | 366 | } |
| 336 | 367 | ||
| 337 | /// Get whether the link is up. | 368 | /// Get whether the link is up. |
| @@ -484,7 +515,10 @@ impl<D: Driver> Stack<D> { | |||
| 484 | self.with_mut(|s, i| { | 515 | self.with_mut(|s, i| { |
| 485 | let socket = s.sockets.get_mut::<dns::Socket>(i.dns_socket); | 516 | let socket = s.sockets.get_mut::<dns::Socket>(i.dns_socket); |
| 486 | match socket.start_query(s.iface.context(), name, qtype) { | 517 | match socket.start_query(s.iface.context(), name, qtype) { |
| 487 | Ok(handle) => Poll::Ready(Ok(handle)), | 518 | Ok(handle) => { |
| 519 | s.waker.wake(); | ||
| 520 | Poll::Ready(Ok(handle)) | ||
| 521 | } | ||
| 488 | Err(dns::StartQueryError::NoFreeSlot) => { | 522 | Err(dns::StartQueryError::NoFreeSlot) => { |
| 489 | i.dns_waker.register(cx.waker()); | 523 | i.dns_waker.register(cx.waker()); |
| 490 | Poll::Pending | 524 | Poll::Pending |
| @@ -673,6 +707,25 @@ impl<D: Driver> Inner<D> { | |||
| 673 | socket.set_max_lease_duration(c.max_lease_duration.map(crate::time::duration_to_smoltcp)); | 707 | socket.set_max_lease_duration(c.max_lease_duration.map(crate::time::duration_to_smoltcp)); |
| 674 | socket.set_ports(c.server_port, c.client_port); | 708 | socket.set_ports(c.server_port, c.client_port); |
| 675 | socket.set_retry_config(c.retry_config); | 709 | socket.set_retry_config(c.retry_config); |
| 710 | |||
| 711 | socket.set_outgoing_options(&[]); | ||
| 712 | #[cfg(feature = "dhcpv4-hostname")] | ||
| 713 | if let Some(h) = c.hostname { | ||
| 714 | // safety: we just did set_outgoing_options([]) so we know the socket is no longer holding a reference. | ||
| 715 | let hostname = unsafe { &mut *self.hostname.get() }; | ||
| 716 | |||
| 717 | // create data | ||
| 718 | // safety: we know the buffer lives forever, new borrows the StackResources for 'static. | ||
| 719 | // also we won't modify it until next call to this function. | ||
| 720 | hostname.data[..h.len()].copy_from_slice(h.as_bytes()); | ||
| 721 | let data: &[u8] = &hostname.data[..h.len()]; | ||
| 722 | let data: &'static [u8] = unsafe { core::mem::transmute(data) }; | ||
| 723 | |||
| 724 | // set the option. | ||
| 725 | hostname.option = smoltcp::wire::DhcpOption { data, kind: 12 }; | ||
| 726 | socket.set_outgoing_options(core::slice::from_ref(&hostname.option)); | ||
| 727 | } | ||
| 728 | |||
| 676 | socket.reset(); | 729 | socket.reset(); |
| 677 | } | 730 | } |
| 678 | _ => { | 731 | _ => { |
| @@ -765,18 +818,28 @@ impl<D: Driver> Inner<D> { | |||
| 765 | fn poll(&mut self, cx: &mut Context<'_>, s: &mut SocketStack) { | 818 | fn poll(&mut self, cx: &mut Context<'_>, s: &mut SocketStack) { |
| 766 | s.waker.register(cx.waker()); | 819 | s.waker.register(cx.waker()); |
| 767 | 820 | ||
| 821 | let (_hardware_addr, medium) = to_smoltcp_hardware_address(self.device.hardware_address()); | ||
| 822 | |||
| 768 | #[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154"))] | 823 | #[cfg(any(feature = "medium-ethernet", feature = "medium-ieee802154"))] |
| 769 | if self.device.capabilities().medium == embassy_net_driver::Medium::Ethernet | ||
| 770 | || self.device.capabilities().medium == embassy_net_driver::Medium::Ieee802154 | ||
| 771 | { | 824 | { |
| 772 | s.iface | 825 | let do_set = match medium { |
| 773 | .set_hardware_addr(to_smoltcp_hardware_address(self.device.hardware_address())); | 826 | #[cfg(feature = "medium-ethernet")] |
| 827 | Medium::Ethernet => true, | ||
| 828 | #[cfg(feature = "medium-ieee802154")] | ||
| 829 | Medium::Ieee802154 => true, | ||
| 830 | #[allow(unreachable_patterns)] | ||
| 831 | _ => false, | ||
| 832 | }; | ||
| 833 | if do_set { | ||
| 834 | s.iface.set_hardware_addr(_hardware_addr); | ||
| 835 | } | ||
| 774 | } | 836 | } |
| 775 | 837 | ||
| 776 | let timestamp = instant_to_smoltcp(Instant::now()); | 838 | let timestamp = instant_to_smoltcp(Instant::now()); |
| 777 | let mut smoldev = DriverAdapter { | 839 | let mut smoldev = DriverAdapter { |
| 778 | cx: Some(cx), | 840 | cx: Some(cx), |
| 779 | inner: &mut self.device, | 841 | inner: &mut self.device, |
| 842 | medium, | ||
| 780 | }; | 843 | }; |
| 781 | s.iface.poll(timestamp, &mut smoldev, &mut s.sockets); | 844 | s.iface.poll(timestamp, &mut smoldev, &mut s.sockets); |
| 782 | 845 | ||
diff --git a/embassy-net/src/tcp.rs b/embassy-net/src/tcp.rs index a12fd382a..b5615cb66 100644 --- a/embassy-net/src/tcp.rs +++ b/embassy-net/src/tcp.rs | |||
| @@ -579,11 +579,10 @@ mod embedded_io_impls { | |||
| 579 | /// TCP client compatible with `embedded-nal-async` traits. | 579 | /// TCP client compatible with `embedded-nal-async` traits. |
| 580 | #[cfg(feature = "nightly")] | 580 | #[cfg(feature = "nightly")] |
| 581 | pub mod client { | 581 | pub mod client { |
| 582 | use core::cell::UnsafeCell; | 582 | use core::cell::{Cell, UnsafeCell}; |
| 583 | use core::mem::MaybeUninit; | 583 | use core::mem::MaybeUninit; |
| 584 | use core::ptr::NonNull; | 584 | use core::ptr::NonNull; |
| 585 | 585 | ||
| 586 | use atomic_polyfill::{AtomicBool, Ordering}; | ||
| 587 | use embedded_nal_async::IpAddr; | 586 | use embedded_nal_async::IpAddr; |
| 588 | 587 | ||
| 589 | use super::*; | 588 | use super::*; |
| @@ -702,15 +701,13 @@ pub mod client { | |||
| 702 | } | 701 | } |
| 703 | } | 702 | } |
| 704 | 703 | ||
| 705 | unsafe impl<const N: usize, const TX_SZ: usize, const RX_SZ: usize> Sync for TcpClientState<N, TX_SZ, RX_SZ> {} | ||
| 706 | |||
| 707 | struct Pool<T, const N: usize> { | 704 | struct Pool<T, const N: usize> { |
| 708 | used: [AtomicBool; N], | 705 | used: [Cell<bool>; N], |
| 709 | data: [UnsafeCell<MaybeUninit<T>>; N], | 706 | data: [UnsafeCell<MaybeUninit<T>>; N], |
| 710 | } | 707 | } |
| 711 | 708 | ||
| 712 | impl<T, const N: usize> Pool<T, N> { | 709 | impl<T, const N: usize> Pool<T, N> { |
| 713 | const VALUE: AtomicBool = AtomicBool::new(false); | 710 | const VALUE: Cell<bool> = Cell::new(false); |
| 714 | const UNINIT: UnsafeCell<MaybeUninit<T>> = UnsafeCell::new(MaybeUninit::uninit()); | 711 | const UNINIT: UnsafeCell<MaybeUninit<T>> = UnsafeCell::new(MaybeUninit::uninit()); |
| 715 | 712 | ||
| 716 | const fn new() -> Self { | 713 | const fn new() -> Self { |
| @@ -724,7 +721,9 @@ pub mod client { | |||
| 724 | impl<T, const N: usize> Pool<T, N> { | 721 | impl<T, const N: usize> Pool<T, N> { |
| 725 | fn alloc(&self) -> Option<NonNull<T>> { | 722 | fn alloc(&self) -> Option<NonNull<T>> { |
| 726 | for n in 0..N { | 723 | for n in 0..N { |
| 727 | if self.used[n].swap(true, Ordering::SeqCst) == false { | 724 | // this can't race because Pool is not Sync. |
| 725 | if !self.used[n].get() { | ||
| 726 | self.used[n].set(true); | ||
| 728 | let p = self.data[n].get() as *mut T; | 727 | let p = self.data[n].get() as *mut T; |
| 729 | return Some(unsafe { NonNull::new_unchecked(p) }); | 728 | return Some(unsafe { NonNull::new_unchecked(p) }); |
| 730 | } | 729 | } |
| @@ -738,7 +737,7 @@ pub mod client { | |||
| 738 | let n = p.as_ptr().offset_from(origin); | 737 | let n = p.as_ptr().offset_from(origin); |
| 739 | assert!(n >= 0); | 738 | assert!(n >= 0); |
| 740 | assert!((n as usize) < N); | 739 | assert!((n as usize) < N); |
| 741 | self.used[n as usize].store(false, Ordering::SeqCst); | 740 | self.used[n as usize].set(false); |
| 742 | } | 741 | } |
| 743 | } | 742 | } |
| 744 | } | 743 | } |
diff --git a/embassy-nrf/Cargo.toml b/embassy-nrf/Cargo.toml index 3c706b473..360f77c19 100644 --- a/embassy-nrf/Cargo.toml +++ b/embassy-nrf/Cargo.toml | |||
| @@ -94,7 +94,7 @@ _gpio-p1 = [] | |||
| 94 | _nrf52832_anomaly_109 = [] | 94 | _nrf52832_anomaly_109 = [] |
| 95 | 95 | ||
| 96 | [dependencies] | 96 | [dependencies] |
| 97 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true } | 97 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true } |
| 98 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 98 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 99 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-3"] } | 99 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-3"] } |
| 100 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } | 100 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } |
| @@ -103,8 +103,8 @@ embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optiona | |||
| 103 | embedded-hal-02 = { package = "embedded-hal", version = "0.2.6", features = ["unproven"] } | 103 | embedded-hal-02 = { package = "embedded-hal", version = "0.2.6", features = ["unproven"] } |
| 104 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1", optional = true} | 104 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1", optional = true} |
| 105 | embedded-hal-async = { version = "=1.0.0-rc.1", optional = true} | 105 | embedded-hal-async = { version = "=1.0.0-rc.1", optional = true} |
| 106 | embedded-io = { version = "0.5.0" } | 106 | embedded-io = { version = "0.6.0" } |
| 107 | embedded-io-async = { version = "0.5.0", optional = true } | 107 | embedded-io-async = { version = "0.6.0", optional = true } |
| 108 | 108 | ||
| 109 | defmt = { version = "0.3", optional = true } | 109 | defmt = { version = "0.3", optional = true } |
| 110 | log = { version = "0.4.14", optional = true } | 110 | log = { version = "0.4.14", optional = true } |
diff --git a/embassy-nrf/src/chips/nrf5340_app.rs b/embassy-nrf/src/chips/nrf5340_app.rs index afc2c4a7e..5e9a8ed05 100644 --- a/embassy-nrf/src/chips/nrf5340_app.rs +++ b/embassy-nrf/src/chips/nrf5340_app.rs | |||
| @@ -6,10 +6,13 @@ pub mod pac { | |||
| 6 | // To avoid cfg spam, we remove _ns or _s suffixes here. | 6 | // To avoid cfg spam, we remove _ns or _s suffixes here. |
| 7 | 7 | ||
| 8 | pub use nrf5340_app_pac::NVIC_PRIO_BITS; | 8 | pub use nrf5340_app_pac::NVIC_PRIO_BITS; |
| 9 | 9 | ||
| 10 | #[cfg(feature="rt")] | ||
| 11 | #[doc(no_inline)] | ||
| 12 | pub use nrf5340_app_pac::interrupt; | ||
| 13 | |||
| 10 | #[doc(no_inline)] | 14 | #[doc(no_inline)] |
| 11 | pub use nrf5340_app_pac::{ | 15 | pub use nrf5340_app_pac::{ |
| 12 | interrupt, | ||
| 13 | Interrupt, | 16 | Interrupt, |
| 14 | Peripherals, | 17 | Peripherals, |
| 15 | 18 | ||
| @@ -60,156 +63,167 @@ pub mod pac { | |||
| 60 | wdt0_ns as wdt0, | 63 | wdt0_ns as wdt0, |
| 61 | }; | 64 | }; |
| 62 | 65 | ||
| 63 | #[cfg(feature = "nrf5340-app-ns")] | 66 | /// Non-Secure mode (NS) peripherals |
| 64 | #[doc(no_inline)] | 67 | pub mod ns { |
| 65 | pub use nrf5340_app_pac::{ | 68 | #[cfg(feature = "nrf5340-app-ns")] |
| 66 | CLOCK_NS as CLOCK, | 69 | #[doc(no_inline)] |
| 67 | COMP_NS as COMP, | 70 | pub use nrf5340_app_pac::{ |
| 68 | CTRLAP_NS as CTRLAP, | 71 | CLOCK_NS as CLOCK, |
| 69 | DCNF_NS as DCNF, | 72 | COMP_NS as COMP, |
| 70 | DPPIC_NS as DPPIC, | 73 | CTRLAP_NS as CTRLAP, |
| 71 | EGU0_NS as EGU0, | 74 | DCNF_NS as DCNF, |
| 72 | EGU1_NS as EGU1, | 75 | DPPIC_NS as DPPIC, |
| 73 | EGU2_NS as EGU2, | 76 | EGU0_NS as EGU0, |
| 74 | EGU3_NS as EGU3, | 77 | EGU1_NS as EGU1, |
| 75 | EGU4_NS as EGU4, | 78 | EGU2_NS as EGU2, |
| 76 | EGU5_NS as EGU5, | 79 | EGU3_NS as EGU3, |
| 77 | FPU_NS as FPU, | 80 | EGU4_NS as EGU4, |
| 78 | GPIOTE1_NS as GPIOTE1, | 81 | EGU5_NS as EGU5, |
| 79 | I2S0_NS as I2S0, | 82 | FPU_NS as FPU, |
| 80 | IPC_NS as IPC, | 83 | GPIOTE1_NS as GPIOTE1, |
| 81 | KMU_NS as KMU, | 84 | I2S0_NS as I2S0, |
| 82 | LPCOMP_NS as LPCOMP, | 85 | IPC_NS as IPC, |
| 83 | MUTEX_NS as MUTEX, | 86 | KMU_NS as KMU, |
| 84 | NFCT_NS as NFCT, | 87 | LPCOMP_NS as LPCOMP, |
| 85 | NVMC_NS as NVMC, | 88 | MUTEX_NS as MUTEX, |
| 86 | OSCILLATORS_NS as OSCILLATORS, | 89 | NFCT_NS as NFCT, |
| 87 | P0_NS as P0, | 90 | NVMC_NS as NVMC, |
| 88 | P1_NS as P1, | 91 | OSCILLATORS_NS as OSCILLATORS, |
| 89 | PDM0_NS as PDM0, | 92 | P0_NS as P0, |
| 90 | POWER_NS as POWER, | 93 | P1_NS as P1, |
| 91 | PWM0_NS as PWM0, | 94 | PDM0_NS as PDM0, |
| 92 | PWM1_NS as PWM1, | 95 | POWER_NS as POWER, |
| 93 | PWM2_NS as PWM2, | 96 | PWM0_NS as PWM0, |
| 94 | PWM3_NS as PWM3, | 97 | PWM1_NS as PWM1, |
| 95 | QDEC0_NS as QDEC0, | 98 | PWM2_NS as PWM2, |
| 96 | QDEC1_NS as QDEC1, | 99 | PWM3_NS as PWM3, |
| 97 | QSPI_NS as QSPI, | 100 | QDEC0_NS as QDEC0, |
| 98 | REGULATORS_NS as REGULATORS, | 101 | QDEC1_NS as QDEC1, |
| 99 | RESET_NS as RESET, | 102 | QSPI_NS as QSPI, |
| 100 | RTC0_NS as RTC0, | 103 | REGULATORS_NS as REGULATORS, |
| 101 | RTC1_NS as RTC1, | 104 | RESET_NS as RESET, |
| 102 | SAADC_NS as SAADC, | 105 | RTC0_NS as RTC0, |
| 103 | SPIM0_NS as SPIM0, | 106 | RTC1_NS as RTC1, |
| 104 | SPIM1_NS as SPIM1, | 107 | SAADC_NS as SAADC, |
| 105 | SPIM2_NS as SPIM2, | 108 | SPIM0_NS as SPIM0, |
| 106 | SPIM3_NS as SPIM3, | 109 | SPIM1_NS as SPIM1, |
| 107 | SPIM4_NS as SPIM4, | 110 | SPIM2_NS as SPIM2, |
| 108 | SPIS0_NS as SPIS0, | 111 | SPIM3_NS as SPIM3, |
| 109 | SPIS1_NS as SPIS1, | 112 | SPIM4_NS as SPIM4, |
| 110 | SPIS2_NS as SPIS2, | 113 | SPIS0_NS as SPIS0, |
| 111 | SPIS3_NS as SPIS3, | 114 | SPIS1_NS as SPIS1, |
| 112 | TIMER0_NS as TIMER0, | 115 | SPIS2_NS as SPIS2, |
| 113 | TIMER1_NS as TIMER1, | 116 | SPIS3_NS as SPIS3, |
| 114 | TIMER2_NS as TIMER2, | 117 | TIMER0_NS as TIMER0, |
| 115 | TWIM0_NS as TWIM0, | 118 | TIMER1_NS as TIMER1, |
| 116 | TWIM1_NS as TWIM1, | 119 | TIMER2_NS as TIMER2, |
| 117 | TWIM2_NS as TWIM2, | 120 | TWIM0_NS as TWIM0, |
| 118 | TWIM3_NS as TWIM3, | 121 | TWIM1_NS as TWIM1, |
| 119 | TWIS0_NS as TWIS0, | 122 | TWIM2_NS as TWIM2, |
| 120 | TWIS1_NS as TWIS1, | 123 | TWIM3_NS as TWIM3, |
| 121 | TWIS2_NS as TWIS2, | 124 | TWIS0_NS as TWIS0, |
| 122 | TWIS3_NS as TWIS3, | 125 | TWIS1_NS as TWIS1, |
| 123 | UARTE0_NS as UARTE0, | 126 | TWIS2_NS as TWIS2, |
| 124 | UARTE1_NS as UARTE1, | 127 | TWIS3_NS as TWIS3, |
| 125 | UARTE2_NS as UARTE2, | 128 | UARTE0_NS as UARTE0, |
| 126 | UARTE3_NS as UARTE3, | 129 | UARTE1_NS as UARTE1, |
| 127 | USBD_NS as USBD, | 130 | UARTE2_NS as UARTE2, |
| 128 | USBREGULATOR_NS as USBREGULATOR, | 131 | UARTE3_NS as UARTE3, |
| 129 | VMC_NS as VMC, | 132 | USBD_NS as USBD, |
| 130 | WDT0_NS as WDT0, | 133 | USBREGULATOR_NS as USBREGULATOR, |
| 131 | WDT1_NS as WDT1, | 134 | VMC_NS as VMC, |
| 132 | }; | 135 | WDT0_NS as WDT0, |
| 133 | 136 | WDT1_NS as WDT1, | |
| 134 | #[cfg(feature = "nrf5340-app-s")] | 137 | }; |
| 135 | #[doc(no_inline)] | 138 | } |
| 136 | pub use nrf5340_app_pac::{ | 139 | |
| 137 | CACHEDATA_S as CACHEDATA, | 140 | /// Secure mode (S) peripherals |
| 138 | CACHEINFO_S as CACHEINFO, | 141 | pub mod s { |
| 139 | CACHE_S as CACHE, | 142 | #[cfg(feature = "nrf5340-app-s")] |
| 140 | CLOCK_S as CLOCK, | 143 | #[doc(no_inline)] |
| 141 | COMP_S as COMP, | 144 | pub use nrf5340_app_pac::{ |
| 142 | CRYPTOCELL_S as CRYPTOCELL, | 145 | CACHEDATA_S as CACHEDATA, |
| 143 | CTI_S as CTI, | 146 | CACHEINFO_S as CACHEINFO, |
| 144 | CTRLAP_S as CTRLAP, | 147 | CACHE_S as CACHE, |
| 145 | DCNF_S as DCNF, | 148 | CLOCK_S as CLOCK, |
| 146 | DPPIC_S as DPPIC, | 149 | COMP_S as COMP, |
| 147 | EGU0_S as EGU0, | 150 | CRYPTOCELL_S as CRYPTOCELL, |
| 148 | EGU1_S as EGU1, | 151 | CTI_S as CTI, |
| 149 | EGU2_S as EGU2, | 152 | CTRLAP_S as CTRLAP, |
| 150 | EGU3_S as EGU3, | 153 | DCNF_S as DCNF, |
| 151 | EGU4_S as EGU4, | 154 | DPPIC_S as DPPIC, |
| 152 | EGU5_S as EGU5, | 155 | EGU0_S as EGU0, |
| 153 | FICR_S as FICR, | 156 | EGU1_S as EGU1, |
| 154 | FPU_S as FPU, | 157 | EGU2_S as EGU2, |
| 155 | GPIOTE0_S as GPIOTE0, | 158 | EGU3_S as EGU3, |
| 156 | I2S0_S as I2S0, | 159 | EGU4_S as EGU4, |
| 157 | IPC_S as IPC, | 160 | EGU5_S as EGU5, |
| 158 | KMU_S as KMU, | 161 | FICR_S as FICR, |
| 159 | LPCOMP_S as LPCOMP, | 162 | FPU_S as FPU, |
| 160 | MUTEX_S as MUTEX, | 163 | GPIOTE0_S as GPIOTE0, |
| 161 | NFCT_S as NFCT, | 164 | I2S0_S as I2S0, |
| 162 | NVMC_S as NVMC, | 165 | IPC_S as IPC, |
| 163 | OSCILLATORS_S as OSCILLATORS, | 166 | KMU_S as KMU, |
| 164 | P0_S as P0, | 167 | LPCOMP_S as LPCOMP, |
| 165 | P1_S as P1, | 168 | MUTEX_S as MUTEX, |
| 166 | PDM0_S as PDM0, | 169 | NFCT_S as NFCT, |
| 167 | POWER_S as POWER, | 170 | NVMC_S as NVMC, |
| 168 | PWM0_S as PWM0, | 171 | OSCILLATORS_S as OSCILLATORS, |
| 169 | PWM1_S as PWM1, | 172 | P0_S as P0, |
| 170 | PWM2_S as PWM2, | 173 | P1_S as P1, |
| 171 | PWM3_S as PWM3, | 174 | PDM0_S as PDM0, |
| 172 | QDEC0_S as QDEC0, | 175 | POWER_S as POWER, |
| 173 | QDEC1_S as QDEC1, | 176 | PWM0_S as PWM0, |
| 174 | QSPI_S as QSPI, | 177 | PWM1_S as PWM1, |
| 175 | REGULATORS_S as REGULATORS, | 178 | PWM2_S as PWM2, |
| 176 | RESET_S as RESET, | 179 | PWM3_S as PWM3, |
| 177 | RTC0_S as RTC0, | 180 | QDEC0_S as QDEC0, |
| 178 | RTC1_S as RTC1, | 181 | QDEC1_S as QDEC1, |
| 179 | SAADC_S as SAADC, | 182 | QSPI_S as QSPI, |
| 180 | SPIM0_S as SPIM0, | 183 | REGULATORS_S as REGULATORS, |
| 181 | SPIM1_S as SPIM1, | 184 | RESET_S as RESET, |
| 182 | SPIM2_S as SPIM2, | 185 | RTC0_S as RTC0, |
| 183 | SPIM3_S as SPIM3, | 186 | RTC1_S as RTC1, |
| 184 | SPIM4_S as SPIM4, | 187 | SAADC_S as SAADC, |
| 185 | SPIS0_S as SPIS0, | 188 | SPIM0_S as SPIM0, |
| 186 | SPIS1_S as SPIS1, | 189 | SPIM1_S as SPIM1, |
| 187 | SPIS2_S as SPIS2, | 190 | SPIM2_S as SPIM2, |
| 188 | SPIS3_S as SPIS3, | 191 | SPIM3_S as SPIM3, |
| 189 | SPU_S as SPU, | 192 | SPIM4_S as SPIM4, |
| 190 | TAD_S as TAD, | 193 | SPIS0_S as SPIS0, |
| 191 | TIMER0_S as TIMER0, | 194 | SPIS1_S as SPIS1, |
| 192 | TIMER1_S as TIMER1, | 195 | SPIS2_S as SPIS2, |
| 193 | TIMER2_S as TIMER2, | 196 | SPIS3_S as SPIS3, |
| 194 | TWIM0_S as TWIM0, | 197 | SPU_S as SPU, |
| 195 | TWIM1_S as TWIM1, | 198 | TAD_S as TAD, |
| 196 | TWIM2_S as TWIM2, | 199 | TIMER0_S as TIMER0, |
| 197 | TWIM3_S as TWIM3, | 200 | TIMER1_S as TIMER1, |
| 198 | TWIS0_S as TWIS0, | 201 | TIMER2_S as TIMER2, |
| 199 | TWIS1_S as TWIS1, | 202 | TWIM0_S as TWIM0, |
| 200 | TWIS2_S as TWIS2, | 203 | TWIM1_S as TWIM1, |
| 201 | TWIS3_S as TWIS3, | 204 | TWIM2_S as TWIM2, |
| 202 | UARTE0_S as UARTE0, | 205 | TWIM3_S as TWIM3, |
| 203 | UARTE1_S as UARTE1, | 206 | TWIS0_S as TWIS0, |
| 204 | UARTE2_S as UARTE2, | 207 | TWIS1_S as TWIS1, |
| 205 | UARTE3_S as UARTE3, | 208 | TWIS2_S as TWIS2, |
| 206 | UICR_S as UICR, | 209 | TWIS3_S as TWIS3, |
| 207 | USBD_S as USBD, | 210 | UARTE0_S as UARTE0, |
| 208 | USBREGULATOR_S as USBREGULATOR, | 211 | UARTE1_S as UARTE1, |
| 209 | VMC_S as VMC, | 212 | UARTE2_S as UARTE2, |
| 210 | WDT0_S as WDT0, | 213 | UARTE3_S as UARTE3, |
| 211 | WDT1_S as WDT1, | 214 | UICR_S as UICR, |
| 212 | }; | 215 | USBD_S as USBD, |
| 216 | USBREGULATOR_S as USBREGULATOR, | ||
| 217 | VMC_S as VMC, | ||
| 218 | WDT0_S as WDT0, | ||
| 219 | WDT1_S as WDT1, | ||
| 220 | }; | ||
| 221 | } | ||
| 222 | |||
| 223 | #[cfg(feature = "_ns")] | ||
| 224 | pub use ns::*; | ||
| 225 | #[cfg(feature = "_s")] | ||
| 226 | pub use s::*; | ||
| 213 | } | 227 | } |
| 214 | 228 | ||
| 215 | /// The maximum buffer size that the EasyDMA can send/recv in one operation. | 229 | /// The maximum buffer size that the EasyDMA can send/recv in one operation. |
diff --git a/embassy-nrf/src/chips/nrf5340_net.rs b/embassy-nrf/src/chips/nrf5340_net.rs index dee666a61..a7cf82872 100644 --- a/embassy-nrf/src/chips/nrf5340_net.rs +++ b/embassy-nrf/src/chips/nrf5340_net.rs | |||
| @@ -7,9 +7,12 @@ pub mod pac { | |||
| 7 | 7 | ||
| 8 | pub use nrf5340_net_pac::NVIC_PRIO_BITS; | 8 | pub use nrf5340_net_pac::NVIC_PRIO_BITS; |
| 9 | 9 | ||
| 10 | #[cfg(feature="rt")] | ||
| 11 | #[doc(no_inline)] | ||
| 12 | pub use nrf5340_net_pac::interrupt; | ||
| 13 | |||
| 10 | #[doc(no_inline)] | 14 | #[doc(no_inline)] |
| 11 | pub use nrf5340_net_pac::{ | 15 | pub use nrf5340_net_pac::{ |
| 12 | interrupt, | ||
| 13 | Interrupt, | 16 | Interrupt, |
| 14 | Peripherals, | 17 | Peripherals, |
| 15 | 18 | ||
diff --git a/embassy-nrf/src/chips/nrf9160.rs b/embassy-nrf/src/chips/nrf9160.rs index 495285ba3..8b1356ef8 100644 --- a/embassy-nrf/src/chips/nrf9160.rs +++ b/embassy-nrf/src/chips/nrf9160.rs | |||
| @@ -7,9 +7,12 @@ pub mod pac { | |||
| 7 | 7 | ||
| 8 | pub use nrf9160_pac::NVIC_PRIO_BITS; | 8 | pub use nrf9160_pac::NVIC_PRIO_BITS; |
| 9 | 9 | ||
| 10 | #[cfg(feature="rt")] | ||
| 11 | #[doc(no_inline)] | ||
| 12 | pub use nrf9160_pac::interrupt; | ||
| 13 | |||
| 10 | #[doc(no_inline)] | 14 | #[doc(no_inline)] |
| 11 | pub use nrf9160_pac::{ | 15 | pub use nrf9160_pac::{ |
| 12 | interrupt, | ||
| 13 | Interrupt, | 16 | Interrupt, |
| 14 | 17 | ||
| 15 | cc_host_rgf_s as cc_host_rgf, | 18 | cc_host_rgf_s as cc_host_rgf, |
| @@ -45,122 +48,131 @@ pub mod pac { | |||
| 45 | wdt_ns as wdt, | 48 | wdt_ns as wdt, |
| 46 | }; | 49 | }; |
| 47 | 50 | ||
| 48 | #[cfg(feature = "nrf9160-ns")] | 51 | /// Non-Secure mode (NS) peripherals |
| 49 | #[doc(no_inline)] | 52 | pub mod ns { |
| 50 | pub use nrf9160_pac::{ | 53 | #[doc(no_inline)] |
| 51 | CLOCK_NS as CLOCK, | 54 | pub use nrf9160_pac::{ |
| 52 | DPPIC_NS as DPPIC, | 55 | CLOCK_NS as CLOCK, |
| 53 | EGU0_NS as EGU0, | 56 | DPPIC_NS as DPPIC, |
| 54 | EGU1_NS as EGU1, | 57 | EGU0_NS as EGU0, |
| 55 | EGU2_NS as EGU2, | 58 | EGU1_NS as EGU1, |
| 56 | EGU3_NS as EGU3, | 59 | EGU2_NS as EGU2, |
| 57 | EGU4_NS as EGU4, | 60 | EGU3_NS as EGU3, |
| 58 | EGU5_NS as EGU5, | 61 | EGU4_NS as EGU4, |
| 59 | FPU_NS as FPU, | 62 | EGU5_NS as EGU5, |
| 60 | GPIOTE1_NS as GPIOTE1, | 63 | FPU_NS as FPU, |
| 61 | I2S_NS as I2S, | 64 | GPIOTE1_NS as GPIOTE1, |
| 62 | IPC_NS as IPC, | 65 | I2S_NS as I2S, |
| 63 | KMU_NS as KMU, | 66 | IPC_NS as IPC, |
| 64 | NVMC_NS as NVMC, | 67 | KMU_NS as KMU, |
| 65 | P0_NS as P0, | 68 | NVMC_NS as NVMC, |
| 66 | PDM_NS as PDM, | 69 | P0_NS as P0, |
| 67 | POWER_NS as POWER, | 70 | PDM_NS as PDM, |
| 68 | PWM0_NS as PWM0, | 71 | POWER_NS as POWER, |
| 69 | PWM1_NS as PWM1, | 72 | PWM0_NS as PWM0, |
| 70 | PWM2_NS as PWM2, | 73 | PWM1_NS as PWM1, |
| 71 | PWM3_NS as PWM3, | 74 | PWM2_NS as PWM2, |
| 72 | REGULATORS_NS as REGULATORS, | 75 | PWM3_NS as PWM3, |
| 73 | RTC0_NS as RTC0, | 76 | REGULATORS_NS as REGULATORS, |
| 74 | RTC1_NS as RTC1, | 77 | RTC0_NS as RTC0, |
| 75 | SAADC_NS as SAADC, | 78 | RTC1_NS as RTC1, |
| 76 | SPIM0_NS as SPIM0, | 79 | SAADC_NS as SAADC, |
| 77 | SPIM1_NS as SPIM1, | 80 | SPIM0_NS as SPIM0, |
| 78 | SPIM2_NS as SPIM2, | 81 | SPIM1_NS as SPIM1, |
| 79 | SPIM3_NS as SPIM3, | 82 | SPIM2_NS as SPIM2, |
| 80 | SPIS0_NS as SPIS0, | 83 | SPIM3_NS as SPIM3, |
| 81 | SPIS1_NS as SPIS1, | 84 | SPIS0_NS as SPIS0, |
| 82 | SPIS2_NS as SPIS2, | 85 | SPIS1_NS as SPIS1, |
| 83 | SPIS3_NS as SPIS3, | 86 | SPIS2_NS as SPIS2, |
| 84 | TIMER0_NS as TIMER0, | 87 | SPIS3_NS as SPIS3, |
| 85 | TIMER1_NS as TIMER1, | 88 | TIMER0_NS as TIMER0, |
| 86 | TIMER2_NS as TIMER2, | 89 | TIMER1_NS as TIMER1, |
| 87 | TWIM0_NS as TWIM0, | 90 | TIMER2_NS as TIMER2, |
| 88 | TWIM1_NS as TWIM1, | 91 | TWIM0_NS as TWIM0, |
| 89 | TWIM2_NS as TWIM2, | 92 | TWIM1_NS as TWIM1, |
| 90 | TWIM3_NS as TWIM3, | 93 | TWIM2_NS as TWIM2, |
| 91 | TWIS0_NS as TWIS0, | 94 | TWIM3_NS as TWIM3, |
| 92 | TWIS1_NS as TWIS1, | 95 | TWIS0_NS as TWIS0, |
| 93 | TWIS2_NS as TWIS2, | 96 | TWIS1_NS as TWIS1, |
| 94 | TWIS3_NS as TWIS3, | 97 | TWIS2_NS as TWIS2, |
| 95 | UARTE0_NS as UARTE0, | 98 | TWIS3_NS as TWIS3, |
| 96 | UARTE1_NS as UARTE1, | 99 | UARTE0_NS as UARTE0, |
| 97 | UARTE2_NS as UARTE2, | 100 | UARTE1_NS as UARTE1, |
| 98 | UARTE3_NS as UARTE3, | 101 | UARTE2_NS as UARTE2, |
| 99 | VMC_NS as VMC, | 102 | UARTE3_NS as UARTE3, |
| 100 | WDT_NS as WDT, | 103 | VMC_NS as VMC, |
| 101 | }; | 104 | WDT_NS as WDT, |
| 105 | }; | ||
| 106 | } | ||
| 102 | 107 | ||
| 103 | #[cfg(feature = "nrf9160-s")] | 108 | /// Secure mode (S) peripherals |
| 104 | #[doc(no_inline)] | 109 | pub mod s { |
| 105 | pub use nrf9160_pac::{ | 110 | #[doc(no_inline)] |
| 106 | CC_HOST_RGF_S as CC_HOST_RGF, | 111 | pub use nrf9160_pac::{ |
| 107 | CLOCK_S as CLOCK, | 112 | CC_HOST_RGF_S as CC_HOST_RGF, |
| 108 | CRYPTOCELL_S as CRYPTOCELL, | 113 | CLOCK_S as CLOCK, |
| 109 | CTRL_AP_PERI_S as CTRL_AP_PERI, | 114 | CRYPTOCELL_S as CRYPTOCELL, |
| 110 | DPPIC_S as DPPIC, | 115 | CTRL_AP_PERI_S as CTRL_AP_PERI, |
| 111 | EGU0_S as EGU0, | 116 | DPPIC_S as DPPIC, |
| 112 | EGU1_S as EGU1, | 117 | EGU0_S as EGU0, |
| 113 | EGU2_S as EGU2, | 118 | EGU1_S as EGU1, |
| 114 | EGU3_S as EGU3, | 119 | EGU2_S as EGU2, |
| 115 | EGU4_S as EGU4, | 120 | EGU3_S as EGU3, |
| 116 | EGU5_S as EGU5, | 121 | EGU4_S as EGU4, |
| 117 | FICR_S as FICR, | 122 | EGU5_S as EGU5, |
| 118 | FPU_S as FPU, | 123 | FICR_S as FICR, |
| 119 | GPIOTE0_S as GPIOTE0, | 124 | FPU_S as FPU, |
| 120 | I2S_S as I2S, | 125 | GPIOTE0_S as GPIOTE0, |
| 121 | IPC_S as IPC, | 126 | I2S_S as I2S, |
| 122 | KMU_S as KMU, | 127 | IPC_S as IPC, |
| 123 | NVMC_S as NVMC, | 128 | KMU_S as KMU, |
| 124 | P0_S as P0, | 129 | NVMC_S as NVMC, |
| 125 | PDM_S as PDM, | 130 | P0_S as P0, |
| 126 | POWER_S as POWER, | 131 | PDM_S as PDM, |
| 127 | PWM0_S as PWM0, | 132 | POWER_S as POWER, |
| 128 | PWM1_S as PWM1, | 133 | PWM0_S as PWM0, |
| 129 | PWM2_S as PWM2, | 134 | PWM1_S as PWM1, |
| 130 | PWM3_S as PWM3, | 135 | PWM2_S as PWM2, |
| 131 | REGULATORS_S as REGULATORS, | 136 | PWM3_S as PWM3, |
| 132 | RTC0_S as RTC0, | 137 | REGULATORS_S as REGULATORS, |
| 133 | RTC1_S as RTC1, | 138 | RTC0_S as RTC0, |
| 134 | SAADC_S as SAADC, | 139 | RTC1_S as RTC1, |
| 135 | SPIM0_S as SPIM0, | 140 | SAADC_S as SAADC, |
| 136 | SPIM1_S as SPIM1, | 141 | SPIM0_S as SPIM0, |
| 137 | SPIM2_S as SPIM2, | 142 | SPIM1_S as SPIM1, |
| 138 | SPIM3_S as SPIM3, | 143 | SPIM2_S as SPIM2, |
| 139 | SPIS0_S as SPIS0, | 144 | SPIM3_S as SPIM3, |
| 140 | SPIS1_S as SPIS1, | 145 | SPIS0_S as SPIS0, |
| 141 | SPIS2_S as SPIS2, | 146 | SPIS1_S as SPIS1, |
| 142 | SPIS3_S as SPIS3, | 147 | SPIS2_S as SPIS2, |
| 143 | SPU_S as SPU, | 148 | SPIS3_S as SPIS3, |
| 144 | TAD_S as TAD, | 149 | SPU_S as SPU, |
| 145 | TIMER0_S as TIMER0, | 150 | TAD_S as TAD, |
| 146 | TIMER1_S as TIMER1, | 151 | TIMER0_S as TIMER0, |
| 147 | TIMER2_S as TIMER2, | 152 | TIMER1_S as TIMER1, |
| 148 | TWIM0_S as TWIM0, | 153 | TIMER2_S as TIMER2, |
| 149 | TWIM1_S as TWIM1, | 154 | TWIM0_S as TWIM0, |
| 150 | TWIM2_S as TWIM2, | 155 | TWIM1_S as TWIM1, |
| 151 | TWIM3_S as TWIM3, | 156 | TWIM2_S as TWIM2, |
| 152 | TWIS0_S as TWIS0, | 157 | TWIM3_S as TWIM3, |
| 153 | TWIS1_S as TWIS1, | 158 | TWIS0_S as TWIS0, |
| 154 | TWIS2_S as TWIS2, | 159 | TWIS1_S as TWIS1, |
| 155 | TWIS3_S as TWIS3, | 160 | TWIS2_S as TWIS2, |
| 156 | UARTE0_S as UARTE0, | 161 | TWIS3_S as TWIS3, |
| 157 | UARTE1_S as UARTE1, | 162 | UARTE0_S as UARTE0, |
| 158 | UARTE2_S as UARTE2, | 163 | UARTE1_S as UARTE1, |
| 159 | UARTE3_S as UARTE3, | 164 | UARTE2_S as UARTE2, |
| 160 | UICR_S as UICR, | 165 | UARTE3_S as UARTE3, |
| 161 | VMC_S as VMC, | 166 | UICR_S as UICR, |
| 162 | WDT_S as WDT, | 167 | VMC_S as VMC, |
| 163 | }; | 168 | WDT_S as WDT, |
| 169 | }; | ||
| 170 | } | ||
| 171 | |||
| 172 | #[cfg(feature = "_ns")] | ||
| 173 | pub use ns::*; | ||
| 174 | #[cfg(feature = "_s")] | ||
| 175 | pub use s::*; | ||
| 164 | } | 176 | } |
| 165 | 177 | ||
| 166 | /// The maximum buffer size that the EasyDMA can send/recv in one operation. | 178 | /// The maximum buffer size that the EasyDMA can send/recv in one operation. |
diff --git a/embassy-nrf/src/lib.rs b/embassy-nrf/src/lib.rs index 9c4b6569d..2cc83d745 100644 --- a/embassy-nrf/src/lib.rs +++ b/embassy-nrf/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![no_std] | 1 | #![no_std] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait))] |
| 3 | #![doc = include_str!("../README.md")] | 3 | #![doc = include_str!("../README.md")] |
| 4 | #![warn(missing_docs)] | 4 | #![warn(missing_docs)] |
| 5 | 5 | ||
diff --git a/embassy-nrf/src/spim.rs b/embassy-nrf/src/spim.rs index 4828af43e..caf681d99 100644 --- a/embassy-nrf/src/spim.rs +++ b/embassy-nrf/src/spim.rs | |||
| @@ -176,7 +176,7 @@ impl<'d, T: Instance> Spim<'d, T> { | |||
| 176 | let mut spim = Self { _p: spim }; | 176 | let mut spim = Self { _p: spim }; |
| 177 | 177 | ||
| 178 | // Apply runtime peripheral configuration | 178 | // Apply runtime peripheral configuration |
| 179 | Self::set_config(&mut spim, &config); | 179 | Self::set_config(&mut spim, &config).unwrap(); |
| 180 | 180 | ||
| 181 | // Disable all events interrupts | 181 | // Disable all events interrupts |
| 182 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); | 182 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); |
| @@ -566,7 +566,8 @@ mod eha { | |||
| 566 | 566 | ||
| 567 | impl<'d, T: Instance> SetConfig for Spim<'d, T> { | 567 | impl<'d, T: Instance> SetConfig for Spim<'d, T> { |
| 568 | type Config = Config; | 568 | type Config = Config; |
| 569 | fn set_config(&mut self, config: &Self::Config) { | 569 | type ConfigError = (); |
| 570 | fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> { | ||
| 570 | let r = T::regs(); | 571 | let r = T::regs(); |
| 571 | // Configure mode. | 572 | // Configure mode. |
| 572 | let mode = config.mode; | 573 | let mode = config.mode; |
| @@ -604,5 +605,7 @@ impl<'d, T: Instance> SetConfig for Spim<'d, T> { | |||
| 604 | // Set over-read character | 605 | // Set over-read character |
| 605 | let orc = config.orc; | 606 | let orc = config.orc; |
| 606 | r.orc.write(|w| unsafe { w.orc().bits(orc) }); | 607 | r.orc.write(|w| unsafe { w.orc().bits(orc) }); |
| 608 | |||
| 609 | Ok(()) | ||
| 607 | } | 610 | } |
| 608 | } | 611 | } |
diff --git a/embassy-nrf/src/spis.rs b/embassy-nrf/src/spis.rs index e695ba6b7..e202c6c27 100644 --- a/embassy-nrf/src/spis.rs +++ b/embassy-nrf/src/spis.rs | |||
| @@ -172,7 +172,7 @@ impl<'d, T: Instance> Spis<'d, T> { | |||
| 172 | let mut spis = Self { _p: spis }; | 172 | let mut spis = Self { _p: spis }; |
| 173 | 173 | ||
| 174 | // Apply runtime peripheral configuration | 174 | // Apply runtime peripheral configuration |
| 175 | Self::set_config(&mut spis, &config); | 175 | Self::set_config(&mut spis, &config).unwrap(); |
| 176 | 176 | ||
| 177 | // Disable all events interrupts. | 177 | // Disable all events interrupts. |
| 178 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); | 178 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); |
| @@ -467,7 +467,8 @@ macro_rules! impl_spis { | |||
| 467 | 467 | ||
| 468 | impl<'d, T: Instance> SetConfig for Spis<'d, T> { | 468 | impl<'d, T: Instance> SetConfig for Spis<'d, T> { |
| 469 | type Config = Config; | 469 | type Config = Config; |
| 470 | fn set_config(&mut self, config: &Self::Config) { | 470 | type ConfigError = (); |
| 471 | fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> { | ||
| 471 | let r = T::regs(); | 472 | let r = T::regs(); |
| 472 | // Configure mode. | 473 | // Configure mode. |
| 473 | let mode = config.mode; | 474 | let mode = config.mode; |
| @@ -509,5 +510,7 @@ impl<'d, T: Instance> SetConfig for Spis<'d, T> { | |||
| 509 | // Configure auto-acquire on 'transfer end' event. | 510 | // Configure auto-acquire on 'transfer end' event. |
| 510 | let auto_acquire = config.auto_acquire; | 511 | let auto_acquire = config.auto_acquire; |
| 511 | r.shorts.write(|w| w.end_acquire().bit(auto_acquire)); | 512 | r.shorts.write(|w| w.end_acquire().bit(auto_acquire)); |
| 513 | |||
| 514 | Ok(()) | ||
| 512 | } | 515 | } |
| 513 | } | 516 | } |
diff --git a/embassy-nrf/src/twim.rs b/embassy-nrf/src/twim.rs index fe38fb102..919bb4ab2 100644 --- a/embassy-nrf/src/twim.rs +++ b/embassy-nrf/src/twim.rs | |||
| @@ -170,7 +170,7 @@ impl<'d, T: Instance> Twim<'d, T> { | |||
| 170 | let mut twim = Self { _p: twim }; | 170 | let mut twim = Self { _p: twim }; |
| 171 | 171 | ||
| 172 | // Apply runtime peripheral configuration | 172 | // Apply runtime peripheral configuration |
| 173 | Self::set_config(&mut twim, &config); | 173 | Self::set_config(&mut twim, &config).unwrap(); |
| 174 | 174 | ||
| 175 | // Disable all events interrupts | 175 | // Disable all events interrupts |
| 176 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); | 176 | r.intenclr.write(|w| unsafe { w.bits(0xFFFF_FFFF) }); |
| @@ -890,9 +890,12 @@ mod eha { | |||
| 890 | 890 | ||
| 891 | impl<'d, T: Instance> SetConfig for Twim<'d, T> { | 891 | impl<'d, T: Instance> SetConfig for Twim<'d, T> { |
| 892 | type Config = Config; | 892 | type Config = Config; |
| 893 | fn set_config(&mut self, config: &Self::Config) { | 893 | type ConfigError = (); |
| 894 | fn set_config(&mut self, config: &Self::Config) -> Result<(), Self::ConfigError> { | ||
| 894 | let r = T::regs(); | 895 | let r = T::regs(); |
| 895 | r.frequency | 896 | r.frequency |
| 896 | .write(|w| unsafe { w.frequency().bits(config.frequency as u32) }); | 897 | .write(|w| unsafe { w.frequency().bits(config.frequency as u32) }); |
| 898 | |||
| 899 | Ok(()) | ||
| 897 | } | 900 | } |
| 898 | } | 901 | } |
diff --git a/embassy-rp/Cargo.toml b/embassy-rp/Cargo.toml index 1147286fc..903dc25a8 100644 --- a/embassy-rp/Cargo.toml +++ b/embassy-rp/Cargo.toml | |||
| @@ -60,7 +60,7 @@ unstable-traits = ["embedded-hal-1", "embedded-hal-nb"] | |||
| 60 | 60 | ||
| 61 | [dependencies] | 61 | [dependencies] |
| 62 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 62 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 63 | embassy-time = { version = "0.1.3", path = "../embassy-time", features = [ "tick-hz-1_000_000" ] } | 63 | embassy-time = { version = "0.1.5", path = "../embassy-time", features = [ "tick-hz-1_000_000" ] } |
| 64 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 64 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 65 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-2"] } | 65 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-2"] } |
| 66 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } | 66 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } |
| @@ -75,8 +75,8 @@ cortex-m = "0.7.6" | |||
| 75 | critical-section = "1.1" | 75 | critical-section = "1.1" |
| 76 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 76 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 77 | chrono = { version = "0.4", default-features = false, optional = true } | 77 | chrono = { version = "0.4", default-features = false, optional = true } |
| 78 | embedded-io = { version = "0.5.0" } | 78 | embedded-io = { version = "0.6.0" } |
| 79 | embedded-io-async = { version = "0.5.0", optional = true } | 79 | embedded-io-async = { version = "0.6.0", optional = true } |
| 80 | embedded-storage = { version = "0.3" } | 80 | embedded-storage = { version = "0.3" } |
| 81 | embedded-storage-async = { version = "0.4.0", optional = true } | 81 | embedded-storage-async = { version = "0.4.0", optional = true } |
| 82 | rand_core = "0.6.4" | 82 | rand_core = "0.6.4" |
diff --git a/embassy-rp/src/adc.rs b/embassy-rp/src/adc.rs index bac455743..5b913f156 100644 --- a/embassy-rp/src/adc.rs +++ b/embassy-rp/src/adc.rs | |||
| @@ -213,6 +213,7 @@ impl<'d> Adc<'d, Async> { | |||
| 213 | ch: &mut Channel<'_>, | 213 | ch: &mut Channel<'_>, |
| 214 | buf: &mut [W], | 214 | buf: &mut [W], |
| 215 | fcs_err: bool, | 215 | fcs_err: bool, |
| 216 | div: u16, | ||
| 216 | dma: impl Peripheral<P = impl dma::Channel>, | 217 | dma: impl Peripheral<P = impl dma::Channel>, |
| 217 | ) -> Result<(), Error> { | 218 | ) -> Result<(), Error> { |
| 218 | let r = Self::regs(); | 219 | let r = Self::regs(); |
| @@ -258,6 +259,7 @@ impl<'d> Adc<'d, Async> { | |||
| 258 | // start conversions and wait for dma to finish. we can't report errors early | 259 | // start conversions and wait for dma to finish. we can't report errors early |
| 259 | // because there's no interrupt to signal them, and inspecting every element | 260 | // because there's no interrupt to signal them, and inspecting every element |
| 260 | // of the fifo is too costly to do here. | 261 | // of the fifo is too costly to do here. |
| 262 | r.div().write_set(|w| w.set_int(div)); | ||
| 261 | r.cs().write_set(|w| w.set_start_many(true)); | 263 | r.cs().write_set(|w| w.set_start_many(true)); |
| 262 | dma.await; | 264 | dma.await; |
| 263 | mem::drop(auto_reset); | 265 | mem::drop(auto_reset); |
| @@ -275,9 +277,10 @@ impl<'d> Adc<'d, Async> { | |||
| 275 | &mut self, | 277 | &mut self, |
| 276 | ch: &mut Channel<'_>, | 278 | ch: &mut Channel<'_>, |
| 277 | buf: &mut [S], | 279 | buf: &mut [S], |
| 280 | div: u16, | ||
| 278 | dma: impl Peripheral<P = impl dma::Channel>, | 281 | dma: impl Peripheral<P = impl dma::Channel>, |
| 279 | ) -> Result<(), Error> { | 282 | ) -> Result<(), Error> { |
| 280 | self.read_many_inner(ch, buf, false, dma).await | 283 | self.read_many_inner(ch, buf, false, div, dma).await |
| 281 | } | 284 | } |
| 282 | 285 | ||
| 283 | #[inline] | 286 | #[inline] |
| @@ -285,11 +288,12 @@ impl<'d> Adc<'d, Async> { | |||
| 285 | &mut self, | 288 | &mut self, |
| 286 | ch: &mut Channel<'_>, | 289 | ch: &mut Channel<'_>, |
| 287 | buf: &mut [Sample], | 290 | buf: &mut [Sample], |
| 291 | div: u16, | ||
| 288 | dma: impl Peripheral<P = impl dma::Channel>, | 292 | dma: impl Peripheral<P = impl dma::Channel>, |
| 289 | ) { | 293 | ) { |
| 290 | // errors are reported in individual samples | 294 | // errors are reported in individual samples |
| 291 | let _ = self | 295 | let _ = self |
| 292 | .read_many_inner(ch, unsafe { mem::transmute::<_, &mut [u16]>(buf) }, true, dma) | 296 | .read_many_inner(ch, unsafe { mem::transmute::<_, &mut [u16]>(buf) }, true, div, dma) |
| 293 | .await; | 297 | .await; |
| 294 | } | 298 | } |
| 295 | } | 299 | } |
diff --git a/embassy-rp/src/bootsel.rs b/embassy-rp/src/bootsel.rs new file mode 100644 index 000000000..540255ae3 --- /dev/null +++ b/embassy-rp/src/bootsel.rs | |||
| @@ -0,0 +1,83 @@ | |||
| 1 | //! Boot Select button | ||
| 2 | //! | ||
| 3 | //! The RP2040 rom supports a BOOTSEL button that is used to enter the USB bootloader | ||
| 4 | //! if held during reset. To avoid wasting GPIO pins, the button is multiplexed onto | ||
| 5 | //! the CS pin of the QSPI flash, but that makes it somewhat expensive and complicated | ||
| 6 | //! to utilize outside of the rom's bootloader. | ||
| 7 | //! | ||
| 8 | //! This module provides functionality to poll BOOTSEL from an embassy application. | ||
| 9 | |||
| 10 | use crate::flash::in_ram; | ||
| 11 | |||
| 12 | impl crate::peripherals::BOOTSEL { | ||
| 13 | /// Polls the BOOTSEL button. Returns true if the button is pressed. | ||
| 14 | /// | ||
| 15 | /// Polling isn't cheap, as this function waits for core 1 to finish it's current | ||
| 16 | /// task and for any DMAs from flash to complete | ||
| 17 | pub fn is_pressed(&mut self) -> bool { | ||
| 18 | let mut cs_status = Default::default(); | ||
| 19 | |||
| 20 | unsafe { in_ram(|| cs_status = ram_helpers::read_cs_status()) }.expect("Must be called from Core 0"); | ||
| 21 | |||
| 22 | // bootsel is active low, so invert | ||
| 23 | !cs_status.infrompad() | ||
| 24 | } | ||
| 25 | } | ||
| 26 | |||
| 27 | mod ram_helpers { | ||
| 28 | use rp_pac::io::regs::GpioStatus; | ||
| 29 | |||
| 30 | /// Temporally reconfigures the CS gpio and returns the GpioStatus. | ||
| 31 | |||
| 32 | /// This function runs from RAM so it can disable flash XIP. | ||
| 33 | /// | ||
| 34 | /// # Safety | ||
| 35 | /// | ||
| 36 | /// The caller must ensure flash is idle and will remain idle. | ||
| 37 | /// This function must live in ram. It uses inline asm to avoid any | ||
| 38 | /// potential calls to ABI functions that might be in flash. | ||
| 39 | #[inline(never)] | ||
| 40 | #[link_section = ".data.ram_func"] | ||
| 41 | #[cfg(target_arch = "arm")] | ||
| 42 | pub unsafe fn read_cs_status() -> GpioStatus { | ||
| 43 | let result: u32; | ||
| 44 | |||
| 45 | // Magic value, used as both OEOVER::DISABLE and delay loop counter | ||
| 46 | let magic = 0x2000; | ||
| 47 | |||
| 48 | core::arch::asm!( | ||
| 49 | ".equiv GPIO_STATUS, 0x0", | ||
| 50 | ".equiv GPIO_CTRL, 0x4", | ||
| 51 | |||
| 52 | "ldr {orig_ctrl}, [{cs_gpio}, $GPIO_CTRL]", | ||
| 53 | |||
| 54 | // The BOOTSEL pulls the flash's CS line low though a 1K resistor. | ||
| 55 | // this is weak enough to avoid disrupting normal operation. | ||
| 56 | // But, if we disable CS's output drive and allow it to float... | ||
| 57 | "str {val}, [{cs_gpio}, $GPIO_CTRL]", | ||
| 58 | |||
| 59 | // ...then wait for the state to settle... | ||
| 60 | "1:", // ~4000 cycle delay loop | ||
| 61 | "subs {val}, #8", | ||
| 62 | "bne 1b", | ||
| 63 | |||
| 64 | // ...we can read the current state of bootsel | ||
| 65 | "ldr {val}, [{cs_gpio}, $GPIO_STATUS]", | ||
| 66 | |||
| 67 | // Finally, restore CS to normal operation so XIP can continue | ||
| 68 | "str {orig_ctrl}, [{cs_gpio}, $GPIO_CTRL]", | ||
| 69 | |||
| 70 | cs_gpio = in(reg) rp_pac::IO_QSPI.gpio(1).as_ptr(), | ||
| 71 | orig_ctrl = out(reg) _, | ||
| 72 | val = inout(reg) magic => result, | ||
| 73 | options(nostack), | ||
| 74 | ); | ||
| 75 | |||
| 76 | core::mem::transmute(result) | ||
| 77 | } | ||
| 78 | |||
| 79 | #[cfg(not(target_arch = "arm"))] | ||
| 80 | pub unsafe fn read_cs_status() -> GpioStatus { | ||
| 81 | unimplemented!() | ||
| 82 | } | ||
| 83 | } | ||
diff --git a/embassy-rp/src/flash.rs b/embassy-rp/src/flash.rs index 1c1c2449e..8fb5542f1 100644 --- a/embassy-rp/src/flash.rs +++ b/embassy-rp/src/flash.rs | |||
| @@ -131,7 +131,7 @@ impl<'d, T: Instance, M: Mode, const FLASH_SIZE: usize> Flash<'d, T, M, FLASH_SI | |||
| 131 | 131 | ||
| 132 | let len = to - from; | 132 | let len = to - from; |
| 133 | 133 | ||
| 134 | unsafe { self.in_ram(|| ram_helpers::flash_range_erase(from, len))? }; | 134 | unsafe { in_ram(|| ram_helpers::flash_range_erase(from, len))? }; |
| 135 | 135 | ||
| 136 | Ok(()) | 136 | Ok(()) |
| 137 | } | 137 | } |
| @@ -156,7 +156,7 @@ impl<'d, T: Instance, M: Mode, const FLASH_SIZE: usize> Flash<'d, T, M, FLASH_SI | |||
| 156 | 156 | ||
| 157 | let unaligned_offset = offset as usize - start; | 157 | let unaligned_offset = offset as usize - start; |
| 158 | 158 | ||
| 159 | unsafe { self.in_ram(|| ram_helpers::flash_range_program(unaligned_offset as u32, &pad_buf))? } | 159 | unsafe { in_ram(|| ram_helpers::flash_range_program(unaligned_offset as u32, &pad_buf))? } |
| 160 | } | 160 | } |
| 161 | 161 | ||
| 162 | let remaining_len = bytes.len() - start_padding; | 162 | let remaining_len = bytes.len() - start_padding; |
| @@ -174,12 +174,12 @@ impl<'d, T: Instance, M: Mode, const FLASH_SIZE: usize> Flash<'d, T, M, FLASH_SI | |||
| 174 | if bytes.as_ptr() as usize >= 0x2000_0000 { | 174 | if bytes.as_ptr() as usize >= 0x2000_0000 { |
| 175 | let aligned_data = &bytes[start_padding..end_padding]; | 175 | let aligned_data = &bytes[start_padding..end_padding]; |
| 176 | 176 | ||
| 177 | unsafe { self.in_ram(|| ram_helpers::flash_range_program(aligned_offset as u32, aligned_data))? } | 177 | unsafe { in_ram(|| ram_helpers::flash_range_program(aligned_offset as u32, aligned_data))? } |
| 178 | } else { | 178 | } else { |
| 179 | for chunk in bytes[start_padding..end_padding].chunks_exact(PAGE_SIZE) { | 179 | for chunk in bytes[start_padding..end_padding].chunks_exact(PAGE_SIZE) { |
| 180 | let mut ram_buf = [0xFF_u8; PAGE_SIZE]; | 180 | let mut ram_buf = [0xFF_u8; PAGE_SIZE]; |
| 181 | ram_buf.copy_from_slice(chunk); | 181 | ram_buf.copy_from_slice(chunk); |
| 182 | unsafe { self.in_ram(|| ram_helpers::flash_range_program(aligned_offset as u32, &ram_buf))? } | 182 | unsafe { in_ram(|| ram_helpers::flash_range_program(aligned_offset as u32, &ram_buf))? } |
| 183 | aligned_offset += PAGE_SIZE; | 183 | aligned_offset += PAGE_SIZE; |
| 184 | } | 184 | } |
| 185 | } | 185 | } |
| @@ -194,47 +194,15 @@ impl<'d, T: Instance, M: Mode, const FLASH_SIZE: usize> Flash<'d, T, M, FLASH_SI | |||
| 194 | 194 | ||
| 195 | let unaligned_offset = end_offset - (PAGE_SIZE - rem_offset); | 195 | let unaligned_offset = end_offset - (PAGE_SIZE - rem_offset); |
| 196 | 196 | ||
| 197 | unsafe { self.in_ram(|| ram_helpers::flash_range_program(unaligned_offset as u32, &pad_buf))? } | 197 | unsafe { in_ram(|| ram_helpers::flash_range_program(unaligned_offset as u32, &pad_buf))? } |
| 198 | } | 198 | } |
| 199 | 199 | ||
| 200 | Ok(()) | 200 | Ok(()) |
| 201 | } | 201 | } |
| 202 | 202 | ||
| 203 | /// Make sure to uphold the contract points with rp2040-flash. | ||
| 204 | /// - interrupts must be disabled | ||
| 205 | /// - DMA must not access flash memory | ||
| 206 | unsafe fn in_ram(&mut self, operation: impl FnOnce()) -> Result<(), Error> { | ||
| 207 | // Make sure we're running on CORE0 | ||
| 208 | let core_id: u32 = pac::SIO.cpuid().read(); | ||
| 209 | if core_id != 0 { | ||
| 210 | return Err(Error::InvalidCore); | ||
| 211 | } | ||
| 212 | |||
| 213 | // Make sure CORE1 is paused during the entire duration of the RAM function | ||
| 214 | crate::multicore::pause_core1(); | ||
| 215 | |||
| 216 | critical_section::with(|_| { | ||
| 217 | // Wait for all DMA channels in flash to finish before ram operation | ||
| 218 | const SRAM_LOWER: u32 = 0x2000_0000; | ||
| 219 | for n in 0..crate::dma::CHANNEL_COUNT { | ||
| 220 | let ch = crate::pac::DMA.ch(n); | ||
| 221 | while ch.read_addr().read() < SRAM_LOWER && ch.ctrl_trig().read().busy() {} | ||
| 222 | } | ||
| 223 | // Wait for completion of any background reads | ||
| 224 | while pac::XIP_CTRL.stream_ctr().read().0 > 0 {} | ||
| 225 | |||
| 226 | // Run our flash operation in RAM | ||
| 227 | operation(); | ||
| 228 | }); | ||
| 229 | |||
| 230 | // Resume CORE1 execution | ||
| 231 | crate::multicore::resume_core1(); | ||
| 232 | Ok(()) | ||
| 233 | } | ||
| 234 | |||
| 235 | /// Read SPI flash unique ID | 203 | /// Read SPI flash unique ID |
| 236 | pub fn blocking_unique_id(&mut self, uid: &mut [u8]) -> Result<(), Error> { | 204 | pub fn blocking_unique_id(&mut self, uid: &mut [u8]) -> Result<(), Error> { |
| 237 | unsafe { self.in_ram(|| ram_helpers::flash_unique_id(uid))? }; | 205 | unsafe { in_ram(|| ram_helpers::flash_unique_id(uid))? }; |
| 238 | Ok(()) | 206 | Ok(()) |
| 239 | } | 207 | } |
| 240 | 208 | ||
| @@ -242,7 +210,7 @@ impl<'d, T: Instance, M: Mode, const FLASH_SIZE: usize> Flash<'d, T, M, FLASH_SI | |||
| 242 | pub fn blocking_jedec_id(&mut self) -> Result<u32, Error> { | 210 | pub fn blocking_jedec_id(&mut self) -> Result<u32, Error> { |
| 243 | let mut jedec = None; | 211 | let mut jedec = None; |
| 244 | unsafe { | 212 | unsafe { |
| 245 | self.in_ram(|| { | 213 | in_ram(|| { |
| 246 | jedec.replace(ram_helpers::flash_jedec_id()); | 214 | jedec.replace(ram_helpers::flash_jedec_id()); |
| 247 | })?; | 215 | })?; |
| 248 | }; | 216 | }; |
| @@ -871,6 +839,38 @@ mod ram_helpers { | |||
| 871 | } | 839 | } |
| 872 | } | 840 | } |
| 873 | 841 | ||
| 842 | /// Make sure to uphold the contract points with rp2040-flash. | ||
| 843 | /// - interrupts must be disabled | ||
| 844 | /// - DMA must not access flash memory | ||
| 845 | pub(crate) unsafe fn in_ram(operation: impl FnOnce()) -> Result<(), Error> { | ||
| 846 | // Make sure we're running on CORE0 | ||
| 847 | let core_id: u32 = pac::SIO.cpuid().read(); | ||
| 848 | if core_id != 0 { | ||
| 849 | return Err(Error::InvalidCore); | ||
| 850 | } | ||
| 851 | |||
| 852 | // Make sure CORE1 is paused during the entire duration of the RAM function | ||
| 853 | crate::multicore::pause_core1(); | ||
| 854 | |||
| 855 | critical_section::with(|_| { | ||
| 856 | // Wait for all DMA channels in flash to finish before ram operation | ||
| 857 | const SRAM_LOWER: u32 = 0x2000_0000; | ||
| 858 | for n in 0..crate::dma::CHANNEL_COUNT { | ||
| 859 | let ch = crate::pac::DMA.ch(n); | ||
| 860 | while ch.read_addr().read() < SRAM_LOWER && ch.ctrl_trig().read().busy() {} | ||
| 861 | } | ||
| 862 | // Wait for completion of any background reads | ||
| 863 | while pac::XIP_CTRL.stream_ctr().read().0 > 0 {} | ||
| 864 | |||
| 865 | // Run our flash operation in RAM | ||
| 866 | operation(); | ||
| 867 | }); | ||
| 868 | |||
| 869 | // Resume CORE1 execution | ||
| 870 | crate::multicore::resume_core1(); | ||
| 871 | Ok(()) | ||
| 872 | } | ||
| 873 | |||
| 874 | mod sealed { | 874 | mod sealed { |
| 875 | pub trait Instance {} | 875 | pub trait Instance {} |
| 876 | pub trait Mode {} | 876 | pub trait Mode {} |
diff --git a/embassy-rp/src/gpio.rs b/embassy-rp/src/gpio.rs index ad9d4262d..ee7e03e95 100644 --- a/embassy-rp/src/gpio.rs +++ b/embassy-rp/src/gpio.rs | |||
| @@ -97,6 +97,12 @@ impl<'d, T: Pin> Input<'d, T> { | |||
| 97 | Self { pin } | 97 | Self { pin } |
| 98 | } | 98 | } |
| 99 | 99 | ||
| 100 | /// Set the pin's Schmitt trigger. | ||
| 101 | #[inline] | ||
| 102 | pub fn set_schmitt(&mut self, enable: bool) { | ||
| 103 | self.pin.set_schmitt(enable) | ||
| 104 | } | ||
| 105 | |||
| 100 | #[inline] | 106 | #[inline] |
| 101 | pub fn is_high(&self) -> bool { | 107 | pub fn is_high(&self) -> bool { |
| 102 | self.pin.is_high() | 108 | self.pin.is_high() |
| @@ -216,7 +222,6 @@ fn IO_IRQ_QSPI() { | |||
| 216 | #[must_use = "futures do nothing unless you `.await` or poll them"] | 222 | #[must_use = "futures do nothing unless you `.await` or poll them"] |
| 217 | struct InputFuture<'a, T: Pin> { | 223 | struct InputFuture<'a, T: Pin> { |
| 218 | pin: PeripheralRef<'a, T>, | 224 | pin: PeripheralRef<'a, T>, |
| 219 | level: InterruptTrigger, | ||
| 220 | } | 225 | } |
| 221 | 226 | ||
| 222 | impl<'d, T: Pin> InputFuture<'d, T> { | 227 | impl<'d, T: Pin> InputFuture<'d, T> { |
| @@ -243,7 +248,6 @@ impl<'d, T: Pin> InputFuture<'d, T> { | |||
| 243 | .inte((pin.pin() / 8) as usize) | 248 | .inte((pin.pin() / 8) as usize) |
| 244 | .write_set(|w| match level { | 249 | .write_set(|w| match level { |
| 245 | InterruptTrigger::LevelHigh => { | 250 | InterruptTrigger::LevelHigh => { |
| 246 | trace!("InputFuture::new enable LevelHigh for pin {}", pin.pin()); | ||
| 247 | w.set_level_high(pin_group, true); | 251 | w.set_level_high(pin_group, true); |
| 248 | } | 252 | } |
| 249 | InterruptTrigger::LevelLow => { | 253 | InterruptTrigger::LevelLow => { |
| @@ -261,7 +265,7 @@ impl<'d, T: Pin> InputFuture<'d, T> { | |||
| 261 | } | 265 | } |
| 262 | }); | 266 | }); |
| 263 | 267 | ||
| 264 | Self { pin, level } | 268 | Self { pin } |
| 265 | } | 269 | } |
| 266 | } | 270 | } |
| 267 | 271 | ||
| @@ -297,14 +301,8 @@ impl<'d, T: Pin> Future for InputFuture<'d, T> { | |||
| 297 | && !inte.level_high(pin_group) | 301 | && !inte.level_high(pin_group) |
| 298 | && !inte.level_low(pin_group) | 302 | && !inte.level_low(pin_group) |
| 299 | { | 303 | { |
| 300 | trace!( | ||
| 301 | "{:?} for pin {} was cleared, return Poll::Ready", | ||
| 302 | self.level, | ||
| 303 | self.pin.pin() | ||
| 304 | ); | ||
| 305 | return Poll::Ready(()); | 304 | return Poll::Ready(()); |
| 306 | } | 305 | } |
| 307 | trace!("InputFuture::poll return Poll::Pending"); | ||
| 308 | Poll::Pending | 306 | Poll::Pending |
| 309 | } | 307 | } |
| 310 | } | 308 | } |
| @@ -326,6 +324,18 @@ impl<'d, T: Pin> Output<'d, T> { | |||
| 326 | Self { pin } | 324 | Self { pin } |
| 327 | } | 325 | } |
| 328 | 326 | ||
| 327 | /// Set the pin's drive strength. | ||
| 328 | #[inline] | ||
| 329 | pub fn set_drive_strength(&mut self, strength: Drive) { | ||
| 330 | self.pin.set_drive_strength(strength) | ||
| 331 | } | ||
| 332 | |||
| 333 | // Set the pin's slew rate. | ||
| 334 | #[inline] | ||
| 335 | pub fn set_slew_rate(&mut self, slew_rate: SlewRate) { | ||
| 336 | self.pin.set_slew_rate(slew_rate) | ||
| 337 | } | ||
| 338 | |||
| 329 | /// Set the output as high. | 339 | /// Set the output as high. |
| 330 | #[inline] | 340 | #[inline] |
| 331 | pub fn set_high(&mut self) { | 341 | pub fn set_high(&mut self) { |
| @@ -386,6 +396,18 @@ impl<'d, T: Pin> OutputOpenDrain<'d, T> { | |||
| 386 | Self { pin } | 396 | Self { pin } |
| 387 | } | 397 | } |
| 388 | 398 | ||
| 399 | /// Set the pin's drive strength. | ||
| 400 | #[inline] | ||
| 401 | pub fn set_drive_strength(&mut self, strength: Drive) { | ||
| 402 | self.pin.set_drive_strength(strength) | ||
| 403 | } | ||
| 404 | |||
| 405 | // Set the pin's slew rate. | ||
| 406 | #[inline] | ||
| 407 | pub fn set_slew_rate(&mut self, slew_rate: SlewRate) { | ||
| 408 | self.pin.set_slew_rate(slew_rate) | ||
| 409 | } | ||
| 410 | |||
| 389 | /// Set the output as high. | 411 | /// Set the output as high. |
| 390 | #[inline] | 412 | #[inline] |
| 391 | pub fn set_high(&mut self) { | 413 | pub fn set_high(&mut self) { |
| @@ -541,6 +563,14 @@ impl<'d, T: Pin> Flex<'d, T> { | |||
| 541 | }); | 563 | }); |
| 542 | } | 564 | } |
| 543 | 565 | ||
| 566 | /// Set the pin's Schmitt trigger. | ||
| 567 | #[inline] | ||
| 568 | pub fn set_schmitt(&mut self, enable: bool) { | ||
| 569 | self.pin.pad_ctrl().modify(|w| { | ||
| 570 | w.set_schmitt(enable); | ||
| 571 | }); | ||
| 572 | } | ||
| 573 | |||
| 544 | /// Put the pin into input mode. | 574 | /// Put the pin into input mode. |
| 545 | /// | 575 | /// |
| 546 | /// The pull setting is left unchanged. | 576 | /// The pull setting is left unchanged. |
diff --git a/embassy-rp/src/i2c.rs b/embassy-rp/src/i2c.rs index c358682c5..4fe4b27eb 100644 --- a/embassy-rp/src/i2c.rs +++ b/embassy-rp/src/i2c.rs | |||
| @@ -6,13 +6,12 @@ use embassy_hal_internal::{into_ref, PeripheralRef}; | |||
| 6 | use embassy_sync::waitqueue::AtomicWaker; | 6 | use embassy_sync::waitqueue::AtomicWaker; |
| 7 | use pac::i2c; | 7 | use pac::i2c; |
| 8 | 8 | ||
| 9 | use crate::gpio::sealed::Pin; | ||
| 10 | use crate::gpio::AnyPin; | 9 | use crate::gpio::AnyPin; |
| 11 | use crate::interrupt::typelevel::{Binding, Interrupt}; | 10 | use crate::interrupt::typelevel::{Binding, Interrupt}; |
| 12 | use crate::{interrupt, pac, peripherals, Peripheral}; | 11 | use crate::{interrupt, pac, peripherals, Peripheral}; |
| 13 | 12 | ||
| 14 | /// I2C error abort reason | 13 | /// I2C error abort reason |
| 15 | #[derive(Debug)] | 14 | #[derive(Debug, PartialEq, Eq)] |
| 16 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 15 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 17 | pub enum AbortReason { | 16 | pub enum AbortReason { |
| 18 | /// A bus operation was not acknowledged, e.g. due to the addressed device | 17 | /// A bus operation was not acknowledged, e.g. due to the addressed device |
| @@ -27,7 +26,7 @@ pub enum AbortReason { | |||
| 27 | } | 26 | } |
| 28 | 27 | ||
| 29 | /// I2C error | 28 | /// I2C error |
| 30 | #[derive(Debug)] | 29 | #[derive(Debug, PartialEq, Eq)] |
| 31 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 30 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 32 | pub enum Error { | 31 | pub enum Error { |
| 33 | /// I2C abort with error | 32 | /// I2C abort with error |
| @@ -295,13 +294,24 @@ impl<'d, T: Instance> I2c<'d, T, Async> { | |||
| 295 | 294 | ||
| 296 | pub async fn read_async(&mut self, addr: u16, buffer: &mut [u8]) -> Result<(), Error> { | 295 | pub async fn read_async(&mut self, addr: u16, buffer: &mut [u8]) -> Result<(), Error> { |
| 297 | Self::setup(addr)?; | 296 | Self::setup(addr)?; |
| 298 | self.read_async_internal(buffer, false, true).await | 297 | self.read_async_internal(buffer, true, true).await |
| 299 | } | 298 | } |
| 300 | 299 | ||
| 301 | pub async fn write_async(&mut self, addr: u16, bytes: impl IntoIterator<Item = u8>) -> Result<(), Error> { | 300 | pub async fn write_async(&mut self, addr: u16, bytes: impl IntoIterator<Item = u8>) -> Result<(), Error> { |
| 302 | Self::setup(addr)?; | 301 | Self::setup(addr)?; |
| 303 | self.write_async_internal(bytes, true).await | 302 | self.write_async_internal(bytes, true).await |
| 304 | } | 303 | } |
| 304 | |||
| 305 | pub async fn write_read_async( | ||
| 306 | &mut self, | ||
| 307 | addr: u16, | ||
| 308 | bytes: impl IntoIterator<Item = u8>, | ||
| 309 | buffer: &mut [u8], | ||
| 310 | ) -> Result<(), Error> { | ||
| 311 | Self::setup(addr)?; | ||
| 312 | self.write_async_internal(bytes, false).await?; | ||
| 313 | self.read_async_internal(buffer, true, true).await | ||
| 314 | } | ||
| 305 | } | 315 | } |
| 306 | 316 | ||
| 307 | pub struct InterruptHandler<T: Instance> { | 317 | pub struct InterruptHandler<T: Instance> { |
| @@ -318,6 +328,22 @@ impl<T: Instance> interrupt::typelevel::Handler<T::Interrupt> for InterruptHandl | |||
| 318 | } | 328 | } |
| 319 | } | 329 | } |
| 320 | 330 | ||
| 331 | pub(crate) fn set_up_i2c_pin<'d, P, T>(pin: &P) | ||
| 332 | where | ||
| 333 | P: core::ops::Deref<Target = T>, | ||
| 334 | T: crate::gpio::Pin, | ||
| 335 | { | ||
| 336 | pin.gpio().ctrl().write(|w| w.set_funcsel(3)); | ||
| 337 | pin.pad_ctrl().write(|w| { | ||
| 338 | w.set_schmitt(true); | ||
| 339 | w.set_slewfast(false); | ||
| 340 | w.set_ie(true); | ||
| 341 | w.set_od(false); | ||
| 342 | w.set_pue(true); | ||
| 343 | w.set_pde(false); | ||
| 344 | }); | ||
| 345 | } | ||
| 346 | |||
| 321 | impl<'d, T: Instance + 'd, M: Mode> I2c<'d, T, M> { | 347 | impl<'d, T: Instance + 'd, M: Mode> I2c<'d, T, M> { |
| 322 | fn new_inner( | 348 | fn new_inner( |
| 323 | _peri: impl Peripheral<P = T> + 'd, | 349 | _peri: impl Peripheral<P = T> + 'd, |
| @@ -355,23 +381,8 @@ impl<'d, T: Instance + 'd, M: Mode> I2c<'d, T, M> { | |||
| 355 | p.ic_rx_tl().write(|w| w.set_rx_tl(0)); | 381 | p.ic_rx_tl().write(|w| w.set_rx_tl(0)); |
| 356 | 382 | ||
| 357 | // Configure SCL & SDA pins | 383 | // Configure SCL & SDA pins |
| 358 | scl.gpio().ctrl().write(|w| w.set_funcsel(3)); | 384 | set_up_i2c_pin(&scl); |
| 359 | sda.gpio().ctrl().write(|w| w.set_funcsel(3)); | 385 | set_up_i2c_pin(&sda); |
| 360 | |||
| 361 | scl.pad_ctrl().write(|w| { | ||
| 362 | w.set_schmitt(true); | ||
| 363 | w.set_ie(true); | ||
| 364 | w.set_od(false); | ||
| 365 | w.set_pue(true); | ||
| 366 | w.set_pde(false); | ||
| 367 | }); | ||
| 368 | sda.pad_ctrl().write(|w| { | ||
| 369 | w.set_schmitt(true); | ||
| 370 | w.set_ie(true); | ||
| 371 | w.set_od(false); | ||
| 372 | w.set_pue(true); | ||
| 373 | w.set_pde(false); | ||
| 374 | }); | ||
| 375 | 386 | ||
| 376 | // Configure baudrate | 387 | // Configure baudrate |
| 377 | 388 | ||
| @@ -713,7 +724,7 @@ mod nightly { | |||
| 713 | 724 | ||
| 714 | Self::setup(addr)?; | 725 | Self::setup(addr)?; |
| 715 | self.write_async_internal(write.iter().cloned(), false).await?; | 726 | self.write_async_internal(write.iter().cloned(), false).await?; |
| 716 | self.read_async_internal(read, false, true).await | 727 | self.read_async_internal(read, true, true).await |
| 717 | } | 728 | } |
| 718 | 729 | ||
| 719 | async fn transaction(&mut self, address: A, operations: &mut [Operation<'_>]) -> Result<(), Self::Error> { | 730 | async fn transaction(&mut self, address: A, operations: &mut [Operation<'_>]) -> Result<(), Self::Error> { |
diff --git a/embassy-rp/src/i2c_slave.rs b/embassy-rp/src/i2c_slave.rs index 6136d69c6..9271ede3a 100644 --- a/embassy-rp/src/i2c_slave.rs +++ b/embassy-rp/src/i2c_slave.rs | |||
| @@ -5,12 +5,14 @@ use core::task::Poll; | |||
| 5 | use embassy_hal_internal::into_ref; | 5 | use embassy_hal_internal::into_ref; |
| 6 | use pac::i2c; | 6 | use pac::i2c; |
| 7 | 7 | ||
| 8 | use crate::i2c::{i2c_reserved_addr, AbortReason, Instance, InterruptHandler, SclPin, SdaPin, FIFO_SIZE}; | 8 | use crate::i2c::{ |
| 9 | i2c_reserved_addr, set_up_i2c_pin, AbortReason, Instance, InterruptHandler, SclPin, SdaPin, FIFO_SIZE, | ||
| 10 | }; | ||
| 9 | use crate::interrupt::typelevel::{Binding, Interrupt}; | 11 | use crate::interrupt::typelevel::{Binding, Interrupt}; |
| 10 | use crate::{pac, Peripheral}; | 12 | use crate::{pac, Peripheral}; |
| 11 | 13 | ||
| 12 | /// I2C error | 14 | /// I2C error |
| 13 | #[derive(Debug)] | 15 | #[derive(Debug, PartialEq, Eq)] |
| 14 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 16 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 15 | #[non_exhaustive] | 17 | #[non_exhaustive] |
| 16 | pub enum Error { | 18 | pub enum Error { |
| @@ -100,23 +102,8 @@ impl<'d, T: Instance> I2cSlave<'d, T> { | |||
| 100 | p.ic_rx_tl().write(|w| w.set_rx_tl(0)); | 102 | p.ic_rx_tl().write(|w| w.set_rx_tl(0)); |
| 101 | 103 | ||
| 102 | // Configure SCL & SDA pins | 104 | // Configure SCL & SDA pins |
| 103 | scl.gpio().ctrl().write(|w| w.set_funcsel(3)); | 105 | set_up_i2c_pin(&scl); |
| 104 | sda.gpio().ctrl().write(|w| w.set_funcsel(3)); | 106 | set_up_i2c_pin(&sda); |
| 105 | |||
| 106 | scl.pad_ctrl().write(|w| { | ||
| 107 | w.set_schmitt(true); | ||
| 108 | w.set_ie(true); | ||
| 109 | w.set_od(false); | ||
| 110 | w.set_pue(true); | ||
| 111 | w.set_pde(false); | ||
| 112 | }); | ||
| 113 | sda.pad_ctrl().write(|w| { | ||
| 114 | w.set_schmitt(true); | ||
| 115 | w.set_ie(true); | ||
| 116 | w.set_od(false); | ||
| 117 | w.set_pue(true); | ||
| 118 | w.set_pde(false); | ||
| 119 | }); | ||
| 120 | 107 | ||
| 121 | // Clear interrupts | 108 | // Clear interrupts |
| 122 | p.ic_clr_intr().read(); | 109 | p.ic_clr_intr().read(); |
diff --git a/embassy-rp/src/lib.rs b/embassy-rp/src/lib.rs index c3561bbe4..2728395b2 100644 --- a/embassy-rp/src/lib.rs +++ b/embassy-rp/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![no_std] | 1 | #![no_std] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait))] |
| 3 | 3 | ||
| 4 | // This mod MUST go first, so that the others see its macros. | 4 | // This mod MUST go first, so that the others see its macros. |
| 5 | pub(crate) mod fmt; | 5 | pub(crate) mod fmt; |
| @@ -10,6 +10,7 @@ mod critical_section_impl; | |||
| 10 | mod intrinsics; | 10 | mod intrinsics; |
| 11 | 11 | ||
| 12 | pub mod adc; | 12 | pub mod adc; |
| 13 | pub mod bootsel; | ||
| 13 | pub mod clocks; | 14 | pub mod clocks; |
| 14 | pub mod dma; | 15 | pub mod dma; |
| 15 | pub mod flash; | 16 | pub mod flash; |
| @@ -193,6 +194,7 @@ embassy_hal_internal::peripherals! { | |||
| 193 | PIO1, | 194 | PIO1, |
| 194 | 195 | ||
| 195 | WATCHDOG, | 196 | WATCHDOG, |
| 197 | BOOTSEL, | ||
| 196 | } | 198 | } |
| 197 | 199 | ||
| 198 | macro_rules! select_bootloader { | 200 | macro_rules! select_bootloader { |
diff --git a/embassy-rp/src/pwm.rs b/embassy-rp/src/pwm.rs index c297d69a2..516b8254b 100644 --- a/embassy-rp/src/pwm.rs +++ b/embassy-rp/src/pwm.rs | |||
| @@ -10,16 +10,39 @@ use crate::gpio::sealed::Pin as _; | |||
| 10 | use crate::gpio::{AnyPin, Pin as GpioPin}; | 10 | use crate::gpio::{AnyPin, Pin as GpioPin}; |
| 11 | use crate::{pac, peripherals, RegExt}; | 11 | use crate::{pac, peripherals, RegExt}; |
| 12 | 12 | ||
| 13 | /// The configuration of a PWM slice. | ||
| 14 | /// Note the period in clock cycles of a slice can be computed as: | ||
| 15 | /// `(top + 1) * (phase_correct ? 1 : 2) * divider` | ||
| 13 | #[non_exhaustive] | 16 | #[non_exhaustive] |
| 14 | #[derive(Clone)] | 17 | #[derive(Clone)] |
| 15 | pub struct Config { | 18 | pub struct Config { |
| 19 | /// Inverts the PWM output signal on channel A. | ||
| 16 | pub invert_a: bool, | 20 | pub invert_a: bool, |
| 21 | /// Inverts the PWM output signal on channel B. | ||
| 17 | pub invert_b: bool, | 22 | pub invert_b: bool, |
| 23 | /// Enables phase-correct mode for PWM operation. | ||
| 24 | /// In phase-correct mode, the PWM signal is generated in such a way that | ||
| 25 | /// the pulse is always centered regardless of the duty cycle. | ||
| 26 | /// The output frequency is halved when phase-correct mode is enabled. | ||
| 18 | pub phase_correct: bool, | 27 | pub phase_correct: bool, |
| 28 | /// Enables the PWM slice, allowing it to generate an output. | ||
| 19 | pub enable: bool, | 29 | pub enable: bool, |
| 30 | /// A fractional clock divider, represented as a fixed-point number with | ||
| 31 | /// 8 integer bits and 4 fractional bits. It allows precise control over | ||
| 32 | /// the PWM output frequency by gating the PWM counter increment. | ||
| 33 | /// A higher value will result in a slower output frequency. | ||
| 20 | pub divider: fixed::FixedU16<fixed::types::extra::U4>, | 34 | pub divider: fixed::FixedU16<fixed::types::extra::U4>, |
| 35 | /// The output on channel A goes high when `compare_a` is higher than the | ||
| 36 | /// counter. A compare of 0 will produce an always low output, while a | ||
| 37 | /// compare of `top + 1` will produce an always high output. | ||
| 21 | pub compare_a: u16, | 38 | pub compare_a: u16, |
| 39 | /// The output on channel B goes high when `compare_b` is higher than the | ||
| 40 | /// counter. A compare of 0 will produce an always low output, while a | ||
| 41 | /// compare of `top + 1` will produce an always high output. | ||
| 22 | pub compare_b: u16, | 42 | pub compare_b: u16, |
| 43 | /// The point at which the counter wraps, representing the maximum possible | ||
| 44 | /// period. The counter will either wrap to 0 or reverse depending on the | ||
| 45 | /// setting of `phase_correct`. | ||
| 23 | pub top: u16, | 46 | pub top: u16, |
| 24 | } | 47 | } |
| 25 | 48 | ||
| @@ -173,6 +196,9 @@ impl<'d, T: Channel> Pwm<'d, T> { | |||
| 173 | }); | 196 | }); |
| 174 | } | 197 | } |
| 175 | 198 | ||
| 199 | /// Advances a slice’s output phase by one count while it is running | ||
| 200 | /// by inserting a pulse into the clock enable. The counter | ||
| 201 | /// will not count faster than once per cycle. | ||
| 176 | #[inline] | 202 | #[inline] |
| 177 | pub fn phase_advance(&mut self) { | 203 | pub fn phase_advance(&mut self) { |
| 178 | let p = self.inner.regs(); | 204 | let p = self.inner.regs(); |
| @@ -180,6 +206,9 @@ impl<'d, T: Channel> Pwm<'d, T> { | |||
| 180 | while p.csr().read().ph_adv() {} | 206 | while p.csr().read().ph_adv() {} |
| 181 | } | 207 | } |
| 182 | 208 | ||
| 209 | /// Retards a slice’s output phase by one count while it is running | ||
| 210 | /// by deleting a pulse from the clock enable. The counter will not | ||
| 211 | /// count backward when clock enable is permenantly low. | ||
| 183 | #[inline] | 212 | #[inline] |
| 184 | pub fn phase_retard(&mut self) { | 213 | pub fn phase_retard(&mut self) { |
| 185 | let p = self.inner.regs(); | 214 | let p = self.inner.regs(); |
diff --git a/embassy-rp/src/spi.rs b/embassy-rp/src/spi.rs index 46c440b84..a59ce8419 100644 --- a/embassy-rp/src/spi.rs +++ b/embassy-rp/src/spi.rs | |||
| @@ -597,7 +597,8 @@ mod eha { | |||
| 597 | 597 | ||
| 598 | impl<'d, T: Instance, M: Mode> SetConfig for Spi<'d, T, M> { | 598 | impl<'d, T: Instance, M: Mode> SetConfig for Spi<'d, T, M> { |
| 599 | type Config = Config; | 599 | type Config = Config; |
| 600 | fn set_config(&mut self, config: &Self::Config) { | 600 | type ConfigError = (); |
| 601 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { | ||
| 601 | let p = self.inner.regs(); | 602 | let p = self.inner.regs(); |
| 602 | let (presc, postdiv) = calc_prescs(config.frequency); | 603 | let (presc, postdiv) = calc_prescs(config.frequency); |
| 603 | p.cpsr().write(|w| w.set_cpsdvsr(presc)); | 604 | p.cpsr().write(|w| w.set_cpsdvsr(presc)); |
| @@ -607,5 +608,7 @@ impl<'d, T: Instance, M: Mode> SetConfig for Spi<'d, T, M> { | |||
| 607 | w.set_sph(config.phase == Phase::CaptureOnSecondTransition); | 608 | w.set_sph(config.phase == Phase::CaptureOnSecondTransition); |
| 608 | w.set_scr(postdiv); | 609 | w.set_scr(postdiv); |
| 609 | }); | 610 | }); |
| 611 | |||
| 612 | Ok(()) | ||
| 610 | } | 613 | } |
| 611 | } | 614 | } |
diff --git a/embassy-rp/src/uart/buffered.rs b/embassy-rp/src/uart/buffered.rs index e57b72599..9f638761d 100644 --- a/embassy-rp/src/uart/buffered.rs +++ b/embassy-rp/src/uart/buffered.rs | |||
| @@ -5,7 +5,7 @@ use core::task::Poll; | |||
| 5 | use atomic_polyfill::{AtomicU8, Ordering}; | 5 | use atomic_polyfill::{AtomicU8, Ordering}; |
| 6 | use embassy_hal_internal::atomic_ring_buffer::RingBuffer; | 6 | use embassy_hal_internal::atomic_ring_buffer::RingBuffer; |
| 7 | use embassy_sync::waitqueue::AtomicWaker; | 7 | use embassy_sync::waitqueue::AtomicWaker; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | 9 | ||
| 10 | use super::*; | 10 | use super::*; |
| 11 | use crate::clocks::clk_peri_freq; | 11 | use crate::clocks::clk_peri_freq; |
| @@ -435,7 +435,7 @@ impl<'d, T: Instance> BufferedUartTx<'d, T> { | |||
| 435 | Self::flush().await.unwrap(); | 435 | Self::flush().await.unwrap(); |
| 436 | while self.busy() {} | 436 | while self.busy() {} |
| 437 | regs.uartlcr_h().write_set(|w| w.set_brk(true)); | 437 | regs.uartlcr_h().write_set(|w| w.set_brk(true)); |
| 438 | Timer::after(Duration::from_micros(wait_usecs)).await; | 438 | Timer::after_micros(wait_usecs).await; |
| 439 | regs.uartlcr_h().write_clear(|w| w.set_brk(true)); | 439 | regs.uartlcr_h().write_clear(|w| w.set_brk(true)); |
| 440 | } | 440 | } |
| 441 | } | 441 | } |
| @@ -490,8 +490,6 @@ impl<T: Instance> interrupt::typelevel::Handler<T::Interrupt> for BufferedInterr | |||
| 490 | w.set_oeic(ris.oeris()); | 490 | w.set_oeic(ris.oeris()); |
| 491 | }); | 491 | }); |
| 492 | 492 | ||
| 493 | trace!("on_interrupt ris={:#X}", ris.0); | ||
| 494 | |||
| 495 | // Errors | 493 | // Errors |
| 496 | if ris.feris() { | 494 | if ris.feris() { |
| 497 | warn!("Framing error"); | 495 | warn!("Framing error"); |
diff --git a/embassy-rp/src/uart/mod.rs b/embassy-rp/src/uart/mod.rs index 202b0883e..461986c81 100644 --- a/embassy-rp/src/uart/mod.rs +++ b/embassy-rp/src/uart/mod.rs | |||
| @@ -6,7 +6,7 @@ use atomic_polyfill::{AtomicU16, Ordering}; | |||
| 6 | use embassy_futures::select::{select, Either}; | 6 | use embassy_futures::select::{select, Either}; |
| 7 | use embassy_hal_internal::{into_ref, PeripheralRef}; | 7 | use embassy_hal_internal::{into_ref, PeripheralRef}; |
| 8 | use embassy_sync::waitqueue::AtomicWaker; | 8 | use embassy_sync::waitqueue::AtomicWaker; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use pac::uart::regs::Uartris; | 10 | use pac::uart::regs::Uartris; |
| 11 | 11 | ||
| 12 | use crate::clocks::clk_peri_freq; | 12 | use crate::clocks::clk_peri_freq; |
| @@ -187,7 +187,7 @@ impl<'d, T: Instance, M: Mode> UartTx<'d, T, M> { | |||
| 187 | self.blocking_flush().unwrap(); | 187 | self.blocking_flush().unwrap(); |
| 188 | while self.busy() {} | 188 | while self.busy() {} |
| 189 | regs.uartlcr_h().write_set(|w| w.set_brk(true)); | 189 | regs.uartlcr_h().write_set(|w| w.set_brk(true)); |
| 190 | Timer::after(Duration::from_micros(wait_usecs)).await; | 190 | Timer::after_micros(wait_usecs).await; |
| 191 | regs.uartlcr_h().write_clear(|w| w.set_brk(true)); | 191 | regs.uartlcr_h().write_clear(|w| w.set_brk(true)); |
| 192 | } | 192 | } |
| 193 | } | 193 | } |
diff --git a/embassy-stm32-wpan/Cargo.toml b/embassy-stm32-wpan/Cargo.toml index 3b10b7c52..52ecf15d1 100644 --- a/embassy-stm32-wpan/Cargo.toml +++ b/embassy-stm32-wpan/Cargo.toml | |||
| @@ -13,11 +13,11 @@ features = ["stm32wb55rg"] | |||
| 13 | [dependencies] | 13 | [dependencies] |
| 14 | embassy-stm32 = { version = "0.1.0", path = "../embassy-stm32" } | 14 | embassy-stm32 = { version = "0.1.0", path = "../embassy-stm32" } |
| 15 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 15 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 16 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true } | 16 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true } |
| 17 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 17 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 18 | embassy-hal-internal = { version = "0.1.0", path = "../embassy-hal-internal" } | 18 | embassy-hal-internal = { version = "0.1.0", path = "../embassy-hal-internal" } |
| 19 | embassy-embedded-hal = { version = "0.1.0", path = "../embassy-embedded-hal" } | 19 | embassy-embedded-hal = { version = "0.1.0", path = "../embassy-embedded-hal" } |
| 20 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver", optional=true } | 20 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver", optional=true } |
| 21 | 21 | ||
| 22 | defmt = { version = "0.3", optional = true } | 22 | defmt = { version = "0.3", optional = true } |
| 23 | cortex-m = "0.7.6" | 23 | cortex-m = "0.7.6" |
diff --git a/embassy-stm32-wpan/src/mac/driver.rs b/embassy-stm32-wpan/src/mac/driver.rs index bfc4f1ee8..ffba6e5e8 100644 --- a/embassy-stm32-wpan/src/mac/driver.rs +++ b/embassy-stm32-wpan/src/mac/driver.rs | |||
| @@ -3,7 +3,7 @@ | |||
| 3 | 3 | ||
| 4 | use core::task::Context; | 4 | use core::task::Context; |
| 5 | 5 | ||
| 6 | use embassy_net_driver::{Capabilities, HardwareAddress, LinkState, Medium}; | 6 | use embassy_net_driver::{Capabilities, HardwareAddress, LinkState}; |
| 7 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | 7 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; |
| 8 | use embassy_sync::channel::Channel; | 8 | use embassy_sync::channel::Channel; |
| 9 | 9 | ||
| @@ -60,24 +60,15 @@ impl<'d> embassy_net_driver::Driver for Driver<'d> { | |||
| 60 | let mut caps = Capabilities::default(); | 60 | let mut caps = Capabilities::default(); |
| 61 | caps.max_transmission_unit = MTU; | 61 | caps.max_transmission_unit = MTU; |
| 62 | // caps.max_burst_size = Some(self.tx.len()); | 62 | // caps.max_burst_size = Some(self.tx.len()); |
| 63 | |||
| 64 | caps.medium = Medium::Ieee802154; | ||
| 65 | caps | 63 | caps |
| 66 | } | 64 | } |
| 67 | 65 | ||
| 68 | fn link_state(&mut self, _cx: &mut Context) -> LinkState { | 66 | fn link_state(&mut self, _cx: &mut Context) -> LinkState { |
| 69 | // if self.phy.poll_link(&mut self.station_management, cx) { | ||
| 70 | // LinkState::Up | ||
| 71 | // } else { | ||
| 72 | // LinkState::Down | ||
| 73 | // } | ||
| 74 | |||
| 75 | LinkState::Down | 67 | LinkState::Down |
| 76 | } | 68 | } |
| 77 | 69 | ||
| 78 | fn hardware_address(&self) -> HardwareAddress { | 70 | fn hardware_address(&self) -> HardwareAddress { |
| 79 | // self.mac_addr | 71 | // self.mac_addr |
| 80 | |||
| 81 | HardwareAddress::Ieee802154([0; 8]) | 72 | HardwareAddress::Ieee802154([0; 8]) |
| 82 | } | 73 | } |
| 83 | } | 74 | } |
diff --git a/embassy-stm32/Cargo.toml b/embassy-stm32/Cargo.toml index 87f9083b3..3b9220bc7 100644 --- a/embassy-stm32/Cargo.toml +++ b/embassy-stm32/Cargo.toml | |||
| @@ -33,11 +33,11 @@ flavors = [ | |||
| 33 | 33 | ||
| 34 | [dependencies] | 34 | [dependencies] |
| 35 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 35 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 36 | embassy-time = { version = "0.1.3", path = "../embassy-time", optional = true } | 36 | embassy-time = { version = "0.1.5", path = "../embassy-time", optional = true } |
| 37 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 37 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 38 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-4"] } | 38 | embassy-hal-internal = {version = "0.1.0", path = "../embassy-hal-internal", features = ["cortex-m", "prio-bits-4"] } |
| 39 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } | 39 | embassy-embedded-hal = {version = "0.1.0", path = "../embassy-embedded-hal" } |
| 40 | embassy-net-driver = { version = "0.1.0", path = "../embassy-net-driver" } | 40 | embassy-net-driver = { version = "0.2.0", path = "../embassy-net-driver" } |
| 41 | embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optional = true } | 41 | embassy-usb-driver = {version = "0.1.0", path = "../embassy-usb-driver", optional = true } |
| 42 | embassy-executor = { version = "0.3.0", path = "../embassy-executor", optional = true } | 42 | embassy-executor = { version = "0.3.0", path = "../embassy-executor", optional = true } |
| 43 | 43 | ||
| @@ -58,16 +58,14 @@ rand_core = "0.6.3" | |||
| 58 | sdio-host = "0.5.0" | 58 | sdio-host = "0.5.0" |
| 59 | embedded-sdmmc = { git = "https://github.com/embassy-rs/embedded-sdmmc-rs", rev = "a4f293d3a6f72158385f79c98634cb8a14d0d2fc", optional = true } | 59 | embedded-sdmmc = { git = "https://github.com/embassy-rs/embedded-sdmmc-rs", rev = "a4f293d3a6f72158385f79c98634cb8a14d0d2fc", optional = true } |
| 60 | critical-section = "1.1" | 60 | critical-section = "1.1" |
| 61 | atomic-polyfill = "1.0.1" | 61 | stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-5b04234fbe61ea875f1a904cd5f68795daaeb526" } |
| 62 | stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-8ee2862086886cd8ebaf5fd5e3bd6cfbe5baa840" } | ||
| 63 | vcell = "0.1.3" | 62 | vcell = "0.1.3" |
| 64 | bxcan = "0.7.0" | 63 | bxcan = "0.7.0" |
| 65 | nb = "1.0.0" | 64 | nb = "1.0.0" |
| 66 | stm32-fmc = "0.3.0" | 65 | stm32-fmc = "0.3.0" |
| 67 | seq-macro = "0.3.0" | ||
| 68 | cfg-if = "1.0.0" | 66 | cfg-if = "1.0.0" |
| 69 | embedded-io = { version = "0.5.0" } | 67 | embedded-io = { version = "0.6.0" } |
| 70 | embedded-io-async = { version = "0.5.0", optional = true } | 68 | embedded-io-async = { version = "0.6.0", optional = true } |
| 71 | chrono = { version = "^0.4", default-features = false, optional = true} | 69 | chrono = { version = "^0.4", default-features = false, optional = true} |
| 72 | bit_field = "0.10.2" | 70 | bit_field = "0.10.2" |
| 73 | document-features = "0.2.7" | 71 | document-features = "0.2.7" |
| @@ -78,7 +76,7 @@ critical-section = { version = "1.1", features = ["std"] } | |||
| 78 | [build-dependencies] | 76 | [build-dependencies] |
| 79 | proc-macro2 = "1.0.36" | 77 | proc-macro2 = "1.0.36" |
| 80 | quote = "1.0.15" | 78 | quote = "1.0.15" |
| 81 | stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-8ee2862086886cd8ebaf5fd5e3bd6cfbe5baa840", default-features = false, features = ["metadata"]} | 79 | stm32-metapac = { git = "https://github.com/embassy-rs/stm32-data-generated", tag = "stm32-data-5b04234fbe61ea875f1a904cd5f68795daaeb526", default-features = false, features = ["metadata"]} |
| 82 | 80 | ||
| 83 | 81 | ||
| 84 | [features] | 82 | [features] |
diff --git a/embassy-stm32/build.rs b/embassy-stm32/build.rs index 2c349e55e..f8908756d 100644 --- a/embassy-stm32/build.rs +++ b/embassy-stm32/build.rs | |||
| @@ -5,9 +5,36 @@ use std::{env, fs}; | |||
| 5 | 5 | ||
| 6 | use proc_macro2::{Ident, TokenStream}; | 6 | use proc_macro2::{Ident, TokenStream}; |
| 7 | use quote::{format_ident, quote}; | 7 | use quote::{format_ident, quote}; |
| 8 | use stm32_metapac::metadata::{MemoryRegionKind, METADATA}; | 8 | use stm32_metapac::metadata::ir::{BlockItemInner, Enum, FieldSet}; |
| 9 | use stm32_metapac::metadata::{MemoryRegionKind, PeripheralRccRegister, METADATA}; | ||
| 9 | 10 | ||
| 10 | fn main() { | 11 | fn main() { |
| 12 | let target = env::var("TARGET").unwrap(); | ||
| 13 | |||
| 14 | if target.starts_with("thumbv6m-") { | ||
| 15 | println!("cargo:rustc-cfg=cortex_m"); | ||
| 16 | println!("cargo:rustc-cfg=armv6m"); | ||
| 17 | } else if target.starts_with("thumbv7m-") { | ||
| 18 | println!("cargo:rustc-cfg=cortex_m"); | ||
| 19 | println!("cargo:rustc-cfg=armv7m"); | ||
| 20 | } else if target.starts_with("thumbv7em-") { | ||
| 21 | println!("cargo:rustc-cfg=cortex_m"); | ||
| 22 | println!("cargo:rustc-cfg=armv7m"); | ||
| 23 | println!("cargo:rustc-cfg=armv7em"); // (not currently used) | ||
| 24 | } else if target.starts_with("thumbv8m.base") { | ||
| 25 | println!("cargo:rustc-cfg=cortex_m"); | ||
| 26 | println!("cargo:rustc-cfg=armv8m"); | ||
| 27 | println!("cargo:rustc-cfg=armv8m_base"); | ||
| 28 | } else if target.starts_with("thumbv8m.main") { | ||
| 29 | println!("cargo:rustc-cfg=cortex_m"); | ||
| 30 | println!("cargo:rustc-cfg=armv8m"); | ||
| 31 | println!("cargo:rustc-cfg=armv8m_main"); | ||
| 32 | } | ||
| 33 | |||
| 34 | if target.ends_with("-eabihf") { | ||
| 35 | println!("cargo:rustc-cfg=has_fpu"); | ||
| 36 | } | ||
| 37 | |||
| 11 | let chip_name = match env::vars() | 38 | let chip_name = match env::vars() |
| 12 | .map(|(a, _)| a) | 39 | .map(|(a, _)| a) |
| 13 | .filter(|x| x.starts_with("CARGO_FEATURE_STM32")) | 40 | .filter(|x| x.starts_with("CARGO_FEATURE_STM32")) |
| @@ -50,12 +77,14 @@ fn main() { | |||
| 50 | // We *shouldn't* have singletons for these, but the HAL currently requires | 77 | // We *shouldn't* have singletons for these, but the HAL currently requires |
| 51 | // singletons, for using with RccPeripheral to enable/disable clocks to them. | 78 | // singletons, for using with RccPeripheral to enable/disable clocks to them. |
| 52 | "rcc" => { | 79 | "rcc" => { |
| 53 | if r.version.starts_with("h5") || r.version.starts_with("h7") || r.version.starts_with("f4") { | 80 | for pin in p.pins { |
| 54 | singletons.push("MCO1".to_string()); | 81 | if pin.signal.starts_with("MCO") { |
| 55 | singletons.push("MCO2".to_string()); | 82 | let name = pin.signal.replace('_', "").to_string(); |
| 56 | } | 83 | if !singletons.contains(&name) { |
| 57 | if r.version.starts_with("l4") { | 84 | println!("cargo:rustc-cfg={}", name.to_ascii_lowercase()); |
| 58 | singletons.push("MCO".to_string()); | 85 | singletons.push(name); |
| 86 | } | ||
| 87 | } | ||
| 59 | } | 88 | } |
| 60 | singletons.push(p.name.to_string()); | 89 | singletons.push(p.name.to_string()); |
| 61 | } | 90 | } |
| @@ -91,6 +120,7 @@ fn main() { | |||
| 91 | struct SplitFeature { | 120 | struct SplitFeature { |
| 92 | feature_name: String, | 121 | feature_name: String, |
| 93 | pin_name_with_c: String, | 122 | pin_name_with_c: String, |
| 123 | #[cfg(feature = "_split-pins-enabled")] | ||
| 94 | pin_name_without_c: String, | 124 | pin_name_without_c: String, |
| 95 | } | 125 | } |
| 96 | 126 | ||
| @@ -359,6 +389,47 @@ fn main() { | |||
| 359 | } | 389 | } |
| 360 | 390 | ||
| 361 | // ======== | 391 | // ======== |
| 392 | // Extract the rcc registers | ||
| 393 | let rcc_registers = METADATA | ||
| 394 | .peripherals | ||
| 395 | .iter() | ||
| 396 | .filter_map(|p| p.registers.as_ref()) | ||
| 397 | .find(|r| r.kind == "rcc") | ||
| 398 | .unwrap(); | ||
| 399 | |||
| 400 | // ======== | ||
| 401 | // Generate rcc fieldset and enum maps | ||
| 402 | let rcc_enum_map: HashMap<&str, HashMap<&str, &Enum>> = { | ||
| 403 | let rcc_blocks = rcc_registers.ir.blocks.iter().find(|b| b.name == "Rcc").unwrap().items; | ||
| 404 | let rcc_fieldsets: HashMap<&str, &FieldSet> = rcc_registers.ir.fieldsets.iter().map(|f| (f.name, f)).collect(); | ||
| 405 | let rcc_enums: HashMap<&str, &Enum> = rcc_registers.ir.enums.iter().map(|e| (e.name, e)).collect(); | ||
| 406 | |||
| 407 | rcc_blocks | ||
| 408 | .iter() | ||
| 409 | .filter_map(|b| match &b.inner { | ||
| 410 | BlockItemInner::Register(register) => register.fieldset.map(|f| (b.name, f)), | ||
| 411 | _ => None, | ||
| 412 | }) | ||
| 413 | .filter_map(|(b, f)| { | ||
| 414 | rcc_fieldsets.get(f).map(|f| { | ||
| 415 | ( | ||
| 416 | b, | ||
| 417 | f.fields | ||
| 418 | .iter() | ||
| 419 | .filter_map(|f| { | ||
| 420 | let enumm = f.enumm?; | ||
| 421 | let enumm = rcc_enums.get(enumm)?; | ||
| 422 | |||
| 423 | Some((f.name, *enumm)) | ||
| 424 | }) | ||
| 425 | .collect(), | ||
| 426 | ) | ||
| 427 | }) | ||
| 428 | }) | ||
| 429 | .collect() | ||
| 430 | }; | ||
| 431 | |||
| 432 | // ======== | ||
| 362 | // Generate RccPeripheral impls | 433 | // Generate RccPeripheral impls |
| 363 | 434 | ||
| 364 | let refcounted_peripherals = HashSet::from(["usart", "adc"]); | 435 | let refcounted_peripherals = HashSet::from(["usart", "adc"]); |
| @@ -377,10 +448,8 @@ fn main() { | |||
| 377 | let rst_reg = format_ident!("{}", rst.register.to_ascii_lowercase()); | 448 | let rst_reg = format_ident!("{}", rst.register.to_ascii_lowercase()); |
| 378 | let set_rst_field = format_ident!("set_{}", rst.field.to_ascii_lowercase()); | 449 | let set_rst_field = format_ident!("set_{}", rst.field.to_ascii_lowercase()); |
| 379 | quote! { | 450 | quote! { |
| 380 | critical_section::with(|_| { | 451 | crate::pac::RCC.#rst_reg().modify(|w| w.#set_rst_field(true)); |
| 381 | crate::pac::RCC.#rst_reg().modify(|w| w.#set_rst_field(true)); | 452 | crate::pac::RCC.#rst_reg().modify(|w| w.#set_rst_field(false)); |
| 382 | crate::pac::RCC.#rst_reg().modify(|w| w.#set_rst_field(false)); | ||
| 383 | }); | ||
| 384 | } | 453 | } |
| 385 | } | 454 | } |
| 386 | None => TokenStream::new(), | 455 | None => TokenStream::new(), |
| @@ -397,9 +466,9 @@ fn main() { | |||
| 397 | 466 | ||
| 398 | let ptype = if let Some(reg) = &p.registers { reg.kind } else { "" }; | 467 | let ptype = if let Some(reg) = &p.registers { reg.kind } else { "" }; |
| 399 | let pname = format_ident!("{}", p.name); | 468 | let pname = format_ident!("{}", p.name); |
| 400 | let clk = format_ident!("{}", rcc.clock.to_ascii_lowercase()); | 469 | let clk = format_ident!("{}", rcc.clock); |
| 401 | let en_reg = format_ident!("{}", en.register.to_ascii_lowercase()); | 470 | let en_reg = format_ident!("{}", en.register); |
| 402 | let set_en_field = format_ident!("set_{}", en.field.to_ascii_lowercase()); | 471 | let set_en_field = format_ident!("set_{}", en.field); |
| 403 | 472 | ||
| 404 | let (before_enable, before_disable) = if refcounted_peripherals.contains(ptype) { | 473 | let (before_enable, before_disable) = if refcounted_peripherals.contains(ptype) { |
| 405 | let refcount_static = | 474 | let refcount_static = |
| @@ -425,31 +494,82 @@ fn main() { | |||
| 425 | (TokenStream::new(), TokenStream::new()) | 494 | (TokenStream::new(), TokenStream::new()) |
| 426 | }; | 495 | }; |
| 427 | 496 | ||
| 497 | let mux_supported = HashSet::from(["c0", "h5", "h50", "h7", "h7ab", "h7rm0433", "g4", "l4"]) | ||
| 498 | .contains(rcc_registers.version); | ||
| 499 | let mux_for = |mux: Option<&'static PeripheralRccRegister>| { | ||
| 500 | // restrict mux implementation to supported versions | ||
| 501 | if !mux_supported { | ||
| 502 | return None; | ||
| 503 | } | ||
| 504 | |||
| 505 | let mux = mux?; | ||
| 506 | let fieldset = rcc_enum_map.get(mux.register)?; | ||
| 507 | let enumm = fieldset.get(mux.field)?; | ||
| 508 | |||
| 509 | Some((mux, *enumm)) | ||
| 510 | }; | ||
| 511 | |||
| 512 | let clock_frequency = match mux_for(rcc.mux.as_ref()) { | ||
| 513 | Some((mux, rcc_enumm)) => { | ||
| 514 | let fieldset_name = format_ident!("{}", mux.register); | ||
| 515 | let field_name = format_ident!("{}", mux.field); | ||
| 516 | let enum_name = format_ident!("{}", rcc_enumm.name); | ||
| 517 | |||
| 518 | let match_arms: TokenStream = rcc_enumm | ||
| 519 | .variants | ||
| 520 | .iter() | ||
| 521 | .filter(|v| v.name != "DISABLE") | ||
| 522 | .map(|v| { | ||
| 523 | let variant_name = format_ident!("{}", v.name); | ||
| 524 | let clock_name = format_ident!("{}", v.name.to_ascii_lowercase()); | ||
| 525 | |||
| 526 | if v.name.starts_with("HCLK") || v.name.starts_with("PCLK") || v.name == "SYS" { | ||
| 527 | quote! { | ||
| 528 | #enum_name::#variant_name => unsafe { crate::rcc::get_freqs().#clock_name }, | ||
| 529 | } | ||
| 530 | } else { | ||
| 531 | quote! { | ||
| 532 | #enum_name::#variant_name => unsafe { crate::rcc::get_freqs().#clock_name.unwrap() }, | ||
| 533 | } | ||
| 534 | } | ||
| 535 | }) | ||
| 536 | .collect(); | ||
| 537 | |||
| 538 | quote! { | ||
| 539 | use crate::pac::rcc::vals::#enum_name; | ||
| 540 | |||
| 541 | #[allow(unreachable_patterns)] | ||
| 542 | match crate::pac::RCC.#fieldset_name().read().#field_name() { | ||
| 543 | #match_arms | ||
| 544 | |||
| 545 | _ => unreachable!(), | ||
| 546 | } | ||
| 547 | } | ||
| 548 | } | ||
| 549 | None => quote! { | ||
| 550 | unsafe { crate::rcc::get_freqs().#clk } | ||
| 551 | }, | ||
| 552 | }; | ||
| 553 | |||
| 428 | g.extend(quote! { | 554 | g.extend(quote! { |
| 429 | impl crate::rcc::sealed::RccPeripheral for peripherals::#pname { | 555 | impl crate::rcc::sealed::RccPeripheral for peripherals::#pname { |
| 430 | fn frequency() -> crate::time::Hertz { | 556 | fn frequency() -> crate::time::Hertz { |
| 431 | unsafe { crate::rcc::get_freqs().#clk } | 557 | #clock_frequency |
| 432 | } | 558 | } |
| 433 | fn enable() { | 559 | fn enable_and_reset_with_cs(_cs: critical_section::CriticalSection) { |
| 434 | critical_section::with(|_| { | 560 | #before_enable |
| 435 | #before_enable | 561 | #[cfg(feature = "low-power")] |
| 436 | #[cfg(feature = "low-power")] | 562 | crate::rcc::clock_refcount_add(_cs); |
| 437 | crate::rcc::clock_refcount_add(); | 563 | crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(true)); |
| 438 | crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(true)); | 564 | #after_enable |
| 439 | #after_enable | ||
| 440 | }) | ||
| 441 | } | ||
| 442 | fn disable() { | ||
| 443 | critical_section::with(|_| { | ||
| 444 | #before_disable | ||
| 445 | crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(false)); | ||
| 446 | #[cfg(feature = "low-power")] | ||
| 447 | crate::rcc::clock_refcount_sub(); | ||
| 448 | }) | ||
| 449 | } | ||
| 450 | fn reset() { | ||
| 451 | #rst | 565 | #rst |
| 452 | } | 566 | } |
| 567 | fn disable_with_cs(_cs: critical_section::CriticalSection) { | ||
| 568 | #before_disable | ||
| 569 | crate::pac::RCC.#en_reg().modify(|w| w.#set_en_field(false)); | ||
| 570 | #[cfg(feature = "low-power")] | ||
| 571 | crate::rcc::clock_refcount_sub(_cs); | ||
| 572 | } | ||
| 453 | } | 573 | } |
| 454 | 574 | ||
| 455 | impl crate::rcc::RccPeripheral for peripherals::#pname {} | 575 | impl crate::rcc::RccPeripheral for peripherals::#pname {} |
| @@ -457,12 +577,14 @@ fn main() { | |||
| 457 | } | 577 | } |
| 458 | } | 578 | } |
| 459 | 579 | ||
| 460 | let mut refcount_mod = TokenStream::new(); | 580 | let refcount_mod: TokenStream = refcount_statics |
| 461 | for refcount_static in refcount_statics { | 581 | .iter() |
| 462 | refcount_mod.extend(quote! { | 582 | .map(|refcount_static| { |
| 463 | pub(crate) static mut #refcount_static: u8 = 0; | 583 | quote! { |
| 464 | }); | 584 | pub(crate) static mut #refcount_static: u8 = 0; |
| 465 | } | 585 | } |
| 586 | }) | ||
| 587 | .collect(); | ||
| 466 | 588 | ||
| 467 | g.extend(quote! { | 589 | g.extend(quote! { |
| 468 | mod refcount_statics { | 590 | mod refcount_statics { |
| @@ -718,12 +840,17 @@ fn main() { | |||
| 718 | (("sdmmc", "D6"), quote!(crate::sdmmc::D6Pin)), | 840 | (("sdmmc", "D6"), quote!(crate::sdmmc::D6Pin)), |
| 719 | (("sdmmc", "D6"), quote!(crate::sdmmc::D7Pin)), | 841 | (("sdmmc", "D6"), quote!(crate::sdmmc::D7Pin)), |
| 720 | (("sdmmc", "D8"), quote!(crate::sdmmc::D8Pin)), | 842 | (("sdmmc", "D8"), quote!(crate::sdmmc::D8Pin)), |
| 721 | (("quadspi", "BK1_IO0"), quote!(crate::qspi::D0Pin)), | 843 | (("quadspi", "BK1_IO0"), quote!(crate::qspi::BK1D0Pin)), |
| 722 | (("quadspi", "BK1_IO1"), quote!(crate::qspi::D1Pin)), | 844 | (("quadspi", "BK1_IO1"), quote!(crate::qspi::BK1D1Pin)), |
| 723 | (("quadspi", "BK1_IO2"), quote!(crate::qspi::D2Pin)), | 845 | (("quadspi", "BK1_IO2"), quote!(crate::qspi::BK1D2Pin)), |
| 724 | (("quadspi", "BK1_IO3"), quote!(crate::qspi::D3Pin)), | 846 | (("quadspi", "BK1_IO3"), quote!(crate::qspi::BK1D3Pin)), |
| 847 | (("quadspi", "BK1_NCS"), quote!(crate::qspi::BK1NSSPin)), | ||
| 848 | (("quadspi", "BK2_IO0"), quote!(crate::qspi::BK2D0Pin)), | ||
| 849 | (("quadspi", "BK2_IO1"), quote!(crate::qspi::BK2D1Pin)), | ||
| 850 | (("quadspi", "BK2_IO2"), quote!(crate::qspi::BK2D2Pin)), | ||
| 851 | (("quadspi", "BK2_IO3"), quote!(crate::qspi::BK2D3Pin)), | ||
| 852 | (("quadspi", "BK2_NCS"), quote!(crate::qspi::BK2NSSPin)), | ||
| 725 | (("quadspi", "CLK"), quote!(crate::qspi::SckPin)), | 853 | (("quadspi", "CLK"), quote!(crate::qspi::SckPin)), |
| 726 | (("quadspi", "BK1_NCS"), quote!(crate::qspi::NSSPin)), | ||
| 727 | ].into(); | 854 | ].into(); |
| 728 | 855 | ||
| 729 | for p in METADATA.peripherals { | 856 | for p in METADATA.peripherals { |
| @@ -745,25 +872,8 @@ fn main() { | |||
| 745 | let af = pin.af.unwrap_or(0); | 872 | let af = pin.af.unwrap_or(0); |
| 746 | 873 | ||
| 747 | // MCO is special | 874 | // MCO is special |
| 748 | if pin.signal.starts_with("MCO_") { | 875 | if pin.signal.starts_with("MCO") { |
| 749 | // Supported in H7 only for now | 876 | peri = format_ident!("{}", pin.signal.replace('_', "")); |
| 750 | if regs.version.starts_with("h5") | ||
| 751 | || regs.version.starts_with("h7") | ||
| 752 | || regs.version.starts_with("f4") | ||
| 753 | { | ||
| 754 | peri = format_ident!("{}", pin.signal.replace('_', "")); | ||
| 755 | } else { | ||
| 756 | continue; | ||
| 757 | } | ||
| 758 | } | ||
| 759 | |||
| 760 | if pin.signal == "MCO" { | ||
| 761 | // Supported in H7 only for now | ||
| 762 | if regs.version.starts_with("l4") { | ||
| 763 | peri = format_ident!("MCO"); | ||
| 764 | } else { | ||
| 765 | continue; | ||
| 766 | } | ||
| 767 | } | 877 | } |
| 768 | 878 | ||
| 769 | g.extend(quote! { | 879 | g.extend(quote! { |
| @@ -804,6 +914,20 @@ fn main() { | |||
| 804 | } | 914 | } |
| 805 | } | 915 | } |
| 806 | 916 | ||
| 917 | if regs.kind == "opamp" { | ||
| 918 | if !pin.signal.starts_with("VP") { | ||
| 919 | continue; | ||
| 920 | } | ||
| 921 | |||
| 922 | let peri = format_ident!("{}", p.name); | ||
| 923 | let pin_name = format_ident!("{}", pin.pin); | ||
| 924 | let ch: u8 = pin.signal.strip_prefix("VP").unwrap().parse().unwrap(); | ||
| 925 | |||
| 926 | g.extend(quote! { | ||
| 927 | impl_opamp_pin!( #peri, #pin_name, #ch); | ||
| 928 | }) | ||
| 929 | } | ||
| 930 | |||
| 807 | // DAC is special | 931 | // DAC is special |
| 808 | if regs.kind == "dac" { | 932 | if regs.kind == "dac" { |
| 809 | let peri = format_ident!("{}", p.name); | 933 | let peri = format_ident!("{}", p.name); |
| @@ -889,6 +1013,97 @@ fn main() { | |||
| 889 | } | 1013 | } |
| 890 | 1014 | ||
| 891 | // ======== | 1015 | // ======== |
| 1016 | // Generate Div/Mul impls for RCC prescalers/dividers/multipliers. | ||
| 1017 | for e in rcc_registers.ir.enums { | ||
| 1018 | fn is_rcc_name(e: &str) -> bool { | ||
| 1019 | match e { | ||
| 1020 | "Pllp" | "Pllq" | "Pllr" | "Pllm" | "Plln" => true, | ||
| 1021 | "Timpre" | "Pllrclkpre" => false, | ||
| 1022 | e if e.ends_with("pre") || e.ends_with("pres") || e.ends_with("div") || e.ends_with("mul") => true, | ||
| 1023 | _ => false, | ||
| 1024 | } | ||
| 1025 | } | ||
| 1026 | |||
| 1027 | #[derive(Copy, Clone, Debug)] | ||
| 1028 | struct Frac { | ||
| 1029 | num: u32, | ||
| 1030 | denom: u32, | ||
| 1031 | } | ||
| 1032 | |||
| 1033 | impl Frac { | ||
| 1034 | fn simplify(self) -> Self { | ||
| 1035 | let d = gcd(self.num, self.denom); | ||
| 1036 | Self { | ||
| 1037 | num: self.num / d, | ||
| 1038 | denom: self.denom / d, | ||
| 1039 | } | ||
| 1040 | } | ||
| 1041 | } | ||
| 1042 | |||
| 1043 | fn gcd(a: u32, b: u32) -> u32 { | ||
| 1044 | if b == 0 { | ||
| 1045 | return a; | ||
| 1046 | } | ||
| 1047 | gcd(b, a % b) | ||
| 1048 | } | ||
| 1049 | |||
| 1050 | fn parse_num(n: &str) -> Result<Frac, ()> { | ||
| 1051 | for prefix in ["DIV", "MUL"] { | ||
| 1052 | if let Some(n) = n.strip_prefix(prefix) { | ||
| 1053 | let exponent = n.find('_').map(|e| n.len() - 1 - e).unwrap_or(0) as u32; | ||
| 1054 | let mantissa = n.replace('_', "").parse().map_err(|_| ())?; | ||
| 1055 | let f = Frac { | ||
| 1056 | num: mantissa, | ||
| 1057 | denom: 10u32.pow(exponent), | ||
| 1058 | }; | ||
| 1059 | return Ok(f.simplify()); | ||
| 1060 | } | ||
| 1061 | } | ||
| 1062 | Err(()) | ||
| 1063 | } | ||
| 1064 | |||
| 1065 | if is_rcc_name(e.name) { | ||
| 1066 | let enum_name = format_ident!("{}", e.name); | ||
| 1067 | let mut muls = Vec::new(); | ||
| 1068 | let mut divs = Vec::new(); | ||
| 1069 | for v in e.variants { | ||
| 1070 | let Ok(val) = parse_num(v.name) else { | ||
| 1071 | panic!("could not parse mul/div. enum={} variant={}", e.name, v.name) | ||
| 1072 | }; | ||
| 1073 | let variant_name = format_ident!("{}", v.name); | ||
| 1074 | let variant = quote!(crate::pac::rcc::vals::#enum_name::#variant_name); | ||
| 1075 | let num = val.num; | ||
| 1076 | let denom = val.denom; | ||
| 1077 | muls.push(quote!(#variant => self * #num / #denom,)); | ||
| 1078 | divs.push(quote!(#variant => self * #denom / #num,)); | ||
| 1079 | } | ||
| 1080 | |||
| 1081 | g.extend(quote! { | ||
| 1082 | impl core::ops::Div<crate::pac::rcc::vals::#enum_name> for crate::time::Hertz { | ||
| 1083 | type Output = crate::time::Hertz; | ||
| 1084 | fn div(self, rhs: crate::pac::rcc::vals::#enum_name) -> Self::Output { | ||
| 1085 | match rhs { | ||
| 1086 | #(#divs)* | ||
| 1087 | #[allow(unreachable_patterns)] | ||
| 1088 | _ => unreachable!(), | ||
| 1089 | } | ||
| 1090 | } | ||
| 1091 | } | ||
| 1092 | impl core::ops::Mul<crate::pac::rcc::vals::#enum_name> for crate::time::Hertz { | ||
| 1093 | type Output = crate::time::Hertz; | ||
| 1094 | fn mul(self, rhs: crate::pac::rcc::vals::#enum_name) -> Self::Output { | ||
| 1095 | match rhs { | ||
| 1096 | #(#muls)* | ||
| 1097 | #[allow(unreachable_patterns)] | ||
| 1098 | _ => unreachable!(), | ||
| 1099 | } | ||
| 1100 | } | ||
| 1101 | } | ||
| 1102 | }); | ||
| 1103 | } | ||
| 1104 | } | ||
| 1105 | |||
| 1106 | // ======== | ||
| 892 | // Write foreach_foo! macrotables | 1107 | // Write foreach_foo! macrotables |
| 893 | 1108 | ||
| 894 | let mut flash_regions_table: Vec<Vec<String>> = Vec::new(); | 1109 | let mut flash_regions_table: Vec<Vec<String>> = Vec::new(); |
diff --git a/embassy-stm32/src/adc/f1.rs b/embassy-stm32/src/adc/f1.rs index c13264819..ad0f13826 100644 --- a/embassy-stm32/src/adc/f1.rs +++ b/embassy-stm32/src/adc/f1.rs | |||
| @@ -51,8 +51,7 @@ impl<T: Instance> super::sealed::AdcPin<T> for Temperature { | |||
| 51 | impl<'d, T: Instance> Adc<'d, T> { | 51 | impl<'d, T: Instance> Adc<'d, T> { |
| 52 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { | 52 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { |
| 53 | into_ref!(adc); | 53 | into_ref!(adc); |
| 54 | T::enable(); | 54 | T::enable_and_reset(); |
| 55 | T::reset(); | ||
| 56 | T::regs().cr2().modify(|reg| reg.set_adon(true)); | 55 | T::regs().cr2().modify(|reg| reg.set_adon(true)); |
| 57 | 56 | ||
| 58 | // 11.4: Before starting a calibration, the ADC must have been in power-on state (ADON bit = ‘1’) | 57 | // 11.4: Before starting a calibration, the ADC must have been in power-on state (ADON bit = ‘1’) |
diff --git a/embassy-stm32/src/adc/f3.rs b/embassy-stm32/src/adc/f3.rs index 7c13f8106..6f59c230f 100644 --- a/embassy-stm32/src/adc/f3.rs +++ b/embassy-stm32/src/adc/f3.rs | |||
| @@ -64,8 +64,7 @@ impl<'d, T: Instance> Adc<'d, T> { | |||
| 64 | 64 | ||
| 65 | into_ref!(adc); | 65 | into_ref!(adc); |
| 66 | 66 | ||
| 67 | T::enable(); | 67 | T::enable_and_reset(); |
| 68 | T::reset(); | ||
| 69 | 68 | ||
| 70 | // Enable the adc regulator | 69 | // Enable the adc regulator |
| 71 | T::regs().cr().modify(|w| w.set_advregen(vals::Advregen::INTERMEDIATE)); | 70 | T::regs().cr().modify(|w| w.set_advregen(vals::Advregen::INTERMEDIATE)); |
diff --git a/embassy-stm32/src/adc/mod.rs b/embassy-stm32/src/adc/mod.rs index 365738a31..3e2980bf4 100644 --- a/embassy-stm32/src/adc/mod.rs +++ b/embassy-stm32/src/adc/mod.rs | |||
| @@ -74,9 +74,9 @@ pub(crate) mod sealed { | |||
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| 77 | #[cfg(not(any(adc_f1, adc_v1, adc_v2, adc_v4, adc_f3)))] | 77 | #[cfg(not(any(adc_f1, adc_v1, adc_v2, adc_v3, adc_v4, adc_f3, adc_g0)))] |
| 78 | pub trait Instance: sealed::Instance + crate::Peripheral<P = Self> {} | 78 | pub trait Instance: sealed::Instance + crate::Peripheral<P = Self> {} |
| 79 | #[cfg(any(adc_f1, adc_v1, adc_v2, adc_v4, adc_f3))] | 79 | #[cfg(any(adc_f1, adc_v1, adc_v2, adc_v3, adc_v4, adc_f3, adc_g0))] |
| 80 | pub trait Instance: sealed::Instance + crate::Peripheral<P = Self> + crate::rcc::RccPeripheral {} | 80 | pub trait Instance: sealed::Instance + crate::Peripheral<P = Self> + crate::rcc::RccPeripheral {} |
| 81 | 81 | ||
| 82 | pub trait AdcPin<T: Instance>: sealed::AdcPin<T> {} | 82 | pub trait AdcPin<T: Instance>: sealed::AdcPin<T> {} |
diff --git a/embassy-stm32/src/adc/v1.rs b/embassy-stm32/src/adc/v1.rs index fded26e40..852b027df 100644 --- a/embassy-stm32/src/adc/v1.rs +++ b/embassy-stm32/src/adc/v1.rs | |||
| @@ -61,8 +61,7 @@ impl<'d, T: Instance> Adc<'d, T> { | |||
| 61 | delay: &mut impl DelayUs<u32>, | 61 | delay: &mut impl DelayUs<u32>, |
| 62 | ) -> Self { | 62 | ) -> Self { |
| 63 | into_ref!(adc); | 63 | into_ref!(adc); |
| 64 | T::enable(); | 64 | T::enable_and_reset(); |
| 65 | T::reset(); | ||
| 66 | 65 | ||
| 67 | // Delay 1μs when using HSI14 as the ADC clock. | 66 | // Delay 1μs when using HSI14 as the ADC clock. |
| 68 | // | 67 | // |
diff --git a/embassy-stm32/src/adc/v2.rs b/embassy-stm32/src/adc/v2.rs index a669013c9..eda1324de 100644 --- a/embassy-stm32/src/adc/v2.rs +++ b/embassy-stm32/src/adc/v2.rs | |||
| @@ -95,8 +95,7 @@ where | |||
| 95 | { | 95 | { |
| 96 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { | 96 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { |
| 97 | into_ref!(adc); | 97 | into_ref!(adc); |
| 98 | T::enable(); | 98 | T::enable_and_reset(); |
| 99 | T::reset(); | ||
| 100 | 99 | ||
| 101 | let presc = Prescaler::from_pclk2(T::frequency()); | 100 | let presc = Prescaler::from_pclk2(T::frequency()); |
| 102 | T::common_regs().ccr().modify(|w| w.set_adcpre(presc.adcpre())); | 101 | T::common_regs().ccr().modify(|w| w.set_adcpre(presc.adcpre())); |
diff --git a/embassy-stm32/src/adc/v3.rs b/embassy-stm32/src/adc/v3.rs index 011ecc281..281a99f72 100644 --- a/embassy-stm32/src/adc/v3.rs +++ b/embassy-stm32/src/adc/v3.rs | |||
| @@ -9,19 +9,6 @@ pub const VREF_DEFAULT_MV: u32 = 3300; | |||
| 9 | /// VREF voltage used for factory calibration of VREFINTCAL register. | 9 | /// VREF voltage used for factory calibration of VREFINTCAL register. |
| 10 | pub const VREF_CALIB_MV: u32 = 3000; | 10 | pub const VREF_CALIB_MV: u32 = 3000; |
| 11 | 11 | ||
| 12 | /// Sadly we cannot use `RccPeripheral::enable` since devices are quite inconsistent ADC clock | ||
| 13 | /// configuration. | ||
| 14 | fn enable() { | ||
| 15 | critical_section::with(|_| { | ||
| 16 | #[cfg(any(stm32h7, stm32wl))] | ||
| 17 | crate::pac::RCC.apb2enr().modify(|w| w.set_adcen(true)); | ||
| 18 | #[cfg(stm32g0)] | ||
| 19 | crate::pac::RCC.apbenr2().modify(|w| w.set_adcen(true)); | ||
| 20 | #[cfg(any(stm32l4, stm32l5, stm32wb))] | ||
| 21 | crate::pac::RCC.ahb2enr().modify(|w| w.set_adcen(true)); | ||
| 22 | }); | ||
| 23 | } | ||
| 24 | |||
| 25 | pub struct VrefInt; | 12 | pub struct VrefInt; |
| 26 | impl<T: Instance> AdcPin<T> for VrefInt {} | 13 | impl<T: Instance> AdcPin<T> for VrefInt {} |
| 27 | impl<T: Instance> super::sealed::AdcPin<T> for VrefInt { | 14 | impl<T: Instance> super::sealed::AdcPin<T> for VrefInt { |
| @@ -61,7 +48,7 @@ impl<T: Instance> super::sealed::AdcPin<T> for Vbat { | |||
| 61 | impl<'d, T: Instance> Adc<'d, T> { | 48 | impl<'d, T: Instance> Adc<'d, T> { |
| 62 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { | 49 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u32>) -> Self { |
| 63 | into_ref!(adc); | 50 | into_ref!(adc); |
| 64 | enable(); | 51 | T::enable_and_reset(); |
| 65 | T::regs().cr().modify(|reg| { | 52 | T::regs().cr().modify(|reg| { |
| 66 | #[cfg(not(adc_g0))] | 53 | #[cfg(not(adc_g0))] |
| 67 | reg.set_deeppwd(false); | 54 | reg.set_deeppwd(false); |
diff --git a/embassy-stm32/src/adc/v4.rs b/embassy-stm32/src/adc/v4.rs index 655c0cb6a..d74617cb3 100644 --- a/embassy-stm32/src/adc/v4.rs +++ b/embassy-stm32/src/adc/v4.rs | |||
| @@ -127,8 +127,7 @@ impl Prescaler { | |||
| 127 | impl<'d, T: Instance> Adc<'d, T> { | 127 | impl<'d, T: Instance> Adc<'d, T> { |
| 128 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u16>) -> Self { | 128 | pub fn new(adc: impl Peripheral<P = T> + 'd, delay: &mut impl DelayUs<u16>) -> Self { |
| 129 | embassy_hal_internal::into_ref!(adc); | 129 | embassy_hal_internal::into_ref!(adc); |
| 130 | T::enable(); | 130 | T::enable_and_reset(); |
| 131 | T::reset(); | ||
| 132 | 131 | ||
| 133 | let prescaler = Prescaler::from_ker_ck(T::frequency()); | 132 | let prescaler = Prescaler::from_ker_ck(T::frequency()); |
| 134 | 133 | ||
diff --git a/embassy-stm32/src/can/bxcan.rs b/embassy-stm32/src/can/bxcan.rs index 7ad13cece..0d4bf692d 100644 --- a/embassy-stm32/src/can/bxcan.rs +++ b/embassy-stm32/src/can/bxcan.rs | |||
| @@ -136,8 +136,7 @@ impl<'d, T: Instance> Can<'d, T> { | |||
| 136 | rx.set_as_af(rx.af_num(), AFType::Input); | 136 | rx.set_as_af(rx.af_num(), AFType::Input); |
| 137 | tx.set_as_af(tx.af_num(), AFType::OutputPushPull); | 137 | tx.set_as_af(tx.af_num(), AFType::OutputPushPull); |
| 138 | 138 | ||
| 139 | T::enable(); | 139 | T::enable_and_reset(); |
| 140 | T::reset(); | ||
| 141 | 140 | ||
| 142 | { | 141 | { |
| 143 | use crate::pac::can::vals::{Errie, Fmpie, Tmeie}; | 142 | use crate::pac::can::vals::{Errie, Fmpie, Tmeie}; |
diff --git a/embassy-stm32/src/crc/v1.rs b/embassy-stm32/src/crc/v1.rs index 154f2eb91..c0f580830 100644 --- a/embassy-stm32/src/crc/v1.rs +++ b/embassy-stm32/src/crc/v1.rs | |||
| @@ -16,9 +16,7 @@ impl<'d> Crc<'d> { | |||
| 16 | 16 | ||
| 17 | // Note: enable and reset come from RccPeripheral. | 17 | // Note: enable and reset come from RccPeripheral. |
| 18 | // enable CRC clock in RCC. | 18 | // enable CRC clock in RCC. |
| 19 | CRC::enable(); | 19 | CRC::enable_and_reset(); |
| 20 | // Reset CRC to default values. | ||
| 21 | CRC::reset(); | ||
| 22 | // Peripheral the peripheral | 20 | // Peripheral the peripheral |
| 23 | let mut instance = Self { _peri: peripheral }; | 21 | let mut instance = Self { _peri: peripheral }; |
| 24 | instance.reset(); | 22 | instance.reset(); |
diff --git a/embassy-stm32/src/crc/v2v3.rs b/embassy-stm32/src/crc/v2v3.rs index de0c08755..b36f6018c 100644 --- a/embassy-stm32/src/crc/v2v3.rs +++ b/embassy-stm32/src/crc/v2v3.rs | |||
| @@ -69,16 +69,13 @@ impl<'d> Crc<'d> { | |||
| 69 | /// Instantiates the CRC32 peripheral and initializes it to default values. | 69 | /// Instantiates the CRC32 peripheral and initializes it to default values. |
| 70 | pub fn new(peripheral: impl Peripheral<P = CRC> + 'd, config: Config) -> Self { | 70 | pub fn new(peripheral: impl Peripheral<P = CRC> + 'd, config: Config) -> Self { |
| 71 | // Note: enable and reset come from RccPeripheral. | 71 | // Note: enable and reset come from RccPeripheral. |
| 72 | // enable CRC clock in RCC. | 72 | // reset to default values and enable CRC clock in RCC. |
| 73 | CRC::enable(); | 73 | CRC::enable_and_reset(); |
| 74 | // Reset CRC to default values. | ||
| 75 | CRC::reset(); | ||
| 76 | into_ref!(peripheral); | 74 | into_ref!(peripheral); |
| 77 | let mut instance = Self { | 75 | let mut instance = Self { |
| 78 | _peripheral: peripheral, | 76 | _peripheral: peripheral, |
| 79 | _config: config, | 77 | _config: config, |
| 80 | }; | 78 | }; |
| 81 | CRC::reset(); | ||
| 82 | instance.reconfigure(); | 79 | instance.reconfigure(); |
| 83 | instance.reset(); | 80 | instance.reset(); |
| 84 | instance | 81 | instance |
diff --git a/embassy-stm32/src/dac/mod.rs b/embassy-stm32/src/dac/mod.rs index a2040b857..3d1a820ed 100644 --- a/embassy-stm32/src/dac/mod.rs +++ b/embassy-stm32/src/dac/mod.rs | |||
| @@ -11,7 +11,7 @@ use crate::{peripherals, Peripheral}; | |||
| 11 | 11 | ||
| 12 | #[derive(Debug, Copy, Clone, Eq, PartialEq)] | 12 | #[derive(Debug, Copy, Clone, Eq, PartialEq)] |
| 13 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 13 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 14 | /// Curstom Errors | 14 | /// Custom Errors |
| 15 | pub enum Error { | 15 | pub enum Error { |
| 16 | UnconfiguredChannel, | 16 | UnconfiguredChannel, |
| 17 | InvalidValue, | 17 | InvalidValue, |
| @@ -255,8 +255,7 @@ impl<'d, T: Instance, Tx> DacCh1<'d, T, Tx> { | |||
| 255 | ) -> Self { | 255 | ) -> Self { |
| 256 | pin.set_as_analog(); | 256 | pin.set_as_analog(); |
| 257 | into_ref!(peri, dma); | 257 | into_ref!(peri, dma); |
| 258 | T::enable(); | 258 | T::enable_and_reset(); |
| 259 | T::reset(); | ||
| 260 | 259 | ||
| 261 | let mut dac = Self { _peri: peri, dma }; | 260 | let mut dac = Self { _peri: peri, dma }; |
| 262 | 261 | ||
| @@ -366,8 +365,7 @@ impl<'d, T: Instance, Tx> DacCh2<'d, T, Tx> { | |||
| 366 | ) -> Self { | 365 | ) -> Self { |
| 367 | pin.set_as_analog(); | 366 | pin.set_as_analog(); |
| 368 | into_ref!(_peri, dma); | 367 | into_ref!(_peri, dma); |
| 369 | T::enable(); | 368 | T::enable_and_reset(); |
| 370 | T::reset(); | ||
| 371 | 369 | ||
| 372 | let mut dac = Self { | 370 | let mut dac = Self { |
| 373 | phantom: PhantomData, | 371 | phantom: PhantomData, |
| @@ -483,8 +481,7 @@ impl<'d, T: Instance, TxCh1, TxCh2> Dac<'d, T, TxCh1, TxCh2> { | |||
| 483 | pin_ch1.set_as_analog(); | 481 | pin_ch1.set_as_analog(); |
| 484 | pin_ch2.set_as_analog(); | 482 | pin_ch2.set_as_analog(); |
| 485 | into_ref!(peri, dma_ch1, dma_ch2); | 483 | into_ref!(peri, dma_ch1, dma_ch2); |
| 486 | T::enable(); | 484 | T::enable_and_reset(); |
| 487 | T::reset(); | ||
| 488 | 485 | ||
| 489 | let mut dac_ch1 = DacCh1 { | 486 | let mut dac_ch1 = DacCh1 { |
| 490 | _peri: peri, | 487 | _peri: peri, |
| @@ -563,35 +560,26 @@ pub trait DacPin<T: Instance, const C: u8>: crate::gpio::Pin + 'static {} | |||
| 563 | 560 | ||
| 564 | foreach_peripheral!( | 561 | foreach_peripheral!( |
| 565 | (dac, $inst:ident) => { | 562 | (dac, $inst:ident) => { |
| 566 | // H7 uses single bit for both DAC1 and DAC2, this is a hack until a proper fix is implemented | 563 | // H7 uses single bit for both DAC1 and DAC2, this is a hack until a proper fix is implemented |
| 567 | #[cfg(rcc_h7)] | 564 | #[cfg(any(rcc_h7, rcc_h7rm0433))] |
| 568 | impl crate::rcc::sealed::RccPeripheral for peripherals::$inst { | 565 | impl crate::rcc::sealed::RccPeripheral for peripherals::$inst { |
| 569 | fn frequency() -> crate::time::Hertz { | 566 | fn frequency() -> crate::time::Hertz { |
| 570 | critical_section::with(|_| unsafe { crate::rcc::get_freqs().apb1 }) | 567 | critical_section::with(|_| unsafe { crate::rcc::get_freqs().pclk1 }) |
| 571 | } | 568 | } |
| 572 | 569 | ||
| 573 | fn reset() { | 570 | fn enable_and_reset_with_cs(_cs: critical_section::CriticalSection) { |
| 574 | critical_section::with(|_| { | 571 | crate::pac::RCC.apb1lrstr().modify(|w| w.set_dac12rst(true)); |
| 575 | crate::pac::RCC.apb1lrstr().modify(|w| w.set_dac12rst(true)); | 572 | crate::pac::RCC.apb1lrstr().modify(|w| w.set_dac12rst(false)); |
| 576 | crate::pac::RCC.apb1lrstr().modify(|w| w.set_dac12rst(false)); | 573 | crate::pac::RCC.apb1lenr().modify(|w| w.set_dac12en(true)); |
| 577 | }) | 574 | } |
| 578 | } | 575 | |
| 579 | 576 | fn disable_with_cs(_cs: critical_section::CriticalSection) { | |
| 580 | fn enable() { | 577 | crate::pac::RCC.apb1lenr().modify(|w| w.set_dac12en(false)) |
| 581 | critical_section::with(|_| { | 578 | } |
| 582 | crate::pac::RCC.apb1lenr().modify(|w| w.set_dac12en(true)); | 579 | } |
| 583 | }) | 580 | |
| 584 | } | 581 | #[cfg(any(rcc_h7, rcc_h7rm0433))] |
| 585 | 582 | impl crate::rcc::RccPeripheral for peripherals::$inst {} | |
| 586 | fn disable() { | ||
| 587 | critical_section::with(|_| { | ||
| 588 | crate::pac::RCC.apb1lenr().modify(|w| w.set_dac12en(false)) | ||
| 589 | }) | ||
| 590 | } | ||
| 591 | } | ||
| 592 | |||
| 593 | #[cfg(rcc_h7)] | ||
| 594 | impl crate::rcc::RccPeripheral for peripherals::$inst {} | ||
| 595 | 583 | ||
| 596 | impl crate::dac::sealed::Instance for peripherals::$inst { | 584 | impl crate::dac::sealed::Instance for peripherals::$inst { |
| 597 | fn regs() -> &'static crate::pac::dac::Dac { | 585 | fn regs() -> &'static crate::pac::dac::Dac { |
diff --git a/embassy-stm32/src/dcmi.rs b/embassy-stm32/src/dcmi.rs index 7497f4aaa..b12230794 100644 --- a/embassy-stm32/src/dcmi.rs +++ b/embassy-stm32/src/dcmi.rs | |||
| @@ -330,8 +330,7 @@ where | |||
| 330 | use_embedded_synchronization: bool, | 330 | use_embedded_synchronization: bool, |
| 331 | edm: u8, | 331 | edm: u8, |
| 332 | ) -> Self { | 332 | ) -> Self { |
| 333 | T::reset(); | 333 | T::enable_and_reset(); |
| 334 | T::enable(); | ||
| 335 | 334 | ||
| 336 | peri.regs().cr().modify(|r| { | 335 | peri.regs().cr().modify(|r| { |
| 337 | r.set_cm(true); // disable continuous mode (snapshot mode) | 336 | r.set_cm(true); // disable continuous mode (snapshot mode) |
diff --git a/embassy-stm32/src/dma/bdma.rs b/embassy-stm32/src/dma/bdma.rs index 20ff29bef..a7422f66b 100644 --- a/embassy-stm32/src/dma/bdma.rs +++ b/embassy-stm32/src/dma/bdma.rs | |||
| @@ -2,10 +2,9 @@ | |||
| 2 | 2 | ||
| 3 | use core::future::Future; | 3 | use core::future::Future; |
| 4 | use core::pin::Pin; | 4 | use core::pin::Pin; |
| 5 | use core::sync::atomic::{fence, Ordering}; | 5 | use core::sync::atomic::{fence, AtomicUsize, Ordering}; |
| 6 | use core::task::{Context, Poll, Waker}; | 6 | use core::task::{Context, Poll, Waker}; |
| 7 | 7 | ||
| 8 | use atomic_polyfill::AtomicUsize; | ||
| 9 | use embassy_hal_internal::{into_ref, Peripheral, PeripheralRef}; | 8 | use embassy_hal_internal::{into_ref, Peripheral, PeripheralRef}; |
| 10 | use embassy_sync::waitqueue::AtomicWaker; | 9 | use embassy_sync::waitqueue::AtomicWaker; |
| 11 | 10 | ||
| @@ -78,10 +77,10 @@ impl State { | |||
| 78 | static STATE: State = State::new(); | 77 | static STATE: State = State::new(); |
| 79 | 78 | ||
| 80 | /// safety: must be called only once | 79 | /// safety: must be called only once |
| 81 | pub(crate) unsafe fn init(irq_priority: Priority) { | 80 | pub(crate) unsafe fn init(cs: critical_section::CriticalSection, irq_priority: Priority) { |
| 82 | foreach_interrupt! { | 81 | foreach_interrupt! { |
| 83 | ($peri:ident, bdma, $block:ident, $signal_name:ident, $irq:ident) => { | 82 | ($peri:ident, bdma, $block:ident, $signal_name:ident, $irq:ident) => { |
| 84 | crate::interrupt::typelevel::$irq::set_priority(irq_priority); | 83 | crate::interrupt::typelevel::$irq::set_priority_with_cs(cs, irq_priority); |
| 85 | crate::interrupt::typelevel::$irq::enable(); | 84 | crate::interrupt::typelevel::$irq::enable(); |
| 86 | }; | 85 | }; |
| 87 | } | 86 | } |
| @@ -127,7 +126,13 @@ pub(crate) unsafe fn on_irq_inner(dma: pac::bdma::Dma, channel_num: usize, index | |||
| 127 | } else if isr.tcif(channel_num) && cr.read().tcie() { | 126 | } else if isr.tcif(channel_num) && cr.read().tcie() { |
| 128 | // Acknowledge transfer complete interrupt | 127 | // Acknowledge transfer complete interrupt |
| 129 | dma.ifcr().write(|w| w.set_tcif(channel_num, true)); | 128 | dma.ifcr().write(|w| w.set_tcif(channel_num, true)); |
| 129 | #[cfg(not(armv6m))] | ||
| 130 | STATE.complete_count[index].fetch_add(1, Ordering::Release); | 130 | STATE.complete_count[index].fetch_add(1, Ordering::Release); |
| 131 | #[cfg(armv6m)] | ||
| 132 | critical_section::with(|_| { | ||
| 133 | let x = STATE.complete_count[index].load(Ordering::Relaxed); | ||
| 134 | STATE.complete_count[index].store(x + 1, Ordering::Release); | ||
| 135 | }) | ||
| 131 | } else { | 136 | } else { |
| 132 | return; | 137 | return; |
| 133 | } | 138 | } |
| @@ -391,7 +396,14 @@ impl<'a, C: Channel> DmaCtrl for DmaCtrlImpl<'a, C> { | |||
| 391 | } | 396 | } |
| 392 | 397 | ||
| 393 | fn reset_complete_count(&mut self) -> usize { | 398 | fn reset_complete_count(&mut self) -> usize { |
| 394 | STATE.complete_count[self.0.index()].swap(0, Ordering::AcqRel) | 399 | #[cfg(not(armv6m))] |
| 400 | return STATE.complete_count[self.0.index()].swap(0, Ordering::AcqRel); | ||
| 401 | #[cfg(armv6m)] | ||
| 402 | return critical_section::with(|_| { | ||
| 403 | let x = STATE.complete_count[self.0.index()].load(Ordering::Acquire); | ||
| 404 | STATE.complete_count[self.0.index()].store(0, Ordering::Release); | ||
| 405 | x | ||
| 406 | }); | ||
| 395 | } | 407 | } |
| 396 | 408 | ||
| 397 | fn set_waker(&mut self, waker: &Waker) { | 409 | fn set_waker(&mut self, waker: &Waker) { |
diff --git a/embassy-stm32/src/dma/dma.rs b/embassy-stm32/src/dma/dma.rs index 5033ae477..cce0407c1 100644 --- a/embassy-stm32/src/dma/dma.rs +++ b/embassy-stm32/src/dma/dma.rs | |||
| @@ -154,10 +154,10 @@ impl State { | |||
| 154 | static STATE: State = State::new(); | 154 | static STATE: State = State::new(); |
| 155 | 155 | ||
| 156 | /// safety: must be called only once | 156 | /// safety: must be called only once |
| 157 | pub(crate) unsafe fn init(irq_priority: Priority) { | 157 | pub(crate) unsafe fn init(cs: critical_section::CriticalSection, irq_priority: Priority) { |
| 158 | foreach_interrupt! { | 158 | foreach_interrupt! { |
| 159 | ($peri:ident, dma, $block:ident, $signal_name:ident, $irq:ident) => { | 159 | ($peri:ident, dma, $block:ident, $signal_name:ident, $irq:ident) => { |
| 160 | interrupt::typelevel::$irq::set_priority(irq_priority); | 160 | interrupt::typelevel::$irq::set_priority_with_cs(cs, irq_priority); |
| 161 | interrupt::typelevel::$irq::enable(); | 161 | interrupt::typelevel::$irq::enable(); |
| 162 | }; | 162 | }; |
| 163 | } | 163 | } |
diff --git a/embassy-stm32/src/dma/dmamux.rs b/embassy-stm32/src/dma/dmamux.rs index 36fc03403..20601dc86 100644 --- a/embassy-stm32/src/dma/dmamux.rs +++ b/embassy-stm32/src/dma/dmamux.rs | |||
| @@ -47,6 +47,6 @@ foreach_dma_channel! { | |||
| 47 | } | 47 | } |
| 48 | 48 | ||
| 49 | /// safety: must be called only once | 49 | /// safety: must be called only once |
| 50 | pub(crate) unsafe fn init() { | 50 | pub(crate) unsafe fn init(_cs: critical_section::CriticalSection) { |
| 51 | crate::_generated::init_dmamux(); | 51 | crate::_generated::init_dmamux(); |
| 52 | } | 52 | } |
diff --git a/embassy-stm32/src/dma/gpdma.rs b/embassy-stm32/src/dma/gpdma.rs index 97cc200d7..b811da1fb 100644 --- a/embassy-stm32/src/dma/gpdma.rs +++ b/embassy-stm32/src/dma/gpdma.rs | |||
| @@ -53,10 +53,10 @@ impl State { | |||
| 53 | static STATE: State = State::new(); | 53 | static STATE: State = State::new(); |
| 54 | 54 | ||
| 55 | /// safety: must be called only once | 55 | /// safety: must be called only once |
| 56 | pub(crate) unsafe fn init(irq_priority: Priority) { | 56 | pub(crate) unsafe fn init(cs: critical_section::CriticalSection, irq_priority: Priority) { |
| 57 | foreach_interrupt! { | 57 | foreach_interrupt! { |
| 58 | ($peri:ident, gpdma, $block:ident, $signal_name:ident, $irq:ident) => { | 58 | ($peri:ident, gpdma, $block:ident, $signal_name:ident, $irq:ident) => { |
| 59 | crate::interrupt::typelevel::$irq::set_priority(irq_priority); | 59 | crate::interrupt::typelevel::$irq::set_priority_with_cs(cs, irq_priority); |
| 60 | crate::interrupt::typelevel::$irq::enable(); | 60 | crate::interrupt::typelevel::$irq::enable(); |
| 61 | }; | 61 | }; |
| 62 | } | 62 | } |
diff --git a/embassy-stm32/src/dma/mod.rs b/embassy-stm32/src/dma/mod.rs index 4f1a58ae2..29fced8fc 100644 --- a/embassy-stm32/src/dma/mod.rs +++ b/embassy-stm32/src/dma/mod.rs | |||
| @@ -56,16 +56,17 @@ pub(crate) fn slice_ptr_parts_mut<T>(slice: *mut [T]) -> (usize, usize) { | |||
| 56 | 56 | ||
| 57 | // safety: must be called only once at startup | 57 | // safety: must be called only once at startup |
| 58 | pub(crate) unsafe fn init( | 58 | pub(crate) unsafe fn init( |
| 59 | cs: critical_section::CriticalSection, | ||
| 59 | #[cfg(bdma)] bdma_priority: Priority, | 60 | #[cfg(bdma)] bdma_priority: Priority, |
| 60 | #[cfg(dma)] dma_priority: Priority, | 61 | #[cfg(dma)] dma_priority: Priority, |
| 61 | #[cfg(gpdma)] gpdma_priority: Priority, | 62 | #[cfg(gpdma)] gpdma_priority: Priority, |
| 62 | ) { | 63 | ) { |
| 63 | #[cfg(bdma)] | 64 | #[cfg(bdma)] |
| 64 | bdma::init(bdma_priority); | 65 | bdma::init(cs, bdma_priority); |
| 65 | #[cfg(dma)] | 66 | #[cfg(dma)] |
| 66 | dma::init(dma_priority); | 67 | dma::init(cs, dma_priority); |
| 67 | #[cfg(gpdma)] | 68 | #[cfg(gpdma)] |
| 68 | gpdma::init(gpdma_priority); | 69 | gpdma::init(cs, gpdma_priority); |
| 69 | #[cfg(dmamux)] | 70 | #[cfg(dmamux)] |
| 70 | dmamux::init(); | 71 | dmamux::init(cs); |
| 71 | } | 72 | } |
diff --git a/embassy-stm32/src/eth/generic_smi.rs b/embassy-stm32/src/eth/generic_smi.rs index 2ed46ca2c..1e1094a1c 100644 --- a/embassy-stm32/src/eth/generic_smi.rs +++ b/embassy-stm32/src/eth/generic_smi.rs | |||
| @@ -41,39 +41,40 @@ mod phy_consts { | |||
| 41 | } | 41 | } |
| 42 | use self::phy_consts::*; | 42 | use self::phy_consts::*; |
| 43 | 43 | ||
| 44 | /// Generic SMI Ethernet PHY | 44 | /// Generic SMI Ethernet PHY implementation |
| 45 | pub struct GenericSMI { | 45 | pub struct GenericSMI { |
| 46 | phy_addr: u8, | ||
| 46 | #[cfg(feature = "time")] | 47 | #[cfg(feature = "time")] |
| 47 | poll_interval: Duration, | 48 | poll_interval: Duration, |
| 48 | #[cfg(not(feature = "time"))] | ||
| 49 | _private: (), | ||
| 50 | } | 49 | } |
| 51 | 50 | ||
| 52 | impl GenericSMI { | 51 | impl GenericSMI { |
| 53 | pub fn new() -> Self { | 52 | /// Construct the PHY. It assumes the address `phy_addr` in the SMI communication |
| 53 | pub fn new(phy_addr: u8) -> Self { | ||
| 54 | Self { | 54 | Self { |
| 55 | phy_addr, | ||
| 55 | #[cfg(feature = "time")] | 56 | #[cfg(feature = "time")] |
| 56 | poll_interval: Duration::from_millis(500), | 57 | poll_interval: Duration::from_millis(500), |
| 57 | #[cfg(not(feature = "time"))] | ||
| 58 | _private: (), | ||
| 59 | } | 58 | } |
| 60 | } | 59 | } |
| 61 | } | 60 | } |
| 62 | 61 | ||
| 63 | unsafe impl PHY for GenericSMI { | 62 | unsafe impl PHY for GenericSMI { |
| 64 | /// Reset PHY and wait for it to come out of reset. | ||
| 65 | fn phy_reset<S: StationManagement>(&mut self, sm: &mut S) { | 63 | fn phy_reset<S: StationManagement>(&mut self, sm: &mut S) { |
| 66 | sm.smi_write(PHY_REG_BCR, PHY_REG_BCR_RESET); | 64 | sm.smi_write(self.phy_addr, PHY_REG_BCR, PHY_REG_BCR_RESET); |
| 67 | while sm.smi_read(PHY_REG_BCR) & PHY_REG_BCR_RESET == PHY_REG_BCR_RESET {} | 65 | while sm.smi_read(self.phy_addr, PHY_REG_BCR) & PHY_REG_BCR_RESET == PHY_REG_BCR_RESET {} |
| 68 | } | 66 | } |
| 69 | 67 | ||
| 70 | /// PHY initialisation. | ||
| 71 | fn phy_init<S: StationManagement>(&mut self, sm: &mut S) { | 68 | fn phy_init<S: StationManagement>(&mut self, sm: &mut S) { |
| 72 | // Clear WU CSR | 69 | // Clear WU CSR |
| 73 | self.smi_write_ext(sm, PHY_REG_WUCSR, 0); | 70 | self.smi_write_ext(sm, PHY_REG_WUCSR, 0); |
| 74 | 71 | ||
| 75 | // Enable auto-negotiation | 72 | // Enable auto-negotiation |
| 76 | sm.smi_write(PHY_REG_BCR, PHY_REG_BCR_AN | PHY_REG_BCR_ANRST | PHY_REG_BCR_100M); | 73 | sm.smi_write( |
| 74 | self.phy_addr, | ||
| 75 | PHY_REG_BCR, | ||
| 76 | PHY_REG_BCR_AN | PHY_REG_BCR_ANRST | PHY_REG_BCR_100M, | ||
| 77 | ); | ||
| 77 | } | 78 | } |
| 78 | 79 | ||
| 79 | fn poll_link<S: StationManagement>(&mut self, sm: &mut S, cx: &mut Context) -> bool { | 80 | fn poll_link<S: StationManagement>(&mut self, sm: &mut S, cx: &mut Context) -> bool { |
| @@ -83,7 +84,7 @@ unsafe impl PHY for GenericSMI { | |||
| 83 | #[cfg(feature = "time")] | 84 | #[cfg(feature = "time")] |
| 84 | let _ = Timer::after(self.poll_interval).poll_unpin(cx); | 85 | let _ = Timer::after(self.poll_interval).poll_unpin(cx); |
| 85 | 86 | ||
| 86 | let bsr = sm.smi_read(PHY_REG_BSR); | 87 | let bsr = sm.smi_read(self.phy_addr, PHY_REG_BSR); |
| 87 | 88 | ||
| 88 | // No link without autonegotiate | 89 | // No link without autonegotiate |
| 89 | if bsr & PHY_REG_BSR_ANDONE == 0 { | 90 | if bsr & PHY_REG_BSR_ANDONE == 0 { |
| @@ -108,9 +109,9 @@ impl GenericSMI { | |||
| 108 | 109 | ||
| 109 | // Writes a value to an extended PHY register in MMD address space | 110 | // Writes a value to an extended PHY register in MMD address space |
| 110 | fn smi_write_ext<S: StationManagement>(&mut self, sm: &mut S, reg_addr: u16, reg_data: u16) { | 111 | fn smi_write_ext<S: StationManagement>(&mut self, sm: &mut S, reg_addr: u16, reg_data: u16) { |
| 111 | sm.smi_write(PHY_REG_CTL, 0x0003); // set address | 112 | sm.smi_write(self.phy_addr, PHY_REG_CTL, 0x0003); // set address |
| 112 | sm.smi_write(PHY_REG_ADDAR, reg_addr); | 113 | sm.smi_write(self.phy_addr, PHY_REG_ADDAR, reg_addr); |
| 113 | sm.smi_write(PHY_REG_CTL, 0x4003); // set data | 114 | sm.smi_write(self.phy_addr, PHY_REG_CTL, 0x4003); // set data |
| 114 | sm.smi_write(PHY_REG_ADDAR, reg_data); | 115 | sm.smi_write(self.phy_addr, PHY_REG_ADDAR, reg_data); |
| 115 | } | 116 | } |
| 116 | } | 117 | } |
diff --git a/embassy-stm32/src/eth/mod.rs b/embassy-stm32/src/eth/mod.rs index 1e057235a..556aadd73 100644 --- a/embassy-stm32/src/eth/mod.rs +++ b/embassy-stm32/src/eth/mod.rs | |||
| @@ -134,9 +134,9 @@ impl<'a, 'd> embassy_net_driver::TxToken for TxToken<'a, 'd> { | |||
| 134 | /// The methods cannot move out of self | 134 | /// The methods cannot move out of self |
| 135 | pub unsafe trait StationManagement { | 135 | pub unsafe trait StationManagement { |
| 136 | /// Read a register over SMI. | 136 | /// Read a register over SMI. |
| 137 | fn smi_read(&mut self, reg: u8) -> u16; | 137 | fn smi_read(&mut self, phy_addr: u8, reg: u8) -> u16; |
| 138 | /// Write a register over SMI. | 138 | /// Write a register over SMI. |
| 139 | fn smi_write(&mut self, reg: u8, val: u16); | 139 | fn smi_write(&mut self, phy_addr: u8, reg: u8, val: u16); |
| 140 | } | 140 | } |
| 141 | 141 | ||
| 142 | /// Traits for an Ethernet PHY | 142 | /// Traits for an Ethernet PHY |
diff --git a/embassy-stm32/src/eth/v1/mod.rs b/embassy-stm32/src/eth/v1/mod.rs index 4d19103dd..13e53f687 100644 --- a/embassy-stm32/src/eth/v1/mod.rs +++ b/embassy-stm32/src/eth/v1/mod.rs | |||
| @@ -107,7 +107,6 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 107 | tx_en: impl Peripheral<P = impl TXEnPin<T>> + 'd, | 107 | tx_en: impl Peripheral<P = impl TXEnPin<T>> + 'd, |
| 108 | phy: P, | 108 | phy: P, |
| 109 | mac_addr: [u8; 6], | 109 | mac_addr: [u8; 6], |
| 110 | phy_addr: u8, | ||
| 111 | ) -> Self { | 110 | ) -> Self { |
| 112 | into_ref!(peri, ref_clk, mdio, mdc, crs, rx_d0, rx_d1, tx_d0, tx_d1, tx_en); | 111 | into_ref!(peri, ref_clk, mdio, mdc, crs, rx_d0, rx_d1, tx_d0, tx_d1, tx_en); |
| 113 | 112 | ||
| @@ -192,7 +191,7 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 192 | // TODO MTU size setting not found for v1 ethernet, check if correct | 191 | // TODO MTU size setting not found for v1 ethernet, check if correct |
| 193 | 192 | ||
| 194 | // NOTE(unsafe) We got the peripheral singleton, which means that `rcc::init` was called | 193 | // NOTE(unsafe) We got the peripheral singleton, which means that `rcc::init` was called |
| 195 | let hclk = unsafe { crate::rcc::get_freqs() }.ahb1; | 194 | let hclk = unsafe { crate::rcc::get_freqs() }.hclk1; |
| 196 | let hclk_mhz = hclk.0 / 1_000_000; | 195 | let hclk_mhz = hclk.0 / 1_000_000; |
| 197 | 196 | ||
| 198 | // Set the MDC clock frequency in the range 1MHz - 2.5MHz | 197 | // Set the MDC clock frequency in the range 1MHz - 2.5MHz |
| @@ -227,7 +226,6 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 227 | station_management: EthernetStationManagement { | 226 | station_management: EthernetStationManagement { |
| 228 | peri: PhantomData, | 227 | peri: PhantomData, |
| 229 | clock_range: clock_range, | 228 | clock_range: clock_range, |
| 230 | phy_addr: phy_addr, | ||
| 231 | }, | 229 | }, |
| 232 | mac_addr, | 230 | mac_addr, |
| 233 | tx: TDesRing::new(&mut queue.tx_desc, &mut queue.tx_buf), | 231 | tx: TDesRing::new(&mut queue.tx_desc, &mut queue.tx_buf), |
| @@ -271,15 +269,14 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 271 | pub struct EthernetStationManagement<T: Instance> { | 269 | pub struct EthernetStationManagement<T: Instance> { |
| 272 | peri: PhantomData<T>, | 270 | peri: PhantomData<T>, |
| 273 | clock_range: Cr, | 271 | clock_range: Cr, |
| 274 | phy_addr: u8, | ||
| 275 | } | 272 | } |
| 276 | 273 | ||
| 277 | unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { | 274 | unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { |
| 278 | fn smi_read(&mut self, reg: u8) -> u16 { | 275 | fn smi_read(&mut self, phy_addr: u8, reg: u8) -> u16 { |
| 279 | let mac = ETH.ethernet_mac(); | 276 | let mac = ETH.ethernet_mac(); |
| 280 | 277 | ||
| 281 | mac.macmiiar().modify(|w| { | 278 | mac.macmiiar().modify(|w| { |
| 282 | w.set_pa(self.phy_addr); | 279 | w.set_pa(phy_addr); |
| 283 | w.set_mr(reg); | 280 | w.set_mr(reg); |
| 284 | w.set_mw(Mw::READ); // read operation | 281 | w.set_mw(Mw::READ); // read operation |
| 285 | w.set_cr(self.clock_range); | 282 | w.set_cr(self.clock_range); |
| @@ -289,12 +286,12 @@ unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { | |||
| 289 | mac.macmiidr().read().md() | 286 | mac.macmiidr().read().md() |
| 290 | } | 287 | } |
| 291 | 288 | ||
| 292 | fn smi_write(&mut self, reg: u8, val: u16) { | 289 | fn smi_write(&mut self, phy_addr: u8, reg: u8, val: u16) { |
| 293 | let mac = ETH.ethernet_mac(); | 290 | let mac = ETH.ethernet_mac(); |
| 294 | 291 | ||
| 295 | mac.macmiidr().write(|w| w.set_md(val)); | 292 | mac.macmiidr().write(|w| w.set_md(val)); |
| 296 | mac.macmiiar().modify(|w| { | 293 | mac.macmiiar().modify(|w| { |
| 297 | w.set_pa(self.phy_addr); | 294 | w.set_pa(phy_addr); |
| 298 | w.set_mr(reg); | 295 | w.set_mr(reg); |
| 299 | w.set_mw(Mw::WRITE); // write | 296 | w.set_mw(Mw::WRITE); // write |
| 300 | w.set_cr(self.clock_range); | 297 | w.set_cr(self.clock_range); |
diff --git a/embassy-stm32/src/eth/v2/mod.rs b/embassy-stm32/src/eth/v2/mod.rs index 6efd40e3e..c77155fea 100644 --- a/embassy-stm32/src/eth/v2/mod.rs +++ b/embassy-stm32/src/eth/v2/mod.rs | |||
| @@ -71,7 +71,6 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 71 | tx_en: impl Peripheral<P = impl TXEnPin<T>> + 'd, | 71 | tx_en: impl Peripheral<P = impl TXEnPin<T>> + 'd, |
| 72 | phy: P, | 72 | phy: P, |
| 73 | mac_addr: [u8; 6], | 73 | mac_addr: [u8; 6], |
| 74 | phy_addr: u8, | ||
| 75 | ) -> Self { | 74 | ) -> Self { |
| 76 | into_ref!(peri, ref_clk, mdio, mdc, crs, rx_d0, rx_d1, tx_d0, tx_d1, tx_en); | 75 | into_ref!(peri, ref_clk, mdio, mdc, crs, rx_d0, rx_d1, tx_d0, tx_d1, tx_en); |
| 77 | 76 | ||
| @@ -165,7 +164,7 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 165 | }); | 164 | }); |
| 166 | 165 | ||
| 167 | // NOTE(unsafe) We got the peripheral singleton, which means that `rcc::init` was called | 166 | // NOTE(unsafe) We got the peripheral singleton, which means that `rcc::init` was called |
| 168 | let hclk = unsafe { crate::rcc::get_freqs() }.ahb1; | 167 | let hclk = unsafe { crate::rcc::get_freqs() }.hclk1; |
| 169 | let hclk_mhz = hclk.0 / 1_000_000; | 168 | let hclk_mhz = hclk.0 / 1_000_000; |
| 170 | 169 | ||
| 171 | // Set the MDC clock frequency in the range 1MHz - 2.5MHz | 170 | // Set the MDC clock frequency in the range 1MHz - 2.5MHz |
| @@ -202,7 +201,6 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 202 | station_management: EthernetStationManagement { | 201 | station_management: EthernetStationManagement { |
| 203 | peri: PhantomData, | 202 | peri: PhantomData, |
| 204 | clock_range: clock_range, | 203 | clock_range: clock_range, |
| 205 | phy_addr: phy_addr, | ||
| 206 | }, | 204 | }, |
| 207 | mac_addr, | 205 | mac_addr, |
| 208 | }; | 206 | }; |
| @@ -242,15 +240,14 @@ impl<'d, T: Instance, P: PHY> Ethernet<'d, T, P> { | |||
| 242 | pub struct EthernetStationManagement<T: Instance> { | 240 | pub struct EthernetStationManagement<T: Instance> { |
| 243 | peri: PhantomData<T>, | 241 | peri: PhantomData<T>, |
| 244 | clock_range: u8, | 242 | clock_range: u8, |
| 245 | phy_addr: u8, | ||
| 246 | } | 243 | } |
| 247 | 244 | ||
| 248 | unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { | 245 | unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { |
| 249 | fn smi_read(&mut self, reg: u8) -> u16 { | 246 | fn smi_read(&mut self, phy_addr: u8, reg: u8) -> u16 { |
| 250 | let mac = ETH.ethernet_mac(); | 247 | let mac = ETH.ethernet_mac(); |
| 251 | 248 | ||
| 252 | mac.macmdioar().modify(|w| { | 249 | mac.macmdioar().modify(|w| { |
| 253 | w.set_pa(self.phy_addr); | 250 | w.set_pa(phy_addr); |
| 254 | w.set_rda(reg); | 251 | w.set_rda(reg); |
| 255 | w.set_goc(0b11); // read | 252 | w.set_goc(0b11); // read |
| 256 | w.set_cr(self.clock_range); | 253 | w.set_cr(self.clock_range); |
| @@ -260,12 +257,12 @@ unsafe impl<T: Instance> StationManagement for EthernetStationManagement<T> { | |||
| 260 | mac.macmdiodr().read().md() | 257 | mac.macmdiodr().read().md() |
| 261 | } | 258 | } |
| 262 | 259 | ||
| 263 | fn smi_write(&mut self, reg: u8, val: u16) { | 260 | fn smi_write(&mut self, phy_addr: u8, reg: u8, val: u16) { |
| 264 | let mac = ETH.ethernet_mac(); | 261 | let mac = ETH.ethernet_mac(); |
| 265 | 262 | ||
| 266 | mac.macmdiodr().write(|w| w.set_md(val)); | 263 | mac.macmdiodr().write(|w| w.set_md(val)); |
| 267 | mac.macmdioar().modify(|w| { | 264 | mac.macmdioar().modify(|w| { |
| 268 | w.set_pa(self.phy_addr); | 265 | w.set_pa(phy_addr); |
| 269 | w.set_rda(reg); | 266 | w.set_rda(reg); |
| 270 | w.set_goc(0b01); // write | 267 | w.set_goc(0b01); // write |
| 271 | w.set_cr(self.clock_range); | 268 | w.set_cr(self.clock_range); |
diff --git a/embassy-stm32/src/exti.rs b/embassy-stm32/src/exti.rs index 62f321709..538791a51 100644 --- a/embassy-stm32/src/exti.rs +++ b/embassy-stm32/src/exti.rs | |||
| @@ -367,7 +367,7 @@ macro_rules! enable_irq { | |||
| 367 | } | 367 | } |
| 368 | 368 | ||
| 369 | /// safety: must be called only once | 369 | /// safety: must be called only once |
| 370 | pub(crate) unsafe fn init() { | 370 | pub(crate) unsafe fn init(_cs: critical_section::CriticalSection) { |
| 371 | use crate::interrupt::typelevel::Interrupt; | 371 | use crate::interrupt::typelevel::Interrupt; |
| 372 | 372 | ||
| 373 | foreach_exti_irq!(enable_irq); | 373 | foreach_exti_irq!(enable_irq); |
diff --git a/embassy-stm32/src/flash/f0.rs b/embassy-stm32/src/flash/f0.rs index d011522be..1ab8435a0 100644 --- a/embassy-stm32/src/flash/f0.rs +++ b/embassy-stm32/src/flash/f0.rs | |||
| @@ -19,8 +19,10 @@ pub(crate) unsafe fn lock() { | |||
| 19 | } | 19 | } |
| 20 | 20 | ||
| 21 | pub(crate) unsafe fn unlock() { | 21 | pub(crate) unsafe fn unlock() { |
| 22 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0x4567_0123)); | 22 | if pac::FLASH.cr().read().lock() { |
| 23 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0xCDEF_89AB)); | 23 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0x4567_0123)); |
| 24 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0xCDEF_89AB)); | ||
| 25 | } | ||
| 24 | } | 26 | } |
| 25 | 27 | ||
| 26 | pub(crate) unsafe fn enable_blocking_write() { | 28 | pub(crate) unsafe fn enable_blocking_write() { |
diff --git a/embassy-stm32/src/flash/f3.rs b/embassy-stm32/src/flash/f3.rs index 065369f64..7e6d7ca26 100644 --- a/embassy-stm32/src/flash/f3.rs +++ b/embassy-stm32/src/flash/f3.rs | |||
| @@ -19,8 +19,10 @@ pub(crate) unsafe fn lock() { | |||
| 19 | } | 19 | } |
| 20 | 20 | ||
| 21 | pub(crate) unsafe fn unlock() { | 21 | pub(crate) unsafe fn unlock() { |
| 22 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0x4567_0123)); | 22 | if pac::FLASH.cr().read().lock() { |
| 23 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0xCDEF_89AB)); | 23 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0x4567_0123)); |
| 24 | pac::FLASH.keyr().write(|w| w.set_fkeyr(0xCDEF_89AB)); | ||
| 25 | } | ||
| 24 | } | 26 | } |
| 25 | 27 | ||
| 26 | pub(crate) unsafe fn enable_blocking_write() { | 28 | pub(crate) unsafe fn enable_blocking_write() { |
diff --git a/embassy-stm32/src/flash/f4.rs b/embassy-stm32/src/flash/f4.rs index 913950fe5..81deaa179 100644 --- a/embassy-stm32/src/flash/f4.rs +++ b/embassy-stm32/src/flash/f4.rs | |||
| @@ -228,8 +228,10 @@ pub(crate) unsafe fn lock() { | |||
| 228 | } | 228 | } |
| 229 | 229 | ||
| 230 | pub(crate) unsafe fn unlock() { | 230 | pub(crate) unsafe fn unlock() { |
| 231 | pac::FLASH.keyr().write(|w| w.set_key(0x45670123)); | 231 | if pac::FLASH.cr().read().lock() { |
| 232 | pac::FLASH.keyr().write(|w| w.set_key(0xCDEF89AB)); | 232 | pac::FLASH.keyr().write(|w| w.set_key(0x45670123)); |
| 233 | pac::FLASH.keyr().write(|w| w.set_key(0xCDEF89AB)); | ||
| 234 | } | ||
| 233 | } | 235 | } |
| 234 | 236 | ||
| 235 | pub(crate) unsafe fn enable_write() { | 237 | pub(crate) unsafe fn enable_write() { |
diff --git a/embassy-stm32/src/flash/f7.rs b/embassy-stm32/src/flash/f7.rs index 3a5bdf9c5..b52231ca8 100644 --- a/embassy-stm32/src/flash/f7.rs +++ b/embassy-stm32/src/flash/f7.rs | |||
| @@ -19,8 +19,10 @@ pub(crate) unsafe fn lock() { | |||
| 19 | } | 19 | } |
| 20 | 20 | ||
| 21 | pub(crate) unsafe fn unlock() { | 21 | pub(crate) unsafe fn unlock() { |
| 22 | pac::FLASH.keyr().write(|w| w.set_key(0x4567_0123)); | 22 | if pac::FLASH.cr().read().lock() { |
| 23 | pac::FLASH.keyr().write(|w| w.set_key(0xCDEF_89AB)); | 23 | pac::FLASH.keyr().write(|w| w.set_key(0x4567_0123)); |
| 24 | pac::FLASH.keyr().write(|w| w.set_key(0xCDEF_89AB)); | ||
| 25 | } | ||
| 24 | } | 26 | } |
| 25 | 27 | ||
| 26 | pub(crate) unsafe fn enable_blocking_write() { | 28 | pub(crate) unsafe fn enable_blocking_write() { |
diff --git a/embassy-stm32/src/flash/g0.rs b/embassy-stm32/src/flash/g0.rs index 3a4576016..19a388970 100644 --- a/embassy-stm32/src/flash/g0.rs +++ b/embassy-stm32/src/flash/g0.rs | |||
| @@ -24,8 +24,10 @@ pub(crate) unsafe fn unlock() { | |||
| 24 | while pac::FLASH.sr().read().bsy() {} | 24 | while pac::FLASH.sr().read().bsy() {} |
| 25 | 25 | ||
| 26 | // Unlock flash | 26 | // Unlock flash |
| 27 | pac::FLASH.keyr().write(|w| w.set_keyr(0x4567_0123)); | 27 | if pac::FLASH.cr().read().lock() { |
| 28 | pac::FLASH.keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | 28 | pac::FLASH.keyr().write(|w| w.set_keyr(0x4567_0123)); |
| 29 | pac::FLASH.keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | ||
| 30 | } | ||
| 29 | } | 31 | } |
| 30 | 32 | ||
| 31 | pub(crate) unsafe fn enable_blocking_write() { | 33 | pub(crate) unsafe fn enable_blocking_write() { |
diff --git a/embassy-stm32/src/flash/h7.rs b/embassy-stm32/src/flash/h7.rs index 625bf13fc..b064fd6ea 100644 --- a/embassy-stm32/src/flash/h7.rs +++ b/embassy-stm32/src/flash/h7.rs | |||
| @@ -26,11 +26,15 @@ pub(crate) unsafe fn lock() { | |||
| 26 | } | 26 | } |
| 27 | 27 | ||
| 28 | pub(crate) unsafe fn unlock() { | 28 | pub(crate) unsafe fn unlock() { |
| 29 | pac::FLASH.bank(0).keyr().write(|w| w.set_keyr(0x4567_0123)); | 29 | if pac::FLASH.bank(0).cr().read().lock() { |
| 30 | pac::FLASH.bank(0).keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | 30 | pac::FLASH.bank(0).keyr().write(|w| w.set_keyr(0x4567_0123)); |
| 31 | pac::FLASH.bank(0).keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | ||
| 32 | } | ||
| 31 | if is_dual_bank() { | 33 | if is_dual_bank() { |
| 32 | pac::FLASH.bank(1).keyr().write(|w| w.set_keyr(0x4567_0123)); | 34 | if pac::FLASH.bank(1).cr().read().lock() { |
| 33 | pac::FLASH.bank(1).keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | 35 | pac::FLASH.bank(1).keyr().write(|w| w.set_keyr(0x4567_0123)); |
| 36 | pac::FLASH.bank(1).keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | ||
| 37 | } | ||
| 34 | } | 38 | } |
| 35 | } | 39 | } |
| 36 | 40 | ||
diff --git a/embassy-stm32/src/flash/l.rs b/embassy-stm32/src/flash/l.rs index 24dcf99bc..1db0da923 100644 --- a/embassy-stm32/src/flash/l.rs +++ b/embassy-stm32/src/flash/l.rs | |||
| @@ -28,17 +28,23 @@ pub(crate) unsafe fn lock() { | |||
| 28 | pub(crate) unsafe fn unlock() { | 28 | pub(crate) unsafe fn unlock() { |
| 29 | #[cfg(any(flash_wl, flash_wb, flash_l4))] | 29 | #[cfg(any(flash_wl, flash_wb, flash_l4))] |
| 30 | { | 30 | { |
| 31 | pac::FLASH.keyr().write(|w| w.set_keyr(0x4567_0123)); | 31 | if pac::FLASH.cr().read().lock() { |
| 32 | pac::FLASH.keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | 32 | pac::FLASH.keyr().write(|w| w.set_keyr(0x4567_0123)); |
| 33 | pac::FLASH.keyr().write(|w| w.set_keyr(0xCDEF_89AB)); | ||
| 34 | } | ||
| 33 | } | 35 | } |
| 34 | 36 | ||
| 35 | #[cfg(any(flash_l0, flash_l1))] | 37 | #[cfg(any(flash_l0, flash_l1))] |
| 36 | { | 38 | { |
| 37 | pac::FLASH.pekeyr().write(|w| w.set_pekeyr(0x89ABCDEF)); | 39 | if pac::FLASH.pecr().read().pelock() { |
| 38 | pac::FLASH.pekeyr().write(|w| w.set_pekeyr(0x02030405)); | 40 | pac::FLASH.pekeyr().write(|w| w.set_pekeyr(0x89ABCDEF)); |
| 41 | pac::FLASH.pekeyr().write(|w| w.set_pekeyr(0x02030405)); | ||
| 42 | } | ||
| 39 | 43 | ||
| 40 | pac::FLASH.prgkeyr().write(|w| w.set_prgkeyr(0x8C9DAEBF)); | 44 | if pac::FLASH.pecr().read().prglock() { |
| 41 | pac::FLASH.prgkeyr().write(|w| w.set_prgkeyr(0x13141516)); | 45 | pac::FLASH.prgkeyr().write(|w| w.set_prgkeyr(0x8C9DAEBF)); |
| 46 | pac::FLASH.prgkeyr().write(|w| w.set_prgkeyr(0x13141516)); | ||
| 47 | } | ||
| 42 | } | 48 | } |
| 43 | } | 49 | } |
| 44 | 50 | ||
diff --git a/embassy-stm32/src/fmc.rs b/embassy-stm32/src/fmc.rs index 177e66a91..d6e25996c 100644 --- a/embassy-stm32/src/fmc.rs +++ b/embassy-stm32/src/fmc.rs | |||
| @@ -19,8 +19,7 @@ where | |||
| 19 | const REGISTERS: *const () = T::REGS.as_ptr() as *const _; | 19 | const REGISTERS: *const () = T::REGS.as_ptr() as *const _; |
| 20 | 20 | ||
| 21 | fn enable(&mut self) { | 21 | fn enable(&mut self) { |
| 22 | <T as crate::rcc::sealed::RccPeripheral>::enable(); | 22 | T::enable_and_reset(); |
| 23 | <T as crate::rcc::sealed::RccPeripheral>::reset(); | ||
| 24 | } | 23 | } |
| 25 | 24 | ||
| 26 | fn memory_controller_enable(&mut self) { | 25 | fn memory_controller_enable(&mut self) { |
diff --git a/embassy-stm32/src/gpio.rs b/embassy-stm32/src/gpio.rs index c709d46da..e1702b008 100644 --- a/embassy-stm32/src/gpio.rs +++ b/embassy-stm32/src/gpio.rs | |||
| @@ -1,6 +1,7 @@ | |||
| 1 | #![macro_use] | 1 | #![macro_use] |
| 2 | use core::convert::Infallible; | 2 | use core::convert::Infallible; |
| 3 | 3 | ||
| 4 | use critical_section::CriticalSection; | ||
| 4 | use embassy_hal_internal::{impl_peripheral, into_ref, PeripheralRef}; | 5 | use embassy_hal_internal::{impl_peripheral, into_ref, PeripheralRef}; |
| 5 | 6 | ||
| 6 | use crate::pac::gpio::{self, vals}; | 7 | use crate::pac::gpio::{self, vals}; |
| @@ -757,9 +758,9 @@ foreach_pin!( | |||
| 757 | }; | 758 | }; |
| 758 | ); | 759 | ); |
| 759 | 760 | ||
| 760 | pub(crate) unsafe fn init() { | 761 | pub(crate) unsafe fn init(_cs: CriticalSection) { |
| 761 | #[cfg(afio)] | 762 | #[cfg(afio)] |
| 762 | <crate::peripherals::AFIO as crate::rcc::sealed::RccPeripheral>::enable(); | 763 | <crate::peripherals::AFIO as crate::rcc::sealed::RccPeripheral>::enable_and_reset_with_cs(_cs); |
| 763 | 764 | ||
| 764 | crate::_generated::init_gpio(); | 765 | crate::_generated::init_gpio(); |
| 765 | } | 766 | } |
| @@ -974,6 +975,18 @@ mod eh1 { | |||
| 974 | type Error = Infallible; | 975 | type Error = Infallible; |
| 975 | } | 976 | } |
| 976 | 977 | ||
| 978 | impl<'d, T: Pin> InputPin for OutputOpenDrain<'d, T> { | ||
| 979 | #[inline] | ||
| 980 | fn is_high(&self) -> Result<bool, Self::Error> { | ||
| 981 | Ok(self.is_high()) | ||
| 982 | } | ||
| 983 | |||
| 984 | #[inline] | ||
| 985 | fn is_low(&self) -> Result<bool, Self::Error> { | ||
| 986 | Ok(self.is_low()) | ||
| 987 | } | ||
| 988 | } | ||
| 989 | |||
| 977 | impl<'d, T: Pin> OutputPin for OutputOpenDrain<'d, T> { | 990 | impl<'d, T: Pin> OutputPin for OutputOpenDrain<'d, T> { |
| 978 | #[inline] | 991 | #[inline] |
| 979 | fn set_high(&mut self) -> Result<(), Self::Error> { | 992 | fn set_high(&mut self) -> Result<(), Self::Error> { |
diff --git a/embassy-stm32/src/hrtim/mod.rs b/embassy-stm32/src/hrtim/mod.rs index c47b0c092..17096d48c 100644 --- a/embassy-stm32/src/hrtim/mod.rs +++ b/embassy-stm32/src/hrtim/mod.rs | |||
| @@ -157,8 +157,7 @@ impl<'d, T: Instance> AdvancedPwm<'d, T> { | |||
| 157 | fn new_inner(tim: impl Peripheral<P = T> + 'd) -> Self { | 157 | fn new_inner(tim: impl Peripheral<P = T> + 'd) -> Self { |
| 158 | into_ref!(tim); | 158 | into_ref!(tim); |
| 159 | 159 | ||
| 160 | T::enable(); | 160 | T::enable_and_reset(); |
| 161 | <T as crate::rcc::sealed::RccPeripheral>::reset(); | ||
| 162 | 161 | ||
| 163 | #[cfg(stm32f334)] | 162 | #[cfg(stm32f334)] |
| 164 | if unsafe { get_freqs() }.hrtim.is_some() { | 163 | if unsafe { get_freqs() }.hrtim.is_some() { |
diff --git a/embassy-stm32/src/i2c/mod.rs b/embassy-stm32/src/i2c/mod.rs index b35678ed9..dde1a5040 100644 --- a/embassy-stm32/src/i2c/mod.rs +++ b/embassy-stm32/src/i2c/mod.rs | |||
| @@ -7,14 +7,9 @@ use crate::interrupt; | |||
| 7 | mod _version; | 7 | mod _version; |
| 8 | pub use _version::*; | 8 | pub use _version::*; |
| 9 | 9 | ||
| 10 | #[cfg(feature = "time")] | ||
| 11 | mod timeout; | ||
| 12 | #[cfg(feature = "time")] | ||
| 13 | pub use timeout::*; | ||
| 14 | |||
| 15 | use crate::peripherals; | 10 | use crate::peripherals; |
| 16 | 11 | ||
| 17 | #[derive(Debug)] | 12 | #[derive(Debug, PartialEq, Eq)] |
| 18 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 13 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 19 | pub enum Error { | 14 | pub enum Error { |
| 20 | Bus, | 15 | Bus, |
diff --git a/embassy-stm32/src/i2c/timeout.rs b/embassy-stm32/src/i2c/timeout.rs deleted file mode 100644 index 103017cd1..000000000 --- a/embassy-stm32/src/i2c/timeout.rs +++ /dev/null | |||
| @@ -1,209 +0,0 @@ | |||
| 1 | use embassy_time::{Duration, Instant}; | ||
| 2 | |||
| 3 | use super::{Error, I2c, Instance}; | ||
| 4 | |||
| 5 | /// An I2C wrapper, which provides `embassy-time` based timeouts for all `embedded-hal` trait methods. | ||
| 6 | /// | ||
| 7 | /// This is useful for recovering from a shorted bus or a device stuck in a clock stretching state. | ||
| 8 | /// A regular [I2c] would freeze until condition is removed. | ||
| 9 | pub struct TimeoutI2c<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> { | ||
| 10 | i2c: &'a mut I2c<'d, T, TXDMA, RXDMA>, | ||
| 11 | timeout: Duration, | ||
| 12 | } | ||
| 13 | |||
| 14 | fn timeout_fn(timeout: Duration) -> impl Fn() -> Result<(), Error> { | ||
| 15 | let deadline = Instant::now() + timeout; | ||
| 16 | move || { | ||
| 17 | if Instant::now() > deadline { | ||
| 18 | Err(Error::Timeout) | ||
| 19 | } else { | ||
| 20 | Ok(()) | ||
| 21 | } | ||
| 22 | } | ||
| 23 | } | ||
| 24 | |||
| 25 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> { | ||
| 26 | pub fn new(i2c: &'a mut I2c<'d, T, TXDMA, RXDMA>, timeout: Duration) -> Self { | ||
| 27 | Self { i2c, timeout } | ||
| 28 | } | ||
| 29 | |||
| 30 | // ========================= | ||
| 31 | // Async public API | ||
| 32 | |||
| 33 | #[cfg(i2c_v2)] | ||
| 34 | pub async fn write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> | ||
| 35 | where | ||
| 36 | TXDMA: crate::i2c::TxDma<T>, | ||
| 37 | { | ||
| 38 | self.write_timeout(address, write, self.timeout).await | ||
| 39 | } | ||
| 40 | |||
| 41 | #[cfg(i2c_v2)] | ||
| 42 | pub async fn write_timeout(&mut self, address: u8, write: &[u8], timeout: Duration) -> Result<(), Error> | ||
| 43 | where | ||
| 44 | TXDMA: crate::i2c::TxDma<T>, | ||
| 45 | { | ||
| 46 | self.i2c.write_timeout(address, write, timeout_fn(timeout)).await | ||
| 47 | } | ||
| 48 | |||
| 49 | #[cfg(i2c_v2)] | ||
| 50 | pub async fn write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> | ||
| 51 | where | ||
| 52 | TXDMA: crate::i2c::TxDma<T>, | ||
| 53 | { | ||
| 54 | self.write_vectored_timeout(address, write, self.timeout).await | ||
| 55 | } | ||
| 56 | |||
| 57 | #[cfg(i2c_v2)] | ||
| 58 | pub async fn write_vectored_timeout(&mut self, address: u8, write: &[&[u8]], timeout: Duration) -> Result<(), Error> | ||
| 59 | where | ||
| 60 | TXDMA: crate::i2c::TxDma<T>, | ||
| 61 | { | ||
| 62 | self.i2c | ||
| 63 | .write_vectored_timeout(address, write, timeout_fn(timeout)) | ||
| 64 | .await | ||
| 65 | } | ||
| 66 | |||
| 67 | #[cfg(i2c_v2)] | ||
| 68 | pub async fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), Error> | ||
| 69 | where | ||
| 70 | RXDMA: crate::i2c::RxDma<T>, | ||
| 71 | { | ||
| 72 | self.read_timeout(address, buffer, self.timeout).await | ||
| 73 | } | ||
| 74 | |||
| 75 | #[cfg(i2c_v2)] | ||
| 76 | pub async fn read_timeout(&mut self, address: u8, buffer: &mut [u8], timeout: Duration) -> Result<(), Error> | ||
| 77 | where | ||
| 78 | RXDMA: crate::i2c::RxDma<T>, | ||
| 79 | { | ||
| 80 | self.i2c.read_timeout(address, buffer, timeout_fn(timeout)).await | ||
| 81 | } | ||
| 82 | |||
| 83 | #[cfg(i2c_v2)] | ||
| 84 | pub async fn write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> | ||
| 85 | where | ||
| 86 | TXDMA: super::TxDma<T>, | ||
| 87 | RXDMA: super::RxDma<T>, | ||
| 88 | { | ||
| 89 | self.write_read_timeout(address, write, read, self.timeout).await | ||
| 90 | } | ||
| 91 | |||
| 92 | #[cfg(i2c_v2)] | ||
| 93 | pub async fn write_read_timeout( | ||
| 94 | &mut self, | ||
| 95 | address: u8, | ||
| 96 | write: &[u8], | ||
| 97 | read: &mut [u8], | ||
| 98 | timeout: Duration, | ||
| 99 | ) -> Result<(), Error> | ||
| 100 | where | ||
| 101 | TXDMA: super::TxDma<T>, | ||
| 102 | RXDMA: super::RxDma<T>, | ||
| 103 | { | ||
| 104 | self.i2c | ||
| 105 | .write_read_timeout(address, write, read, timeout_fn(timeout)) | ||
| 106 | .await | ||
| 107 | } | ||
| 108 | |||
| 109 | // ========================= | ||
| 110 | // Blocking public API | ||
| 111 | |||
| 112 | /// Blocking read with a custom timeout | ||
| 113 | pub fn blocking_read_timeout(&mut self, addr: u8, read: &mut [u8], timeout: Duration) -> Result<(), Error> { | ||
| 114 | self.i2c.blocking_read_timeout(addr, read, timeout_fn(timeout)) | ||
| 115 | } | ||
| 116 | |||
| 117 | /// Blocking read with default timeout, provided in [`TimeoutI2c::new()`] | ||
| 118 | pub fn blocking_read(&mut self, addr: u8, read: &mut [u8]) -> Result<(), Error> { | ||
| 119 | self.blocking_read_timeout(addr, read, self.timeout) | ||
| 120 | } | ||
| 121 | |||
| 122 | /// Blocking write with a custom timeout | ||
| 123 | pub fn blocking_write_timeout(&mut self, addr: u8, write: &[u8], timeout: Duration) -> Result<(), Error> { | ||
| 124 | self.i2c.blocking_write_timeout(addr, write, timeout_fn(timeout)) | ||
| 125 | } | ||
| 126 | |||
| 127 | /// Blocking write with default timeout, provided in [`TimeoutI2c::new()`] | ||
| 128 | pub fn blocking_write(&mut self, addr: u8, write: &[u8]) -> Result<(), Error> { | ||
| 129 | self.blocking_write_timeout(addr, write, self.timeout) | ||
| 130 | } | ||
| 131 | |||
| 132 | /// Blocking write-read with a custom timeout | ||
| 133 | pub fn blocking_write_read_timeout( | ||
| 134 | &mut self, | ||
| 135 | addr: u8, | ||
| 136 | write: &[u8], | ||
| 137 | read: &mut [u8], | ||
| 138 | timeout: Duration, | ||
| 139 | ) -> Result<(), Error> { | ||
| 140 | self.i2c | ||
| 141 | .blocking_write_read_timeout(addr, write, read, timeout_fn(timeout)) | ||
| 142 | } | ||
| 143 | |||
| 144 | /// Blocking write-read with default timeout, provided in [`TimeoutI2c::new()`] | ||
| 145 | pub fn blocking_write_read(&mut self, addr: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> { | ||
| 146 | self.blocking_write_read_timeout(addr, write, read, self.timeout) | ||
| 147 | } | ||
| 148 | } | ||
| 149 | |||
| 150 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> embedded_hal_02::blocking::i2c::Read | ||
| 151 | for TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> | ||
| 152 | { | ||
| 153 | type Error = Error; | ||
| 154 | |||
| 155 | fn read(&mut self, addr: u8, read: &mut [u8]) -> Result<(), Self::Error> { | ||
| 156 | self.blocking_read(addr, read) | ||
| 157 | } | ||
| 158 | } | ||
| 159 | |||
| 160 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> embedded_hal_02::blocking::i2c::Write | ||
| 161 | for TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> | ||
| 162 | { | ||
| 163 | type Error = Error; | ||
| 164 | |||
| 165 | fn write(&mut self, addr: u8, write: &[u8]) -> Result<(), Self::Error> { | ||
| 166 | self.blocking_write(addr, write) | ||
| 167 | } | ||
| 168 | } | ||
| 169 | |||
| 170 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> embedded_hal_02::blocking::i2c::WriteRead | ||
| 171 | for TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> | ||
| 172 | { | ||
| 173 | type Error = Error; | ||
| 174 | |||
| 175 | fn write_read(&mut self, addr: u8, write: &[u8], read: &mut [u8]) -> Result<(), Self::Error> { | ||
| 176 | self.blocking_write_read(addr, write, read) | ||
| 177 | } | ||
| 178 | } | ||
| 179 | |||
| 180 | #[cfg(feature = "unstable-traits")] | ||
| 181 | mod eh1 { | ||
| 182 | use super::*; | ||
| 183 | |||
| 184 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> embedded_hal_1::i2c::ErrorType for TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> { | ||
| 185 | type Error = Error; | ||
| 186 | } | ||
| 187 | |||
| 188 | impl<'a, 'd: 'a, T: Instance, TXDMA, RXDMA> embedded_hal_1::i2c::I2c for TimeoutI2c<'a, 'd, T, TXDMA, RXDMA> { | ||
| 189 | fn read(&mut self, address: u8, read: &mut [u8]) -> Result<(), Self::Error> { | ||
| 190 | self.blocking_read(address, read) | ||
| 191 | } | ||
| 192 | |||
| 193 | fn write(&mut self, address: u8, write: &[u8]) -> Result<(), Self::Error> { | ||
| 194 | self.blocking_write(address, write) | ||
| 195 | } | ||
| 196 | |||
| 197 | fn write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Self::Error> { | ||
| 198 | self.blocking_write_read(address, write, read) | ||
| 199 | } | ||
| 200 | |||
| 201 | fn transaction( | ||
| 202 | &mut self, | ||
| 203 | _address: u8, | ||
| 204 | _operations: &mut [embedded_hal_1::i2c::Operation<'_>], | ||
| 205 | ) -> Result<(), Self::Error> { | ||
| 206 | todo!(); | ||
| 207 | } | ||
| 208 | } | ||
| 209 | } | ||
diff --git a/embassy-stm32/src/i2c/v1.rs b/embassy-stm32/src/i2c/v1.rs index f32dd0f0c..ab59f5ab9 100644 --- a/embassy-stm32/src/i2c/v1.rs +++ b/embassy-stm32/src/i2c/v1.rs | |||
| @@ -56,8 +56,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 56 | ) -> Self { | 56 | ) -> Self { |
| 57 | into_ref!(scl, sda, tx_dma, rx_dma); | 57 | into_ref!(scl, sda, tx_dma, rx_dma); |
| 58 | 58 | ||
| 59 | T::enable(); | 59 | T::enable_and_reset(); |
| 60 | T::reset(); | ||
| 61 | 60 | ||
| 62 | scl.set_as_af_pull( | 61 | scl.set_as_af_pull( |
| 63 | scl.af_num(), | 62 | scl.af_num(), |
| @@ -518,7 +517,8 @@ impl Timings { | |||
| 518 | 517 | ||
| 519 | impl<'d, T: Instance> SetConfig for I2c<'d, T> { | 518 | impl<'d, T: Instance> SetConfig for I2c<'d, T> { |
| 520 | type Config = Hertz; | 519 | type Config = Hertz; |
| 521 | fn set_config(&mut self, config: &Self::Config) { | 520 | type ConfigError = (); |
| 521 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { | ||
| 522 | let timings = Timings::new(T::frequency(), *config); | 522 | let timings = Timings::new(T::frequency(), *config); |
| 523 | T::regs().cr2().modify(|reg| { | 523 | T::regs().cr2().modify(|reg| { |
| 524 | reg.set_freq(timings.freq); | 524 | reg.set_freq(timings.freq); |
| @@ -531,5 +531,7 @@ impl<'d, T: Instance> SetConfig for I2c<'d, T> { | |||
| 531 | T::regs().trise().modify(|reg| { | 531 | T::regs().trise().modify(|reg| { |
| 532 | reg.set_trise(timings.trise); | 532 | reg.set_trise(timings.trise); |
| 533 | }); | 533 | }); |
| 534 | |||
| 535 | Ok(()) | ||
| 534 | } | 536 | } |
| 535 | } | 537 | } |
diff --git a/embassy-stm32/src/i2c/v2.rs b/embassy-stm32/src/i2c/v2.rs index 36f70e32e..fc6dcd6ed 100644 --- a/embassy-stm32/src/i2c/v2.rs +++ b/embassy-stm32/src/i2c/v2.rs | |||
| @@ -1,14 +1,21 @@ | |||
| 1 | use core::cmp; | 1 | use core::cmp; |
| 2 | #[cfg(feature = "time")] | ||
| 2 | use core::future::poll_fn; | 3 | use core::future::poll_fn; |
| 3 | use core::marker::PhantomData; | 4 | use core::marker::PhantomData; |
| 5 | #[cfg(feature = "time")] | ||
| 4 | use core::task::Poll; | 6 | use core::task::Poll; |
| 5 | 7 | ||
| 6 | use embassy_embedded_hal::SetConfig; | 8 | use embassy_embedded_hal::SetConfig; |
| 9 | #[cfg(feature = "time")] | ||
| 7 | use embassy_hal_internal::drop::OnDrop; | 10 | use embassy_hal_internal::drop::OnDrop; |
| 8 | use embassy_hal_internal::{into_ref, PeripheralRef}; | 11 | use embassy_hal_internal::{into_ref, PeripheralRef}; |
| 9 | use embassy_sync::waitqueue::AtomicWaker; | 12 | use embassy_sync::waitqueue::AtomicWaker; |
| 13 | #[cfg(feature = "time")] | ||
| 14 | use embassy_time::{Duration, Instant}; | ||
| 10 | 15 | ||
| 11 | use crate::dma::{NoDma, Transfer}; | 16 | use crate::dma::NoDma; |
| 17 | #[cfg(feature = "time")] | ||
| 18 | use crate::dma::Transfer; | ||
| 12 | use crate::gpio::sealed::AFType; | 19 | use crate::gpio::sealed::AFType; |
| 13 | use crate::gpio::Pull; | 20 | use crate::gpio::Pull; |
| 14 | use crate::i2c::{Error, Instance, SclPin, SdaPin}; | 21 | use crate::i2c::{Error, Instance, SclPin, SdaPin}; |
| @@ -43,6 +50,8 @@ impl<T: Instance> interrupt::typelevel::Handler<T::Interrupt> for InterruptHandl | |||
| 43 | pub struct Config { | 50 | pub struct Config { |
| 44 | pub sda_pullup: bool, | 51 | pub sda_pullup: bool, |
| 45 | pub scl_pullup: bool, | 52 | pub scl_pullup: bool, |
| 53 | #[cfg(feature = "time")] | ||
| 54 | pub transaction_timeout: Duration, | ||
| 46 | } | 55 | } |
| 47 | 56 | ||
| 48 | impl Default for Config { | 57 | impl Default for Config { |
| @@ -50,6 +59,8 @@ impl Default for Config { | |||
| 50 | Self { | 59 | Self { |
| 51 | sda_pullup: false, | 60 | sda_pullup: false, |
| 52 | scl_pullup: false, | 61 | scl_pullup: false, |
| 62 | #[cfg(feature = "time")] | ||
| 63 | transaction_timeout: Duration::from_millis(100), | ||
| 53 | } | 64 | } |
| 54 | } | 65 | } |
| 55 | } | 66 | } |
| @@ -68,9 +79,12 @@ impl State { | |||
| 68 | 79 | ||
| 69 | pub struct I2c<'d, T: Instance, TXDMA = NoDma, RXDMA = NoDma> { | 80 | pub struct I2c<'d, T: Instance, TXDMA = NoDma, RXDMA = NoDma> { |
| 70 | _peri: PeripheralRef<'d, T>, | 81 | _peri: PeripheralRef<'d, T>, |
| 82 | #[allow(dead_code)] | ||
| 71 | tx_dma: PeripheralRef<'d, TXDMA>, | 83 | tx_dma: PeripheralRef<'d, TXDMA>, |
| 72 | #[allow(dead_code)] | 84 | #[allow(dead_code)] |
| 73 | rx_dma: PeripheralRef<'d, RXDMA>, | 85 | rx_dma: PeripheralRef<'d, RXDMA>, |
| 86 | #[cfg(feature = "time")] | ||
| 87 | timeout: Duration, | ||
| 74 | } | 88 | } |
| 75 | 89 | ||
| 76 | impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | 90 | impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { |
| @@ -86,8 +100,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 86 | ) -> Self { | 100 | ) -> Self { |
| 87 | into_ref!(peri, scl, sda, tx_dma, rx_dma); | 101 | into_ref!(peri, scl, sda, tx_dma, rx_dma); |
| 88 | 102 | ||
| 89 | T::enable(); | 103 | T::enable_and_reset(); |
| 90 | T::reset(); | ||
| 91 | 104 | ||
| 92 | scl.set_as_af_pull( | 105 | scl.set_as_af_pull( |
| 93 | scl.af_num(), | 106 | scl.af_num(), |
| @@ -132,6 +145,8 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 132 | _peri: peri, | 145 | _peri: peri, |
| 133 | tx_dma, | 146 | tx_dma, |
| 134 | rx_dma, | 147 | rx_dma, |
| 148 | #[cfg(feature = "time")] | ||
| 149 | timeout: config.transaction_timeout, | ||
| 135 | } | 150 | } |
| 136 | } | 151 | } |
| 137 | 152 | ||
| @@ -422,6 +437,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 422 | result | 437 | result |
| 423 | } | 438 | } |
| 424 | 439 | ||
| 440 | #[cfg(feature = "time")] | ||
| 425 | async fn write_dma_internal( | 441 | async fn write_dma_internal( |
| 426 | &mut self, | 442 | &mut self, |
| 427 | address: u8, | 443 | address: u8, |
| @@ -512,6 +528,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 512 | Ok(()) | 528 | Ok(()) |
| 513 | } | 529 | } |
| 514 | 530 | ||
| 531 | #[cfg(feature = "time")] | ||
| 515 | async fn read_dma_internal( | 532 | async fn read_dma_internal( |
| 516 | &mut self, | 533 | &mut self, |
| 517 | address: u8, | 534 | address: u8, |
| @@ -594,42 +611,41 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 594 | // ========================= | 611 | // ========================= |
| 595 | // Async public API | 612 | // Async public API |
| 596 | 613 | ||
| 614 | #[cfg(feature = "time")] | ||
| 597 | pub async fn write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> | 615 | pub async fn write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> |
| 598 | where | 616 | where |
| 599 | TXDMA: crate::i2c::TxDma<T>, | 617 | TXDMA: crate::i2c::TxDma<T>, |
| 600 | { | 618 | { |
| 601 | self.write_timeout(address, write, || Ok(())).await | 619 | self.write_timeout(address, write, self.timeout).await |
| 602 | } | 620 | } |
| 603 | 621 | ||
| 604 | pub async fn write_timeout( | 622 | #[cfg(feature = "time")] |
| 605 | &mut self, | 623 | pub async fn write_timeout(&mut self, address: u8, write: &[u8], timeout: Duration) -> Result<(), Error> |
| 606 | address: u8, | ||
| 607 | write: &[u8], | ||
| 608 | check_timeout: impl Fn() -> Result<(), Error>, | ||
| 609 | ) -> Result<(), Error> | ||
| 610 | where | 624 | where |
| 611 | TXDMA: crate::i2c::TxDma<T>, | 625 | TXDMA: crate::i2c::TxDma<T>, |
| 612 | { | 626 | { |
| 613 | if write.is_empty() { | 627 | if write.is_empty() { |
| 614 | self.write_internal(address, write, true, check_timeout) | 628 | self.write_internal(address, write, true, timeout_fn(timeout)) |
| 615 | } else { | 629 | } else { |
| 616 | self.write_dma_internal(address, write, true, true, check_timeout).await | 630 | embassy_time::with_timeout( |
| 631 | timeout, | ||
| 632 | self.write_dma_internal(address, write, true, true, timeout_fn(timeout)), | ||
| 633 | ) | ||
| 634 | .await | ||
| 635 | .unwrap_or(Err(Error::Timeout)) | ||
| 617 | } | 636 | } |
| 618 | } | 637 | } |
| 619 | 638 | ||
| 639 | #[cfg(feature = "time")] | ||
| 620 | pub async fn write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> | 640 | pub async fn write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> |
| 621 | where | 641 | where |
| 622 | TXDMA: crate::i2c::TxDma<T>, | 642 | TXDMA: crate::i2c::TxDma<T>, |
| 623 | { | 643 | { |
| 624 | self.write_vectored_timeout(address, write, || Ok(())).await | 644 | self.write_vectored_timeout(address, write, self.timeout).await |
| 625 | } | 645 | } |
| 626 | 646 | ||
| 627 | pub async fn write_vectored_timeout( | 647 | #[cfg(feature = "time")] |
| 628 | &mut self, | 648 | pub async fn write_vectored_timeout(&mut self, address: u8, write: &[&[u8]], timeout: Duration) -> Result<(), Error> |
| 629 | address: u8, | ||
| 630 | write: &[&[u8]], | ||
| 631 | check_timeout: impl Fn() -> Result<(), Error>, | ||
| 632 | ) -> Result<(), Error> | ||
| 633 | where | 649 | where |
| 634 | TXDMA: crate::i2c::TxDma<T>, | 650 | TXDMA: crate::i2c::TxDma<T>, |
| 635 | { | 651 | { |
| @@ -644,67 +660,88 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 644 | let next = iter.next(); | 660 | let next = iter.next(); |
| 645 | let is_last = next.is_none(); | 661 | let is_last = next.is_none(); |
| 646 | 662 | ||
| 647 | self.write_dma_internal(address, c, first, is_last, || check_timeout()) | 663 | embassy_time::with_timeout( |
| 648 | .await?; | 664 | timeout, |
| 665 | self.write_dma_internal(address, c, first, is_last, timeout_fn(timeout)), | ||
| 666 | ) | ||
| 667 | .await | ||
| 668 | .unwrap_or(Err(Error::Timeout))?; | ||
| 649 | first = false; | 669 | first = false; |
| 650 | current = next; | 670 | current = next; |
| 651 | } | 671 | } |
| 652 | Ok(()) | 672 | Ok(()) |
| 653 | } | 673 | } |
| 654 | 674 | ||
| 675 | #[cfg(feature = "time")] | ||
| 655 | pub async fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), Error> | 676 | pub async fn read(&mut self, address: u8, buffer: &mut [u8]) -> Result<(), Error> |
| 656 | where | 677 | where |
| 657 | RXDMA: crate::i2c::RxDma<T>, | 678 | RXDMA: crate::i2c::RxDma<T>, |
| 658 | { | 679 | { |
| 659 | self.read_timeout(address, buffer, || Ok(())).await | 680 | self.read_timeout(address, buffer, self.timeout).await |
| 660 | } | 681 | } |
| 661 | 682 | ||
| 662 | pub async fn read_timeout( | 683 | #[cfg(feature = "time")] |
| 663 | &mut self, | 684 | pub async fn read_timeout(&mut self, address: u8, buffer: &mut [u8], timeout: Duration) -> Result<(), Error> |
| 664 | address: u8, | ||
| 665 | buffer: &mut [u8], | ||
| 666 | check_timeout: impl Fn() -> Result<(), Error>, | ||
| 667 | ) -> Result<(), Error> | ||
| 668 | where | 685 | where |
| 669 | RXDMA: crate::i2c::RxDma<T>, | 686 | RXDMA: crate::i2c::RxDma<T>, |
| 670 | { | 687 | { |
| 671 | if buffer.is_empty() { | 688 | if buffer.is_empty() { |
| 672 | self.read_internal(address, buffer, false, check_timeout) | 689 | self.read_internal(address, buffer, false, timeout_fn(timeout)) |
| 673 | } else { | 690 | } else { |
| 674 | self.read_dma_internal(address, buffer, false, check_timeout).await | 691 | embassy_time::with_timeout( |
| 692 | timeout, | ||
| 693 | self.read_dma_internal(address, buffer, false, timeout_fn(timeout)), | ||
| 694 | ) | ||
| 695 | .await | ||
| 696 | .unwrap_or(Err(Error::Timeout)) | ||
| 675 | } | 697 | } |
| 676 | } | 698 | } |
| 677 | 699 | ||
| 700 | #[cfg(feature = "time")] | ||
| 678 | pub async fn write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> | 701 | pub async fn write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> |
| 679 | where | 702 | where |
| 680 | TXDMA: super::TxDma<T>, | 703 | TXDMA: super::TxDma<T>, |
| 681 | RXDMA: super::RxDma<T>, | 704 | RXDMA: super::RxDma<T>, |
| 682 | { | 705 | { |
| 683 | self.write_read_timeout(address, write, read, || Ok(())).await | 706 | self.write_read_timeout(address, write, read, self.timeout).await |
| 684 | } | 707 | } |
| 685 | 708 | ||
| 709 | #[cfg(feature = "time")] | ||
| 686 | pub async fn write_read_timeout( | 710 | pub async fn write_read_timeout( |
| 687 | &mut self, | 711 | &mut self, |
| 688 | address: u8, | 712 | address: u8, |
| 689 | write: &[u8], | 713 | write: &[u8], |
| 690 | read: &mut [u8], | 714 | read: &mut [u8], |
| 691 | check_timeout: impl Fn() -> Result<(), Error>, | 715 | timeout: Duration, |
| 692 | ) -> Result<(), Error> | 716 | ) -> Result<(), Error> |
| 693 | where | 717 | where |
| 694 | TXDMA: super::TxDma<T>, | 718 | TXDMA: super::TxDma<T>, |
| 695 | RXDMA: super::RxDma<T>, | 719 | RXDMA: super::RxDma<T>, |
| 696 | { | 720 | { |
| 721 | let start_instant = Instant::now(); | ||
| 722 | let check_timeout = timeout_fn(timeout); | ||
| 697 | if write.is_empty() { | 723 | if write.is_empty() { |
| 698 | self.write_internal(address, write, false, || check_timeout())?; | 724 | self.write_internal(address, write, false, &check_timeout)?; |
| 699 | } else { | 725 | } else { |
| 700 | self.write_dma_internal(address, write, true, true, || check_timeout()) | 726 | embassy_time::with_timeout( |
| 701 | .await?; | 727 | timeout, |
| 728 | self.write_dma_internal(address, write, true, true, &check_timeout), | ||
| 729 | ) | ||
| 730 | .await | ||
| 731 | .unwrap_or(Err(Error::Timeout))?; | ||
| 702 | } | 732 | } |
| 703 | 733 | ||
| 734 | let time_left_until_timeout = timeout - Instant::now().duration_since(start_instant); | ||
| 735 | |||
| 704 | if read.is_empty() { | 736 | if read.is_empty() { |
| 705 | self.read_internal(address, read, true, check_timeout)?; | 737 | self.read_internal(address, read, true, &check_timeout)?; |
| 706 | } else { | 738 | } else { |
| 707 | self.read_dma_internal(address, read, true, check_timeout).await?; | 739 | embassy_time::with_timeout( |
| 740 | time_left_until_timeout, | ||
| 741 | self.read_dma_internal(address, read, true, &check_timeout), | ||
| 742 | ) | ||
| 743 | .await | ||
| 744 | .unwrap_or(Err(Error::Timeout))?; | ||
| 708 | } | 745 | } |
| 709 | 746 | ||
| 710 | Ok(()) | 747 | Ok(()) |
| @@ -713,33 +750,73 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 713 | // ========================= | 750 | // ========================= |
| 714 | // Blocking public API | 751 | // Blocking public API |
| 715 | 752 | ||
| 753 | #[cfg(feature = "time")] | ||
| 754 | pub fn blocking_read_timeout(&mut self, address: u8, read: &mut [u8], timeout: Duration) -> Result<(), Error> { | ||
| 755 | self.read_internal(address, read, false, timeout_fn(timeout)) | ||
| 756 | // Automatic Stop | ||
| 757 | } | ||
| 758 | |||
| 759 | #[cfg(not(feature = "time"))] | ||
| 716 | pub fn blocking_read_timeout( | 760 | pub fn blocking_read_timeout( |
| 717 | &mut self, | 761 | &mut self, |
| 718 | address: u8, | 762 | address: u8, |
| 719 | read: &mut [u8], | 763 | read: &mut [u8], |
| 720 | check_timeout: impl Fn() -> Result<(), Error>, | 764 | check_timeout: impl Fn() -> Result<(), Error>, |
| 721 | ) -> Result<(), Error> { | 765 | ) -> Result<(), Error> { |
| 722 | self.read_internal(address, read, false, &check_timeout) | 766 | self.read_internal(address, read, false, check_timeout) |
| 723 | // Automatic Stop | 767 | // Automatic Stop |
| 724 | } | 768 | } |
| 725 | 769 | ||
| 770 | #[cfg(feature = "time")] | ||
| 771 | pub fn blocking_read(&mut self, address: u8, read: &mut [u8]) -> Result<(), Error> { | ||
| 772 | self.blocking_read_timeout(address, read, self.timeout) | ||
| 773 | } | ||
| 774 | |||
| 775 | #[cfg(not(feature = "time"))] | ||
| 726 | pub fn blocking_read(&mut self, address: u8, read: &mut [u8]) -> Result<(), Error> { | 776 | pub fn blocking_read(&mut self, address: u8, read: &mut [u8]) -> Result<(), Error> { |
| 727 | self.blocking_read_timeout(address, read, || Ok(())) | 777 | self.blocking_read_timeout(address, read, || Ok(())) |
| 728 | } | 778 | } |
| 729 | 779 | ||
| 780 | #[cfg(feature = "time")] | ||
| 781 | pub fn blocking_write_timeout(&mut self, address: u8, write: &[u8], timeout: Duration) -> Result<(), Error> { | ||
| 782 | self.write_internal(address, write, true, timeout_fn(timeout)) | ||
| 783 | } | ||
| 784 | |||
| 785 | #[cfg(not(feature = "time"))] | ||
| 730 | pub fn blocking_write_timeout( | 786 | pub fn blocking_write_timeout( |
| 731 | &mut self, | 787 | &mut self, |
| 732 | address: u8, | 788 | address: u8, |
| 733 | write: &[u8], | 789 | write: &[u8], |
| 734 | check_timeout: impl Fn() -> Result<(), Error>, | 790 | check_timeout: impl Fn() -> Result<(), Error>, |
| 735 | ) -> Result<(), Error> { | 791 | ) -> Result<(), Error> { |
| 736 | self.write_internal(address, write, true, &check_timeout) | 792 | self.write_internal(address, write, true, check_timeout) |
| 737 | } | 793 | } |
| 738 | 794 | ||
| 795 | #[cfg(feature = "time")] | ||
| 796 | pub fn blocking_write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> { | ||
| 797 | self.blocking_write_timeout(address, write, self.timeout) | ||
| 798 | } | ||
| 799 | |||
| 800 | #[cfg(not(feature = "time"))] | ||
| 739 | pub fn blocking_write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> { | 801 | pub fn blocking_write(&mut self, address: u8, write: &[u8]) -> Result<(), Error> { |
| 740 | self.blocking_write_timeout(address, write, || Ok(())) | 802 | self.blocking_write_timeout(address, write, || Ok(())) |
| 741 | } | 803 | } |
| 742 | 804 | ||
| 805 | #[cfg(feature = "time")] | ||
| 806 | pub fn blocking_write_read_timeout( | ||
| 807 | &mut self, | ||
| 808 | address: u8, | ||
| 809 | write: &[u8], | ||
| 810 | read: &mut [u8], | ||
| 811 | timeout: Duration, | ||
| 812 | ) -> Result<(), Error> { | ||
| 813 | let check_timeout = timeout_fn(timeout); | ||
| 814 | self.write_internal(address, write, false, &check_timeout)?; | ||
| 815 | self.read_internal(address, read, true, &check_timeout) | ||
| 816 | // Automatic Stop | ||
| 817 | } | ||
| 818 | |||
| 819 | #[cfg(not(feature = "time"))] | ||
| 743 | pub fn blocking_write_read_timeout( | 820 | pub fn blocking_write_read_timeout( |
| 744 | &mut self, | 821 | &mut self, |
| 745 | address: u8, | 822 | address: u8, |
| @@ -752,11 +829,17 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 752 | // Automatic Stop | 829 | // Automatic Stop |
| 753 | } | 830 | } |
| 754 | 831 | ||
| 832 | #[cfg(feature = "time")] | ||
| 833 | pub fn blocking_write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> { | ||
| 834 | self.blocking_write_read_timeout(address, write, read, self.timeout) | ||
| 835 | } | ||
| 836 | |||
| 837 | #[cfg(not(feature = "time"))] | ||
| 755 | pub fn blocking_write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> { | 838 | pub fn blocking_write_read(&mut self, address: u8, write: &[u8], read: &mut [u8]) -> Result<(), Error> { |
| 756 | self.blocking_write_read_timeout(address, write, read, || Ok(())) | 839 | self.blocking_write_read_timeout(address, write, read, || Ok(())) |
| 757 | } | 840 | } |
| 758 | 841 | ||
| 759 | pub fn blocking_write_vectored_timeout( | 842 | fn blocking_write_vectored_with_timeout( |
| 760 | &mut self, | 843 | &mut self, |
| 761 | address: u8, | 844 | address: u8, |
| 762 | write: &[&[u8]], | 845 | write: &[&[u8]], |
| @@ -765,6 +848,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 765 | if write.is_empty() { | 848 | if write.is_empty() { |
| 766 | return Err(Error::ZeroLengthTransfer); | 849 | return Err(Error::ZeroLengthTransfer); |
| 767 | } | 850 | } |
| 851 | |||
| 768 | let first_length = write[0].len(); | 852 | let first_length = write[0].len(); |
| 769 | let last_slice_index = write.len() - 1; | 853 | let last_slice_index = write.len() - 1; |
| 770 | 854 | ||
| @@ -833,6 +917,33 @@ impl<'d, T: Instance, TXDMA, RXDMA> I2c<'d, T, TXDMA, RXDMA> { | |||
| 833 | result | 917 | result |
| 834 | } | 918 | } |
| 835 | 919 | ||
| 920 | #[cfg(feature = "time")] | ||
| 921 | pub fn blocking_write_vectored_timeout( | ||
| 922 | &mut self, | ||
| 923 | address: u8, | ||
| 924 | write: &[&[u8]], | ||
| 925 | timeout: Duration, | ||
| 926 | ) -> Result<(), Error> { | ||
| 927 | let check_timeout = timeout_fn(timeout); | ||
| 928 | self.blocking_write_vectored_with_timeout(address, write, check_timeout) | ||
| 929 | } | ||
| 930 | |||
| 931 | #[cfg(not(feature = "time"))] | ||
| 932 | pub fn blocking_write_vectored_timeout( | ||
| 933 | &mut self, | ||
| 934 | address: u8, | ||
| 935 | write: &[&[u8]], | ||
| 936 | check_timeout: impl Fn() -> Result<(), Error>, | ||
| 937 | ) -> Result<(), Error> { | ||
| 938 | self.blocking_write_vectored_with_timeout(address, write, check_timeout) | ||
| 939 | } | ||
| 940 | |||
| 941 | #[cfg(feature = "time")] | ||
| 942 | pub fn blocking_write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> { | ||
| 943 | self.blocking_write_vectored_timeout(address, write, self.timeout) | ||
| 944 | } | ||
| 945 | |||
| 946 | #[cfg(not(feature = "time"))] | ||
| 836 | pub fn blocking_write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> { | 947 | pub fn blocking_write_vectored(&mut self, address: u8, write: &[&[u8]]) -> Result<(), Error> { |
| 837 | self.blocking_write_vectored_timeout(address, write, || Ok(())) | 948 | self.blocking_write_vectored_timeout(address, write, || Ok(())) |
| 838 | } | 949 | } |
| @@ -844,6 +955,7 @@ impl<'d, T: Instance, TXDMA, RXDMA> Drop for I2c<'d, T, TXDMA, RXDMA> { | |||
| 844 | } | 955 | } |
| 845 | } | 956 | } |
| 846 | 957 | ||
| 958 | #[cfg(feature = "time")] | ||
| 847 | mod eh02 { | 959 | mod eh02 { |
| 848 | use super::*; | 960 | use super::*; |
| 849 | 961 | ||
| @@ -1043,7 +1155,7 @@ mod eh1 { | |||
| 1043 | } | 1155 | } |
| 1044 | } | 1156 | } |
| 1045 | 1157 | ||
| 1046 | #[cfg(all(feature = "unstable-traits", feature = "nightly"))] | 1158 | #[cfg(all(feature = "unstable-traits", feature = "nightly", feature = "time"))] |
| 1047 | mod eha { | 1159 | mod eha { |
| 1048 | use super::super::{RxDma, TxDma}; | 1160 | use super::super::{RxDma, TxDma}; |
| 1049 | use super::*; | 1161 | use super::*; |
| @@ -1075,7 +1187,8 @@ mod eha { | |||
| 1075 | 1187 | ||
| 1076 | impl<'d, T: Instance> SetConfig for I2c<'d, T> { | 1188 | impl<'d, T: Instance> SetConfig for I2c<'d, T> { |
| 1077 | type Config = Hertz; | 1189 | type Config = Hertz; |
| 1078 | fn set_config(&mut self, config: &Self::Config) { | 1190 | type ConfigError = (); |
| 1191 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { | ||
| 1079 | let timings = Timings::new(T::frequency(), *config); | 1192 | let timings = Timings::new(T::frequency(), *config); |
| 1080 | T::regs().timingr().write(|reg| { | 1193 | T::regs().timingr().write(|reg| { |
| 1081 | reg.set_presc(timings.prescale); | 1194 | reg.set_presc(timings.prescale); |
| @@ -1084,5 +1197,19 @@ impl<'d, T: Instance> SetConfig for I2c<'d, T> { | |||
| 1084 | reg.set_sdadel(timings.sdadel); | 1197 | reg.set_sdadel(timings.sdadel); |
| 1085 | reg.set_scldel(timings.scldel); | 1198 | reg.set_scldel(timings.scldel); |
| 1086 | }); | 1199 | }); |
| 1200 | |||
| 1201 | Ok(()) | ||
| 1202 | } | ||
| 1203 | } | ||
| 1204 | |||
| 1205 | #[cfg(feature = "time")] | ||
| 1206 | fn timeout_fn(timeout: Duration) -> impl Fn() -> Result<(), Error> { | ||
| 1207 | let deadline = Instant::now() + timeout; | ||
| 1208 | move || { | ||
| 1209 | if Instant::now() > deadline { | ||
| 1210 | Err(Error::Timeout) | ||
| 1211 | } else { | ||
| 1212 | Ok(()) | ||
| 1213 | } | ||
| 1087 | } | 1214 | } |
| 1088 | } | 1215 | } |
diff --git a/embassy-stm32/src/i2s.rs b/embassy-stm32/src/i2s.rs index 8fd3a8c6a..67d40c479 100644 --- a/embassy-stm32/src/i2s.rs +++ b/embassy-stm32/src/i2s.rs | |||
| @@ -170,7 +170,7 @@ impl<'d, T: Instance, Tx, Rx> I2S<'d, T, Tx, Rx> { | |||
| 170 | let spi = Spi::new_internal(peri, txdma, rxdma, spi_cfg); | 170 | let spi = Spi::new_internal(peri, txdma, rxdma, spi_cfg); |
| 171 | 171 | ||
| 172 | #[cfg(all(rcc_f4, not(stm32f410)))] | 172 | #[cfg(all(rcc_f4, not(stm32f410)))] |
| 173 | let pclk = unsafe { get_freqs() }.plli2s.unwrap(); | 173 | let pclk = unsafe { get_freqs() }.plli2s1_q.unwrap(); |
| 174 | 174 | ||
| 175 | #[cfg(stm32f410)] | 175 | #[cfg(stm32f410)] |
| 176 | let pclk = T::frequency(); | 176 | let pclk = T::frequency(); |
diff --git a/embassy-stm32/src/ipcc.rs b/embassy-stm32/src/ipcc.rs index e100ca5cc..1b1e182f0 100644 --- a/embassy-stm32/src/ipcc.rs +++ b/embassy-stm32/src/ipcc.rs | |||
| @@ -93,8 +93,7 @@ pub struct Ipcc; | |||
| 93 | 93 | ||
| 94 | impl Ipcc { | 94 | impl Ipcc { |
| 95 | pub fn enable(_config: Config) { | 95 | pub fn enable(_config: Config) { |
| 96 | IPCC::enable(); | 96 | IPCC::enable_and_reset(); |
| 97 | IPCC::reset(); | ||
| 98 | IPCC::set_cpu2(true); | 97 | IPCC::set_cpu2(true); |
| 99 | 98 | ||
| 100 | _configure_pwr(); | 99 | _configure_pwr(); |
diff --git a/embassy-stm32/src/lib.rs b/embassy-stm32/src/lib.rs index 9dd2f6163..372246f87 100644 --- a/embassy-stm32/src/lib.rs +++ b/embassy-stm32/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![cfg_attr(not(test), no_std)] | 1 | #![cfg_attr(not(test), no_std)] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait))] |
| 3 | 3 | ||
| 4 | //! ## Feature flags | 4 | //! ## Feature flags |
| 5 | #![doc = document_features::document_features!(feature_label = r#"<span class="stab portability"><code>{feature}</code></span>"#)] | 5 | #![doc = document_features::document_features!(feature_label = r#"<span class="stab portability"><code>{feature}</code></span>"#)] |
| @@ -49,6 +49,8 @@ pub mod i2s; | |||
| 49 | pub mod ipcc; | 49 | pub mod ipcc; |
| 50 | #[cfg(feature = "low-power")] | 50 | #[cfg(feature = "low-power")] |
| 51 | pub mod low_power; | 51 | pub mod low_power; |
| 52 | #[cfg(opamp)] | ||
| 53 | pub mod opamp; | ||
| 52 | #[cfg(quadspi)] | 54 | #[cfg(quadspi)] |
| 53 | pub mod qspi; | 55 | pub mod qspi; |
| 54 | #[cfg(rng)] | 56 | #[cfg(rng)] |
| @@ -153,79 +155,82 @@ impl Default for Config { | |||
| 153 | 155 | ||
| 154 | /// Initialize embassy. | 156 | /// Initialize embassy. |
| 155 | pub fn init(config: Config) -> Peripherals { | 157 | pub fn init(config: Config) -> Peripherals { |
| 156 | let p = Peripherals::take(); | 158 | critical_section::with(|cs| { |
| 159 | let p = Peripherals::take_with_cs(cs); | ||
| 160 | |||
| 161 | #[cfg(dbgmcu)] | ||
| 162 | if config.enable_debug_during_sleep { | ||
| 163 | crate::pac::DBGMCU.cr().modify(|cr| { | ||
| 164 | #[cfg(any(dbgmcu_f0, dbgmcu_c0, dbgmcu_g0, dbgmcu_u5, dbgmcu_wba))] | ||
| 165 | { | ||
| 166 | cr.set_dbg_stop(true); | ||
| 167 | cr.set_dbg_standby(true); | ||
| 168 | } | ||
| 169 | #[cfg(any( | ||
| 170 | dbgmcu_f1, dbgmcu_f2, dbgmcu_f3, dbgmcu_f4, dbgmcu_f7, dbgmcu_g4, dbgmcu_f7, dbgmcu_l0, dbgmcu_l1, | ||
| 171 | dbgmcu_l4, dbgmcu_wb, dbgmcu_wl | ||
| 172 | ))] | ||
| 173 | { | ||
| 174 | cr.set_dbg_sleep(true); | ||
| 175 | cr.set_dbg_stop(true); | ||
| 176 | cr.set_dbg_standby(true); | ||
| 177 | } | ||
| 178 | #[cfg(dbgmcu_h7)] | ||
| 179 | { | ||
| 180 | cr.set_d1dbgcken(true); | ||
| 181 | cr.set_d3dbgcken(true); | ||
| 182 | cr.set_dbgsleep_d1(true); | ||
| 183 | cr.set_dbgstby_d1(true); | ||
| 184 | cr.set_dbgstop_d1(true); | ||
| 185 | } | ||
| 186 | }); | ||
| 187 | } | ||
| 157 | 188 | ||
| 158 | #[cfg(dbgmcu)] | 189 | #[cfg(not(any(stm32f1, stm32wb, stm32wl)))] |
| 159 | if config.enable_debug_during_sleep { | 190 | peripherals::SYSCFG::enable_and_reset_with_cs(cs); |
| 160 | crate::pac::DBGMCU.cr().modify(|cr| { | 191 | #[cfg(not(any(stm32h5, stm32h7, stm32wb, stm32wl)))] |
| 161 | #[cfg(any(dbgmcu_f0, dbgmcu_c0, dbgmcu_g0, dbgmcu_u5, dbgmcu_wba))] | 192 | peripherals::PWR::enable_and_reset_with_cs(cs); |
| 162 | { | 193 | #[cfg(not(any(stm32f2, stm32f4, stm32f7, stm32l0, stm32h5, stm32h7)))] |
| 163 | cr.set_dbg_stop(true); | 194 | peripherals::FLASH::enable_and_reset_with_cs(cs); |
| 164 | cr.set_dbg_standby(true); | 195 | |
| 165 | } | 196 | unsafe { |
| 166 | #[cfg(any( | 197 | #[cfg(feature = "_split-pins-enabled")] |
| 167 | dbgmcu_f1, dbgmcu_f2, dbgmcu_f3, dbgmcu_f4, dbgmcu_f7, dbgmcu_g4, dbgmcu_f7, dbgmcu_l0, dbgmcu_l1, | 198 | crate::pac::SYSCFG.pmcr().modify(|pmcr| { |
| 168 | dbgmcu_l4, dbgmcu_wb, dbgmcu_wl | 199 | #[cfg(feature = "split-pa0")] |
| 169 | ))] | 200 | pmcr.set_pa0so(true); |
| 170 | { | 201 | #[cfg(feature = "split-pa1")] |
| 171 | cr.set_dbg_sleep(true); | 202 | pmcr.set_pa1so(true); |
| 172 | cr.set_dbg_stop(true); | 203 | #[cfg(feature = "split-pc2")] |
| 173 | cr.set_dbg_standby(true); | 204 | pmcr.set_pc2so(true); |
| 174 | } | 205 | #[cfg(feature = "split-pc3")] |
| 175 | #[cfg(dbgmcu_h7)] | 206 | pmcr.set_pc3so(true); |
| 176 | { | 207 | }); |
| 177 | cr.set_d1dbgcken(true); | 208 | |
| 178 | cr.set_d3dbgcken(true); | 209 | gpio::init(cs); |
| 179 | cr.set_dbgsleep_d1(true); | 210 | dma::init( |
| 180 | cr.set_dbgstby_d1(true); | 211 | cs, |
| 181 | cr.set_dbgstop_d1(true); | 212 | #[cfg(bdma)] |
| 213 | config.bdma_interrupt_priority, | ||
| 214 | #[cfg(dma)] | ||
| 215 | config.dma_interrupt_priority, | ||
| 216 | #[cfg(gpdma)] | ||
| 217 | config.gpdma_interrupt_priority, | ||
| 218 | ); | ||
| 219 | #[cfg(feature = "exti")] | ||
| 220 | exti::init(cs); | ||
| 221 | |||
| 222 | rcc::init(config.rcc); | ||
| 223 | |||
| 224 | // must be after rcc init | ||
| 225 | #[cfg(feature = "_time-driver")] | ||
| 226 | time_driver::init(cs); | ||
| 227 | |||
| 228 | #[cfg(feature = "low-power")] | ||
| 229 | while !crate::rcc::low_power_ready() { | ||
| 230 | crate::rcc::clock_refcount_sub(cs); | ||
| 182 | } | 231 | } |
| 183 | }); | ||
| 184 | } | ||
| 185 | |||
| 186 | #[cfg(not(any(stm32f1, stm32wb, stm32wl)))] | ||
| 187 | peripherals::SYSCFG::enable(); | ||
| 188 | #[cfg(not(any(stm32h5, stm32h7, stm32wb, stm32wl)))] | ||
| 189 | peripherals::PWR::enable(); | ||
| 190 | #[cfg(not(any(stm32f2, stm32f4, stm32f7, stm32l0, stm32h5, stm32h7)))] | ||
| 191 | peripherals::FLASH::enable(); | ||
| 192 | |||
| 193 | unsafe { | ||
| 194 | #[cfg(feature = "_split-pins-enabled")] | ||
| 195 | crate::pac::SYSCFG.pmcr().modify(|pmcr| { | ||
| 196 | #[cfg(feature = "split-pa0")] | ||
| 197 | pmcr.set_pa0so(true); | ||
| 198 | #[cfg(feature = "split-pa1")] | ||
| 199 | pmcr.set_pa1so(true); | ||
| 200 | #[cfg(feature = "split-pc2")] | ||
| 201 | pmcr.set_pc2so(true); | ||
| 202 | #[cfg(feature = "split-pc3")] | ||
| 203 | pmcr.set_pc3so(true); | ||
| 204 | }); | ||
| 205 | |||
| 206 | gpio::init(); | ||
| 207 | dma::init( | ||
| 208 | #[cfg(bdma)] | ||
| 209 | config.bdma_interrupt_priority, | ||
| 210 | #[cfg(dma)] | ||
| 211 | config.dma_interrupt_priority, | ||
| 212 | #[cfg(gpdma)] | ||
| 213 | config.gpdma_interrupt_priority, | ||
| 214 | ); | ||
| 215 | #[cfg(feature = "exti")] | ||
| 216 | exti::init(); | ||
| 217 | |||
| 218 | rcc::init(config.rcc); | ||
| 219 | |||
| 220 | // must be after rcc init | ||
| 221 | #[cfg(feature = "_time-driver")] | ||
| 222 | time_driver::init(); | ||
| 223 | |||
| 224 | #[cfg(feature = "low-power")] | ||
| 225 | while !crate::rcc::low_power_ready() { | ||
| 226 | crate::rcc::clock_refcount_sub(); | ||
| 227 | } | 232 | } |
| 228 | } | ||
| 229 | 233 | ||
| 230 | p | 234 | p |
| 235 | }) | ||
| 231 | } | 236 | } |
diff --git a/embassy-stm32/src/low_power.rs b/embassy-stm32/src/low_power.rs index ce8afb578..861a59d7b 100644 --- a/embassy-stm32/src/low_power.rs +++ b/embassy-stm32/src/low_power.rs | |||
| @@ -1,5 +1,6 @@ | |||
| 1 | use core::arch::asm; | 1 | use core::arch::asm; |
| 2 | use core::marker::PhantomData; | 2 | use core::marker::PhantomData; |
| 3 | use core::sync::atomic::{compiler_fence, Ordering}; | ||
| 3 | 4 | ||
| 4 | use cortex_m::peripheral::SCB; | 5 | use cortex_m::peripheral::SCB; |
| 5 | use embassy_executor::*; | 6 | use embassy_executor::*; |
| @@ -67,10 +68,8 @@ impl Executor { | |||
| 67 | } | 68 | } |
| 68 | 69 | ||
| 69 | unsafe fn on_wakeup_irq(&mut self) { | 70 | unsafe fn on_wakeup_irq(&mut self) { |
| 70 | trace!("low power: on wakeup irq"); | ||
| 71 | |||
| 72 | self.time_driver.resume_time(); | 71 | self.time_driver.resume_time(); |
| 73 | trace!("low power: resume time"); | 72 | trace!("low power: resume"); |
| 74 | } | 73 | } |
| 75 | 74 | ||
| 76 | pub(self) fn stop_with_rtc(&mut self, rtc: &'static Rtc) { | 75 | pub(self) fn stop_with_rtc(&mut self, rtc: &'static Rtc) { |
| @@ -82,21 +81,18 @@ impl Executor { | |||
| 82 | } | 81 | } |
| 83 | 82 | ||
| 84 | fn configure_pwr(&mut self) { | 83 | fn configure_pwr(&mut self) { |
| 85 | trace!("low power: configure_pwr"); | ||
| 86 | |||
| 87 | self.scb.clear_sleepdeep(); | 84 | self.scb.clear_sleepdeep(); |
| 88 | if !low_power_ready() { | ||
| 89 | trace!("low power: configure_pwr: low power not ready"); | ||
| 90 | return; | ||
| 91 | } | ||
| 92 | 85 | ||
| 93 | if self.time_driver.pause_time().is_err() { | 86 | compiler_fence(Ordering::SeqCst); |
| 94 | trace!("low power: configure_pwr: time driver failed to pause"); | ||
| 95 | return; | ||
| 96 | } | ||
| 97 | 87 | ||
| 98 | trace!("low power: enter stop..."); | 88 | if !low_power_ready() { |
| 99 | self.scb.set_sleepdeep(); | 89 | trace!("low power: not ready to stop"); |
| 90 | } else if self.time_driver.pause_time().is_err() { | ||
| 91 | trace!("low power: failed to pause time"); | ||
| 92 | } else { | ||
| 93 | trace!("low power: stop"); | ||
| 94 | self.scb.set_sleepdeep(); | ||
| 95 | } | ||
| 100 | } | 96 | } |
| 101 | 97 | ||
| 102 | /// Run the executor. | 98 | /// Run the executor. |
diff --git a/embassy-stm32/src/opamp.rs b/embassy-stm32/src/opamp.rs new file mode 100644 index 000000000..e0fad26eb --- /dev/null +++ b/embassy-stm32/src/opamp.rs | |||
| @@ -0,0 +1,159 @@ | |||
| 1 | #![macro_use] | ||
| 2 | |||
| 3 | use embassy_hal_internal::{into_ref, PeripheralRef}; | ||
| 4 | |||
| 5 | use crate::Peripheral; | ||
| 6 | |||
| 7 | #[derive(Clone, Copy)] | ||
| 8 | pub enum OpAmpGain { | ||
| 9 | Mul1, | ||
| 10 | Mul2, | ||
| 11 | Mul4, | ||
| 12 | Mul8, | ||
| 13 | Mul16, | ||
| 14 | } | ||
| 15 | |||
| 16 | pub struct OpAmpOutput<'d, 'p, T: Instance, P: NonInvertingPin<T>> { | ||
| 17 | _inner: &'d OpAmp<'d, T>, | ||
| 18 | _input: &'p mut P, | ||
| 19 | } | ||
| 20 | |||
| 21 | pub struct OpAmp<'d, T: Instance> { | ||
| 22 | _inner: PeripheralRef<'d, T>, | ||
| 23 | } | ||
| 24 | |||
| 25 | impl<'d, T: Instance> OpAmp<'d, T> { | ||
| 26 | pub fn new(opamp: impl Peripheral<P = T> + 'd) -> Self { | ||
| 27 | Self::new_inner(opamp) | ||
| 28 | } | ||
| 29 | |||
| 30 | fn new_inner(opamp: impl Peripheral<P = T> + 'd) -> Self { | ||
| 31 | into_ref!(opamp); | ||
| 32 | |||
| 33 | #[cfg(opamp_f3)] | ||
| 34 | T::regs().opampcsr().modify(|w| { | ||
| 35 | w.set_opampen(true); | ||
| 36 | }); | ||
| 37 | |||
| 38 | #[cfg(opamp_g4)] | ||
| 39 | T::regs().opamp_csr().modify(|w| { | ||
| 40 | w.set_opaen(true); | ||
| 41 | }); | ||
| 42 | |||
| 43 | Self { _inner: opamp } | ||
| 44 | } | ||
| 45 | |||
| 46 | pub fn buffer_for<'a, 'b, P>(&'a mut self, pin: &'b mut P, gain: OpAmpGain) -> OpAmpOutput<'a, 'b, T, P> | ||
| 47 | where | ||
| 48 | P: NonInvertingPin<T>, | ||
| 49 | { | ||
| 50 | let (vm_sel, pga_gain) = match gain { | ||
| 51 | OpAmpGain::Mul1 => (0b11, 0b00), | ||
| 52 | OpAmpGain::Mul2 => (0b10, 0b00), | ||
| 53 | OpAmpGain::Mul4 => (0b10, 0b01), | ||
| 54 | OpAmpGain::Mul8 => (0b10, 0b10), | ||
| 55 | OpAmpGain::Mul16 => (0b10, 0b11), | ||
| 56 | }; | ||
| 57 | |||
| 58 | #[cfg(opamp_f3)] | ||
| 59 | T::regs().opampcsr().modify(|w| { | ||
| 60 | w.set_vp_sel(pin.channel()); | ||
| 61 | w.set_vm_sel(vm_sel); | ||
| 62 | w.set_pga_gain(pga_gain); | ||
| 63 | }); | ||
| 64 | |||
| 65 | #[cfg(opamp_g4)] | ||
| 66 | T::regs().opamp_csr().modify(|w| { | ||
| 67 | use crate::pac::opamp::vals::*; | ||
| 68 | |||
| 69 | w.set_vp_sel(OpampCsrVpSel::from_bits(pin.channel())); | ||
| 70 | w.set_vm_sel(OpampCsrVmSel::from_bits(vm_sel)); | ||
| 71 | w.set_pga_gain(OpampCsrPgaGain::from_bits(pga_gain)); | ||
| 72 | }); | ||
| 73 | |||
| 74 | OpAmpOutput { | ||
| 75 | _inner: self, | ||
| 76 | _input: pin, | ||
| 77 | } | ||
| 78 | } | ||
| 79 | } | ||
| 80 | |||
| 81 | pub trait Instance: sealed::Instance + 'static {} | ||
| 82 | |||
| 83 | pub(crate) mod sealed { | ||
| 84 | pub trait Instance { | ||
| 85 | fn regs() -> crate::pac::opamp::Opamp; | ||
| 86 | } | ||
| 87 | |||
| 88 | pub trait NonInvertingPin<T: Instance> { | ||
| 89 | fn channel(&self) -> u8; | ||
| 90 | } | ||
| 91 | |||
| 92 | pub trait InvertingPin<T: Instance> { | ||
| 93 | fn channel(&self) -> u8; | ||
| 94 | } | ||
| 95 | } | ||
| 96 | |||
| 97 | pub trait NonInvertingPin<T: Instance>: sealed::NonInvertingPin<T> {} | ||
| 98 | |||
| 99 | pub trait InvertingPin<T: Instance>: sealed::InvertingPin<T> {} | ||
| 100 | |||
| 101 | #[cfg(opamp_f3)] | ||
| 102 | macro_rules! impl_opamp_output { | ||
| 103 | ($inst:ident, $adc:ident, $ch:expr) => { | ||
| 104 | impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::sealed::AdcPin<crate::peripherals::$adc> | ||
| 105 | for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P> | ||
| 106 | { | ||
| 107 | fn channel(&self) -> u8 { | ||
| 108 | $ch | ||
| 109 | } | ||
| 110 | } | ||
| 111 | |||
| 112 | impl<'d, 'p, P: NonInvertingPin<crate::peripherals::$inst>> crate::adc::AdcPin<crate::peripherals::$adc> | ||
| 113 | for OpAmpOutput<'d, 'p, crate::peripherals::$inst, P> | ||
| 114 | { | ||
| 115 | } | ||
| 116 | }; | ||
| 117 | } | ||
| 118 | |||
| 119 | #[cfg(opamp_f3)] | ||
| 120 | foreach_peripheral!( | ||
| 121 | (opamp, OPAMP1) => { | ||
| 122 | impl_opamp_output!(OPAMP1, ADC1, 3); | ||
| 123 | }; | ||
| 124 | (opamp, OPAMP2) => { | ||
| 125 | impl_opamp_output!(OPAMP2, ADC2, 3); | ||
| 126 | }; | ||
| 127 | (opamp, OPAMP3) => { | ||
| 128 | impl_opamp_output!(OPAMP3, ADC3, 1); | ||
| 129 | }; | ||
| 130 | (opamp, OPAMP4) => { | ||
| 131 | impl_opamp_output!(OPAMP4, ADC4, 3); | ||
| 132 | }; | ||
| 133 | ); | ||
| 134 | |||
| 135 | foreach_peripheral! { | ||
| 136 | (opamp, $inst:ident) => { | ||
| 137 | impl sealed::Instance for crate::peripherals::$inst { | ||
| 138 | fn regs() -> crate::pac::opamp::Opamp { | ||
| 139 | crate::pac::$inst | ||
| 140 | } | ||
| 141 | } | ||
| 142 | |||
| 143 | impl Instance for crate::peripherals::$inst { | ||
| 144 | |||
| 145 | } | ||
| 146 | }; | ||
| 147 | } | ||
| 148 | |||
| 149 | #[allow(unused_macros)] | ||
| 150 | macro_rules! impl_opamp_pin { | ||
| 151 | ($inst:ident, $pin:ident, $ch:expr) => { | ||
| 152 | impl crate::opamp::NonInvertingPin<peripherals::$inst> for crate::peripherals::$pin {} | ||
| 153 | impl crate::opamp::sealed::NonInvertingPin<peripherals::$inst> for crate::peripherals::$pin { | ||
| 154 | fn channel(&self) -> u8 { | ||
| 155 | $ch | ||
| 156 | } | ||
| 157 | } | ||
| 158 | }; | ||
| 159 | } | ||
diff --git a/embassy-stm32/src/qspi/enums.rs b/embassy-stm32/src/qspi/enums.rs index 2dbe2b061..0412d991a 100644 --- a/embassy-stm32/src/qspi/enums.rs +++ b/embassy-stm32/src/qspi/enums.rs | |||
| @@ -38,6 +38,22 @@ impl Into<u8> for QspiWidth { | |||
| 38 | } | 38 | } |
| 39 | } | 39 | } |
| 40 | 40 | ||
| 41 | #[allow(dead_code)] | ||
| 42 | #[derive(Copy, Clone)] | ||
| 43 | pub enum FlashSelection { | ||
| 44 | Flash1, | ||
| 45 | Flash2, | ||
| 46 | } | ||
| 47 | |||
| 48 | impl Into<bool> for FlashSelection { | ||
| 49 | fn into(self) -> bool { | ||
| 50 | match self { | ||
| 51 | FlashSelection::Flash1 => false, | ||
| 52 | FlashSelection::Flash2 => true, | ||
| 53 | } | ||
| 54 | } | ||
| 55 | } | ||
| 56 | |||
| 41 | #[derive(Copy, Clone)] | 57 | #[derive(Copy, Clone)] |
| 42 | pub enum MemorySize { | 58 | pub enum MemorySize { |
| 43 | _1KiB, | 59 | _1KiB, |
diff --git a/embassy-stm32/src/qspi/mod.rs b/embassy-stm32/src/qspi/mod.rs index 32382fb28..4b0e8ecef 100644 --- a/embassy-stm32/src/qspi/mod.rs +++ b/embassy-stm32/src/qspi/mod.rs | |||
| @@ -7,7 +7,7 @@ use enums::*; | |||
| 7 | 7 | ||
| 8 | use crate::dma::Transfer; | 8 | use crate::dma::Transfer; |
| 9 | use crate::gpio::sealed::AFType; | 9 | use crate::gpio::sealed::AFType; |
| 10 | use crate::gpio::AnyPin; | 10 | use crate::gpio::{AnyPin, Pull}; |
| 11 | use crate::pac::quadspi::Quadspi as Regs; | 11 | use crate::pac::quadspi::Quadspi as Regs; |
| 12 | use crate::rcc::RccPeripheral; | 12 | use crate::rcc::RccPeripheral; |
| 13 | use crate::{peripherals, Peripheral}; | 13 | use crate::{peripherals, Peripheral}; |
| @@ -83,30 +83,30 @@ pub struct Qspi<'d, T: Instance, Dma> { | |||
| 83 | } | 83 | } |
| 84 | 84 | ||
| 85 | impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | 85 | impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { |
| 86 | pub fn new( | 86 | pub fn new_bk1( |
| 87 | peri: impl Peripheral<P = T> + 'd, | 87 | peri: impl Peripheral<P = T> + 'd, |
| 88 | d0: impl Peripheral<P = impl D0Pin<T>> + 'd, | 88 | d0: impl Peripheral<P = impl BK1D0Pin<T>> + 'd, |
| 89 | d1: impl Peripheral<P = impl D1Pin<T>> + 'd, | 89 | d1: impl Peripheral<P = impl BK1D1Pin<T>> + 'd, |
| 90 | d2: impl Peripheral<P = impl D2Pin<T>> + 'd, | 90 | d2: impl Peripheral<P = impl BK1D2Pin<T>> + 'd, |
| 91 | d3: impl Peripheral<P = impl D3Pin<T>> + 'd, | 91 | d3: impl Peripheral<P = impl BK1D3Pin<T>> + 'd, |
| 92 | sck: impl Peripheral<P = impl SckPin<T>> + 'd, | 92 | sck: impl Peripheral<P = impl SckPin<T>> + 'd, |
| 93 | nss: impl Peripheral<P = impl NSSPin<T>> + 'd, | 93 | nss: impl Peripheral<P = impl BK1NSSPin<T>> + 'd, |
| 94 | dma: impl Peripheral<P = Dma> + 'd, | 94 | dma: impl Peripheral<P = Dma> + 'd, |
| 95 | config: Config, | 95 | config: Config, |
| 96 | ) -> Self { | 96 | ) -> Self { |
| 97 | into_ref!(peri, d0, d1, d2, d3, sck, nss); | 97 | into_ref!(peri, d0, d1, d2, d3, sck, nss); |
| 98 | 98 | ||
| 99 | sck.set_as_af(sck.af_num(), AFType::OutputPushPull); | 99 | sck.set_as_af_pull(sck.af_num(), AFType::OutputPushPull, Pull::None); |
| 100 | sck.set_speed(crate::gpio::Speed::VeryHigh); | 100 | sck.set_speed(crate::gpio::Speed::VeryHigh); |
| 101 | nss.set_as_af(nss.af_num(), AFType::OutputPushPull); | 101 | nss.set_as_af_pull(nss.af_num(), AFType::OutputPushPull, Pull::Up); |
| 102 | nss.set_speed(crate::gpio::Speed::VeryHigh); | 102 | nss.set_speed(crate::gpio::Speed::VeryHigh); |
| 103 | d0.set_as_af(d0.af_num(), AFType::OutputPushPull); | 103 | d0.set_as_af_pull(d0.af_num(), AFType::OutputPushPull, Pull::None); |
| 104 | d0.set_speed(crate::gpio::Speed::VeryHigh); | 104 | d0.set_speed(crate::gpio::Speed::VeryHigh); |
| 105 | d1.set_as_af(d1.af_num(), AFType::OutputPushPull); | 105 | d1.set_as_af_pull(d1.af_num(), AFType::OutputPushPull, Pull::None); |
| 106 | d1.set_speed(crate::gpio::Speed::VeryHigh); | 106 | d1.set_speed(crate::gpio::Speed::VeryHigh); |
| 107 | d2.set_as_af(d2.af_num(), AFType::OutputPushPull); | 107 | d2.set_as_af_pull(d2.af_num(), AFType::OutputPushPull, Pull::None); |
| 108 | d2.set_speed(crate::gpio::Speed::VeryHigh); | 108 | d2.set_speed(crate::gpio::Speed::VeryHigh); |
| 109 | d3.set_as_af(d3.af_num(), AFType::OutputPushPull); | 109 | d3.set_as_af_pull(d3.af_num(), AFType::OutputPushPull, Pull::None); |
| 110 | d3.set_speed(crate::gpio::Speed::VeryHigh); | 110 | d3.set_speed(crate::gpio::Speed::VeryHigh); |
| 111 | 111 | ||
| 112 | Self::new_inner( | 112 | Self::new_inner( |
| @@ -119,6 +119,47 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 119 | Some(nss.map_into()), | 119 | Some(nss.map_into()), |
| 120 | dma, | 120 | dma, |
| 121 | config, | 121 | config, |
| 122 | FlashSelection::Flash2, | ||
| 123 | ) | ||
| 124 | } | ||
| 125 | |||
| 126 | pub fn new_bk2( | ||
| 127 | peri: impl Peripheral<P = T> + 'd, | ||
| 128 | d0: impl Peripheral<P = impl BK2D0Pin<T>> + 'd, | ||
| 129 | d1: impl Peripheral<P = impl BK2D1Pin<T>> + 'd, | ||
| 130 | d2: impl Peripheral<P = impl BK2D2Pin<T>> + 'd, | ||
| 131 | d3: impl Peripheral<P = impl BK2D3Pin<T>> + 'd, | ||
| 132 | sck: impl Peripheral<P = impl SckPin<T>> + 'd, | ||
| 133 | nss: impl Peripheral<P = impl BK2NSSPin<T>> + 'd, | ||
| 134 | dma: impl Peripheral<P = Dma> + 'd, | ||
| 135 | config: Config, | ||
| 136 | ) -> Self { | ||
| 137 | into_ref!(peri, d0, d1, d2, d3, sck, nss); | ||
| 138 | |||
| 139 | sck.set_as_af_pull(sck.af_num(), AFType::OutputPushPull, Pull::None); | ||
| 140 | sck.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 141 | nss.set_as_af_pull(nss.af_num(), AFType::OutputPushPull, Pull::Up); | ||
| 142 | nss.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 143 | d0.set_as_af_pull(d0.af_num(), AFType::OutputPushPull, Pull::None); | ||
| 144 | d0.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 145 | d1.set_as_af_pull(d1.af_num(), AFType::OutputPushPull, Pull::None); | ||
| 146 | d1.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 147 | d2.set_as_af_pull(d2.af_num(), AFType::OutputPushPull, Pull::None); | ||
| 148 | d2.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 149 | d3.set_as_af_pull(d3.af_num(), AFType::OutputPushPull, Pull::None); | ||
| 150 | d3.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 151 | |||
| 152 | Self::new_inner( | ||
| 153 | peri, | ||
| 154 | Some(d0.map_into()), | ||
| 155 | Some(d1.map_into()), | ||
| 156 | Some(d2.map_into()), | ||
| 157 | Some(d3.map_into()), | ||
| 158 | Some(sck.map_into()), | ||
| 159 | Some(nss.map_into()), | ||
| 160 | dma, | ||
| 161 | config, | ||
| 162 | FlashSelection::Flash2, | ||
| 122 | ) | 163 | ) |
| 123 | } | 164 | } |
| 124 | 165 | ||
| @@ -132,22 +173,39 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 132 | nss: Option<PeripheralRef<'d, AnyPin>>, | 173 | nss: Option<PeripheralRef<'d, AnyPin>>, |
| 133 | dma: impl Peripheral<P = Dma> + 'd, | 174 | dma: impl Peripheral<P = Dma> + 'd, |
| 134 | config: Config, | 175 | config: Config, |
| 176 | fsel: FlashSelection, | ||
| 135 | ) -> Self { | 177 | ) -> Self { |
| 136 | into_ref!(peri, dma); | 178 | into_ref!(peri, dma); |
| 137 | 179 | ||
| 138 | T::enable(); | 180 | T::enable_and_reset(); |
| 139 | T::REGS.cr().write(|w| w.set_fthres(config.fifo_threshold.into())); | ||
| 140 | 181 | ||
| 141 | while T::REGS.sr().read().busy() {} | 182 | while T::REGS.sr().read().busy() {} |
| 142 | 183 | ||
| 143 | T::REGS.cr().write(|w| { | 184 | #[cfg(stm32h7)] |
| 144 | w.set_prescaler(config.prescaler); | 185 | { |
| 186 | use stm32_metapac::quadspi::regs::Cr; | ||
| 187 | // Apply precautionary steps according to the errata... | ||
| 188 | T::REGS.cr().write_value(Cr(0)); | ||
| 189 | while T::REGS.sr().read().busy() {} | ||
| 190 | T::REGS.cr().write_value(Cr(0xFF000001)); | ||
| 191 | T::REGS.ccr().write(|w| w.set_frcm(true)); | ||
| 192 | T::REGS.ccr().write(|w| w.set_frcm(true)); | ||
| 193 | T::REGS.cr().write_value(Cr(0)); | ||
| 194 | while T::REGS.sr().read().busy() {} | ||
| 195 | } | ||
| 196 | |||
| 197 | T::REGS.cr().modify(|w| { | ||
| 145 | w.set_en(true); | 198 | w.set_en(true); |
| 199 | //w.set_tcen(false); | ||
| 200 | w.set_sshift(false); | ||
| 201 | w.set_fthres(config.fifo_threshold.into()); | ||
| 202 | w.set_prescaler(config.prescaler); | ||
| 203 | w.set_fsel(fsel.into()); | ||
| 146 | }); | 204 | }); |
| 147 | T::REGS.dcr().write(|w| { | 205 | T::REGS.dcr().modify(|w| { |
| 148 | w.set_fsize(config.memory_size.into()); | 206 | w.set_fsize(config.memory_size.into()); |
| 149 | w.set_csht(config.cs_high_time.into()); | 207 | w.set_csht(config.cs_high_time.into()); |
| 150 | w.set_ckmode(false); | 208 | w.set_ckmode(true); |
| 151 | }); | 209 | }); |
| 152 | 210 | ||
| 153 | Self { | 211 | Self { |
| @@ -164,6 +222,7 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 164 | } | 222 | } |
| 165 | 223 | ||
| 166 | pub fn command(&mut self, transaction: TransferConfig) { | 224 | pub fn command(&mut self, transaction: TransferConfig) { |
| 225 | #[cfg(not(stm32h7))] | ||
| 167 | T::REGS.cr().modify(|v| v.set_dmaen(false)); | 226 | T::REGS.cr().modify(|v| v.set_dmaen(false)); |
| 168 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); | 227 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); |
| 169 | 228 | ||
| @@ -172,6 +231,7 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 172 | } | 231 | } |
| 173 | 232 | ||
| 174 | pub fn blocking_read(&mut self, buf: &mut [u8], transaction: TransferConfig) { | 233 | pub fn blocking_read(&mut self, buf: &mut [u8], transaction: TransferConfig) { |
| 234 | #[cfg(not(stm32h7))] | ||
| 175 | T::REGS.cr().modify(|v| v.set_dmaen(false)); | 235 | T::REGS.cr().modify(|v| v.set_dmaen(false)); |
| 176 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); | 236 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); |
| 177 | 237 | ||
| @@ -195,7 +255,10 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 195 | } | 255 | } |
| 196 | 256 | ||
| 197 | pub fn blocking_write(&mut self, buf: &[u8], transaction: TransferConfig) { | 257 | pub fn blocking_write(&mut self, buf: &[u8], transaction: TransferConfig) { |
| 258 | // STM32H7 does not have dmaen | ||
| 259 | #[cfg(not(stm32h7))] | ||
| 198 | T::REGS.cr().modify(|v| v.set_dmaen(false)); | 260 | T::REGS.cr().modify(|v| v.set_dmaen(false)); |
| 261 | |||
| 199 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); | 262 | self.setup_transaction(QspiMode::IndirectWrite, &transaction); |
| 200 | 263 | ||
| 201 | if let Some(len) = transaction.data_len { | 264 | if let Some(len) = transaction.data_len { |
| @@ -238,6 +301,8 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 238 | ) | 301 | ) |
| 239 | }; | 302 | }; |
| 240 | 303 | ||
| 304 | // STM32H7 does not have dmaen | ||
| 305 | #[cfg(not(stm32h7))] | ||
| 241 | T::REGS.cr().modify(|v| v.set_dmaen(true)); | 306 | T::REGS.cr().modify(|v| v.set_dmaen(true)); |
| 242 | 307 | ||
| 243 | transfer.blocking_wait(); | 308 | transfer.blocking_wait(); |
| @@ -264,6 +329,8 @@ impl<'d, T: Instance, Dma> Qspi<'d, T, Dma> { | |||
| 264 | ) | 329 | ) |
| 265 | }; | 330 | }; |
| 266 | 331 | ||
| 332 | // STM32H7 does not have dmaen | ||
| 333 | #[cfg(not(stm32h7))] | ||
| 267 | T::REGS.cr().modify(|v| v.set_dmaen(true)); | 334 | T::REGS.cr().modify(|v| v.set_dmaen(true)); |
| 268 | 335 | ||
| 269 | transfer.blocking_wait(); | 336 | transfer.blocking_wait(); |
| @@ -313,11 +380,17 @@ pub(crate) mod sealed { | |||
| 313 | pub trait Instance: Peripheral<P = Self> + sealed::Instance + RccPeripheral {} | 380 | pub trait Instance: Peripheral<P = Self> + sealed::Instance + RccPeripheral {} |
| 314 | 381 | ||
| 315 | pin_trait!(SckPin, Instance); | 382 | pin_trait!(SckPin, Instance); |
| 316 | pin_trait!(D0Pin, Instance); | 383 | pin_trait!(BK1D0Pin, Instance); |
| 317 | pin_trait!(D1Pin, Instance); | 384 | pin_trait!(BK1D1Pin, Instance); |
| 318 | pin_trait!(D2Pin, Instance); | 385 | pin_trait!(BK1D2Pin, Instance); |
| 319 | pin_trait!(D3Pin, Instance); | 386 | pin_trait!(BK1D3Pin, Instance); |
| 320 | pin_trait!(NSSPin, Instance); | 387 | pin_trait!(BK1NSSPin, Instance); |
| 388 | |||
| 389 | pin_trait!(BK2D0Pin, Instance); | ||
| 390 | pin_trait!(BK2D1Pin, Instance); | ||
| 391 | pin_trait!(BK2D2Pin, Instance); | ||
| 392 | pin_trait!(BK2D3Pin, Instance); | ||
| 393 | pin_trait!(BK2NSSPin, Instance); | ||
| 321 | 394 | ||
| 322 | dma_trait!(QuadDma, Instance); | 395 | dma_trait!(QuadDma, Instance); |
| 323 | 396 | ||
diff --git a/embassy-stm32/src/rcc/bd.rs b/embassy-stm32/src/rcc/bd.rs index de27130f2..d20f58185 100644 --- a/embassy-stm32/src/rcc/bd.rs +++ b/embassy-stm32/src/rcc/bd.rs | |||
| @@ -1,102 +1,161 @@ | |||
| 1 | use core::sync::atomic::{compiler_fence, Ordering}; | ||
| 2 | |||
| 3 | use crate::pac::common::{Reg, RW}; | ||
| 4 | pub use crate::pac::rcc::vals::Rtcsel as RtcClockSource; | ||
| 5 | use crate::time::Hertz; | ||
| 6 | |||
| 7 | #[cfg(any(stm32f0, stm32f1, stm32f3))] | ||
| 8 | pub const LSI_FREQ: Hertz = Hertz(40_000); | ||
| 9 | #[cfg(not(any(stm32f0, stm32f1, stm32f3)))] | ||
| 10 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 11 | |||
| 12 | #[allow(dead_code)] | ||
| 13 | #[derive(Clone, Copy)] | ||
| 14 | pub enum LseMode { | ||
| 15 | Oscillator(LseDrive), | ||
| 16 | Bypass, | ||
| 17 | } | ||
| 18 | |||
| 19 | pub struct LseConfig { | ||
| 20 | pub frequency: Hertz, | ||
| 21 | pub mode: LseMode, | ||
| 22 | } | ||
| 23 | |||
| 1 | #[allow(dead_code)] | 24 | #[allow(dead_code)] |
| 2 | #[derive(Default, Clone, Copy)] | 25 | #[derive(Default, Clone, Copy)] |
| 3 | pub enum LseDrive { | 26 | pub enum LseDrive { |
| 4 | #[cfg(any(rtc_v2f7, rtc_v2l4))] | ||
| 5 | Low = 0, | 27 | Low = 0, |
| 6 | MediumLow = 0x01, | 28 | MediumLow = 0x01, |
| 7 | #[default] | 29 | #[default] |
| 8 | MediumHigh = 0x02, | 30 | MediumHigh = 0x02, |
| 9 | #[cfg(any(rtc_v2f7, rtc_v2l4))] | ||
| 10 | High = 0x03, | 31 | High = 0x03, |
| 11 | } | 32 | } |
| 12 | 33 | ||
| 13 | #[cfg(any(rtc_v2f7, rtc_v2h7, rtc_v2l0, rtc_v2l4))] | 34 | // All families but these have the LSEDRV register |
| 35 | #[cfg(not(any(rcc_f1, rcc_f1cl, rcc_f100, rcc_f2, rcc_f4, rcc_f400, rcc_f410, rcc_l1)))] | ||
| 14 | impl From<LseDrive> for crate::pac::rcc::vals::Lsedrv { | 36 | impl From<LseDrive> for crate::pac::rcc::vals::Lsedrv { |
| 15 | fn from(value: LseDrive) -> Self { | 37 | fn from(value: LseDrive) -> Self { |
| 16 | use crate::pac::rcc::vals::Lsedrv; | 38 | use crate::pac::rcc::vals::Lsedrv; |
| 17 | 39 | ||
| 18 | match value { | 40 | match value { |
| 19 | #[cfg(any(rtc_v2f7, rtc_v2l4))] | ||
| 20 | LseDrive::Low => Lsedrv::LOW, | 41 | LseDrive::Low => Lsedrv::LOW, |
| 21 | LseDrive::MediumLow => Lsedrv::MEDIUMLOW, | 42 | LseDrive::MediumLow => Lsedrv::MEDIUMLOW, |
| 22 | LseDrive::MediumHigh => Lsedrv::MEDIUMHIGH, | 43 | LseDrive::MediumHigh => Lsedrv::MEDIUMHIGH, |
| 23 | #[cfg(any(rtc_v2f7, rtc_v2l4))] | ||
| 24 | LseDrive::High => Lsedrv::HIGH, | 44 | LseDrive::High => Lsedrv::HIGH, |
| 25 | } | 45 | } |
| 26 | } | 46 | } |
| 27 | } | 47 | } |
| 28 | 48 | ||
| 29 | pub use crate::pac::rcc::vals::Rtcsel as RtcClockSource; | ||
| 30 | |||
| 31 | #[cfg(not(any(rtc_v2l0, rtc_v2l1, stm32c0)))] | 49 | #[cfg(not(any(rtc_v2l0, rtc_v2l1, stm32c0)))] |
| 32 | #[allow(dead_code)] | ||
| 33 | type Bdcr = crate::pac::rcc::regs::Bdcr; | 50 | type Bdcr = crate::pac::rcc::regs::Bdcr; |
| 34 | |||
| 35 | #[cfg(any(rtc_v2l0, rtc_v2l1))] | 51 | #[cfg(any(rtc_v2l0, rtc_v2l1))] |
| 36 | #[allow(dead_code)] | ||
| 37 | type Bdcr = crate::pac::rcc::regs::Csr; | 52 | type Bdcr = crate::pac::rcc::regs::Csr; |
| 53 | #[cfg(any(stm32c0))] | ||
| 54 | type Bdcr = crate::pac::rcc::regs::Csr1; | ||
| 55 | |||
| 56 | #[cfg(any(stm32c0))] | ||
| 57 | fn unlock() {} | ||
| 58 | |||
| 59 | #[cfg(not(any(stm32c0)))] | ||
| 60 | fn unlock() { | ||
| 61 | #[cfg(any(stm32f0, stm32f1, stm32f2, stm32f3, stm32l0, stm32l1))] | ||
| 62 | let cr = crate::pac::PWR.cr(); | ||
| 63 | #[cfg(not(any(stm32f0, stm32f1, stm32f2, stm32f3, stm32l0, stm32l1, stm32u5, stm32h5, stm32wba)))] | ||
| 64 | let cr = crate::pac::PWR.cr1(); | ||
| 65 | #[cfg(any(stm32u5, stm32h5, stm32wba))] | ||
| 66 | let cr = crate::pac::PWR.dbpcr(); | ||
| 67 | |||
| 68 | cr.modify(|w| w.set_dbp(true)); | ||
| 69 | while !cr.read().dbp() {} | ||
| 70 | } | ||
| 38 | 71 | ||
| 39 | #[allow(dead_code)] | 72 | fn bdcr() -> Reg<Bdcr, RW> { |
| 40 | pub struct BackupDomain {} | 73 | #[cfg(any(rtc_v2l0, rtc_v2l1))] |
| 41 | 74 | return crate::pac::RCC.csr(); | |
| 42 | impl BackupDomain { | 75 | #[cfg(not(any(rtc_v2l0, rtc_v2l1, stm32c0)))] |
| 43 | #[cfg(any( | 76 | return crate::pac::RCC.bdcr(); |
| 44 | rtc_v2f0, rtc_v2f2, rtc_v2f3, rtc_v2f4, rtc_v2f7, rtc_v2h7, rtc_v2l0, rtc_v2l1, rtc_v2l4, rtc_v2wb, rtc_v3, | 77 | #[cfg(any(stm32c0))] |
| 45 | rtc_v3u5 | 78 | return crate::pac::RCC.csr1(); |
| 46 | ))] | 79 | } |
| 47 | #[allow(dead_code, unused_variables)] | ||
| 48 | fn modify<R>(f: impl FnOnce(&mut Bdcr) -> R) -> R { | ||
| 49 | #[cfg(any(rtc_v2f2, rtc_v2f3, rtc_v2l1, rtc_v2l0))] | ||
| 50 | let cr = crate::pac::PWR.cr(); | ||
| 51 | #[cfg(any(rtc_v2f4, rtc_v2f7, rtc_v2h7, rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] | ||
| 52 | let cr = crate::pac::PWR.cr1(); | ||
| 53 | |||
| 54 | // TODO: Missing from PAC for l0 and f0? | ||
| 55 | #[cfg(not(any(rtc_v2f0, rtc_v3u5)))] | ||
| 56 | { | ||
| 57 | cr.modify(|w| w.set_dbp(true)); | ||
| 58 | while !cr.read().dbp() {} | ||
| 59 | } | ||
| 60 | 80 | ||
| 61 | #[cfg(any(rtc_v2l0, rtc_v2l1))] | 81 | pub struct LsConfig { |
| 62 | let cr = crate::pac::RCC.csr(); | 82 | pub rtc: RtcClockSource, |
| 83 | pub lsi: bool, | ||
| 84 | pub lse: Option<LseConfig>, | ||
| 85 | } | ||
| 63 | 86 | ||
| 64 | #[cfg(not(any(rtc_v2l0, rtc_v2l1)))] | 87 | impl LsConfig { |
| 65 | let cr = crate::pac::RCC.bdcr(); | 88 | pub const fn default_lse() -> Self { |
| 89 | Self { | ||
| 90 | rtc: RtcClockSource::LSE, | ||
| 91 | lse: Some(LseConfig { | ||
| 92 | frequency: Hertz(32_768), | ||
| 93 | mode: LseMode::Oscillator(LseDrive::MediumHigh), | ||
| 94 | }), | ||
| 95 | lsi: false, | ||
| 96 | } | ||
| 97 | } | ||
| 66 | 98 | ||
| 67 | cr.modify(|w| f(w)) | 99 | pub const fn default_lsi() -> Self { |
| 100 | Self { | ||
| 101 | rtc: RtcClockSource::LSI, | ||
| 102 | lsi: true, | ||
| 103 | lse: None, | ||
| 104 | } | ||
| 68 | } | 105 | } |
| 69 | 106 | ||
| 70 | #[cfg(any( | 107 | pub const fn off() -> Self { |
| 71 | rtc_v2f0, rtc_v2f2, rtc_v2f3, rtc_v2f4, rtc_v2f7, rtc_v2h7, rtc_v2l0, rtc_v2l1, rtc_v2l4, rtc_v2wb, rtc_v3, | 108 | Self { |
| 72 | rtc_v3u5 | 109 | rtc: RtcClockSource::DISABLE, |
| 73 | ))] | 110 | lsi: false, |
| 74 | #[allow(dead_code)] | 111 | lse: None, |
| 75 | fn read() -> Bdcr { | 112 | } |
| 76 | #[cfg(any(rtc_v2l0, rtc_v2l1))] | 113 | } |
| 77 | let r = crate::pac::RCC.csr().read(); | 114 | } |
| 78 | 115 | ||
| 79 | #[cfg(not(any(rtc_v2l0, rtc_v2l1)))] | 116 | impl Default for LsConfig { |
| 80 | let r = crate::pac::RCC.bdcr().read(); | 117 | fn default() -> Self { |
| 118 | // on L5, just the fact that LSI is enabled makes things crash. | ||
| 119 | // TODO: investigate. | ||
| 81 | 120 | ||
| 82 | r | 121 | #[cfg(not(stm32l5))] |
| 122 | return Self::default_lsi(); | ||
| 123 | #[cfg(stm32l5)] | ||
| 124 | return Self::off(); | ||
| 83 | } | 125 | } |
| 126 | } | ||
| 84 | 127 | ||
| 85 | #[cfg(any( | 128 | impl LsConfig { |
| 86 | rtc_v2f0, rtc_v2f2, rtc_v2f3, rtc_v2f4, rtc_v2f7, rtc_v2h7, rtc_v2l0, rtc_v2l1, rtc_v2l4, rtc_v2wb, rtc_v3, | 129 | pub(crate) fn init(&self) -> Option<Hertz> { |
| 87 | rtc_v3u5 | 130 | let rtc_clk = match self.rtc { |
| 88 | ))] | 131 | RtcClockSource::LSI => { |
| 89 | #[allow(dead_code, unused_variables)] | 132 | assert!(self.lsi); |
| 90 | pub fn configure_ls(clock_source: RtcClockSource, lsi: bool, lse: Option<LseDrive>) { | 133 | Some(LSI_FREQ) |
| 91 | if lsi { | 134 | } |
| 92 | #[cfg(rtc_v3u5)] | 135 | RtcClockSource::LSE => Some(self.lse.as_ref().unwrap().frequency), |
| 93 | let csr = crate::pac::RCC.bdcr(); | 136 | RtcClockSource::DISABLE => None, |
| 137 | _ => todo!(), | ||
| 138 | }; | ||
| 94 | 139 | ||
| 95 | #[cfg(not(rtc_v3u5))] | 140 | let (lse_en, lse_byp, lse_drv) = match &self.lse { |
| 96 | let csr = crate::pac::RCC.csr(); | 141 | Some(c) => match c.mode { |
| 142 | LseMode::Oscillator(lse_drv) => (true, false, Some(lse_drv)), | ||
| 143 | LseMode::Bypass => (true, true, None), | ||
| 144 | }, | ||
| 145 | None => (false, false, None), | ||
| 146 | }; | ||
| 147 | _ = lse_drv; // not all chips have it. | ||
| 148 | |||
| 149 | // Disable backup domain write protection | ||
| 150 | unlock(); | ||
| 97 | 151 | ||
| 98 | // Disable backup domain write protection | 152 | if self.lsi { |
| 99 | Self::modify(|_| {}); | 153 | #[cfg(any(stm32u5, stm32h5, stm32wba))] |
| 154 | let csr = crate::pac::RCC.bdcr(); | ||
| 155 | #[cfg(not(any(stm32u5, stm32h5, stm32wba, stm32c0)))] | ||
| 156 | let csr = crate::pac::RCC.csr(); | ||
| 157 | #[cfg(any(stm32c0))] | ||
| 158 | let csr = crate::pac::RCC.csr2(); | ||
| 100 | 159 | ||
| 101 | #[cfg(not(any(rcc_wb, rcc_wba)))] | 160 | #[cfg(not(any(rcc_wb, rcc_wba)))] |
| 102 | csr.modify(|w| w.set_lsion(true)); | 161 | csr.modify(|w| w.set_lsion(true)); |
| @@ -111,66 +170,76 @@ impl BackupDomain { | |||
| 111 | while !csr.read().lsi1rdy() {} | 170 | while !csr.read().lsi1rdy() {} |
| 112 | } | 171 | } |
| 113 | 172 | ||
| 114 | if let Some(lse_drive) = lse { | 173 | // backup domain configuration (LSEON, RTCEN, RTCSEL) is kept across resets. |
| 115 | Self::modify(|w| { | 174 | // once set, changing it requires a backup domain reset. |
| 116 | #[cfg(any(rtc_v2f7, rtc_v2h7, rtc_v2l0, rtc_v2l4))] | 175 | // first check if the configuration matches what we want. |
| 117 | w.set_lsedrv(lse_drive.into()); | ||
| 118 | w.set_lseon(true); | ||
| 119 | }); | ||
| 120 | 176 | ||
| 121 | while !Self::read().lserdy() {} | 177 | // check if it's already enabled and in the source we want. |
| 178 | let reg = bdcr().read(); | ||
| 179 | let mut ok = true; | ||
| 180 | ok &= reg.rtcsel() == self.rtc; | ||
| 181 | #[cfg(not(rcc_wba))] | ||
| 182 | { | ||
| 183 | ok &= reg.rtcen() == (self.rtc != RtcClockSource::DISABLE); | ||
| 184 | } | ||
| 185 | ok &= reg.lseon() == lse_en; | ||
| 186 | ok &= reg.lsebyp() == lse_byp; | ||
| 187 | #[cfg(not(any(rcc_f1, rcc_f1cl, rcc_f100, rcc_f2, rcc_f4, rcc_f400, rcc_f410, rcc_l1)))] | ||
| 188 | if let Some(lse_drv) = lse_drv { | ||
| 189 | ok &= reg.lsedrv() == lse_drv.into(); | ||
| 122 | } | 190 | } |
| 123 | 191 | ||
| 124 | match clock_source { | 192 | // if configuration is OK, we're done. |
| 125 | RtcClockSource::LSI => assert!(lsi), | 193 | if ok { |
| 126 | RtcClockSource::LSE => assert!(&lse.is_some()), | 194 | trace!("BDCR ok: {:08x}", bdcr().read().0); |
| 127 | _ => {} | 195 | return rtc_clk; |
| 128 | }; | 196 | } |
| 129 | 197 | ||
| 130 | if clock_source == RtcClockSource::NOCLOCK { | 198 | // If not OK, reset backup domain and configure it. |
| 131 | // disable it | 199 | #[cfg(not(any(rcc_l0, rcc_l0_v2, rcc_l1, stm32h5, stm32c0)))] |
| 132 | Self::modify(|w| { | 200 | { |
| 133 | #[cfg(not(rcc_wba))] | 201 | bdcr().modify(|w| w.set_bdrst(true)); |
| 134 | w.set_rtcen(false); | 202 | bdcr().modify(|w| w.set_bdrst(false)); |
| 135 | w.set_rtcsel(clock_source); | 203 | } |
| 204 | #[cfg(any(stm32h5))] | ||
| 205 | { | ||
| 206 | bdcr().modify(|w| w.set_vswrst(true)); | ||
| 207 | bdcr().modify(|w| w.set_vswrst(false)); | ||
| 208 | } | ||
| 209 | #[cfg(any(stm32c0))] | ||
| 210 | { | ||
| 211 | bdcr().modify(|w| w.set_rtcrst(true)); | ||
| 212 | bdcr().modify(|w| w.set_rtcrst(false)); | ||
| 213 | } | ||
| 214 | |||
| 215 | if lse_en { | ||
| 216 | bdcr().modify(|w| { | ||
| 217 | #[cfg(not(any(rcc_f1, rcc_f1cl, rcc_f100, rcc_f2, rcc_f4, rcc_f400, rcc_f410, rcc_l1)))] | ||
| 218 | if let Some(lse_drv) = lse_drv { | ||
| 219 | w.set_lsedrv(lse_drv.into()); | ||
| 220 | } | ||
| 221 | w.set_lsebyp(lse_byp); | ||
| 222 | w.set_lseon(true); | ||
| 136 | }); | 223 | }); |
| 137 | } else { | ||
| 138 | // check if it's already enabled and in the source we want. | ||
| 139 | let reg = Self::read(); | ||
| 140 | let ok = reg.rtcsel() == clock_source; | ||
| 141 | #[cfg(not(rcc_wba))] | ||
| 142 | let ok = ok & reg.rtcen(); | ||
| 143 | |||
| 144 | // if not, configure it. | ||
| 145 | if !ok { | ||
| 146 | #[cfg(any(rtc_v2h7, rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] | ||
| 147 | assert!(!reg.lsecsson(), "RTC is not compatible with LSE CSS, yet."); | ||
| 148 | 224 | ||
| 149 | #[cfg(not(any(rcc_l0, rcc_l1)))] | 225 | while !bdcr().read().lserdy() {} |
| 150 | Self::modify(|w| w.set_bdrst(true)); | 226 | } |
| 151 | 227 | ||
| 152 | Self::modify(|w| { | 228 | if self.rtc != RtcClockSource::DISABLE { |
| 153 | // Reset | 229 | bdcr().modify(|w| { |
| 154 | #[cfg(not(any(rcc_l0, rcc_l1)))] | 230 | #[cfg(any(rtc_v2h7, rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] |
| 155 | w.set_bdrst(false); | 231 | assert!(!w.lsecsson(), "RTC is not compatible with LSE CSS, yet."); |
| 156 | 232 | ||
| 157 | #[cfg(not(rcc_wba))] | 233 | #[cfg(not(rcc_wba))] |
| 158 | w.set_rtcen(true); | 234 | w.set_rtcen(true); |
| 159 | w.set_rtcsel(clock_source); | 235 | w.set_rtcsel(self.rtc); |
| 236 | }); | ||
| 237 | } | ||
| 160 | 238 | ||
| 161 | // Restore bcdr | 239 | trace!("BDCR configured: {:08x}", bdcr().read().0); |
| 162 | #[cfg(any(rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] | ||
| 163 | w.set_lscosel(reg.lscosel()); | ||
| 164 | #[cfg(any(rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] | ||
| 165 | w.set_lscoen(reg.lscoen()); | ||
| 166 | 240 | ||
| 167 | w.set_lseon(reg.lseon()); | 241 | compiler_fence(Ordering::SeqCst); |
| 168 | 242 | ||
| 169 | #[cfg(any(rtc_v2f0, rtc_v2f7, rtc_v2h7, rtc_v2l4, rtc_v2wb, rtc_v3, rtc_v3u5))] | 243 | rtc_clk |
| 170 | w.set_lsedrv(reg.lsedrv()); | ||
| 171 | w.set_lsebyp(reg.lsebyp()); | ||
| 172 | }); | ||
| 173 | } | ||
| 174 | } | ||
| 175 | } | 244 | } |
| 176 | } | 245 | } |
diff --git a/embassy-stm32/src/rcc/bus.rs b/embassy-stm32/src/rcc/bus.rs deleted file mode 100644 index 495cf7fe1..000000000 --- a/embassy-stm32/src/rcc/bus.rs +++ /dev/null | |||
| @@ -1,56 +0,0 @@ | |||
| 1 | use core::ops::Div; | ||
| 2 | |||
| 3 | #[allow(unused_imports)] | ||
| 4 | use crate::pac::rcc; | ||
| 5 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Ppre as APBPrescaler}; | ||
| 6 | use crate::time::Hertz; | ||
| 7 | |||
| 8 | impl Div<AHBPrescaler> for Hertz { | ||
| 9 | type Output = Hertz; | ||
| 10 | |||
| 11 | fn div(self, rhs: AHBPrescaler) -> Self::Output { | ||
| 12 | let divisor = match rhs { | ||
| 13 | AHBPrescaler::DIV1 => 1, | ||
| 14 | AHBPrescaler::DIV2 => 2, | ||
| 15 | #[cfg(any(rcc_wb, rcc_wl5, rcc_wle))] | ||
| 16 | AHBPrescaler::DIV3 => 3, | ||
| 17 | AHBPrescaler::DIV4 => 4, | ||
| 18 | #[cfg(any(rcc_wb, rcc_wl5, rcc_wle))] | ||
| 19 | AHBPrescaler::DIV5 => 5, | ||
| 20 | #[cfg(any(rcc_wb, rcc_wl5, rcc_wle))] | ||
| 21 | AHBPrescaler::DIV6 => 6, | ||
| 22 | AHBPrescaler::DIV8 => 8, | ||
| 23 | #[cfg(any(rcc_wb, rcc_wl5, rcc_wle))] | ||
| 24 | AHBPrescaler::DIV10 => 10, | ||
| 25 | AHBPrescaler::DIV16 => 16, | ||
| 26 | #[cfg(any(rcc_wb, rcc_wl5, rcc_wle))] | ||
| 27 | AHBPrescaler::DIV32 => 32, | ||
| 28 | #[cfg(not(rcc_wba))] | ||
| 29 | AHBPrescaler::DIV64 => 64, | ||
| 30 | #[cfg(not(rcc_wba))] | ||
| 31 | AHBPrescaler::DIV128 => 128, | ||
| 32 | #[cfg(not(rcc_wba))] | ||
| 33 | AHBPrescaler::DIV256 => 256, | ||
| 34 | #[cfg(not(rcc_wba))] | ||
| 35 | AHBPrescaler::DIV512 => 512, | ||
| 36 | _ => unreachable!(), | ||
| 37 | }; | ||
| 38 | Hertz(self.0 / divisor) | ||
| 39 | } | ||
| 40 | } | ||
| 41 | |||
| 42 | impl Div<APBPrescaler> for Hertz { | ||
| 43 | type Output = Hertz; | ||
| 44 | |||
| 45 | fn div(self, rhs: APBPrescaler) -> Self::Output { | ||
| 46 | let divisor = match rhs { | ||
| 47 | APBPrescaler::DIV1 => 1, | ||
| 48 | APBPrescaler::DIV2 => 2, | ||
| 49 | APBPrescaler::DIV4 => 4, | ||
| 50 | APBPrescaler::DIV8 => 8, | ||
| 51 | APBPrescaler::DIV16 => 16, | ||
| 52 | _ => unreachable!(), | ||
| 53 | }; | ||
| 54 | Hertz(self.0 / divisor) | ||
| 55 | } | ||
| 56 | } | ||
diff --git a/embassy-stm32/src/rcc/c0.rs b/embassy-stm32/src/rcc/c0.rs index 8f45e7c0f..68f029ca0 100644 --- a/embassy-stm32/src/rcc/c0.rs +++ b/embassy-stm32/src/rcc/c0.rs | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 2 | use crate::pac::flash::vals::Latency; | 1 | use crate::pac::flash::vals::Latency; |
| 3 | use crate::pac::rcc::vals::{Hsidiv, Ppre, Sw}; | 2 | use crate::pac::rcc::vals::Sw; |
| 3 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Hsidiv as HSIPrescaler, Ppre as APBPrescaler}; | ||
| 4 | use crate::pac::{FLASH, RCC}; | 4 | use crate::pac::{FLASH, RCC}; |
| 5 | use crate::rcc::{set_freqs, Clocks}; | 5 | use crate::rcc::{set_freqs, Clocks}; |
| 6 | use crate::time::Hertz; | 6 | use crate::time::Hertz; |
| @@ -8,9 +8,6 @@ use crate::time::Hertz; | |||
| 8 | /// HSI speed | 8 | /// HSI speed |
| 9 | pub const HSI_FREQ: Hertz = Hertz(48_000_000); | 9 | pub const HSI_FREQ: Hertz = Hertz(48_000_000); |
| 10 | 10 | ||
| 11 | /// LSI speed | ||
| 12 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 13 | |||
| 14 | /// System clock mux source | 11 | /// System clock mux source |
| 15 | #[derive(Clone, Copy)] | 12 | #[derive(Clone, Copy)] |
| 16 | pub enum ClockSrc { | 13 | pub enum ClockSrc { |
| @@ -19,47 +16,22 @@ pub enum ClockSrc { | |||
| 19 | LSI, | 16 | LSI, |
| 20 | } | 17 | } |
| 21 | 18 | ||
| 22 | #[derive(Clone, Copy)] | ||
| 23 | pub enum HSIPrescaler { | ||
| 24 | NotDivided, | ||
| 25 | Div2, | ||
| 26 | Div4, | ||
| 27 | Div8, | ||
| 28 | Div16, | ||
| 29 | Div32, | ||
| 30 | Div64, | ||
| 31 | Div128, | ||
| 32 | } | ||
| 33 | |||
| 34 | impl Into<Hsidiv> for HSIPrescaler { | ||
| 35 | fn into(self) -> Hsidiv { | ||
| 36 | match self { | ||
| 37 | HSIPrescaler::NotDivided => Hsidiv::DIV1, | ||
| 38 | HSIPrescaler::Div2 => Hsidiv::DIV2, | ||
| 39 | HSIPrescaler::Div4 => Hsidiv::DIV4, | ||
| 40 | HSIPrescaler::Div8 => Hsidiv::DIV8, | ||
| 41 | HSIPrescaler::Div16 => Hsidiv::DIV16, | ||
| 42 | HSIPrescaler::Div32 => Hsidiv::DIV32, | ||
| 43 | HSIPrescaler::Div64 => Hsidiv::DIV64, | ||
| 44 | HSIPrescaler::Div128 => Hsidiv::DIV128, | ||
| 45 | } | ||
| 46 | } | ||
| 47 | } | ||
| 48 | |||
| 49 | /// Clocks configutation | 19 | /// Clocks configutation |
| 50 | pub struct Config { | 20 | pub struct Config { |
| 51 | pub mux: ClockSrc, | 21 | pub mux: ClockSrc, |
| 52 | pub ahb_pre: AHBPrescaler, | 22 | pub ahb_pre: AHBPrescaler, |
| 53 | pub apb_pre: APBPrescaler, | 23 | pub apb_pre: APBPrescaler, |
| 24 | pub ls: super::LsConfig, | ||
| 54 | } | 25 | } |
| 55 | 26 | ||
| 56 | impl Default for Config { | 27 | impl Default for Config { |
| 57 | #[inline] | 28 | #[inline] |
| 58 | fn default() -> Config { | 29 | fn default() -> Config { |
| 59 | Config { | 30 | Config { |
| 60 | mux: ClockSrc::HSI(HSIPrescaler::NotDivided), | 31 | mux: ClockSrc::HSI(HSIPrescaler::DIV1), |
| 61 | ahb_pre: AHBPrescaler::DIV1, | 32 | ahb_pre: AHBPrescaler::DIV1, |
| 62 | apb_pre: APBPrescaler::DIV1, | 33 | apb_pre: APBPrescaler::DIV1, |
| 34 | ls: Default::default(), | ||
| 63 | } | 35 | } |
| 64 | } | 36 | } |
| 65 | } | 37 | } |
| @@ -68,33 +40,34 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 68 | let (sys_clk, sw) = match config.mux { | 40 | let (sys_clk, sw) = match config.mux { |
| 69 | ClockSrc::HSI(div) => { | 41 | ClockSrc::HSI(div) => { |
| 70 | // Enable HSI | 42 | // Enable HSI |
| 71 | let div: Hsidiv = div.into(); | ||
| 72 | RCC.cr().write(|w| { | 43 | RCC.cr().write(|w| { |
| 73 | w.set_hsidiv(div); | 44 | w.set_hsidiv(div); |
| 74 | w.set_hsion(true) | 45 | w.set_hsion(true) |
| 75 | }); | 46 | }); |
| 76 | while !RCC.cr().read().hsirdy() {} | 47 | while !RCC.cr().read().hsirdy() {} |
| 77 | 48 | ||
| 78 | (HSI_FREQ.0 >> div.to_bits(), Sw::HSI) | 49 | (HSI_FREQ / div, Sw::HSI) |
| 79 | } | 50 | } |
| 80 | ClockSrc::HSE(freq) => { | 51 | ClockSrc::HSE(freq) => { |
| 81 | // Enable HSE | 52 | // Enable HSE |
| 82 | RCC.cr().write(|w| w.set_hseon(true)); | 53 | RCC.cr().write(|w| w.set_hseon(true)); |
| 83 | while !RCC.cr().read().hserdy() {} | 54 | while !RCC.cr().read().hserdy() {} |
| 84 | 55 | ||
| 85 | (freq.0, Sw::HSE) | 56 | (freq, Sw::HSE) |
| 86 | } | 57 | } |
| 87 | ClockSrc::LSI => { | 58 | ClockSrc::LSI => { |
| 88 | // Enable LSI | 59 | // Enable LSI |
| 89 | RCC.csr2().write(|w| w.set_lsion(true)); | 60 | RCC.csr2().write(|w| w.set_lsion(true)); |
| 90 | while !RCC.csr2().read().lsirdy() {} | 61 | while !RCC.csr2().read().lsirdy() {} |
| 91 | (LSI_FREQ.0, Sw::LSI) | 62 | (super::LSI_FREQ, Sw::LSI) |
| 92 | } | 63 | } |
| 93 | }; | 64 | }; |
| 94 | 65 | ||
| 66 | let rtc = config.ls.init(); | ||
| 67 | |||
| 95 | // Determine the flash latency implied by the target clock speed | 68 | // Determine the flash latency implied by the target clock speed |
| 96 | // RM0454 § 3.3.4: | 69 | // RM0454 § 3.3.4: |
| 97 | let target_flash_latency = if sys_clk <= 24_000_000 { | 70 | let target_flash_latency = if sys_clk <= Hertz(24_000_000) { |
| 98 | Latency::WS0 | 71 | Latency::WS0 |
| 99 | } else { | 72 | } else { |
| 100 | Latency::WS1 | 73 | Latency::WS1 |
| @@ -129,7 +102,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 129 | } | 102 | } |
| 130 | 103 | ||
| 131 | // Configure SYSCLK source, HCLK divisor, and PCLK divisor all at once | 104 | // Configure SYSCLK source, HCLK divisor, and PCLK divisor all at once |
| 132 | let (sw, hpre, ppre) = (sw.into(), config.ahb_pre.into(), config.apb_pre.into()); | 105 | let (sw, hpre, ppre) = (sw.into(), config.ahb_pre, config.apb_pre); |
| 133 | RCC.cfgr().modify(|w| { | 106 | RCC.cfgr().modify(|w| { |
| 134 | w.set_sw(sw); | 107 | w.set_sw(sw); |
| 135 | w.set_hpre(hpre); | 108 | w.set_hpre(hpre); |
| @@ -150,34 +123,23 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 150 | FLASH.acr().modify(|w| w.set_latency(target_flash_latency)); | 123 | FLASH.acr().modify(|w| w.set_latency(target_flash_latency)); |
| 151 | } | 124 | } |
| 152 | 125 | ||
| 153 | let ahb_div = match config.ahb_pre { | 126 | let ahb_freq = sys_clk / config.ahb_pre; |
| 154 | AHBPrescaler::DIV1 => 1, | ||
| 155 | AHBPrescaler::DIV2 => 2, | ||
| 156 | AHBPrescaler::DIV4 => 4, | ||
| 157 | AHBPrescaler::DIV8 => 8, | ||
| 158 | AHBPrescaler::DIV16 => 16, | ||
| 159 | AHBPrescaler::DIV64 => 64, | ||
| 160 | AHBPrescaler::DIV128 => 128, | ||
| 161 | AHBPrescaler::DIV256 => 256, | ||
| 162 | AHBPrescaler::DIV512 => 512, | ||
| 163 | _ => unreachable!(), | ||
| 164 | }; | ||
| 165 | let ahb_freq = sys_clk / ahb_div; | ||
| 166 | 127 | ||
| 167 | let (apb_freq, apb_tim_freq) = match config.apb_pre { | 128 | let (apb_freq, apb_tim_freq) = match config.apb_pre { |
| 168 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 129 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 169 | pre => { | 130 | pre => { |
| 170 | let pre: Ppre = pre.into(); | 131 | let freq = ahb_freq / pre; |
| 171 | let pre: u8 = 1 << (pre.to_bits() - 3); | 132 | (freq, freq * 2u32) |
| 172 | let freq = ahb_freq / pre as u32; | ||
| 173 | (freq, freq * 2) | ||
| 174 | } | 133 | } |
| 175 | }; | 134 | }; |
| 176 | 135 | ||
| 177 | set_freqs(Clocks { | 136 | set_freqs(Clocks { |
| 178 | sys: Hertz(sys_clk), | 137 | hsi: None, |
| 179 | ahb1: Hertz(ahb_freq), | 138 | lse: None, |
| 180 | apb1: Hertz(apb_freq), | 139 | sys: sys_clk, |
| 181 | apb1_tim: Hertz(apb_tim_freq), | 140 | hclk1: ahb_freq, |
| 141 | pclk1: apb_freq, | ||
| 142 | pclk1_tim: apb_tim_freq, | ||
| 143 | rtc, | ||
| 182 | }); | 144 | }); |
| 183 | } | 145 | } |
diff --git a/embassy-stm32/src/rcc/f0.rs b/embassy-stm32/src/rcc/f0.rs index ca6eed284..feaa2f4c0 100644 --- a/embassy-stm32/src/rcc/f0.rs +++ b/embassy-stm32/src/rcc/f0.rs | |||
| @@ -8,9 +8,6 @@ use crate::time::Hertz; | |||
| 8 | /// HSI speed | 8 | /// HSI speed |
| 9 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); | 9 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); |
| 10 | 10 | ||
| 11 | /// LSI speed | ||
| 12 | pub const LSI_FREQ: Hertz = Hertz(40_000); | ||
| 13 | |||
| 14 | /// Configuration of the clocks | 11 | /// Configuration of the clocks |
| 15 | /// | 12 | /// |
| 16 | /// hse takes precedence over hsi48 if both are enabled | 13 | /// hse takes precedence over hsi48 if both are enabled |
| @@ -27,6 +24,8 @@ pub struct Config { | |||
| 27 | pub sys_ck: Option<Hertz>, | 24 | pub sys_ck: Option<Hertz>, |
| 28 | pub hclk: Option<Hertz>, | 25 | pub hclk: Option<Hertz>, |
| 29 | pub pclk: Option<Hertz>, | 26 | pub pclk: Option<Hertz>, |
| 27 | |||
| 28 | pub ls: super::LsConfig, | ||
| 30 | } | 29 | } |
| 31 | 30 | ||
| 32 | pub(crate) unsafe fn init(config: Config) { | 31 | pub(crate) unsafe fn init(config: Config) { |
| @@ -128,7 +127,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 128 | } | 127 | } |
| 129 | 128 | ||
| 130 | if config.usb_pll { | 129 | if config.usb_pll { |
| 131 | RCC.cfgr3().modify(|w| w.set_usbsw(Usbsw::PLLCLK)); | 130 | RCC.cfgr3().modify(|w| w.set_usbsw(Usbsw::PLL1_P)); |
| 132 | } | 131 | } |
| 133 | // TODO: Option to use CRS (Clock Recovery) | 132 | // TODO: Option to use CRS (Clock Recovery) |
| 134 | 133 | ||
| @@ -141,7 +140,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 141 | RCC.cfgr().modify(|w| { | 140 | RCC.cfgr().modify(|w| { |
| 142 | w.set_ppre(Ppre::from_bits(ppre_bits)); | 141 | w.set_ppre(Ppre::from_bits(ppre_bits)); |
| 143 | w.set_hpre(Hpre::from_bits(hpre_bits)); | 142 | w.set_hpre(Hpre::from_bits(hpre_bits)); |
| 144 | w.set_sw(Sw::PLL) | 143 | w.set_sw(Sw::PLL1_P) |
| 145 | }); | 144 | }); |
| 146 | } else { | 145 | } else { |
| 147 | RCC.cfgr().modify(|w| { | 146 | RCC.cfgr().modify(|w| { |
| @@ -159,12 +158,15 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 159 | }) | 158 | }) |
| 160 | } | 159 | } |
| 161 | 160 | ||
| 161 | let rtc = config.ls.init(); | ||
| 162 | |||
| 162 | set_freqs(Clocks { | 163 | set_freqs(Clocks { |
| 163 | sys: Hertz(real_sysclk), | 164 | sys: Hertz(real_sysclk), |
| 164 | apb1: Hertz(pclk), | 165 | pclk1: Hertz(pclk), |
| 165 | apb2: Hertz(pclk), | 166 | pclk2: Hertz(pclk), |
| 166 | apb1_tim: Hertz(pclk * timer_mul), | 167 | pclk1_tim: Hertz(pclk * timer_mul), |
| 167 | apb2_tim: Hertz(pclk * timer_mul), | 168 | pclk2_tim: Hertz(pclk * timer_mul), |
| 168 | ahb1: Hertz(hclk), | 169 | hclk1: Hertz(hclk), |
| 170 | rtc, | ||
| 169 | }); | 171 | }); |
| 170 | } | 172 | } |
diff --git a/embassy-stm32/src/rcc/f1.rs b/embassy-stm32/src/rcc/f1.rs index 081c0c767..8d315f7b2 100644 --- a/embassy-stm32/src/rcc/f1.rs +++ b/embassy-stm32/src/rcc/f1.rs | |||
| @@ -9,9 +9,6 @@ use crate::time::Hertz; | |||
| 9 | /// HSI speed | 9 | /// HSI speed |
| 10 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); | 10 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); |
| 11 | 11 | ||
| 12 | /// LSI speed | ||
| 13 | pub const LSI_FREQ: Hertz = Hertz(40_000); | ||
| 14 | |||
| 15 | /// Configuration of the clocks | 12 | /// Configuration of the clocks |
| 16 | /// | 13 | /// |
| 17 | #[non_exhaustive] | 14 | #[non_exhaustive] |
| @@ -25,6 +22,8 @@ pub struct Config { | |||
| 25 | pub pclk2: Option<Hertz>, | 22 | pub pclk2: Option<Hertz>, |
| 26 | pub adcclk: Option<Hertz>, | 23 | pub adcclk: Option<Hertz>, |
| 27 | pub pllxtpre: bool, | 24 | pub pllxtpre: bool, |
| 25 | |||
| 26 | pub ls: super::LsConfig, | ||
| 28 | } | 27 | } |
| 29 | 28 | ||
| 30 | pub(crate) unsafe fn init(config: Config) { | 29 | pub(crate) unsafe fn init(config: Config) { |
| @@ -103,7 +102,6 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 103 | 102 | ||
| 104 | assert!(pclk2 <= 72_000_000); | 103 | assert!(pclk2 <= 72_000_000); |
| 105 | 104 | ||
| 106 | // Only needed for stm32f103? | ||
| 107 | FLASH.acr().write(|w| { | 105 | FLASH.acr().write(|w| { |
| 108 | w.set_latency(if real_sysclk <= 24_000_000 { | 106 | w.set_latency(if real_sysclk <= 24_000_000 { |
| 109 | Latency::WS0 | 107 | Latency::WS0 |
| @@ -112,6 +110,8 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 112 | } else { | 110 | } else { |
| 113 | Latency::WS2 | 111 | Latency::WS2 |
| 114 | }); | 112 | }); |
| 113 | // the prefetch buffer is enabled by default, let's keep it enabled | ||
| 114 | w.set_prftbe(true); | ||
| 115 | }); | 115 | }); |
| 116 | 116 | ||
| 117 | // the USB clock is only valid if an external crystal is used, the PLL is enabled, and the | 117 | // the USB clock is only valid if an external crystal is used, the PLL is enabled, and the |
| @@ -169,7 +169,14 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 169 | #[cfg(not(rcc_f100))] | 169 | #[cfg(not(rcc_f100))] |
| 170 | w.set_usbpre(Usbpre::from_bits(usbpre as u8)); | 170 | w.set_usbpre(Usbpre::from_bits(usbpre as u8)); |
| 171 | w.set_sw(if pllmul_bits.is_some() { | 171 | w.set_sw(if pllmul_bits.is_some() { |
| 172 | Sw::PLL | 172 | #[cfg(not(rcc_f1cl))] |
| 173 | { | ||
| 174 | Sw::PLL1_P | ||
| 175 | } | ||
| 176 | #[cfg(rcc_f1cl)] | ||
| 177 | { | ||
| 178 | Sw::PLL | ||
| 179 | } | ||
| 173 | } else if config.hse.is_some() { | 180 | } else if config.hse.is_some() { |
| 174 | Sw::HSE | 181 | Sw::HSE |
| 175 | } else { | 182 | } else { |
| @@ -177,13 +184,16 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 177 | }); | 184 | }); |
| 178 | }); | 185 | }); |
| 179 | 186 | ||
| 187 | let rtc = config.ls.init(); | ||
| 188 | |||
| 180 | set_freqs(Clocks { | 189 | set_freqs(Clocks { |
| 181 | sys: Hertz(real_sysclk), | 190 | sys: Hertz(real_sysclk), |
| 182 | apb1: Hertz(pclk1), | 191 | pclk1: Hertz(pclk1), |
| 183 | apb2: Hertz(pclk2), | 192 | pclk2: Hertz(pclk2), |
| 184 | apb1_tim: Hertz(pclk1 * timer_mul1), | 193 | pclk1_tim: Hertz(pclk1 * timer_mul1), |
| 185 | apb2_tim: Hertz(pclk2 * timer_mul2), | 194 | pclk2_tim: Hertz(pclk2 * timer_mul2), |
| 186 | ahb1: Hertz(hclk), | 195 | hclk1: Hertz(hclk), |
| 187 | adc: Some(Hertz(adcclk)), | 196 | adc: Some(Hertz(adcclk)), |
| 197 | rtc, | ||
| 188 | }); | 198 | }); |
| 189 | } | 199 | } |
diff --git a/embassy-stm32/src/rcc/f2.rs b/embassy-stm32/src/rcc/f2.rs index 44de5bf19..9a66e75a4 100644 --- a/embassy-stm32/src/rcc/f2.rs +++ b/embassy-stm32/src/rcc/f2.rs | |||
| @@ -1,21 +1,16 @@ | |||
| 1 | use core::convert::TryFrom; | ||
| 2 | use core::ops::{Div, Mul}; | ||
| 3 | |||
| 4 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 5 | use crate::pac::flash::vals::Latency; | 1 | use crate::pac::flash::vals::Latency; |
| 6 | use crate::pac::rcc::vals::{Pllp, Pllsrc, Sw}; | 2 | use crate::pac::rcc::vals::Sw; |
| 3 | pub use crate::pac::rcc::vals::{ | ||
| 4 | Hpre as AHBPrescaler, Pllm as PLLPreDiv, Plln as PLLMul, Pllp as PLLPDiv, Pllq as PLLQDiv, Pllsrc as PLLSrc, | ||
| 5 | Ppre as APBPrescaler, | ||
| 6 | }; | ||
| 7 | use crate::pac::{FLASH, RCC}; | 7 | use crate::pac::{FLASH, RCC}; |
| 8 | use crate::rcc::bd::BackupDomain; | ||
| 9 | use crate::rcc::{set_freqs, Clocks}; | 8 | use crate::rcc::{set_freqs, Clocks}; |
| 10 | use crate::rtc::RtcClockSource; | ||
| 11 | use crate::time::Hertz; | 9 | use crate::time::Hertz; |
| 12 | 10 | ||
| 13 | /// HSI speed | 11 | /// HSI speed |
| 14 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 12 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 15 | 13 | ||
| 16 | /// LSI speed | ||
| 17 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 18 | |||
| 19 | #[derive(Clone, Copy)] | 14 | #[derive(Clone, Copy)] |
| 20 | pub struct HSEConfig { | 15 | pub struct HSEConfig { |
| 21 | pub frequency: Hertz, | 16 | pub frequency: Hertz, |
| @@ -43,17 +38,17 @@ pub enum HSESrc { | |||
| 43 | pub struct PLLConfig { | 38 | pub struct PLLConfig { |
| 44 | pub pre_div: PLLPreDiv, | 39 | pub pre_div: PLLPreDiv, |
| 45 | pub mul: PLLMul, | 40 | pub mul: PLLMul, |
| 46 | pub main_div: PLLMainDiv, | 41 | pub p_div: PLLPDiv, |
| 47 | pub pll48_div: PLL48Div, | 42 | pub q_div: PLLQDiv, |
| 48 | } | 43 | } |
| 49 | 44 | ||
| 50 | impl Default for PLLConfig { | 45 | impl Default for PLLConfig { |
| 51 | fn default() -> Self { | 46 | fn default() -> Self { |
| 52 | PLLConfig { | 47 | PLLConfig { |
| 53 | pre_div: PLLPreDiv(16), | 48 | pre_div: PLLPreDiv::DIV16, |
| 54 | mul: PLLMul(192), | 49 | mul: PLLMul::MUL192, |
| 55 | main_div: PLLMainDiv::Div2, | 50 | p_div: PLLPDiv::DIV2, |
| 56 | pll48_div: PLL48Div(4), | 51 | q_div: PLLQDiv::DIV4, |
| 57 | } | 52 | } |
| 58 | } | 53 | } |
| 59 | } | 54 | } |
| @@ -61,9 +56,9 @@ impl Default for PLLConfig { | |||
| 61 | impl PLLConfig { | 56 | impl PLLConfig { |
| 62 | pub fn clocks(&self, src_freq: Hertz) -> PLLClocks { | 57 | pub fn clocks(&self, src_freq: Hertz) -> PLLClocks { |
| 63 | let in_freq = src_freq / self.pre_div; | 58 | let in_freq = src_freq / self.pre_div; |
| 64 | let vco_freq = Hertz((src_freq.0 as u64 * self.mul.0 as u64 / self.pre_div.0 as u64) as u32); | 59 | let vco_freq = src_freq / self.pre_div * self.mul; |
| 65 | let main_freq = vco_freq / self.main_div; | 60 | let main_freq = vco_freq / self.p_div; |
| 66 | let pll48_freq = vco_freq / self.pll48_div; | 61 | let pll48_freq = vco_freq / self.q_div; |
| 67 | PLLClocks { | 62 | PLLClocks { |
| 68 | in_freq, | 63 | in_freq, |
| 69 | vco_freq, | 64 | vco_freq, |
| @@ -72,129 +67,6 @@ impl PLLConfig { | |||
| 72 | } | 67 | } |
| 73 | } | 68 | } |
| 74 | } | 69 | } |
| 75 | |||
| 76 | /// Clock source for both main PLL and PLLI2S | ||
| 77 | #[derive(Clone, Copy, PartialEq)] | ||
| 78 | pub enum PLLSrc { | ||
| 79 | HSE, | ||
| 80 | HSI, | ||
| 81 | } | ||
| 82 | |||
| 83 | impl Into<Pllsrc> for PLLSrc { | ||
| 84 | fn into(self) -> Pllsrc { | ||
| 85 | match self { | ||
| 86 | PLLSrc::HSE => Pllsrc::HSE, | ||
| 87 | PLLSrc::HSI => Pllsrc::HSI, | ||
| 88 | } | ||
| 89 | } | ||
| 90 | } | ||
| 91 | |||
| 92 | /// Division factor for both main PLL and PLLI2S | ||
| 93 | #[derive(Clone, Copy, PartialEq)] | ||
| 94 | #[repr(transparent)] | ||
| 95 | pub struct PLLPreDiv(u8); | ||
| 96 | |||
| 97 | impl TryFrom<u8> for PLLPreDiv { | ||
| 98 | type Error = &'static str; | ||
| 99 | |||
| 100 | fn try_from(value: u8) -> Result<Self, Self::Error> { | ||
| 101 | match value { | ||
| 102 | 2..=63 => Ok(PLLPreDiv(value)), | ||
| 103 | _ => Err("PLLPreDiv must be within range 2..=63"), | ||
| 104 | } | ||
| 105 | } | ||
| 106 | } | ||
| 107 | |||
| 108 | impl Div<PLLPreDiv> for Hertz { | ||
| 109 | type Output = Hertz; | ||
| 110 | |||
| 111 | fn div(self, rhs: PLLPreDiv) -> Self::Output { | ||
| 112 | Hertz(self.0 / u32::from(rhs.0)) | ||
| 113 | } | ||
| 114 | } | ||
| 115 | |||
| 116 | /// Multiplication factor for main PLL | ||
| 117 | #[derive(Clone, Copy, PartialEq)] | ||
| 118 | #[repr(transparent)] | ||
| 119 | pub struct PLLMul(u16); | ||
| 120 | |||
| 121 | impl Mul<PLLMul> for Hertz { | ||
| 122 | type Output = Hertz; | ||
| 123 | |||
| 124 | fn mul(self, rhs: PLLMul) -> Self::Output { | ||
| 125 | Hertz(self.0 * u32::from(rhs.0)) | ||
| 126 | } | ||
| 127 | } | ||
| 128 | |||
| 129 | impl TryFrom<u16> for PLLMul { | ||
| 130 | type Error = &'static str; | ||
| 131 | |||
| 132 | fn try_from(value: u16) -> Result<Self, Self::Error> { | ||
| 133 | match value { | ||
| 134 | 192..=432 => Ok(PLLMul(value)), | ||
| 135 | _ => Err("PLLMul must be within range 192..=432"), | ||
| 136 | } | ||
| 137 | } | ||
| 138 | } | ||
| 139 | |||
| 140 | /// PLL division factor for the main system clock | ||
| 141 | #[derive(Clone, Copy, PartialEq)] | ||
| 142 | pub enum PLLMainDiv { | ||
| 143 | Div2, | ||
| 144 | Div4, | ||
| 145 | Div6, | ||
| 146 | Div8, | ||
| 147 | } | ||
| 148 | |||
| 149 | impl Into<Pllp> for PLLMainDiv { | ||
| 150 | fn into(self) -> Pllp { | ||
| 151 | match self { | ||
| 152 | PLLMainDiv::Div2 => Pllp::DIV2, | ||
| 153 | PLLMainDiv::Div4 => Pllp::DIV4, | ||
| 154 | PLLMainDiv::Div6 => Pllp::DIV6, | ||
| 155 | PLLMainDiv::Div8 => Pllp::DIV8, | ||
| 156 | } | ||
| 157 | } | ||
| 158 | } | ||
| 159 | |||
| 160 | impl Div<PLLMainDiv> for Hertz { | ||
| 161 | type Output = Hertz; | ||
| 162 | |||
| 163 | fn div(self, rhs: PLLMainDiv) -> Self::Output { | ||
| 164 | let divisor = match rhs { | ||
| 165 | PLLMainDiv::Div2 => 2, | ||
| 166 | PLLMainDiv::Div4 => 4, | ||
| 167 | PLLMainDiv::Div6 => 6, | ||
| 168 | PLLMainDiv::Div8 => 8, | ||
| 169 | }; | ||
| 170 | Hertz(self.0 / divisor) | ||
| 171 | } | ||
| 172 | } | ||
| 173 | |||
| 174 | /// PLL division factor for USB OTG FS / SDIO / RNG | ||
| 175 | #[derive(Clone, Copy, PartialEq)] | ||
| 176 | #[repr(transparent)] | ||
| 177 | pub struct PLL48Div(u8); | ||
| 178 | |||
| 179 | impl Div<PLL48Div> for Hertz { | ||
| 180 | type Output = Hertz; | ||
| 181 | |||
| 182 | fn div(self, rhs: PLL48Div) -> Self::Output { | ||
| 183 | Hertz(self.0 / u32::from(rhs.0)) | ||
| 184 | } | ||
| 185 | } | ||
| 186 | |||
| 187 | impl TryFrom<u8> for PLL48Div { | ||
| 188 | type Error = &'static str; | ||
| 189 | |||
| 190 | fn try_from(value: u8) -> Result<Self, Self::Error> { | ||
| 191 | match value { | ||
| 192 | 2..=15 => Ok(PLL48Div(value)), | ||
| 193 | _ => Err("PLL48Div must be within range 2..=15"), | ||
| 194 | } | ||
| 195 | } | ||
| 196 | } | ||
| 197 | |||
| 198 | #[derive(Clone, Copy, PartialEq)] | 70 | #[derive(Clone, Copy, PartialEq)] |
| 199 | pub struct PLLClocks { | 71 | pub struct PLLClocks { |
| 200 | pub in_freq: Hertz, | 72 | pub in_freq: Hertz, |
| @@ -303,13 +175,11 @@ pub struct Config { | |||
| 303 | pub pll_mux: PLLSrc, | 175 | pub pll_mux: PLLSrc, |
| 304 | pub pll: PLLConfig, | 176 | pub pll: PLLConfig, |
| 305 | pub mux: ClockSrc, | 177 | pub mux: ClockSrc, |
| 306 | pub rtc: Option<RtcClockSource>, | ||
| 307 | pub lsi: bool, | ||
| 308 | pub lse: Option<Hertz>, | ||
| 309 | pub voltage: VoltageScale, | 178 | pub voltage: VoltageScale, |
| 310 | pub ahb_pre: AHBPrescaler, | 179 | pub ahb_pre: AHBPrescaler, |
| 311 | pub apb1_pre: APBPrescaler, | 180 | pub apb1_pre: APBPrescaler, |
| 312 | pub apb2_pre: APBPrescaler, | 181 | pub apb2_pre: APBPrescaler, |
| 182 | pub ls: super::LsConfig, | ||
| 313 | } | 183 | } |
| 314 | 184 | ||
| 315 | impl Default for Config { | 185 | impl Default for Config { |
| @@ -322,12 +192,10 @@ impl Default for Config { | |||
| 322 | pll: PLLConfig::default(), | 192 | pll: PLLConfig::default(), |
| 323 | voltage: VoltageScale::Range3, | 193 | voltage: VoltageScale::Range3, |
| 324 | mux: ClockSrc::HSI, | 194 | mux: ClockSrc::HSI, |
| 325 | rtc: None, | ||
| 326 | lsi: false, | ||
| 327 | lse: None, | ||
| 328 | ahb_pre: AHBPrescaler::DIV1, | 195 | ahb_pre: AHBPrescaler::DIV1, |
| 329 | apb1_pre: APBPrescaler::DIV1, | 196 | apb1_pre: APBPrescaler::DIV1, |
| 330 | apb2_pre: APBPrescaler::DIV1, | 197 | apb2_pre: APBPrescaler::DIV1, |
| 198 | ls: Default::default(), | ||
| 331 | } | 199 | } |
| 332 | } | 200 | } |
| 333 | } | 201 | } |
| @@ -367,11 +235,11 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 367 | assert!(pll_clocks.pll48_freq <= Hertz(48_000_000)); | 235 | assert!(pll_clocks.pll48_freq <= Hertz(48_000_000)); |
| 368 | 236 | ||
| 369 | RCC.pllcfgr().write(|w| { | 237 | RCC.pllcfgr().write(|w| { |
| 370 | w.set_pllsrc(config.pll_mux.into()); | 238 | w.set_pllsrc(config.pll_mux); |
| 371 | w.set_pllm(config.pll.pre_div.0); | 239 | w.set_pllm(config.pll.pre_div); |
| 372 | w.set_plln(config.pll.mul.0); | 240 | w.set_plln(config.pll.mul); |
| 373 | w.set_pllp(config.pll.main_div.into()); | 241 | w.set_pllp(config.pll.p_div); |
| 374 | w.set_pllq(config.pll.pll48_div.0); | 242 | w.set_pllq(config.pll.q_div); |
| 375 | }); | 243 | }); |
| 376 | 244 | ||
| 377 | let (sys_clk, sw) = match config.mux { | 245 | let (sys_clk, sw) = match config.mux { |
| @@ -388,7 +256,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 388 | ClockSrc::PLL => { | 256 | ClockSrc::PLL => { |
| 389 | RCC.cr().modify(|w| w.set_pllon(true)); | 257 | RCC.cr().modify(|w| w.set_pllon(true)); |
| 390 | while !RCC.cr().read().pllrdy() {} | 258 | while !RCC.cr().read().pllrdy() {} |
| 391 | (pll_clocks.main_freq, Sw::PLL) | 259 | (pll_clocks.main_freq, Sw::PLL1_P) |
| 392 | } | 260 | } |
| 393 | }; | 261 | }; |
| 394 | // RM0033 Figure 9. Clock tree suggests max SYSCLK/HCLK is 168 MHz, but datasheet specifies PLL | 262 | // RM0033 Figure 9. Clock tree suggests max SYSCLK/HCLK is 168 MHz, but datasheet specifies PLL |
| @@ -424,9 +292,9 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 424 | 292 | ||
| 425 | RCC.cfgr().modify(|w| { | 293 | RCC.cfgr().modify(|w| { |
| 426 | w.set_sw(sw.into()); | 294 | w.set_sw(sw.into()); |
| 427 | w.set_hpre(config.ahb_pre.into()); | 295 | w.set_hpre(config.ahb_pre); |
| 428 | w.set_ppre1(config.apb1_pre.into()); | 296 | w.set_ppre1(config.apb1_pre); |
| 429 | w.set_ppre2(config.apb2_pre.into()); | 297 | w.set_ppre2(config.apb2_pre); |
| 430 | }); | 298 | }); |
| 431 | while RCC.cfgr().read().sws().to_bits() != sw.to_bits() {} | 299 | while RCC.cfgr().read().sws().to_bits() != sw.to_bits() {} |
| 432 | 300 | ||
| @@ -435,21 +303,18 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 435 | RCC.cr().modify(|w| w.set_hsion(false)); | 303 | RCC.cr().modify(|w| w.set_hsion(false)); |
| 436 | } | 304 | } |
| 437 | 305 | ||
| 438 | BackupDomain::configure_ls( | 306 | let rtc = config.ls.init(); |
| 439 | config.rtc.unwrap_or(RtcClockSource::NOCLOCK), | ||
| 440 | config.lsi, | ||
| 441 | config.lse.map(|_| Default::default()), | ||
| 442 | ); | ||
| 443 | 307 | ||
| 444 | set_freqs(Clocks { | 308 | set_freqs(Clocks { |
| 445 | sys: sys_clk, | 309 | sys: sys_clk, |
| 446 | ahb1: ahb_freq, | 310 | hclk1: ahb_freq, |
| 447 | ahb2: ahb_freq, | 311 | hclk2: ahb_freq, |
| 448 | ahb3: ahb_freq, | 312 | hclk3: ahb_freq, |
| 449 | apb1: apb1_freq, | 313 | pclk1: apb1_freq, |
| 450 | apb1_tim: apb1_tim_freq, | 314 | pclk1_tim: apb1_tim_freq, |
| 451 | apb2: apb2_freq, | 315 | pclk2: apb2_freq, |
| 452 | apb2_tim: apb2_tim_freq, | 316 | pclk2_tim: apb2_tim_freq, |
| 453 | pll48: Some(pll_clocks.pll48_freq), | 317 | pll1_q: Some(pll_clocks.pll48_freq), |
| 318 | rtc, | ||
| 454 | }); | 319 | }); |
| 455 | } | 320 | } |
diff --git a/embassy-stm32/src/rcc/f3.rs b/embassy-stm32/src/rcc/f3.rs index 630dbd4fe..9dcd50df4 100644 --- a/embassy-stm32/src/rcc/f3.rs +++ b/embassy-stm32/src/rcc/f3.rs | |||
| @@ -1,7 +1,8 @@ | |||
| 1 | #[cfg(rcc_f3)] | 1 | #[cfg(rcc_f3)] |
| 2 | use crate::pac::adccommon::vals::Ckmode; | 2 | use crate::pac::adccommon::vals::Ckmode; |
| 3 | use crate::pac::flash::vals::Latency; | 3 | use crate::pac::flash::vals::Latency; |
| 4 | use crate::pac::rcc::vals::{Adcpres, Hpre, Pllmul, Pllsrc, Ppre, Prediv, Sw, Usbpre}; | 4 | pub use crate::pac::rcc::vals::Adcpres; |
| 5 | use crate::pac::rcc::vals::{Hpre, Pllmul, Pllsrc, Ppre, Prediv, Sw, Usbpre}; | ||
| 5 | use crate::pac::{FLASH, RCC}; | 6 | use crate::pac::{FLASH, RCC}; |
| 6 | use crate::rcc::{set_freqs, Clocks}; | 7 | use crate::rcc::{set_freqs, Clocks}; |
| 7 | use crate::time::Hertz; | 8 | use crate::time::Hertz; |
| @@ -9,28 +10,6 @@ use crate::time::Hertz; | |||
| 9 | /// HSI speed | 10 | /// HSI speed |
| 10 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); | 11 | pub const HSI_FREQ: Hertz = Hertz(8_000_000); |
| 11 | 12 | ||
| 12 | /// LSI speed | ||
| 13 | pub const LSI_FREQ: Hertz = Hertz(40_000); | ||
| 14 | |||
| 15 | impl From<AdcClockSource> for Adcpres { | ||
| 16 | fn from(value: AdcClockSource) -> Self { | ||
| 17 | match value { | ||
| 18 | AdcClockSource::PllDiv1 => Adcpres::DIV1, | ||
| 19 | AdcClockSource::PllDiv2 => Adcpres::DIV2, | ||
| 20 | AdcClockSource::PllDiv4 => Adcpres::DIV4, | ||
| 21 | AdcClockSource::PllDiv6 => Adcpres::DIV6, | ||
| 22 | AdcClockSource::PllDiv8 => Adcpres::DIV8, | ||
| 23 | AdcClockSource::PllDiv12 => Adcpres::DIV12, | ||
| 24 | AdcClockSource::PllDiv16 => Adcpres::DIV16, | ||
| 25 | AdcClockSource::PllDiv32 => Adcpres::DIV32, | ||
| 26 | AdcClockSource::PllDiv64 => Adcpres::DIV64, | ||
| 27 | AdcClockSource::PllDiv128 => Adcpres::DIV128, | ||
| 28 | AdcClockSource::PllDiv256 => Adcpres::DIV256, | ||
| 29 | _ => unreachable!(), | ||
| 30 | } | ||
| 31 | } | ||
| 32 | } | ||
| 33 | |||
| 34 | #[cfg(rcc_f3)] | 13 | #[cfg(rcc_f3)] |
| 35 | impl From<AdcClockSource> for Ckmode { | 14 | impl From<AdcClockSource> for Ckmode { |
| 36 | fn from(value: AdcClockSource) -> Self { | 15 | fn from(value: AdcClockSource) -> Self { |
| @@ -45,32 +24,13 @@ impl From<AdcClockSource> for Ckmode { | |||
| 45 | 24 | ||
| 46 | #[derive(Clone, Copy)] | 25 | #[derive(Clone, Copy)] |
| 47 | pub enum AdcClockSource { | 26 | pub enum AdcClockSource { |
| 48 | PllDiv1 = 1, | 27 | Pll(Adcpres), |
| 49 | PllDiv2 = 2, | ||
| 50 | PllDiv4 = 4, | ||
| 51 | PllDiv6 = 6, | ||
| 52 | PllDiv8 = 8, | ||
| 53 | PllDiv12 = 12, | ||
| 54 | PllDiv16 = 16, | ||
| 55 | PllDiv32 = 32, | ||
| 56 | PllDiv64 = 64, | ||
| 57 | PllDiv128 = 128, | ||
| 58 | PllDiv256 = 256, | ||
| 59 | BusDiv1, | 28 | BusDiv1, |
| 60 | BusDiv2, | 29 | BusDiv2, |
| 61 | BusDiv4, | 30 | BusDiv4, |
| 62 | } | 31 | } |
| 63 | 32 | ||
| 64 | impl AdcClockSource { | 33 | impl AdcClockSource { |
| 65 | pub fn is_bus(&self) -> bool { | ||
| 66 | match self { | ||
| 67 | Self::BusDiv1 => true, | ||
| 68 | Self::BusDiv2 => true, | ||
| 69 | Self::BusDiv4 => true, | ||
| 70 | _ => false, | ||
| 71 | } | ||
| 72 | } | ||
| 73 | |||
| 74 | pub fn bus_div(&self) -> u32 { | 34 | pub fn bus_div(&self) -> u32 { |
| 75 | match self { | 35 | match self { |
| 76 | Self::BusDiv1 => 1, | 36 | Self::BusDiv1 => 1, |
| @@ -124,6 +84,7 @@ pub struct Config { | |||
| 124 | pub adc34: Option<AdcClockSource>, | 84 | pub adc34: Option<AdcClockSource>, |
| 125 | #[cfg(stm32f334)] | 85 | #[cfg(stm32f334)] |
| 126 | pub hrtim: HrtimClockSource, | 86 | pub hrtim: HrtimClockSource, |
| 87 | pub ls: super::LsConfig, | ||
| 127 | } | 88 | } |
| 128 | 89 | ||
| 129 | // Information required to setup the PLL clock | 90 | // Information required to setup the PLL clock |
| @@ -137,67 +98,67 @@ struct PllConfig { | |||
| 137 | /// Initialize and Set the clock frequencies | 98 | /// Initialize and Set the clock frequencies |
| 138 | pub(crate) unsafe fn init(config: Config) { | 99 | pub(crate) unsafe fn init(config: Config) { |
| 139 | // Calculate the real System clock, and PLL configuration if applicable | 100 | // Calculate the real System clock, and PLL configuration if applicable |
| 140 | let (Hertz(sysclk), pll_config) = get_sysclk(&config); | 101 | let (sysclk, pll_config) = get_sysclk(&config); |
| 141 | assert!(sysclk <= 72_000_000); | 102 | assert!(sysclk.0 <= 72_000_000); |
| 142 | 103 | ||
| 143 | // Calculate real AHB clock | 104 | // Calculate real AHB clock |
| 144 | let hclk = config.hclk.map(|h| h.0).unwrap_or(sysclk); | 105 | let hclk = config.hclk.map(|h| h).unwrap_or(sysclk); |
| 145 | let (hpre_bits, hpre_div) = match sysclk / hclk { | 106 | let hpre = match sysclk.0 / hclk.0 { |
| 146 | 0 => unreachable!(), | 107 | 0 => unreachable!(), |
| 147 | 1 => (Hpre::DIV1, 1), | 108 | 1 => Hpre::DIV1, |
| 148 | 2 => (Hpre::DIV2, 2), | 109 | 2 => Hpre::DIV2, |
| 149 | 3..=5 => (Hpre::DIV4, 4), | 110 | 3..=5 => Hpre::DIV4, |
| 150 | 6..=11 => (Hpre::DIV8, 8), | 111 | 6..=11 => Hpre::DIV8, |
| 151 | 12..=39 => (Hpre::DIV16, 16), | 112 | 12..=39 => Hpre::DIV16, |
| 152 | 40..=95 => (Hpre::DIV64, 64), | 113 | 40..=95 => Hpre::DIV64, |
| 153 | 96..=191 => (Hpre::DIV128, 128), | 114 | 96..=191 => Hpre::DIV128, |
| 154 | 192..=383 => (Hpre::DIV256, 256), | 115 | 192..=383 => Hpre::DIV256, |
| 155 | _ => (Hpre::DIV512, 512), | 116 | _ => Hpre::DIV512, |
| 156 | }; | 117 | }; |
| 157 | let hclk = sysclk / hpre_div; | 118 | let hclk = sysclk / hpre; |
| 158 | assert!(hclk <= 72_000_000); | 119 | assert!(hclk <= Hertz(72_000_000)); |
| 159 | 120 | ||
| 160 | // Calculate real APB1 clock | 121 | // Calculate real APB1 clock |
| 161 | let pclk1 = config.pclk1.map(|p| p.0).unwrap_or(hclk); | 122 | let pclk1 = config.pclk1.unwrap_or(hclk); |
| 162 | let (ppre1_bits, ppre1) = match hclk / pclk1 { | 123 | let ppre1 = match hclk / pclk1 { |
| 163 | 0 => unreachable!(), | 124 | 0 => unreachable!(), |
| 164 | 1 => (Ppre::DIV1, 1), | 125 | 1 => Ppre::DIV1, |
| 165 | 2 => (Ppre::DIV2, 2), | 126 | 2 => Ppre::DIV2, |
| 166 | 3..=5 => (Ppre::DIV4, 4), | 127 | 3..=5 => Ppre::DIV4, |
| 167 | 6..=11 => (Ppre::DIV8, 8), | 128 | 6..=11 => Ppre::DIV8, |
| 168 | _ => (Ppre::DIV16, 16), | 129 | _ => Ppre::DIV16, |
| 169 | }; | 130 | }; |
| 170 | let timer_mul1 = if ppre1 == 1 { 1 } else { 2 }; | 131 | let timer_mul1 = if ppre1 == Ppre::DIV1 { 1u32 } else { 2 }; |
| 171 | let pclk1 = hclk / ppre1; | 132 | let pclk1 = hclk / ppre1; |
| 172 | assert!(pclk1 <= 36_000_000); | 133 | assert!(pclk1 <= Hertz(36_000_000)); |
| 173 | 134 | ||
| 174 | // Calculate real APB2 clock | 135 | // Calculate real APB2 clock |
| 175 | let pclk2 = config.pclk2.map(|p| p.0).unwrap_or(hclk); | 136 | let pclk2 = config.pclk2.unwrap_or(hclk); |
| 176 | let (ppre2_bits, ppre2) = match hclk / pclk2 { | 137 | let ppre2 = match hclk / pclk2 { |
| 177 | 0 => unreachable!(), | 138 | 0 => unreachable!(), |
| 178 | 1 => (Ppre::DIV1, 1), | 139 | 1 => Ppre::DIV1, |
| 179 | 2 => (Ppre::DIV2, 2), | 140 | 2 => Ppre::DIV2, |
| 180 | 3..=5 => (Ppre::DIV4, 4), | 141 | 3..=5 => Ppre::DIV4, |
| 181 | 6..=11 => (Ppre::DIV8, 8), | 142 | 6..=11 => Ppre::DIV8, |
| 182 | _ => (Ppre::DIV16, 16), | 143 | _ => Ppre::DIV16, |
| 183 | }; | 144 | }; |
| 184 | let timer_mul2 = if ppre2 == 1 { 1 } else { 2 }; | 145 | let timer_mul2 = if ppre2 == Ppre::DIV1 { 1u32 } else { 2 }; |
| 185 | let pclk2 = hclk / ppre2; | 146 | let pclk2 = hclk / ppre2; |
| 186 | assert!(pclk2 <= 72_000_000); | 147 | assert!(pclk2 <= Hertz(72_000_000)); |
| 187 | 148 | ||
| 188 | // Set latency based on HCLK frquency | 149 | // Set latency based on HCLK frquency |
| 189 | // RM0316: "The prefetch buffer must be kept on when using a prescaler | 150 | // RM0316: "The prefetch buffer must be kept on when using a prescaler |
| 190 | // different from 1 on the AHB clock.", "Half-cycle access cannot be | 151 | // different from 1 on the AHB clock.", "Half-cycle access cannot be |
| 191 | // used when there is a prescaler different from 1 on the AHB clock" | 152 | // used when there is a prescaler different from 1 on the AHB clock" |
| 192 | FLASH.acr().modify(|w| { | 153 | FLASH.acr().modify(|w| { |
| 193 | w.set_latency(if hclk <= 24_000_000 { | 154 | w.set_latency(if hclk <= Hertz(24_000_000) { |
| 194 | Latency::WS0 | 155 | Latency::WS0 |
| 195 | } else if hclk <= 48_000_000 { | 156 | } else if hclk <= Hertz(48_000_000) { |
| 196 | Latency::WS1 | 157 | Latency::WS1 |
| 197 | } else { | 158 | } else { |
| 198 | Latency::WS2 | 159 | Latency::WS2 |
| 199 | }); | 160 | }); |
| 200 | if hpre_div != 1 { | 161 | if hpre != Hpre::DIV1 { |
| 201 | w.set_hlfcya(false); | 162 | w.set_hlfcya(false); |
| 202 | w.set_prftbe(true); | 163 | w.set_prftbe(true); |
| 203 | } | 164 | } |
| @@ -240,9 +201,9 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 240 | // Set prescalers | 201 | // Set prescalers |
| 241 | // CFGR has been written before (PLL, PLL48) don't overwrite these settings | 202 | // CFGR has been written before (PLL, PLL48) don't overwrite these settings |
| 242 | RCC.cfgr().modify(|w| { | 203 | RCC.cfgr().modify(|w| { |
| 243 | w.set_ppre2(ppre2_bits); | 204 | w.set_ppre2(ppre2); |
| 244 | w.set_ppre1(ppre1_bits); | 205 | w.set_ppre1(ppre1); |
| 245 | w.set_hpre(hpre_bits); | 206 | w.set_hpre(hpre); |
| 246 | }); | 207 | }); |
| 247 | 208 | ||
| 248 | // Wait for the new prescalers to kick in | 209 | // Wait for the new prescalers to kick in |
| @@ -253,52 +214,50 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 253 | // CFGR has been written before (PLL, PLL48, clock divider) don't overwrite these settings | 214 | // CFGR has been written before (PLL, PLL48, clock divider) don't overwrite these settings |
| 254 | RCC.cfgr().modify(|w| { | 215 | RCC.cfgr().modify(|w| { |
| 255 | w.set_sw(match (pll_config, config.hse) { | 216 | w.set_sw(match (pll_config, config.hse) { |
| 256 | (Some(_), _) => Sw::PLL, | 217 | (Some(_), _) => Sw::PLL1_P, |
| 257 | (None, Some(_)) => Sw::HSE, | 218 | (None, Some(_)) => Sw::HSE, |
| 258 | (None, None) => Sw::HSI, | 219 | (None, None) => Sw::HSI, |
| 259 | }) | 220 | }) |
| 260 | }); | 221 | }); |
| 261 | 222 | ||
| 262 | #[cfg(rcc_f3)] | 223 | #[cfg(rcc_f3)] |
| 263 | let adc = config.adc.map(|adc| { | 224 | let adc = config.adc.map(|adc| match adc { |
| 264 | if !adc.is_bus() { | 225 | AdcClockSource::Pll(adcpres) => { |
| 265 | RCC.cfgr2().modify(|w| { | 226 | RCC.cfgr2().modify(|w| { |
| 266 | // Make sure that we're using the PLL | 227 | // Make sure that we're using the PLL |
| 267 | pll_config.unwrap(); | 228 | pll_config.unwrap(); |
| 268 | w.set_adc12pres(adc.into()); | 229 | w.set_adc12pres(adcpres); |
| 269 | 230 | ||
| 270 | Hertz(sysclk / adc as u32) | 231 | sysclk / adcpres |
| 271 | }) | 232 | }) |
| 272 | } else { | 233 | } |
| 273 | crate::pac::ADC_COMMON.ccr().modify(|w| { | 234 | _ => crate::pac::ADC_COMMON.ccr().modify(|w| { |
| 274 | assert!(!(adc.bus_div() == 1 && hpre_bits != Hpre::DIV1)); | 235 | assert!(!(adc.bus_div() == 1 && hpre != Hpre::DIV1)); |
| 275 | 236 | ||
| 276 | w.set_ckmode(adc.into()); | 237 | w.set_ckmode(adc.into()); |
| 277 | 238 | ||
| 278 | Hertz(sysclk / adc.bus_div() as u32) | 239 | sysclk / adc.bus_div() |
| 279 | }) | 240 | }), |
| 280 | } | ||
| 281 | }); | 241 | }); |
| 282 | 242 | ||
| 283 | #[cfg(all(rcc_f3, adc3_common))] | 243 | #[cfg(all(rcc_f3, adc3_common))] |
| 284 | let adc34 = config.adc.map(|adc| { | 244 | let adc34 = config.adc34.map(|adc| match adc { |
| 285 | if !adc.is_bus() { | 245 | AdcClockSource::Pll(adcpres) => { |
| 286 | RCC.cfgr2().modify(|w| { | 246 | RCC.cfgr2().modify(|w| { |
| 287 | // Make sure that we're using the PLL | 247 | // Make sure that we're using the PLL |
| 288 | pll_config.unwrap(); | 248 | pll_config.unwrap(); |
| 289 | w.set_adc12pres(adc.into()); | 249 | w.set_adc34pres(adcpres); |
| 290 | 250 | ||
| 291 | Hertz(sysclk / adc as u32) | 251 | sysclk / adcpres |
| 292 | }) | 252 | }) |
| 293 | } else { | 253 | } |
| 294 | crate::pac::ADC3_COMMON.ccr().modify(|w| { | 254 | _ => crate::pac::ADC_COMMON.ccr().modify(|w| { |
| 295 | assert!(!(adc.bus_div() == 1 && hpre_bits != Hpre::DIV1)); | 255 | assert!(!(adc.bus_div() == 1 && hpre != Hpre::DIV1)); |
| 296 | 256 | ||
| 297 | w.set_ckmode(adc.into()); | 257 | w.set_ckmode(adc.into()); |
| 298 | 258 | ||
| 299 | Hertz(sysclk / adc.bus_div() as u32) | 259 | sysclk / adc.bus_div() |
| 300 | }) | 260 | }), |
| 301 | } | ||
| 302 | }); | 261 | }); |
| 303 | 262 | ||
| 304 | #[cfg(stm32f334)] | 263 | #[cfg(stm32f334)] |
| @@ -310,21 +269,23 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 310 | 269 | ||
| 311 | // Make sure that we're using the PLL | 270 | // Make sure that we're using the PLL |
| 312 | pll_config.unwrap(); | 271 | pll_config.unwrap(); |
| 313 | assert!((pclk2 == sysclk) || (pclk2 * 2 == sysclk)); | 272 | assert!((pclk2 == sysclk) || (pclk2 * 2u32 == sysclk)); |
| 314 | 273 | ||
| 315 | RCC.cfgr3().modify(|w| w.set_hrtim1sw(Timsw::PLL)); | 274 | RCC.cfgr3().modify(|w| w.set_hrtim1sw(Timsw::PLL1_P)); |
| 316 | 275 | ||
| 317 | Some(Hertz(sysclk * 2)) | 276 | Some(sysclk * 2u32) |
| 318 | } | 277 | } |
| 319 | }; | 278 | }; |
| 320 | 279 | ||
| 280 | let rtc = config.ls.init(); | ||
| 281 | |||
| 321 | set_freqs(Clocks { | 282 | set_freqs(Clocks { |
| 322 | sys: Hertz(sysclk), | 283 | sys: sysclk, |
| 323 | apb1: Hertz(pclk1), | 284 | pclk1: pclk1, |
| 324 | apb2: Hertz(pclk2), | 285 | pclk2: pclk2, |
| 325 | apb1_tim: Hertz(pclk1 * timer_mul1), | 286 | pclk1_tim: pclk1 * timer_mul1, |
| 326 | apb2_tim: Hertz(pclk2 * timer_mul2), | 287 | pclk2_tim: pclk2 * timer_mul2, |
| 327 | ahb1: Hertz(hclk), | 288 | hclk1: hclk, |
| 328 | #[cfg(rcc_f3)] | 289 | #[cfg(rcc_f3)] |
| 329 | adc: adc, | 290 | adc: adc, |
| 330 | #[cfg(all(rcc_f3, adc3_common))] | 291 | #[cfg(all(rcc_f3, adc3_common))] |
| @@ -333,6 +294,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 333 | adc34: None, | 294 | adc34: None, |
| 334 | #[cfg(stm32f334)] | 295 | #[cfg(stm32f334)] |
| 335 | hrtim: hrtim, | 296 | hrtim: hrtim, |
| 297 | rtc, | ||
| 336 | }); | 298 | }); |
| 337 | } | 299 | } |
| 338 | 300 | ||
| @@ -421,16 +383,16 @@ fn calc_pll(config: &Config, Hertz(sysclk): Hertz) -> (Hertz, PllConfig) { | |||
| 421 | 383 | ||
| 422 | #[inline] | 384 | #[inline] |
| 423 | #[allow(unused_variables)] | 385 | #[allow(unused_variables)] |
| 424 | fn get_usb_pre(config: &Config, sysclk: u32, pclk1: u32, pll_config: &Option<PllConfig>) -> Usbpre { | 386 | fn get_usb_pre(config: &Config, sysclk: Hertz, pclk1: Hertz, pll_config: &Option<PllConfig>) -> Usbpre { |
| 425 | cfg_if::cfg_if! { | 387 | cfg_if::cfg_if! { |
| 426 | // Some chips do not have USB | 388 | // Some chips do not have USB |
| 427 | if #[cfg(any(stm32f301, stm32f318, stm32f334))] { | 389 | if #[cfg(any(stm32f301, stm32f318, stm32f334))] { |
| 428 | panic!("USB clock not supported by the chip"); | 390 | panic!("USB clock not supported by the chip"); |
| 429 | } else { | 391 | } else { |
| 430 | let usb_ok = config.hse.is_some() && pll_config.is_some() && (pclk1 >= 10_000_000); | 392 | let usb_ok = config.hse.is_some() && pll_config.is_some() && (pclk1 >= Hertz(10_000_000)); |
| 431 | match (usb_ok, sysclk) { | 393 | match (usb_ok, sysclk) { |
| 432 | (true, 72_000_000) => Usbpre::DIV1_5, | 394 | (true, Hertz(72_000_000)) => Usbpre::DIV1_5, |
| 433 | (true, 48_000_000) => Usbpre::DIV1, | 395 | (true, Hertz(48_000_000)) => Usbpre::DIV1, |
| 434 | _ => panic!( | 396 | _ => panic!( |
| 435 | "USB clock is only valid if the PLL output frequency is either 48MHz or 72MHz" | 397 | "USB clock is only valid if the PLL output frequency is either 48MHz or 72MHz" |
| 436 | ), | 398 | ), |
diff --git a/embassy-stm32/src/rcc/f4.rs b/embassy-stm32/src/rcc/f4.rs deleted file mode 100644 index ebf78d0e2..000000000 --- a/embassy-stm32/src/rcc/f4.rs +++ /dev/null | |||
| @@ -1,579 +0,0 @@ | |||
| 1 | use core::marker::PhantomData; | ||
| 2 | |||
| 3 | use embassy_hal_internal::into_ref; | ||
| 4 | use stm32_metapac::rcc::vals::{Mco1, Mco2, Mcopre}; | ||
| 5 | |||
| 6 | use crate::gpio::sealed::AFType; | ||
| 7 | use crate::gpio::Speed; | ||
| 8 | use crate::pac::rcc::vals::{Hpre, Ppre, Sw}; | ||
| 9 | use crate::pac::{FLASH, PWR, RCC}; | ||
| 10 | use crate::rcc::bd::{BackupDomain, RtcClockSource}; | ||
| 11 | use crate::rcc::{set_freqs, Clocks}; | ||
| 12 | use crate::time::Hertz; | ||
| 13 | use crate::{peripherals, Peripheral}; | ||
| 14 | |||
| 15 | /// HSI speed | ||
| 16 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 17 | |||
| 18 | /// LSI speed | ||
| 19 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 20 | |||
| 21 | /// Clocks configuration | ||
| 22 | #[non_exhaustive] | ||
| 23 | #[derive(Default)] | ||
| 24 | pub struct Config { | ||
| 25 | pub hse: Option<Hertz>, | ||
| 26 | pub bypass_hse: bool, | ||
| 27 | pub hclk: Option<Hertz>, | ||
| 28 | pub sys_ck: Option<Hertz>, | ||
| 29 | pub pclk1: Option<Hertz>, | ||
| 30 | pub pclk2: Option<Hertz>, | ||
| 31 | |||
| 32 | #[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))] | ||
| 33 | pub plli2s: Option<Hertz>, | ||
| 34 | |||
| 35 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 36 | pub pllsai: Option<Hertz>, | ||
| 37 | |||
| 38 | pub pll48: bool, | ||
| 39 | pub rtc: Option<RtcClockSource>, | ||
| 40 | pub lsi: bool, | ||
| 41 | pub lse: Option<Hertz>, | ||
| 42 | } | ||
| 43 | |||
| 44 | #[cfg(stm32f410)] | ||
| 45 | fn setup_i2s_pll(_vco_in: u32, _plli2s: Option<u32>) -> Option<u32> { | ||
| 46 | None | ||
| 47 | } | ||
| 48 | |||
| 49 | // Not currently implemented, but will be in the future | ||
| 50 | #[cfg(any(stm32f411, stm32f412, stm32f413, stm32f423, stm32f446))] | ||
| 51 | fn setup_i2s_pll(_vco_in: u32, _plli2s: Option<u32>) -> Option<u32> { | ||
| 52 | None | ||
| 53 | } | ||
| 54 | |||
| 55 | #[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))] | ||
| 56 | fn calculate_sai_i2s_pll_values(vco_in: u32, max_div: u32, target: Option<u32>) -> Option<(u32, u32, u32)> { | ||
| 57 | let min_div = 2; | ||
| 58 | let target = match target { | ||
| 59 | Some(target) => target, | ||
| 60 | None => return None, | ||
| 61 | }; | ||
| 62 | |||
| 63 | // We loop through the possible divider values to find the best configuration. Looping | ||
| 64 | // through all possible "N" values would result in more iterations. | ||
| 65 | let (n, outdiv, output, _error) = (min_div..=max_div) | ||
| 66 | .filter_map(|outdiv| { | ||
| 67 | let target_vco_out = match target.checked_mul(outdiv) { | ||
| 68 | Some(x) => x, | ||
| 69 | None => return None, | ||
| 70 | }; | ||
| 71 | let n = (target_vco_out + (vco_in >> 1)) / vco_in; | ||
| 72 | let vco_out = vco_in * n; | ||
| 73 | if !(100_000_000..=432_000_000).contains(&vco_out) { | ||
| 74 | return None; | ||
| 75 | } | ||
| 76 | let output = vco_out / outdiv; | ||
| 77 | let error = (output as i32 - target as i32).unsigned_abs(); | ||
| 78 | Some((n, outdiv, output, error)) | ||
| 79 | }) | ||
| 80 | .min_by_key(|(_, _, _, error)| *error)?; | ||
| 81 | |||
| 82 | Some((n, outdiv, output)) | ||
| 83 | } | ||
| 84 | |||
| 85 | #[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))] | ||
| 86 | fn setup_i2s_pll(vco_in: u32, plli2s: Option<u32>) -> Option<u32> { | ||
| 87 | let (n, outdiv, output) = calculate_sai_i2s_pll_values(vco_in, 7, plli2s)?; | ||
| 88 | |||
| 89 | RCC.plli2scfgr().modify(|w| { | ||
| 90 | w.set_plli2sn(n as u16); | ||
| 91 | w.set_plli2sr(outdiv as u8); | ||
| 92 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 93 | w.set_plli2sq(outdiv as u8); //set sai divider same as i2s | ||
| 94 | }); | ||
| 95 | |||
| 96 | Some(output) | ||
| 97 | } | ||
| 98 | |||
| 99 | #[cfg(not(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479)))] | ||
| 100 | fn setup_sai_pll(_vco_in: u32, _pllsai: Option<u32>) -> Option<u32> { | ||
| 101 | None | ||
| 102 | } | ||
| 103 | |||
| 104 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 105 | fn setup_sai_pll(vco_in: u32, pllsai: Option<u32>) -> Option<u32> { | ||
| 106 | let (n, outdiv, output) = calculate_sai_i2s_pll_values(vco_in, 15, pllsai)?; | ||
| 107 | |||
| 108 | RCC.pllsaicfgr().modify(|w| { | ||
| 109 | w.set_pllsain(n as u16); | ||
| 110 | w.set_pllsaiq(outdiv as u8); | ||
| 111 | }); | ||
| 112 | |||
| 113 | Some(output) | ||
| 114 | } | ||
| 115 | |||
| 116 | fn setup_pll( | ||
| 117 | pllsrcclk: u32, | ||
| 118 | use_hse: bool, | ||
| 119 | pllsysclk: Option<u32>, | ||
| 120 | plli2s: Option<u32>, | ||
| 121 | pllsai: Option<u32>, | ||
| 122 | pll48clk: bool, | ||
| 123 | ) -> PllResults { | ||
| 124 | use crate::pac::rcc::vals::{Pllp, Pllsrc}; | ||
| 125 | |||
| 126 | let sysclk = pllsysclk.unwrap_or(pllsrcclk); | ||
| 127 | if pllsysclk.is_none() && !pll48clk { | ||
| 128 | RCC.pllcfgr().modify(|w| w.set_pllsrc(Pllsrc::from_bits(use_hse as u8))); | ||
| 129 | |||
| 130 | return PllResults { | ||
| 131 | use_pll: false, | ||
| 132 | pllsysclk: None, | ||
| 133 | pll48clk: None, | ||
| 134 | plli2sclk: None, | ||
| 135 | pllsaiclk: None, | ||
| 136 | }; | ||
| 137 | } | ||
| 138 | // Input divisor from PLL source clock, must result to frequency in | ||
| 139 | // the range from 1 to 2 MHz | ||
| 140 | let pllm_min = (pllsrcclk + 1_999_999) / 2_000_000; | ||
| 141 | let pllm_max = pllsrcclk / 1_000_000; | ||
| 142 | |||
| 143 | // Sysclk output divisor must be one of 2, 4, 6 or 8 | ||
| 144 | let sysclk_div = core::cmp::min(8, (432_000_000 / sysclk) & !1); | ||
| 145 | |||
| 146 | let target_freq = if pll48clk { 48_000_000 } else { sysclk * sysclk_div }; | ||
| 147 | |||
| 148 | // Find the lowest pllm value that minimize the difference between | ||
| 149 | // target frequency and the real vco_out frequency. | ||
| 150 | let pllm = unwrap!((pllm_min..=pllm_max).min_by_key(|pllm| { | ||
| 151 | let vco_in = pllsrcclk / pllm; | ||
| 152 | let plln = target_freq / vco_in; | ||
| 153 | target_freq - vco_in * plln | ||
| 154 | })); | ||
| 155 | |||
| 156 | let vco_in = pllsrcclk / pllm; | ||
| 157 | assert!((1_000_000..=2_000_000).contains(&vco_in)); | ||
| 158 | |||
| 159 | // Main scaler, must result in >= 100MHz (>= 192MHz for F401) | ||
| 160 | // and <= 432MHz, min 50, max 432 | ||
| 161 | let plln = if pll48clk { | ||
| 162 | // try the different valid pllq according to the valid | ||
| 163 | // main scaller values, and take the best | ||
| 164 | let pllq = unwrap!((4..=9).min_by_key(|pllq| { | ||
| 165 | let plln = 48_000_000 * pllq / vco_in; | ||
| 166 | let pll48_diff = 48_000_000 - vco_in * plln / pllq; | ||
| 167 | let sysclk_diff = (sysclk as i32 - (vco_in * plln / sysclk_div) as i32).abs(); | ||
| 168 | (pll48_diff, sysclk_diff) | ||
| 169 | })); | ||
| 170 | 48_000_000 * pllq / vco_in | ||
| 171 | } else { | ||
| 172 | sysclk * sysclk_div / vco_in | ||
| 173 | }; | ||
| 174 | |||
| 175 | let pllp = (sysclk_div / 2) - 1; | ||
| 176 | |||
| 177 | let pllq = (vco_in * plln + 47_999_999) / 48_000_000; | ||
| 178 | let real_pll48clk = vco_in * plln / pllq; | ||
| 179 | |||
| 180 | RCC.pllcfgr().modify(|w| { | ||
| 181 | w.set_pllm(pllm as u8); | ||
| 182 | w.set_plln(plln as u16); | ||
| 183 | w.set_pllp(Pllp::from_bits(pllp as u8)); | ||
| 184 | w.set_pllq(pllq as u8); | ||
| 185 | w.set_pllsrc(Pllsrc::from_bits(use_hse as u8)); | ||
| 186 | w.set_pllr(0); | ||
| 187 | }); | ||
| 188 | |||
| 189 | let real_pllsysclk = vco_in * plln / sysclk_div; | ||
| 190 | |||
| 191 | PllResults { | ||
| 192 | use_pll: true, | ||
| 193 | pllsysclk: Some(real_pllsysclk), | ||
| 194 | pll48clk: if pll48clk { Some(real_pll48clk) } else { None }, | ||
| 195 | plli2sclk: setup_i2s_pll(vco_in, plli2s), | ||
| 196 | pllsaiclk: setup_sai_pll(vco_in, pllsai), | ||
| 197 | } | ||
| 198 | } | ||
| 199 | |||
| 200 | pub enum McoClock { | ||
| 201 | DIV1, | ||
| 202 | DIV2, | ||
| 203 | DIV3, | ||
| 204 | DIV4, | ||
| 205 | DIV5, | ||
| 206 | } | ||
| 207 | |||
| 208 | impl McoClock { | ||
| 209 | fn into_raw(&self) -> Mcopre { | ||
| 210 | match self { | ||
| 211 | McoClock::DIV1 => Mcopre::DIV1, | ||
| 212 | McoClock::DIV2 => Mcopre::DIV2, | ||
| 213 | McoClock::DIV3 => Mcopre::DIV3, | ||
| 214 | McoClock::DIV4 => Mcopre::DIV4, | ||
| 215 | McoClock::DIV5 => Mcopre::DIV5, | ||
| 216 | } | ||
| 217 | } | ||
| 218 | } | ||
| 219 | |||
| 220 | #[derive(Copy, Clone)] | ||
| 221 | pub enum Mco1Source { | ||
| 222 | Hsi, | ||
| 223 | Lse, | ||
| 224 | Hse, | ||
| 225 | Pll, | ||
| 226 | } | ||
| 227 | |||
| 228 | impl Default for Mco1Source { | ||
| 229 | fn default() -> Self { | ||
| 230 | Self::Hsi | ||
| 231 | } | ||
| 232 | } | ||
| 233 | |||
| 234 | pub trait McoSource { | ||
| 235 | type Raw; | ||
| 236 | |||
| 237 | fn into_raw(&self) -> Self::Raw; | ||
| 238 | } | ||
| 239 | |||
| 240 | impl McoSource for Mco1Source { | ||
| 241 | type Raw = Mco1; | ||
| 242 | fn into_raw(&self) -> Self::Raw { | ||
| 243 | match self { | ||
| 244 | Mco1Source::Hsi => Mco1::HSI, | ||
| 245 | Mco1Source::Lse => Mco1::LSE, | ||
| 246 | Mco1Source::Hse => Mco1::HSE, | ||
| 247 | Mco1Source::Pll => Mco1::PLL, | ||
| 248 | } | ||
| 249 | } | ||
| 250 | } | ||
| 251 | |||
| 252 | #[derive(Copy, Clone)] | ||
| 253 | pub enum Mco2Source { | ||
| 254 | SysClk, | ||
| 255 | Plli2s, | ||
| 256 | Hse, | ||
| 257 | Pll, | ||
| 258 | } | ||
| 259 | |||
| 260 | impl Default for Mco2Source { | ||
| 261 | fn default() -> Self { | ||
| 262 | Self::SysClk | ||
| 263 | } | ||
| 264 | } | ||
| 265 | |||
| 266 | impl McoSource for Mco2Source { | ||
| 267 | type Raw = Mco2; | ||
| 268 | fn into_raw(&self) -> Self::Raw { | ||
| 269 | match self { | ||
| 270 | Mco2Source::SysClk => Mco2::SYSCLK, | ||
| 271 | Mco2Source::Plli2s => Mco2::PLLI2S, | ||
| 272 | Mco2Source::Hse => Mco2::HSE, | ||
| 273 | Mco2Source::Pll => Mco2::PLL, | ||
| 274 | } | ||
| 275 | } | ||
| 276 | } | ||
| 277 | |||
| 278 | pub(crate) mod sealed { | ||
| 279 | use stm32_metapac::rcc::vals::Mcopre; | ||
| 280 | pub trait McoInstance { | ||
| 281 | type Source; | ||
| 282 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: Mcopre); | ||
| 283 | } | ||
| 284 | } | ||
| 285 | |||
| 286 | pub trait McoInstance: sealed::McoInstance + 'static {} | ||
| 287 | |||
| 288 | pin_trait!(McoPin, McoInstance); | ||
| 289 | |||
| 290 | impl sealed::McoInstance for peripherals::MCO1 { | ||
| 291 | type Source = Mco1; | ||
| 292 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: Mcopre) { | ||
| 293 | RCC.cfgr().modify(|w| { | ||
| 294 | w.set_mco1(source); | ||
| 295 | w.set_mco1pre(prescaler); | ||
| 296 | }); | ||
| 297 | match source { | ||
| 298 | Mco1::PLL => { | ||
| 299 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 300 | while !RCC.cr().read().pllrdy() {} | ||
| 301 | } | ||
| 302 | Mco1::HSI => { | ||
| 303 | RCC.cr().modify(|w| w.set_hsion(true)); | ||
| 304 | while !RCC.cr().read().hsirdy() {} | ||
| 305 | } | ||
| 306 | _ => {} | ||
| 307 | } | ||
| 308 | } | ||
| 309 | } | ||
| 310 | impl McoInstance for peripherals::MCO1 {} | ||
| 311 | |||
| 312 | impl sealed::McoInstance for peripherals::MCO2 { | ||
| 313 | type Source = Mco2; | ||
| 314 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: Mcopre) { | ||
| 315 | RCC.cfgr().modify(|w| { | ||
| 316 | w.set_mco2(source); | ||
| 317 | w.set_mco2pre(prescaler); | ||
| 318 | }); | ||
| 319 | match source { | ||
| 320 | Mco2::PLL => { | ||
| 321 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 322 | while !RCC.cr().read().pllrdy() {} | ||
| 323 | } | ||
| 324 | #[cfg(not(stm32f410))] | ||
| 325 | Mco2::PLLI2S => { | ||
| 326 | RCC.cr().modify(|w| w.set_plli2son(true)); | ||
| 327 | while !RCC.cr().read().plli2srdy() {} | ||
| 328 | } | ||
| 329 | _ => {} | ||
| 330 | } | ||
| 331 | } | ||
| 332 | } | ||
| 333 | impl McoInstance for peripherals::MCO2 {} | ||
| 334 | |||
| 335 | pub struct Mco<'d, T: McoInstance> { | ||
| 336 | phantom: PhantomData<&'d mut T>, | ||
| 337 | } | ||
| 338 | |||
| 339 | impl<'d, T: McoInstance> Mco<'d, T> { | ||
| 340 | pub fn new( | ||
| 341 | _peri: impl Peripheral<P = T> + 'd, | ||
| 342 | pin: impl Peripheral<P = impl McoPin<T>> + 'd, | ||
| 343 | source: impl McoSource<Raw = T::Source>, | ||
| 344 | prescaler: McoClock, | ||
| 345 | ) -> Self { | ||
| 346 | into_ref!(pin); | ||
| 347 | |||
| 348 | critical_section::with(|_| unsafe { | ||
| 349 | T::apply_clock_settings(source.into_raw(), prescaler.into_raw()); | ||
| 350 | pin.set_as_af(pin.af_num(), AFType::OutputPushPull); | ||
| 351 | pin.set_speed(Speed::VeryHigh); | ||
| 352 | }); | ||
| 353 | |||
| 354 | Self { phantom: PhantomData } | ||
| 355 | } | ||
| 356 | } | ||
| 357 | |||
| 358 | fn flash_setup(sysclk: u32) { | ||
| 359 | use crate::pac::flash::vals::Latency; | ||
| 360 | |||
| 361 | // Be conservative with voltage ranges | ||
| 362 | const FLASH_LATENCY_STEP: u32 = 30_000_000; | ||
| 363 | |||
| 364 | critical_section::with(|_| { | ||
| 365 | FLASH | ||
| 366 | .acr() | ||
| 367 | .modify(|w| w.set_latency(Latency::from_bits(((sysclk - 1) / FLASH_LATENCY_STEP) as u8))); | ||
| 368 | }); | ||
| 369 | } | ||
| 370 | |||
| 371 | pub(crate) unsafe fn init(config: Config) { | ||
| 372 | let pllsrcclk = config.hse.map(|hse| hse.0).unwrap_or(HSI_FREQ.0); | ||
| 373 | let sysclk = config.sys_ck.map(|sys| sys.0).unwrap_or(pllsrcclk); | ||
| 374 | let sysclk_on_pll = sysclk != pllsrcclk; | ||
| 375 | |||
| 376 | let plls = setup_pll( | ||
| 377 | pllsrcclk, | ||
| 378 | config.hse.is_some(), | ||
| 379 | if sysclk_on_pll { Some(sysclk) } else { None }, | ||
| 380 | #[cfg(not(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446)))] | ||
| 381 | config.plli2s.map(|i2s| i2s.0), | ||
| 382 | #[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f446))] | ||
| 383 | None, | ||
| 384 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 385 | config.pllsai.map(|sai| sai.0), | ||
| 386 | #[cfg(not(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479)))] | ||
| 387 | None, | ||
| 388 | config.pll48, | ||
| 389 | ); | ||
| 390 | |||
| 391 | if config.pll48 { | ||
| 392 | let freq = unwrap!(plls.pll48clk); | ||
| 393 | |||
| 394 | assert!((max::PLL_48_CLK as i32 - freq as i32).abs() <= max::PLL_48_TOLERANCE as i32); | ||
| 395 | } | ||
| 396 | |||
| 397 | let sysclk = if sysclk_on_pll { unwrap!(plls.pllsysclk) } else { sysclk }; | ||
| 398 | |||
| 399 | // AHB prescaler | ||
| 400 | let hclk = config.hclk.map(|h| h.0).unwrap_or(sysclk); | ||
| 401 | let (hpre_bits, hpre_div) = match (sysclk + hclk - 1) / hclk { | ||
| 402 | 0 => unreachable!(), | ||
| 403 | 1 => (Hpre::DIV1, 1), | ||
| 404 | 2 => (Hpre::DIV2, 2), | ||
| 405 | 3..=5 => (Hpre::DIV4, 4), | ||
| 406 | 6..=11 => (Hpre::DIV8, 8), | ||
| 407 | 12..=39 => (Hpre::DIV16, 16), | ||
| 408 | 40..=95 => (Hpre::DIV64, 64), | ||
| 409 | 96..=191 => (Hpre::DIV128, 128), | ||
| 410 | 192..=383 => (Hpre::DIV256, 256), | ||
| 411 | _ => (Hpre::DIV512, 512), | ||
| 412 | }; | ||
| 413 | |||
| 414 | // Calculate real AHB clock | ||
| 415 | let hclk = sysclk / hpre_div; | ||
| 416 | |||
| 417 | let pclk1 = config | ||
| 418 | .pclk1 | ||
| 419 | .map(|p| p.0) | ||
| 420 | .unwrap_or_else(|| core::cmp::min(max::PCLK1_MAX, hclk)); | ||
| 421 | |||
| 422 | let (ppre1_bits, ppre1) = match (hclk + pclk1 - 1) / pclk1 { | ||
| 423 | 0 => unreachable!(), | ||
| 424 | 1 => (0b000, 1), | ||
| 425 | 2 => (0b100, 2), | ||
| 426 | 3..=5 => (0b101, 4), | ||
| 427 | 6..=11 => (0b110, 8), | ||
| 428 | _ => (0b111, 16), | ||
| 429 | }; | ||
| 430 | let timer_mul1 = if ppre1 == 1 { 1 } else { 2 }; | ||
| 431 | |||
| 432 | // Calculate real APB1 clock | ||
| 433 | let pclk1 = hclk / ppre1; | ||
| 434 | assert!(pclk1 <= max::PCLK1_MAX); | ||
| 435 | |||
| 436 | let pclk2 = config | ||
| 437 | .pclk2 | ||
| 438 | .map(|p| p.0) | ||
| 439 | .unwrap_or_else(|| core::cmp::min(max::PCLK2_MAX, hclk)); | ||
| 440 | let (ppre2_bits, ppre2) = match (hclk + pclk2 - 1) / pclk2 { | ||
| 441 | 0 => unreachable!(), | ||
| 442 | 1 => (0b000, 1), | ||
| 443 | 2 => (0b100, 2), | ||
| 444 | 3..=5 => (0b101, 4), | ||
| 445 | 6..=11 => (0b110, 8), | ||
| 446 | _ => (0b111, 16), | ||
| 447 | }; | ||
| 448 | let timer_mul2 = if ppre2 == 1 { 1 } else { 2 }; | ||
| 449 | |||
| 450 | // Calculate real APB2 clock | ||
| 451 | let pclk2 = hclk / ppre2; | ||
| 452 | assert!(pclk2 <= max::PCLK2_MAX); | ||
| 453 | |||
| 454 | flash_setup(sysclk); | ||
| 455 | |||
| 456 | if config.hse.is_some() { | ||
| 457 | RCC.cr().modify(|w| { | ||
| 458 | w.set_hsebyp(config.bypass_hse); | ||
| 459 | w.set_hseon(true); | ||
| 460 | }); | ||
| 461 | while !RCC.cr().read().hserdy() {} | ||
| 462 | } | ||
| 463 | |||
| 464 | if plls.use_pll { | ||
| 465 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 466 | |||
| 467 | if hclk > max::HCLK_OVERDRIVE_FREQUENCY { | ||
| 468 | PWR.cr1().modify(|w| w.set_oden(true)); | ||
| 469 | while !PWR.csr1().read().odrdy() {} | ||
| 470 | |||
| 471 | PWR.cr1().modify(|w| w.set_odswen(true)); | ||
| 472 | while !PWR.csr1().read().odswrdy() {} | ||
| 473 | } | ||
| 474 | |||
| 475 | while !RCC.cr().read().pllrdy() {} | ||
| 476 | } | ||
| 477 | |||
| 478 | #[cfg(not(stm32f410))] | ||
| 479 | if plls.plli2sclk.is_some() { | ||
| 480 | RCC.cr().modify(|w| w.set_plli2son(true)); | ||
| 481 | |||
| 482 | while !RCC.cr().read().plli2srdy() {} | ||
| 483 | } | ||
| 484 | |||
| 485 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 486 | if plls.pllsaiclk.is_some() { | ||
| 487 | RCC.cr().modify(|w| w.set_pllsaion(true)); | ||
| 488 | while !RCC.cr().read().pllsairdy() {} | ||
| 489 | } | ||
| 490 | |||
| 491 | RCC.cfgr().modify(|w| { | ||
| 492 | w.set_ppre2(Ppre::from_bits(ppre2_bits)); | ||
| 493 | w.set_ppre1(Ppre::from_bits(ppre1_bits)); | ||
| 494 | w.set_hpre(hpre_bits); | ||
| 495 | }); | ||
| 496 | |||
| 497 | // Wait for the new prescalers to kick in | ||
| 498 | // "The clocks are divided with the new prescaler factor from 1 to 16 AHB cycles after write" | ||
| 499 | cortex_m::asm::delay(16); | ||
| 500 | |||
| 501 | RCC.cfgr().modify(|w| { | ||
| 502 | w.set_sw(if sysclk_on_pll { | ||
| 503 | Sw::PLL | ||
| 504 | } else if config.hse.is_some() { | ||
| 505 | Sw::HSE | ||
| 506 | } else { | ||
| 507 | Sw::HSI | ||
| 508 | }) | ||
| 509 | }); | ||
| 510 | |||
| 511 | BackupDomain::configure_ls( | ||
| 512 | config.rtc.unwrap_or(RtcClockSource::NOCLOCK), | ||
| 513 | config.lsi, | ||
| 514 | config.lse.map(|_| Default::default()), | ||
| 515 | ); | ||
| 516 | |||
| 517 | let rtc = match config.rtc { | ||
| 518 | Some(RtcClockSource::LSI) => Some(LSI_FREQ), | ||
| 519 | Some(RtcClockSource::LSE) => Some(config.lse.unwrap()), | ||
| 520 | _ => None, | ||
| 521 | }; | ||
| 522 | |||
| 523 | set_freqs(Clocks { | ||
| 524 | sys: Hertz(sysclk), | ||
| 525 | apb1: Hertz(pclk1), | ||
| 526 | apb2: Hertz(pclk2), | ||
| 527 | |||
| 528 | apb1_tim: Hertz(pclk1 * timer_mul1), | ||
| 529 | apb2_tim: Hertz(pclk2 * timer_mul2), | ||
| 530 | |||
| 531 | ahb1: Hertz(hclk), | ||
| 532 | ahb2: Hertz(hclk), | ||
| 533 | ahb3: Hertz(hclk), | ||
| 534 | |||
| 535 | pll48: plls.pll48clk.map(Hertz), | ||
| 536 | |||
| 537 | #[cfg(not(stm32f410))] | ||
| 538 | plli2s: plls.plli2sclk.map(Hertz), | ||
| 539 | |||
| 540 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 541 | pllsai: plls.pllsaiclk.map(Hertz), | ||
| 542 | |||
| 543 | rtc: rtc, | ||
| 544 | rtc_hse: None, | ||
| 545 | }); | ||
| 546 | } | ||
| 547 | |||
| 548 | struct PllResults { | ||
| 549 | use_pll: bool, | ||
| 550 | pllsysclk: Option<u32>, | ||
| 551 | pll48clk: Option<u32>, | ||
| 552 | #[allow(dead_code)] | ||
| 553 | plli2sclk: Option<u32>, | ||
| 554 | #[allow(dead_code)] | ||
| 555 | pllsaiclk: Option<u32>, | ||
| 556 | } | ||
| 557 | |||
| 558 | mod max { | ||
| 559 | #[cfg(stm32f401)] | ||
| 560 | pub(crate) const SYSCLK_MAX: u32 = 84_000_000; | ||
| 561 | #[cfg(any(stm32f405, stm32f407, stm32f415, stm32f417,))] | ||
| 562 | pub(crate) const SYSCLK_MAX: u32 = 168_000_000; | ||
| 563 | #[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))] | ||
| 564 | pub(crate) const SYSCLK_MAX: u32 = 100_000_000; | ||
| 565 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479,))] | ||
| 566 | pub(crate) const SYSCLK_MAX: u32 = 180_000_000; | ||
| 567 | |||
| 568 | pub(crate) const HCLK_OVERDRIVE_FREQUENCY: u32 = 168_000_000; | ||
| 569 | |||
| 570 | pub(crate) const PCLK1_MAX: u32 = PCLK2_MAX / 2; | ||
| 571 | |||
| 572 | #[cfg(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))] | ||
| 573 | pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX; | ||
| 574 | #[cfg(not(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,)))] | ||
| 575 | pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX / 2; | ||
| 576 | |||
| 577 | pub(crate) const PLL_48_CLK: u32 = 48_000_000; | ||
| 578 | pub(crate) const PLL_48_TOLERANCE: u32 = 120_000; | ||
| 579 | } | ||
diff --git a/embassy-stm32/src/rcc/f4f7.rs b/embassy-stm32/src/rcc/f4f7.rs new file mode 100644 index 000000000..3f9a2be67 --- /dev/null +++ b/embassy-stm32/src/rcc/f4f7.rs | |||
| @@ -0,0 +1,385 @@ | |||
| 1 | pub use crate::pac::rcc::vals::{ | ||
| 2 | Hpre as AHBPrescaler, Pllm as PllPreDiv, Plln as PllMul, Pllp, Pllq, Pllr, Pllsrc as PllSource, | ||
| 3 | Ppre as APBPrescaler, Sw as Sysclk, | ||
| 4 | }; | ||
| 5 | use crate::pac::{FLASH, RCC}; | ||
| 6 | use crate::rcc::{set_freqs, Clocks}; | ||
| 7 | use crate::time::Hertz; | ||
| 8 | |||
| 9 | // TODO: on some F4s, PLLM is shared between all PLLs. Enforce that. | ||
| 10 | // TODO: on some F4s, add support for plli2s_src | ||
| 11 | // | ||
| 12 | // plli2s plli2s_m plli2s_src pllsai pllsai_m | ||
| 13 | // f401 y shared | ||
| 14 | // f410 | ||
| 15 | // f411 y individual | ||
| 16 | // f412 y individual y | ||
| 17 | // f4[12]3 y individual y | ||
| 18 | // f446 y individual y individual | ||
| 19 | // f4[67]9 y shared y shared | ||
| 20 | // f4[23][79] y shared y shared | ||
| 21 | // f4[01][57] y shared | ||
| 22 | |||
| 23 | /// HSI speed | ||
| 24 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 25 | |||
| 26 | #[derive(Clone, Copy, Eq, PartialEq)] | ||
| 27 | pub enum HseMode { | ||
| 28 | /// crystal/ceramic oscillator (HSEBYP=0) | ||
| 29 | Oscillator, | ||
| 30 | /// external analog clock (low swing) (HSEBYP=1) | ||
| 31 | Bypass, | ||
| 32 | } | ||
| 33 | |||
| 34 | #[derive(Clone, Copy, Eq, PartialEq)] | ||
| 35 | pub struct Hse { | ||
| 36 | /// HSE frequency. | ||
| 37 | pub freq: Hertz, | ||
| 38 | /// HSE mode. | ||
| 39 | pub mode: HseMode, | ||
| 40 | } | ||
| 41 | |||
| 42 | #[derive(Clone, Copy)] | ||
| 43 | pub struct Pll { | ||
| 44 | /// PLL pre-divider (DIVM). | ||
| 45 | pub prediv: PllPreDiv, | ||
| 46 | |||
| 47 | /// PLL multiplication factor. | ||
| 48 | pub mul: PllMul, | ||
| 49 | |||
| 50 | /// PLL P division factor. If None, PLL P output is disabled. | ||
| 51 | pub divp: Option<Pllp>, | ||
| 52 | /// PLL Q division factor. If None, PLL Q output is disabled. | ||
| 53 | pub divq: Option<Pllq>, | ||
| 54 | /// PLL R division factor. If None, PLL R output is disabled. | ||
| 55 | pub divr: Option<Pllr>, | ||
| 56 | } | ||
| 57 | |||
| 58 | /// Configuration of the core clocks | ||
| 59 | #[non_exhaustive] | ||
| 60 | pub struct Config { | ||
| 61 | pub hsi: bool, | ||
| 62 | pub hse: Option<Hse>, | ||
| 63 | pub sys: Sysclk, | ||
| 64 | |||
| 65 | pub pll_src: PllSource, | ||
| 66 | |||
| 67 | pub pll: Option<Pll>, | ||
| 68 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 69 | pub plli2s: Option<Pll>, | ||
| 70 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 71 | pub pllsai: Option<Pll>, | ||
| 72 | |||
| 73 | pub ahb_pre: AHBPrescaler, | ||
| 74 | pub apb1_pre: APBPrescaler, | ||
| 75 | pub apb2_pre: APBPrescaler, | ||
| 76 | |||
| 77 | pub ls: super::LsConfig, | ||
| 78 | } | ||
| 79 | |||
| 80 | impl Default for Config { | ||
| 81 | fn default() -> Self { | ||
| 82 | Self { | ||
| 83 | hsi: true, | ||
| 84 | hse: None, | ||
| 85 | sys: Sysclk::HSI, | ||
| 86 | pll_src: PllSource::HSI, | ||
| 87 | pll: None, | ||
| 88 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 89 | plli2s: None, | ||
| 90 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 91 | pllsai: None, | ||
| 92 | |||
| 93 | ahb_pre: AHBPrescaler::DIV1, | ||
| 94 | apb1_pre: APBPrescaler::DIV1, | ||
| 95 | apb2_pre: APBPrescaler::DIV1, | ||
| 96 | |||
| 97 | ls: Default::default(), | ||
| 98 | } | ||
| 99 | } | ||
| 100 | } | ||
| 101 | |||
| 102 | pub(crate) unsafe fn init(config: Config) { | ||
| 103 | // always enable overdrive for now. Make it configurable in the future. | ||
| 104 | #[cfg(not(any( | ||
| 105 | stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423, stm32f405, stm32f407, stm32f415, stm32f417 | ||
| 106 | )))] | ||
| 107 | { | ||
| 108 | use crate::pac::PWR; | ||
| 109 | PWR.cr1().modify(|w| w.set_oden(true)); | ||
| 110 | while !PWR.csr1().read().odrdy() {} | ||
| 111 | |||
| 112 | PWR.cr1().modify(|w| w.set_odswen(true)); | ||
| 113 | while !PWR.csr1().read().odswrdy() {} | ||
| 114 | } | ||
| 115 | |||
| 116 | // Configure HSI | ||
| 117 | let hsi = match config.hsi { | ||
| 118 | false => { | ||
| 119 | RCC.cr().modify(|w| w.set_hsion(false)); | ||
| 120 | None | ||
| 121 | } | ||
| 122 | true => { | ||
| 123 | RCC.cr().modify(|w| w.set_hsion(true)); | ||
| 124 | while !RCC.cr().read().hsirdy() {} | ||
| 125 | Some(HSI_FREQ) | ||
| 126 | } | ||
| 127 | }; | ||
| 128 | |||
| 129 | // Configure HSE | ||
| 130 | let hse = match config.hse { | ||
| 131 | None => { | ||
| 132 | RCC.cr().modify(|w| w.set_hseon(false)); | ||
| 133 | None | ||
| 134 | } | ||
| 135 | Some(hse) => { | ||
| 136 | match hse.mode { | ||
| 137 | HseMode::Bypass => assert!(max::HSE_BYP.contains(&hse.freq)), | ||
| 138 | HseMode::Oscillator => assert!(max::HSE_OSC.contains(&hse.freq)), | ||
| 139 | } | ||
| 140 | |||
| 141 | RCC.cr().modify(|w| w.set_hsebyp(hse.mode != HseMode::Oscillator)); | ||
| 142 | RCC.cr().modify(|w| w.set_hseon(true)); | ||
| 143 | while !RCC.cr().read().hserdy() {} | ||
| 144 | Some(hse.freq) | ||
| 145 | } | ||
| 146 | }; | ||
| 147 | |||
| 148 | // Configure PLLs. | ||
| 149 | let pll_input = PllInput { | ||
| 150 | hse, | ||
| 151 | hsi, | ||
| 152 | source: config.pll_src, | ||
| 153 | }; | ||
| 154 | let pll = init_pll(PllInstance::Pll, config.pll, &pll_input); | ||
| 155 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 156 | let _plli2s = init_pll(PllInstance::Plli2s, config.plli2s, &pll_input); | ||
| 157 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 158 | let _pllsai = init_pll(PllInstance::Pllsai, config.pllsai, &pll_input); | ||
| 159 | |||
| 160 | // Configure sysclk | ||
| 161 | let sys = match config.sys { | ||
| 162 | Sysclk::HSI => unwrap!(hsi), | ||
| 163 | Sysclk::HSE => unwrap!(hse), | ||
| 164 | Sysclk::PLL1_P => unwrap!(pll.p), | ||
| 165 | _ => unreachable!(), | ||
| 166 | }; | ||
| 167 | |||
| 168 | let hclk = sys / config.ahb_pre; | ||
| 169 | let (pclk1, pclk1_tim) = calc_pclk(hclk, config.apb1_pre); | ||
| 170 | let (pclk2, pclk2_tim) = calc_pclk(hclk, config.apb2_pre); | ||
| 171 | |||
| 172 | assert!(max::SYSCLK.contains(&sys)); | ||
| 173 | assert!(max::HCLK.contains(&hclk)); | ||
| 174 | assert!(max::PCLK1.contains(&pclk1)); | ||
| 175 | assert!(max::PCLK2.contains(&pclk2)); | ||
| 176 | |||
| 177 | let rtc = config.ls.init(); | ||
| 178 | |||
| 179 | flash_setup(hclk); | ||
| 180 | |||
| 181 | RCC.cfgr().modify(|w| { | ||
| 182 | w.set_sw(config.sys); | ||
| 183 | w.set_hpre(config.ahb_pre); | ||
| 184 | w.set_ppre1(config.apb1_pre); | ||
| 185 | w.set_ppre2(config.apb2_pre); | ||
| 186 | }); | ||
| 187 | while RCC.cfgr().read().sws() != config.sys {} | ||
| 188 | |||
| 189 | set_freqs(Clocks { | ||
| 190 | sys, | ||
| 191 | hclk1: hclk, | ||
| 192 | hclk2: hclk, | ||
| 193 | hclk3: hclk, | ||
| 194 | pclk1, | ||
| 195 | pclk2, | ||
| 196 | pclk1_tim, | ||
| 197 | pclk2_tim, | ||
| 198 | rtc, | ||
| 199 | pll1_q: pll.q, | ||
| 200 | #[cfg(all(rcc_f4, not(stm32f410)))] | ||
| 201 | plli2s1_q: _plli2s.q, | ||
| 202 | #[cfg(all(rcc_f4, not(stm32f410)))] | ||
| 203 | plli2s1_r: _plli2s.r, | ||
| 204 | |||
| 205 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 206 | pllsai1_q: _pllsai.q, | ||
| 207 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 208 | pllsai1_r: _pllsai.r, | ||
| 209 | }); | ||
| 210 | } | ||
| 211 | |||
| 212 | struct PllInput { | ||
| 213 | source: PllSource, | ||
| 214 | hsi: Option<Hertz>, | ||
| 215 | hse: Option<Hertz>, | ||
| 216 | } | ||
| 217 | |||
| 218 | #[derive(Default)] | ||
| 219 | #[allow(unused)] | ||
| 220 | struct PllOutput { | ||
| 221 | p: Option<Hertz>, | ||
| 222 | q: Option<Hertz>, | ||
| 223 | r: Option<Hertz>, | ||
| 224 | } | ||
| 225 | |||
| 226 | #[derive(PartialEq, Eq, Clone, Copy)] | ||
| 227 | enum PllInstance { | ||
| 228 | Pll, | ||
| 229 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 230 | Plli2s, | ||
| 231 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 232 | Pllsai, | ||
| 233 | } | ||
| 234 | |||
| 235 | fn pll_enable(instance: PllInstance, enabled: bool) { | ||
| 236 | match instance { | ||
| 237 | PllInstance::Pll => { | ||
| 238 | RCC.cr().modify(|w| w.set_pllon(enabled)); | ||
| 239 | while RCC.cr().read().pllrdy() != enabled {} | ||
| 240 | } | ||
| 241 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 242 | PllInstance::Plli2s => { | ||
| 243 | RCC.cr().modify(|w| w.set_plli2son(enabled)); | ||
| 244 | while RCC.cr().read().plli2srdy() != enabled {} | ||
| 245 | } | ||
| 246 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 247 | PllInstance::Pllsai => { | ||
| 248 | RCC.cr().modify(|w| w.set_pllsaion(enabled)); | ||
| 249 | while RCC.cr().read().pllsairdy() != enabled {} | ||
| 250 | } | ||
| 251 | } | ||
| 252 | } | ||
| 253 | |||
| 254 | fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> PllOutput { | ||
| 255 | // Disable PLL | ||
| 256 | pll_enable(instance, false); | ||
| 257 | |||
| 258 | let Some(pll) = config else { return PllOutput::default() }; | ||
| 259 | |||
| 260 | let pll_src = match input.source { | ||
| 261 | PllSource::HSE => input.hse, | ||
| 262 | PllSource::HSI => input.hsi, | ||
| 263 | }; | ||
| 264 | |||
| 265 | let pll_src = pll_src.unwrap(); | ||
| 266 | |||
| 267 | let in_freq = pll_src / pll.prediv; | ||
| 268 | assert!(max::PLL_IN.contains(&in_freq)); | ||
| 269 | let vco_freq = in_freq * pll.mul; | ||
| 270 | assert!(max::PLL_VCO.contains(&vco_freq)); | ||
| 271 | |||
| 272 | let p = pll.divp.map(|div| vco_freq / div); | ||
| 273 | let q = pll.divq.map(|div| vco_freq / div); | ||
| 274 | let r = pll.divr.map(|div| vco_freq / div); | ||
| 275 | |||
| 276 | macro_rules! write_fields { | ||
| 277 | ($w:ident) => { | ||
| 278 | $w.set_plln(pll.mul); | ||
| 279 | if let Some(divp) = pll.divp { | ||
| 280 | $w.set_pllp(divp); | ||
| 281 | } | ||
| 282 | if let Some(divq) = pll.divq { | ||
| 283 | $w.set_pllq(divq); | ||
| 284 | } | ||
| 285 | if let Some(divr) = pll.divr { | ||
| 286 | $w.set_pllr(divr); | ||
| 287 | } | ||
| 288 | }; | ||
| 289 | } | ||
| 290 | |||
| 291 | match instance { | ||
| 292 | PllInstance::Pll => RCC.pllcfgr().write(|w| { | ||
| 293 | w.set_pllm(pll.prediv); | ||
| 294 | w.set_pllsrc(input.source); | ||
| 295 | write_fields!(w); | ||
| 296 | }), | ||
| 297 | #[cfg(any(all(stm32f4, not(stm32f410)), stm32f7))] | ||
| 298 | PllInstance::Plli2s => RCC.plli2scfgr().write(|w| { | ||
| 299 | write_fields!(w); | ||
| 300 | }), | ||
| 301 | #[cfg(any(stm32f446, stm32f427, stm32f437, stm32f4x9, stm32f7))] | ||
| 302 | PllInstance::Pllsai => RCC.pllsaicfgr().write(|w| { | ||
| 303 | write_fields!(w); | ||
| 304 | }), | ||
| 305 | } | ||
| 306 | |||
| 307 | // Enable PLL | ||
| 308 | pll_enable(instance, true); | ||
| 309 | |||
| 310 | PllOutput { p, q, r } | ||
| 311 | } | ||
| 312 | |||
| 313 | fn flash_setup(clk: Hertz) { | ||
| 314 | use crate::pac::flash::vals::Latency; | ||
| 315 | |||
| 316 | // Be conservative with voltage ranges | ||
| 317 | const FLASH_LATENCY_STEP: u32 = 30_000_000; | ||
| 318 | |||
| 319 | let latency = (clk.0 - 1) / FLASH_LATENCY_STEP; | ||
| 320 | debug!("flash: latency={}", latency); | ||
| 321 | |||
| 322 | let latency = Latency::from_bits(latency as u8); | ||
| 323 | FLASH.acr().write(|w| { | ||
| 324 | w.set_latency(latency); | ||
| 325 | }); | ||
| 326 | while FLASH.acr().read().latency() != latency {} | ||
| 327 | } | ||
| 328 | |||
| 329 | fn calc_pclk<D>(hclk: Hertz, ppre: D) -> (Hertz, Hertz) | ||
| 330 | where | ||
| 331 | Hertz: core::ops::Div<D, Output = Hertz>, | ||
| 332 | { | ||
| 333 | let pclk = hclk / ppre; | ||
| 334 | let pclk_tim = if hclk == pclk { pclk } else { pclk * 2u32 }; | ||
| 335 | (pclk, pclk_tim) | ||
| 336 | } | ||
| 337 | |||
| 338 | #[cfg(stm32f7)] | ||
| 339 | mod max { | ||
| 340 | use core::ops::RangeInclusive; | ||
| 341 | |||
| 342 | use crate::time::Hertz; | ||
| 343 | |||
| 344 | pub(crate) const HSE_OSC: RangeInclusive<Hertz> = Hertz(4_000_000)..=Hertz(26_000_000); | ||
| 345 | pub(crate) const HSE_BYP: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(50_000_000); | ||
| 346 | |||
| 347 | pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000); | ||
| 348 | pub(crate) const HCLK: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000); | ||
| 349 | pub(crate) const PCLK1: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000 / 4); | ||
| 350 | pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(12_500_000)..=Hertz(216_000_000 / 2); | ||
| 351 | |||
| 352 | pub(crate) const PLL_IN: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(2_100_000); | ||
| 353 | pub(crate) const PLL_VCO: RangeInclusive<Hertz> = Hertz(100_000_000)..=Hertz(432_000_000); | ||
| 354 | } | ||
| 355 | |||
| 356 | #[cfg(stm32f4)] | ||
| 357 | mod max { | ||
| 358 | use core::ops::RangeInclusive; | ||
| 359 | |||
| 360 | use crate::time::Hertz; | ||
| 361 | |||
| 362 | pub(crate) const HSE_OSC: RangeInclusive<Hertz> = Hertz(4_000_000)..=Hertz(26_000_000); | ||
| 363 | pub(crate) const HSE_BYP: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(50_000_000); | ||
| 364 | |||
| 365 | #[cfg(stm32f401)] | ||
| 366 | pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(84_000_000); | ||
| 367 | #[cfg(any(stm32f405, stm32f407, stm32f415, stm32f417,))] | ||
| 368 | pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(168_000_000); | ||
| 369 | #[cfg(any(stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))] | ||
| 370 | pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(100_000_000); | ||
| 371 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479,))] | ||
| 372 | pub(crate) const SYSCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(180_000_000); | ||
| 373 | |||
| 374 | pub(crate) const HCLK: RangeInclusive<Hertz> = Hertz(0)..=Hertz(SYSCLK.end().0); | ||
| 375 | |||
| 376 | pub(crate) const PCLK1: RangeInclusive<Hertz> = Hertz(0)..=Hertz(PCLK2.end().0 / 2); | ||
| 377 | |||
| 378 | #[cfg(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,))] | ||
| 379 | pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(0)..=Hertz(HCLK.end().0); | ||
| 380 | #[cfg(not(any(stm32f401, stm32f410, stm32f411, stm32f412, stm32f413, stm32f423,)))] | ||
| 381 | pub(crate) const PCLK2: RangeInclusive<Hertz> = Hertz(0)..=Hertz(HCLK.end().0 / 2); | ||
| 382 | |||
| 383 | pub(crate) const PLL_IN: RangeInclusive<Hertz> = Hertz(1_000_000)..=Hertz(2_100_000); | ||
| 384 | pub(crate) const PLL_VCO: RangeInclusive<Hertz> = Hertz(100_000_000)..=Hertz(432_000_000); | ||
| 385 | } | ||
diff --git a/embassy-stm32/src/rcc/f7.rs b/embassy-stm32/src/rcc/f7.rs deleted file mode 100644 index f32559e26..000000000 --- a/embassy-stm32/src/rcc/f7.rs +++ /dev/null | |||
| @@ -1,323 +0,0 @@ | |||
| 1 | use crate::pac::pwr::vals::Vos; | ||
| 2 | use crate::pac::rcc::vals::{Hpre, Ppre, Sw}; | ||
| 3 | use crate::pac::{FLASH, PWR, RCC}; | ||
| 4 | use crate::rcc::bd::{BackupDomain, RtcClockSource}; | ||
| 5 | use crate::rcc::{set_freqs, Clocks}; | ||
| 6 | use crate::time::Hertz; | ||
| 7 | |||
| 8 | /// HSI speed | ||
| 9 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 10 | |||
| 11 | /// LSI speed | ||
| 12 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 13 | |||
| 14 | /// Clocks configuration | ||
| 15 | #[non_exhaustive] | ||
| 16 | #[derive(Default)] | ||
| 17 | pub struct Config { | ||
| 18 | pub hse: Option<Hertz>, | ||
| 19 | pub bypass_hse: bool, | ||
| 20 | pub hclk: Option<Hertz>, | ||
| 21 | pub sys_ck: Option<Hertz>, | ||
| 22 | pub pclk1: Option<Hertz>, | ||
| 23 | pub pclk2: Option<Hertz>, | ||
| 24 | |||
| 25 | pub pll48: bool, | ||
| 26 | pub rtc: Option<RtcClockSource>, | ||
| 27 | pub lsi: bool, | ||
| 28 | pub lse: Option<Hertz>, | ||
| 29 | } | ||
| 30 | |||
| 31 | fn setup_pll(pllsrcclk: u32, use_hse: bool, pllsysclk: Option<u32>, pll48clk: bool) -> PllResults { | ||
| 32 | use crate::pac::rcc::vals::{Pllp, Pllsrc}; | ||
| 33 | |||
| 34 | let sysclk = pllsysclk.unwrap_or(pllsrcclk); | ||
| 35 | if pllsysclk.is_none() && !pll48clk { | ||
| 36 | RCC.pllcfgr().modify(|w| w.set_pllsrc(Pllsrc::from_bits(use_hse as u8))); | ||
| 37 | |||
| 38 | return PllResults { | ||
| 39 | use_pll: false, | ||
| 40 | pllsysclk: None, | ||
| 41 | pll48clk: None, | ||
| 42 | }; | ||
| 43 | } | ||
| 44 | // Input divisor from PLL source clock, must result to frequency in | ||
| 45 | // the range from 1 to 2 MHz | ||
| 46 | let pllm_min = (pllsrcclk + 1_999_999) / 2_000_000; | ||
| 47 | let pllm_max = pllsrcclk / 1_000_000; | ||
| 48 | |||
| 49 | // Sysclk output divisor must be one of 2, 4, 6 or 8 | ||
| 50 | let sysclk_div = core::cmp::min(8, (432_000_000 / sysclk) & !1); | ||
| 51 | |||
| 52 | let target_freq = if pll48clk { 48_000_000 } else { sysclk * sysclk_div }; | ||
| 53 | |||
| 54 | // Find the lowest pllm value that minimize the difference between | ||
| 55 | // target frequency and the real vco_out frequency. | ||
| 56 | let pllm = unwrap!((pllm_min..=pllm_max).min_by_key(|pllm| { | ||
| 57 | let vco_in = pllsrcclk / pllm; | ||
| 58 | let plln = target_freq / vco_in; | ||
| 59 | target_freq - vco_in * plln | ||
| 60 | })); | ||
| 61 | |||
| 62 | let vco_in = pllsrcclk / pllm; | ||
| 63 | assert!((1_000_000..=2_000_000).contains(&vco_in)); | ||
| 64 | |||
| 65 | // Main scaler, must result in >= 100MHz (>= 192MHz for F401) | ||
| 66 | // and <= 432MHz, min 50, max 432 | ||
| 67 | let plln = if pll48clk { | ||
| 68 | // try the different valid pllq according to the valid | ||
| 69 | // main scaller values, and take the best | ||
| 70 | let pllq = unwrap!((4..=9).min_by_key(|pllq| { | ||
| 71 | let plln = 48_000_000 * pllq / vco_in; | ||
| 72 | let pll48_diff = 48_000_000 - vco_in * plln / pllq; | ||
| 73 | let sysclk_diff = (sysclk as i32 - (vco_in * plln / sysclk_div) as i32).abs(); | ||
| 74 | (pll48_diff, sysclk_diff) | ||
| 75 | })); | ||
| 76 | 48_000_000 * pllq / vco_in | ||
| 77 | } else { | ||
| 78 | sysclk * sysclk_div / vco_in | ||
| 79 | }; | ||
| 80 | |||
| 81 | let pllp = (sysclk_div / 2) - 1; | ||
| 82 | |||
| 83 | let pllq = (vco_in * plln + 47_999_999) / 48_000_000; | ||
| 84 | let real_pll48clk = vco_in * plln / pllq; | ||
| 85 | |||
| 86 | RCC.pllcfgr().modify(|w| { | ||
| 87 | w.set_pllm(pllm as u8); | ||
| 88 | w.set_plln(plln as u16); | ||
| 89 | w.set_pllp(Pllp::from_bits(pllp as u8)); | ||
| 90 | w.set_pllq(pllq as u8); | ||
| 91 | w.set_pllsrc(Pllsrc::from_bits(use_hse as u8)); | ||
| 92 | }); | ||
| 93 | |||
| 94 | let real_pllsysclk = vco_in * plln / sysclk_div; | ||
| 95 | |||
| 96 | PllResults { | ||
| 97 | use_pll: true, | ||
| 98 | pllsysclk: Some(real_pllsysclk), | ||
| 99 | pll48clk: if pll48clk { Some(real_pll48clk) } else { None }, | ||
| 100 | } | ||
| 101 | } | ||
| 102 | |||
| 103 | fn flash_setup(sysclk: u32) { | ||
| 104 | use crate::pac::flash::vals::Latency; | ||
| 105 | |||
| 106 | // Be conservative with voltage ranges | ||
| 107 | const FLASH_LATENCY_STEP: u32 = 30_000_000; | ||
| 108 | |||
| 109 | critical_section::with(|_| { | ||
| 110 | FLASH | ||
| 111 | .acr() | ||
| 112 | .modify(|w| w.set_latency(Latency::from_bits(((sysclk - 1) / FLASH_LATENCY_STEP) as u8))); | ||
| 113 | }); | ||
| 114 | } | ||
| 115 | |||
| 116 | pub(crate) unsafe fn init(config: Config) { | ||
| 117 | if let Some(hse) = config.hse { | ||
| 118 | if config.bypass_hse { | ||
| 119 | assert!((max::HSE_BYPASS_MIN..=max::HSE_BYPASS_MAX).contains(&hse.0)); | ||
| 120 | } else { | ||
| 121 | assert!((max::HSE_OSC_MIN..=max::HSE_OSC_MAX).contains(&hse.0)); | ||
| 122 | } | ||
| 123 | } | ||
| 124 | |||
| 125 | let pllsrcclk = config.hse.map(|hse| hse.0).unwrap_or(HSI_FREQ.0); | ||
| 126 | let sysclk = config.sys_ck.map(|sys| sys.0).unwrap_or(pllsrcclk); | ||
| 127 | let sysclk_on_pll = sysclk != pllsrcclk; | ||
| 128 | |||
| 129 | assert!((max::SYSCLK_MIN..=max::SYSCLK_MAX).contains(&sysclk)); | ||
| 130 | |||
| 131 | let plls = setup_pll( | ||
| 132 | pllsrcclk, | ||
| 133 | config.hse.is_some(), | ||
| 134 | if sysclk_on_pll { Some(sysclk) } else { None }, | ||
| 135 | config.pll48, | ||
| 136 | ); | ||
| 137 | |||
| 138 | if config.pll48 { | ||
| 139 | let freq = unwrap!(plls.pll48clk); | ||
| 140 | |||
| 141 | assert!((max::PLL_48_CLK as i32 - freq as i32).abs() <= max::PLL_48_TOLERANCE as i32); | ||
| 142 | } | ||
| 143 | |||
| 144 | let sysclk = if sysclk_on_pll { unwrap!(plls.pllsysclk) } else { sysclk }; | ||
| 145 | |||
| 146 | // AHB prescaler | ||
| 147 | let hclk = config.hclk.map(|h| h.0).unwrap_or(sysclk); | ||
| 148 | let (hpre_bits, hpre_div) = match (sysclk + hclk - 1) / hclk { | ||
| 149 | 0 => unreachable!(), | ||
| 150 | 1 => (Hpre::DIV1, 1), | ||
| 151 | 2 => (Hpre::DIV2, 2), | ||
| 152 | 3..=5 => (Hpre::DIV4, 4), | ||
| 153 | 6..=11 => (Hpre::DIV8, 8), | ||
| 154 | 12..=39 => (Hpre::DIV16, 16), | ||
| 155 | 40..=95 => (Hpre::DIV64, 64), | ||
| 156 | 96..=191 => (Hpre::DIV128, 128), | ||
| 157 | 192..=383 => (Hpre::DIV256, 256), | ||
| 158 | _ => (Hpre::DIV512, 512), | ||
| 159 | }; | ||
| 160 | |||
| 161 | // Calculate real AHB clock | ||
| 162 | let hclk = sysclk / hpre_div; | ||
| 163 | |||
| 164 | assert!(hclk <= max::HCLK_MAX); | ||
| 165 | |||
| 166 | let pclk1 = config | ||
| 167 | .pclk1 | ||
| 168 | .map(|p| p.0) | ||
| 169 | .unwrap_or_else(|| core::cmp::min(max::PCLK1_MAX, hclk)); | ||
| 170 | |||
| 171 | let (ppre1_bits, ppre1) = match (hclk + pclk1 - 1) / pclk1 { | ||
| 172 | 0 => unreachable!(), | ||
| 173 | 1 => (0b000, 1), | ||
| 174 | 2 => (0b100, 2), | ||
| 175 | 3..=5 => (0b101, 4), | ||
| 176 | 6..=11 => (0b110, 8), | ||
| 177 | _ => (0b111, 16), | ||
| 178 | }; | ||
| 179 | let timer_mul1 = if ppre1 == 1 { 1 } else { 2 }; | ||
| 180 | |||
| 181 | // Calculate real APB1 clock | ||
| 182 | let pclk1 = hclk / ppre1; | ||
| 183 | assert!((max::PCLK1_MIN..=max::PCLK1_MAX).contains(&pclk1)); | ||
| 184 | |||
| 185 | let pclk2 = config | ||
| 186 | .pclk2 | ||
| 187 | .map(|p| p.0) | ||
| 188 | .unwrap_or_else(|| core::cmp::min(max::PCLK2_MAX, hclk)); | ||
| 189 | let (ppre2_bits, ppre2) = match (hclk + pclk2 - 1) / pclk2 { | ||
| 190 | 0 => unreachable!(), | ||
| 191 | 1 => (0b000, 1), | ||
| 192 | 2 => (0b100, 2), | ||
| 193 | 3..=5 => (0b101, 4), | ||
| 194 | 6..=11 => (0b110, 8), | ||
| 195 | _ => (0b111, 16), | ||
| 196 | }; | ||
| 197 | let timer_mul2 = if ppre2 == 1 { 1 } else { 2 }; | ||
| 198 | |||
| 199 | // Calculate real APB2 clock | ||
| 200 | let pclk2 = hclk / ppre2; | ||
| 201 | assert!((max::PCLK2_MIN..=max::PCLK2_MAX).contains(&pclk2)); | ||
| 202 | |||
| 203 | flash_setup(sysclk); | ||
| 204 | |||
| 205 | if config.hse.is_some() { | ||
| 206 | RCC.cr().modify(|w| { | ||
| 207 | w.set_hsebyp(config.bypass_hse); | ||
| 208 | w.set_hseon(true); | ||
| 209 | }); | ||
| 210 | while !RCC.cr().read().hserdy() {} | ||
| 211 | } | ||
| 212 | |||
| 213 | if plls.use_pll { | ||
| 214 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 215 | |||
| 216 | // setup VOSScale | ||
| 217 | let vos_scale = if sysclk <= 144_000_000 { | ||
| 218 | 3 | ||
| 219 | } else if sysclk <= 168_000_000 { | ||
| 220 | 2 | ||
| 221 | } else { | ||
| 222 | 1 | ||
| 223 | }; | ||
| 224 | PWR.cr1().modify(|w| { | ||
| 225 | w.set_vos(match vos_scale { | ||
| 226 | 3 => Vos::SCALE3, | ||
| 227 | 2 => Vos::SCALE2, | ||
| 228 | 1 => Vos::SCALE1, | ||
| 229 | _ => panic!("Invalid VOS Scale."), | ||
| 230 | }) | ||
| 231 | }); | ||
| 232 | |||
| 233 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 234 | |||
| 235 | if hclk > max::HCLK_OVERDRIVE_FREQUENCY { | ||
| 236 | PWR.cr1().modify(|w| w.set_oden(true)); | ||
| 237 | while !PWR.csr1().read().odrdy() {} | ||
| 238 | |||
| 239 | PWR.cr1().modify(|w| w.set_odswen(true)); | ||
| 240 | while !PWR.csr1().read().odswrdy() {} | ||
| 241 | } | ||
| 242 | |||
| 243 | while !RCC.cr().read().pllrdy() {} | ||
| 244 | } | ||
| 245 | |||
| 246 | RCC.cfgr().modify(|w| { | ||
| 247 | w.set_ppre2(Ppre::from_bits(ppre2_bits)); | ||
| 248 | w.set_ppre1(Ppre::from_bits(ppre1_bits)); | ||
| 249 | w.set_hpre(hpre_bits); | ||
| 250 | }); | ||
| 251 | |||
| 252 | // Wait for the new prescalers to kick in | ||
| 253 | // "The clocks are divided with the new prescaler factor from 1 to 16 AHB cycles after write" | ||
| 254 | cortex_m::asm::delay(16); | ||
| 255 | |||
| 256 | RCC.cfgr().modify(|w| { | ||
| 257 | w.set_sw(if sysclk_on_pll { | ||
| 258 | Sw::PLL | ||
| 259 | } else if config.hse.is_some() { | ||
| 260 | Sw::HSE | ||
| 261 | } else { | ||
| 262 | Sw::HSI | ||
| 263 | }) | ||
| 264 | }); | ||
| 265 | |||
| 266 | BackupDomain::configure_ls( | ||
| 267 | config.rtc.unwrap_or(RtcClockSource::NOCLOCK), | ||
| 268 | config.lsi, | ||
| 269 | config.lse.map(|_| Default::default()), | ||
| 270 | ); | ||
| 271 | |||
| 272 | let rtc = match config.rtc { | ||
| 273 | Some(RtcClockSource::LSI) => Some(LSI_FREQ), | ||
| 274 | Some(RtcClockSource::LSE) => Some(config.lse.unwrap()), | ||
| 275 | _ => None, | ||
| 276 | }; | ||
| 277 | |||
| 278 | set_freqs(Clocks { | ||
| 279 | sys: Hertz(sysclk), | ||
| 280 | apb1: Hertz(pclk1), | ||
| 281 | apb2: Hertz(pclk2), | ||
| 282 | |||
| 283 | apb1_tim: Hertz(pclk1 * timer_mul1), | ||
| 284 | apb2_tim: Hertz(pclk2 * timer_mul2), | ||
| 285 | |||
| 286 | ahb1: Hertz(hclk), | ||
| 287 | ahb2: Hertz(hclk), | ||
| 288 | ahb3: Hertz(hclk), | ||
| 289 | |||
| 290 | pll48: plls.pll48clk.map(Hertz), | ||
| 291 | |||
| 292 | rtc, | ||
| 293 | }); | ||
| 294 | } | ||
| 295 | |||
| 296 | struct PllResults { | ||
| 297 | use_pll: bool, | ||
| 298 | pllsysclk: Option<u32>, | ||
| 299 | pll48clk: Option<u32>, | ||
| 300 | } | ||
| 301 | |||
| 302 | mod max { | ||
| 303 | pub(crate) const HSE_OSC_MIN: u32 = 4_000_000; | ||
| 304 | pub(crate) const HSE_OSC_MAX: u32 = 26_000_000; | ||
| 305 | pub(crate) const HSE_BYPASS_MIN: u32 = 1_000_000; | ||
| 306 | pub(crate) const HSE_BYPASS_MAX: u32 = 50_000_000; | ||
| 307 | |||
| 308 | pub(crate) const HCLK_MAX: u32 = 216_000_000; | ||
| 309 | pub(crate) const HCLK_OVERDRIVE_FREQUENCY: u32 = 180_000_000; | ||
| 310 | |||
| 311 | pub(crate) const SYSCLK_MIN: u32 = 12_500_000; | ||
| 312 | pub(crate) const SYSCLK_MAX: u32 = 216_000_000; | ||
| 313 | |||
| 314 | pub(crate) const PCLK1_MIN: u32 = SYSCLK_MIN; | ||
| 315 | pub(crate) const PCLK1_MAX: u32 = SYSCLK_MAX / 4; | ||
| 316 | |||
| 317 | pub(crate) const PCLK2_MIN: u32 = SYSCLK_MIN; | ||
| 318 | pub(crate) const PCLK2_MAX: u32 = SYSCLK_MAX / 2; | ||
| 319 | |||
| 320 | // USB specification allows +-0.25% | ||
| 321 | pub(crate) const PLL_48_CLK: u32 = 48_000_000; | ||
| 322 | pub(crate) const PLL_48_TOLERANCE: u32 = 120_000; | ||
| 323 | } | ||
diff --git a/embassy-stm32/src/rcc/g0.rs b/embassy-stm32/src/rcc/g0.rs index 7f0a2c7fb..85ebd32e1 100644 --- a/embassy-stm32/src/rcc/g0.rs +++ b/embassy-stm32/src/rcc/g0.rs | |||
| @@ -1,6 +1,8 @@ | |||
| 1 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 2 | use crate::pac::flash::vals::Latency; | 1 | use crate::pac::flash::vals::Latency; |
| 3 | use crate::pac::rcc::vals::{self, Hsidiv, Ppre, Sw}; | 2 | use crate::pac::rcc::vals::{self, Sw}; |
| 3 | pub use crate::pac::rcc::vals::{ | ||
| 4 | Hpre as AHBPrescaler, Hsidiv as HSI16Prescaler, Pllm, Plln, Pllp, Pllq, Pllr, Ppre as APBPrescaler, | ||
| 5 | }; | ||
| 4 | use crate::pac::{FLASH, PWR, RCC}; | 6 | use crate::pac::{FLASH, PWR, RCC}; |
| 5 | use crate::rcc::{set_freqs, Clocks}; | 7 | use crate::rcc::{set_freqs, Clocks}; |
| 6 | use crate::time::Hertz; | 8 | use crate::time::Hertz; |
| @@ -8,9 +10,6 @@ use crate::time::Hertz; | |||
| 8 | /// HSI speed | 10 | /// HSI speed |
| 9 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 11 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 10 | 12 | ||
| 11 | /// LSI speed | ||
| 12 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 13 | |||
| 14 | /// System clock mux source | 13 | /// System clock mux source |
| 15 | #[derive(Clone, Copy)] | 14 | #[derive(Clone, Copy)] |
| 16 | pub enum ClockSrc { | 15 | pub enum ClockSrc { |
| @@ -20,33 +19,6 @@ pub enum ClockSrc { | |||
| 20 | LSI, | 19 | LSI, |
| 21 | } | 20 | } |
| 22 | 21 | ||
| 23 | #[derive(Clone, Copy)] | ||
| 24 | pub enum HSI16Prescaler { | ||
| 25 | NotDivided, | ||
| 26 | Div2, | ||
| 27 | Div4, | ||
| 28 | Div8, | ||
| 29 | Div16, | ||
| 30 | Div32, | ||
| 31 | Div64, | ||
| 32 | Div128, | ||
| 33 | } | ||
| 34 | |||
| 35 | impl Into<Hsidiv> for HSI16Prescaler { | ||
| 36 | fn into(self) -> Hsidiv { | ||
| 37 | match self { | ||
| 38 | HSI16Prescaler::NotDivided => Hsidiv::DIV1, | ||
| 39 | HSI16Prescaler::Div2 => Hsidiv::DIV2, | ||
| 40 | HSI16Prescaler::Div4 => Hsidiv::DIV4, | ||
| 41 | HSI16Prescaler::Div8 => Hsidiv::DIV8, | ||
| 42 | HSI16Prescaler::Div16 => Hsidiv::DIV16, | ||
| 43 | HSI16Prescaler::Div32 => Hsidiv::DIV32, | ||
| 44 | HSI16Prescaler::Div64 => Hsidiv::DIV64, | ||
| 45 | HSI16Prescaler::Div128 => Hsidiv::DIV128, | ||
| 46 | } | ||
| 47 | } | ||
| 48 | } | ||
| 49 | |||
| 50 | /// The PLL configuration. | 22 | /// The PLL configuration. |
| 51 | /// | 23 | /// |
| 52 | /// * `VCOCLK = source / m * n` | 24 | /// * `VCOCLK = source / m * n` |
| @@ -60,15 +32,15 @@ pub struct PllConfig { | |||
| 60 | /// The initial divisor of that clock signal | 32 | /// The initial divisor of that clock signal |
| 61 | pub m: Pllm, | 33 | pub m: Pllm, |
| 62 | /// The PLL VCO multiplier, which must be in the range `8..=86`. | 34 | /// The PLL VCO multiplier, which must be in the range `8..=86`. |
| 63 | pub n: u8, | 35 | pub n: Plln, |
| 64 | /// The final divisor for `PLLRCLK` output which drives the system clock | 36 | /// The final divisor for `PLLRCLK` output which drives the system clock |
| 65 | pub r: Pllr, | 37 | pub r: Pllr, |
| 66 | 38 | ||
| 67 | /// The divisor for the `PLLQCLK` output, if desired | 39 | /// The divisor for the `PLLQCLK` output, if desired |
| 68 | pub q: Option<Pllr>, | 40 | pub q: Option<Pllq>, |
| 69 | 41 | ||
| 70 | /// The divisor for the `PLLPCLK` output, if desired | 42 | /// The divisor for the `PLLPCLK` output, if desired |
| 71 | pub p: Option<Pllr>, | 43 | pub p: Option<Pllp>, |
| 72 | } | 44 | } |
| 73 | 45 | ||
| 74 | impl Default for PllConfig { | 46 | impl Default for PllConfig { |
| @@ -77,9 +49,9 @@ impl Default for PllConfig { | |||
| 77 | // HSI16 / 1 * 8 / 2 = 64 MHz | 49 | // HSI16 / 1 * 8 / 2 = 64 MHz |
| 78 | PllConfig { | 50 | PllConfig { |
| 79 | source: PllSrc::HSI16, | 51 | source: PllSrc::HSI16, |
| 80 | m: Pllm::Div1, | 52 | m: Pllm::DIV1, |
| 81 | n: 8, | 53 | n: Plln::MUL8, |
| 82 | r: Pllr::Div2, | 54 | r: Pllr::DIV2, |
| 83 | q: None, | 55 | q: None, |
| 84 | p: None, | 56 | p: None, |
| 85 | } | 57 | } |
| @@ -92,131 +64,51 @@ pub enum PllSrc { | |||
| 92 | HSE(Hertz), | 64 | HSE(Hertz), |
| 93 | } | 65 | } |
| 94 | 66 | ||
| 95 | #[derive(Clone, Copy)] | ||
| 96 | pub enum Pllm { | ||
| 97 | Div1, | ||
| 98 | Div2, | ||
| 99 | Div3, | ||
| 100 | Div4, | ||
| 101 | Div5, | ||
| 102 | Div6, | ||
| 103 | Div7, | ||
| 104 | Div8, | ||
| 105 | } | ||
| 106 | |||
| 107 | impl From<Pllm> for u8 { | ||
| 108 | fn from(v: Pllm) -> Self { | ||
| 109 | match v { | ||
| 110 | Pllm::Div1 => 0b000, | ||
| 111 | Pllm::Div2 => 0b001, | ||
| 112 | Pllm::Div3 => 0b010, | ||
| 113 | Pllm::Div4 => 0b011, | ||
| 114 | Pllm::Div5 => 0b100, | ||
| 115 | Pllm::Div6 => 0b101, | ||
| 116 | Pllm::Div7 => 0b110, | ||
| 117 | Pllm::Div8 => 0b111, | ||
| 118 | } | ||
| 119 | } | ||
| 120 | } | ||
| 121 | |||
| 122 | impl From<Pllm> for u32 { | ||
| 123 | fn from(v: Pllm) -> Self { | ||
| 124 | match v { | ||
| 125 | Pllm::Div1 => 1, | ||
| 126 | Pllm::Div2 => 2, | ||
| 127 | Pllm::Div3 => 3, | ||
| 128 | Pllm::Div4 => 4, | ||
| 129 | Pllm::Div5 => 5, | ||
| 130 | Pllm::Div6 => 6, | ||
| 131 | Pllm::Div7 => 7, | ||
| 132 | Pllm::Div8 => 8, | ||
| 133 | } | ||
| 134 | } | ||
| 135 | } | ||
| 136 | |||
| 137 | #[derive(Clone, Copy)] | ||
| 138 | pub enum Pllr { | ||
| 139 | Div2, | ||
| 140 | Div3, | ||
| 141 | Div4, | ||
| 142 | Div5, | ||
| 143 | Div6, | ||
| 144 | Div7, | ||
| 145 | Div8, | ||
| 146 | } | ||
| 147 | |||
| 148 | impl From<Pllr> for u8 { | ||
| 149 | fn from(v: Pllr) -> Self { | ||
| 150 | match v { | ||
| 151 | Pllr::Div2 => 0b000, | ||
| 152 | Pllr::Div3 => 0b001, | ||
| 153 | Pllr::Div4 => 0b010, | ||
| 154 | Pllr::Div5 => 0b011, | ||
| 155 | Pllr::Div6 => 0b101, | ||
| 156 | Pllr::Div7 => 0b110, | ||
| 157 | Pllr::Div8 => 0b111, | ||
| 158 | } | ||
| 159 | } | ||
| 160 | } | ||
| 161 | |||
| 162 | impl From<Pllr> for u32 { | ||
| 163 | fn from(v: Pllr) -> Self { | ||
| 164 | match v { | ||
| 165 | Pllr::Div2 => 2, | ||
| 166 | Pllr::Div3 => 3, | ||
| 167 | Pllr::Div4 => 4, | ||
| 168 | Pllr::Div5 => 5, | ||
| 169 | Pllr::Div6 => 6, | ||
| 170 | Pllr::Div7 => 7, | ||
| 171 | Pllr::Div8 => 8, | ||
| 172 | } | ||
| 173 | } | ||
| 174 | } | ||
| 175 | |||
| 176 | /// Clocks configutation | 67 | /// Clocks configutation |
| 177 | pub struct Config { | 68 | pub struct Config { |
| 178 | pub mux: ClockSrc, | 69 | pub mux: ClockSrc, |
| 179 | pub ahb_pre: AHBPrescaler, | 70 | pub ahb_pre: AHBPrescaler, |
| 180 | pub apb_pre: APBPrescaler, | 71 | pub apb_pre: APBPrescaler, |
| 181 | pub low_power_run: bool, | 72 | pub low_power_run: bool, |
| 73 | pub ls: super::LsConfig, | ||
| 182 | } | 74 | } |
| 183 | 75 | ||
| 184 | impl Default for Config { | 76 | impl Default for Config { |
| 185 | #[inline] | 77 | #[inline] |
| 186 | fn default() -> Config { | 78 | fn default() -> Config { |
| 187 | Config { | 79 | Config { |
| 188 | mux: ClockSrc::HSI16(HSI16Prescaler::NotDivided), | 80 | mux: ClockSrc::HSI16(HSI16Prescaler::DIV1), |
| 189 | ahb_pre: AHBPrescaler::DIV1, | 81 | ahb_pre: AHBPrescaler::DIV1, |
| 190 | apb_pre: APBPrescaler::DIV1, | 82 | apb_pre: APBPrescaler::DIV1, |
| 191 | low_power_run: false, | 83 | low_power_run: false, |
| 84 | ls: Default::default(), | ||
| 192 | } | 85 | } |
| 193 | } | 86 | } |
| 194 | } | 87 | } |
| 195 | 88 | ||
| 196 | impl PllConfig { | 89 | impl PllConfig { |
| 197 | pub(crate) fn init(self) -> u32 { | 90 | pub(crate) fn init(self) -> Hertz { |
| 198 | assert!(self.n >= 8 && self.n <= 86); | ||
| 199 | let (src, input_freq) = match self.source { | 91 | let (src, input_freq) = match self.source { |
| 200 | PllSrc::HSI16 => (vals::Pllsrc::HSI16, HSI_FREQ.0), | 92 | PllSrc::HSI16 => (vals::Pllsrc::HSI, HSI_FREQ), |
| 201 | PllSrc::HSE(freq) => (vals::Pllsrc::HSE, freq.0), | 93 | PllSrc::HSE(freq) => (vals::Pllsrc::HSE, freq), |
| 202 | }; | 94 | }; |
| 203 | 95 | ||
| 204 | let m_freq = input_freq / u32::from(self.m); | 96 | let m_freq = input_freq / self.m; |
| 205 | // RM0454 § 5.4.4: | 97 | // RM0454 § 5.4.4: |
| 206 | // > Caution: The software must set these bits so that the PLL input frequency after the | 98 | // > Caution: The software must set these bits so that the PLL input frequency after the |
| 207 | // > /M divider is between 2.66 and 16 MHz. | 99 | // > /M divider is between 2.66 and 16 MHz. |
| 208 | debug_assert!(m_freq >= 2_660_000 && m_freq <= 16_000_000); | 100 | debug_assert!(m_freq.0 >= 2_660_000 && m_freq.0 <= 16_000_000); |
| 209 | 101 | ||
| 210 | let n_freq = m_freq * self.n as u32; | 102 | let n_freq = m_freq * self.n as u32; |
| 211 | // RM0454 § 5.4.4: | 103 | // RM0454 § 5.4.4: |
| 212 | // > Caution: The software must set these bits so that the VCO output frequency is between | 104 | // > Caution: The software must set these bits so that the VCO output frequency is between |
| 213 | // > 64 and 344 MHz. | 105 | // > 64 and 344 MHz. |
| 214 | debug_assert!(n_freq >= 64_000_000 && n_freq <= 344_000_000); | 106 | debug_assert!(n_freq.0 >= 64_000_000 && n_freq.0 <= 344_000_000); |
| 215 | 107 | ||
| 216 | let r_freq = n_freq / u32::from(self.r); | 108 | let r_freq = n_freq / self.r; |
| 217 | // RM0454 § 5.4.4: | 109 | // RM0454 § 5.4.4: |
| 218 | // > Caution: The software must set this bitfield so as not to exceed 64 MHz on this clock. | 110 | // > Caution: The software must set this bitfield so as not to exceed 64 MHz on this clock. |
| 219 | debug_assert!(r_freq <= 64_000_000); | 111 | debug_assert!(r_freq.0 <= 64_000_000); |
| 220 | 112 | ||
| 221 | // RM0454 § 5.2.3: | 113 | // RM0454 § 5.2.3: |
| 222 | // > To modify the PLL configuration, proceed as follows: | 114 | // > To modify the PLL configuration, proceed as follows: |
| @@ -239,25 +131,16 @@ impl PllConfig { | |||
| 239 | } | 131 | } |
| 240 | } | 132 | } |
| 241 | 133 | ||
| 242 | // Configure PLLSYSCFGR | 134 | // Configure PLLCFGR |
| 243 | RCC.pllsyscfgr().modify(|w| { | 135 | RCC.pllcfgr().modify(|w| { |
| 244 | w.set_pllr(u8::from(self.r)); | 136 | w.set_pllr(self.r); |
| 245 | w.set_pllren(false); | 137 | w.set_pllren(false); |
| 246 | 138 | w.set_pllq(self.q.unwrap_or(Pllq::DIV2)); | |
| 247 | if let Some(q) = self.q { | ||
| 248 | w.set_pllq(u8::from(q)); | ||
| 249 | } | ||
| 250 | w.set_pllqen(false); | 139 | w.set_pllqen(false); |
| 251 | 140 | w.set_pllp(self.p.unwrap_or(Pllp::DIV2)); | |
| 252 | if let Some(p) = self.p { | ||
| 253 | w.set_pllp(u8::from(p)); | ||
| 254 | } | ||
| 255 | w.set_pllpen(false); | 141 | w.set_pllpen(false); |
| 256 | |||
| 257 | w.set_plln(self.n); | 142 | w.set_plln(self.n); |
| 258 | 143 | w.set_pllm(self.m); | |
| 259 | w.set_pllm(self.m as u8); | ||
| 260 | |||
| 261 | w.set_pllsrc(src) | 144 | w.set_pllsrc(src) |
| 262 | }); | 145 | }); |
| 263 | 146 | ||
| @@ -269,7 +152,7 @@ impl PllConfig { | |||
| 269 | 152 | ||
| 270 | // > 5. Enable the desired PLL outputs by configuring PLLPEN, PLLQEN, and PLLREN in PLL | 153 | // > 5. Enable the desired PLL outputs by configuring PLLPEN, PLLQEN, and PLLREN in PLL |
| 271 | // > configuration register (RCC_PLLCFGR). | 154 | // > configuration register (RCC_PLLCFGR). |
| 272 | RCC.pllsyscfgr().modify(|w| { | 155 | RCC.pllcfgr().modify(|w| { |
| 273 | // We'll use R for system clock, so enable that unconditionally | 156 | // We'll use R for system clock, so enable that unconditionally |
| 274 | w.set_pllren(true); | 157 | w.set_pllren(true); |
| 275 | 158 | ||
| @@ -286,39 +169,38 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 286 | let (sys_clk, sw) = match config.mux { | 169 | let (sys_clk, sw) = match config.mux { |
| 287 | ClockSrc::HSI16(div) => { | 170 | ClockSrc::HSI16(div) => { |
| 288 | // Enable HSI16 | 171 | // Enable HSI16 |
| 289 | let div: Hsidiv = div.into(); | ||
| 290 | RCC.cr().write(|w| { | 172 | RCC.cr().write(|w| { |
| 291 | w.set_hsidiv(div); | 173 | w.set_hsidiv(div); |
| 292 | w.set_hsion(true) | 174 | w.set_hsion(true) |
| 293 | }); | 175 | }); |
| 294 | while !RCC.cr().read().hsirdy() {} | 176 | while !RCC.cr().read().hsirdy() {} |
| 295 | 177 | ||
| 296 | (HSI_FREQ.0 >> div.to_bits(), Sw::HSI) | 178 | (HSI_FREQ / div, Sw::HSI) |
| 297 | } | 179 | } |
| 298 | ClockSrc::HSE(freq) => { | 180 | ClockSrc::HSE(freq) => { |
| 299 | // Enable HSE | 181 | // Enable HSE |
| 300 | RCC.cr().write(|w| w.set_hseon(true)); | 182 | RCC.cr().write(|w| w.set_hseon(true)); |
| 301 | while !RCC.cr().read().hserdy() {} | 183 | while !RCC.cr().read().hserdy() {} |
| 302 | 184 | ||
| 303 | (freq.0, Sw::HSE) | 185 | (freq, Sw::HSE) |
| 304 | } | 186 | } |
| 305 | ClockSrc::PLL(pll) => { | 187 | ClockSrc::PLL(pll) => { |
| 306 | let freq = pll.init(); | 188 | let freq = pll.init(); |
| 307 | (freq, Sw::PLLRCLK) | 189 | (freq, Sw::PLL1_R) |
| 308 | } | 190 | } |
| 309 | ClockSrc::LSI => { | 191 | ClockSrc::LSI => { |
| 310 | // Enable LSI | 192 | // Enable LSI |
| 311 | RCC.csr().write(|w| w.set_lsion(true)); | 193 | RCC.csr().write(|w| w.set_lsion(true)); |
| 312 | while !RCC.csr().read().lsirdy() {} | 194 | while !RCC.csr().read().lsirdy() {} |
| 313 | (LSI_FREQ.0, Sw::LSI) | 195 | (super::LSI_FREQ, Sw::LSI) |
| 314 | } | 196 | } |
| 315 | }; | 197 | }; |
| 316 | 198 | ||
| 317 | // Determine the flash latency implied by the target clock speed | 199 | // Determine the flash latency implied by the target clock speed |
| 318 | // RM0454 § 3.3.4: | 200 | // RM0454 § 3.3.4: |
| 319 | let target_flash_latency = if sys_clk <= 24_000_000 { | 201 | let target_flash_latency = if sys_clk.0 <= 24_000_000 { |
| 320 | Latency::WS0 | 202 | Latency::WS0 |
| 321 | } else if sys_clk <= 48_000_000 { | 203 | } else if sys_clk.0 <= 48_000_000 { |
| 322 | Latency::WS1 | 204 | Latency::WS1 |
| 323 | } else { | 205 | } else { |
| 324 | Latency::WS2 | 206 | Latency::WS2 |
| @@ -353,7 +235,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 353 | } | 235 | } |
| 354 | 236 | ||
| 355 | // Configure SYSCLK source, HCLK divisor, and PCLK divisor all at once | 237 | // Configure SYSCLK source, HCLK divisor, and PCLK divisor all at once |
| 356 | let (sw, hpre, ppre) = (sw.into(), config.ahb_pre.into(), config.apb_pre.into()); | 238 | let (sw, hpre, ppre) = (sw.into(), config.ahb_pre, config.apb_pre); |
| 357 | RCC.cfgr().modify(|w| { | 239 | RCC.cfgr().modify(|w| { |
| 358 | w.set_sw(sw); | 240 | w.set_sw(sw); |
| 359 | w.set_hpre(hpre); | 241 | w.set_hpre(hpre); |
| @@ -374,27 +256,28 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 374 | FLASH.acr().modify(|w| w.set_latency(target_flash_latency)); | 256 | FLASH.acr().modify(|w| w.set_latency(target_flash_latency)); |
| 375 | } | 257 | } |
| 376 | 258 | ||
| 377 | let ahb_freq = Hertz(sys_clk) / config.ahb_pre; | 259 | let ahb_freq = sys_clk / config.ahb_pre; |
| 378 | 260 | ||
| 379 | let (apb_freq, apb_tim_freq) = match config.apb_pre { | 261 | let (apb_freq, apb_tim_freq) = match config.apb_pre { |
| 380 | APBPrescaler::DIV1 => (ahb_freq.0, ahb_freq.0), | 262 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 381 | pre => { | 263 | pre => { |
| 382 | let pre: Ppre = pre.into(); | 264 | let freq = ahb_freq / pre; |
| 383 | let pre: u8 = 1 << (pre.to_bits() - 3); | 265 | (freq, freq * 2u32) |
| 384 | let freq = ahb_freq.0 / pre as u32; | ||
| 385 | (freq, freq * 2) | ||
| 386 | } | 266 | } |
| 387 | }; | 267 | }; |
| 388 | 268 | ||
| 389 | if config.low_power_run { | 269 | if config.low_power_run { |
| 390 | assert!(sys_clk <= 2_000_000); | 270 | assert!(sys_clk.0 <= 2_000_000); |
| 391 | PWR.cr1().modify(|w| w.set_lpr(true)); | 271 | PWR.cr1().modify(|w| w.set_lpr(true)); |
| 392 | } | 272 | } |
| 393 | 273 | ||
| 274 | let rtc = config.ls.init(); | ||
| 275 | |||
| 394 | set_freqs(Clocks { | 276 | set_freqs(Clocks { |
| 395 | sys: Hertz(sys_clk), | 277 | sys: sys_clk, |
| 396 | ahb1: ahb_freq, | 278 | hclk1: ahb_freq, |
| 397 | apb1: Hertz(apb_freq), | 279 | pclk1: apb_freq, |
| 398 | apb1_tim: Hertz(apb_tim_freq), | 280 | pclk1_tim: apb_tim_freq, |
| 281 | rtc, | ||
| 399 | }); | 282 | }); |
| 400 | } | 283 | } |
diff --git a/embassy-stm32/src/rcc/g4.rs b/embassy-stm32/src/rcc/g4.rs index 41bebc918..ba2a5e19c 100644 --- a/embassy-stm32/src/rcc/g4.rs +++ b/embassy-stm32/src/rcc/g4.rs | |||
| @@ -2,7 +2,10 @@ use stm32_metapac::flash::vals::Latency; | |||
| 2 | use stm32_metapac::rcc::vals::{Adcsel, Pllsrc, Sw}; | 2 | use stm32_metapac::rcc::vals::{Adcsel, Pllsrc, Sw}; |
| 3 | use stm32_metapac::FLASH; | 3 | use stm32_metapac::FLASH; |
| 4 | 4 | ||
| 5 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | 5 | pub use crate::pac::rcc::vals::{ |
| 6 | Adcsel as AdcClockSource, Hpre as AHBPrescaler, Pllm as PllM, Plln as PllN, Pllp as PllP, Pllq as PllQ, | ||
| 7 | Pllr as PllR, Ppre as APBPrescaler, | ||
| 8 | }; | ||
| 6 | use crate::pac::{PWR, RCC}; | 9 | use crate::pac::{PWR, RCC}; |
| 7 | use crate::rcc::sealed::RccPeripheral; | 10 | use crate::rcc::sealed::RccPeripheral; |
| 8 | use crate::rcc::{set_freqs, Clocks}; | 11 | use crate::rcc::{set_freqs, Clocks}; |
| @@ -11,32 +14,6 @@ use crate::time::Hertz; | |||
| 11 | /// HSI speed | 14 | /// HSI speed |
| 12 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 15 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 13 | 16 | ||
| 14 | /// LSI speed | ||
| 15 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 16 | |||
| 17 | #[derive(Clone, Copy)] | ||
| 18 | pub enum AdcClockSource { | ||
| 19 | NoClk, | ||
| 20 | SysClk, | ||
| 21 | PllP, | ||
| 22 | } | ||
| 23 | |||
| 24 | impl AdcClockSource { | ||
| 25 | pub fn adcsel(&self) -> Adcsel { | ||
| 26 | match self { | ||
| 27 | AdcClockSource::NoClk => Adcsel::NOCLK, | ||
| 28 | AdcClockSource::SysClk => Adcsel::SYSCLK, | ||
| 29 | AdcClockSource::PllP => Adcsel::PLLP, | ||
| 30 | } | ||
| 31 | } | ||
| 32 | } | ||
| 33 | |||
| 34 | impl Default for AdcClockSource { | ||
| 35 | fn default() -> Self { | ||
| 36 | Self::NoClk | ||
| 37 | } | ||
| 38 | } | ||
| 39 | |||
| 40 | /// System clock mux source | 17 | /// System clock mux source |
| 41 | #[derive(Clone, Copy)] | 18 | #[derive(Clone, Copy)] |
| 42 | pub enum ClockSrc { | 19 | pub enum ClockSrc { |
| @@ -56,182 +33,7 @@ impl Into<Pllsrc> for PllSrc { | |||
| 56 | fn into(self) -> Pllsrc { | 33 | fn into(self) -> Pllsrc { |
| 57 | match self { | 34 | match self { |
| 58 | PllSrc::HSE(..) => Pllsrc::HSE, | 35 | PllSrc::HSE(..) => Pllsrc::HSE, |
| 59 | PllSrc::HSI16 => Pllsrc::HSI16, | 36 | PllSrc::HSI16 => Pllsrc::HSI, |
| 60 | } | ||
| 61 | } | ||
| 62 | } | ||
| 63 | |||
| 64 | seq_macro::seq!(P in 2..=31 { | ||
| 65 | /// Output divider for the PLL P output. | ||
| 66 | #[derive(Clone, Copy)] | ||
| 67 | pub enum PllP { | ||
| 68 | // Note: If PLL P is set to 0 the PLLP bit controls the output division. There does not seem to | ||
| 69 | // a good reason to do this so the API does not support it. | ||
| 70 | // Div1 is invalid | ||
| 71 | #( | ||
| 72 | Div~P, | ||
| 73 | )* | ||
| 74 | } | ||
| 75 | |||
| 76 | impl From<PllP> for u8 { | ||
| 77 | /// Returns the register value for the P output divider. | ||
| 78 | fn from(val: PllP) -> u8 { | ||
| 79 | match val { | ||
| 80 | #( | ||
| 81 | PllP::Div~P => P, | ||
| 82 | )* | ||
| 83 | } | ||
| 84 | } | ||
| 85 | } | ||
| 86 | }); | ||
| 87 | |||
| 88 | impl PllP { | ||
| 89 | /// Returns the numeric value of the P output divider. | ||
| 90 | pub fn to_div(self) -> u32 { | ||
| 91 | let val: u8 = self.into(); | ||
| 92 | val as u32 | ||
| 93 | } | ||
| 94 | } | ||
| 95 | |||
| 96 | /// Output divider for the PLL Q output. | ||
| 97 | #[derive(Clone, Copy)] | ||
| 98 | pub enum PllQ { | ||
| 99 | Div2, | ||
| 100 | Div4, | ||
| 101 | Div6, | ||
| 102 | Div8, | ||
| 103 | } | ||
| 104 | |||
| 105 | impl PllQ { | ||
| 106 | /// Returns the numeric value of the Q output divider. | ||
| 107 | pub fn to_div(self) -> u32 { | ||
| 108 | let val: u8 = self.into(); | ||
| 109 | (val as u32 + 1) * 2 | ||
| 110 | } | ||
| 111 | } | ||
| 112 | |||
| 113 | impl From<PllQ> for u8 { | ||
| 114 | /// Returns the register value for the Q output divider. | ||
| 115 | fn from(val: PllQ) -> u8 { | ||
| 116 | match val { | ||
| 117 | PllQ::Div2 => 0b00, | ||
| 118 | PllQ::Div4 => 0b01, | ||
| 119 | PllQ::Div6 => 0b10, | ||
| 120 | PllQ::Div8 => 0b11, | ||
| 121 | } | ||
| 122 | } | ||
| 123 | } | ||
| 124 | |||
| 125 | /// Output divider for the PLL R output. | ||
| 126 | #[derive(Clone, Copy)] | ||
| 127 | pub enum PllR { | ||
| 128 | Div2, | ||
| 129 | Div4, | ||
| 130 | Div6, | ||
| 131 | Div8, | ||
| 132 | } | ||
| 133 | |||
| 134 | impl PllR { | ||
| 135 | /// Returns the numeric value of the R output divider. | ||
| 136 | pub fn to_div(self) -> u32 { | ||
| 137 | let val: u8 = self.into(); | ||
| 138 | (val as u32 + 1) * 2 | ||
| 139 | } | ||
| 140 | } | ||
| 141 | |||
| 142 | impl From<PllR> for u8 { | ||
| 143 | /// Returns the register value for the R output divider. | ||
| 144 | fn from(val: PllR) -> u8 { | ||
| 145 | match val { | ||
| 146 | PllR::Div2 => 0b00, | ||
| 147 | PllR::Div4 => 0b01, | ||
| 148 | PllR::Div6 => 0b10, | ||
| 149 | PllR::Div8 => 0b11, | ||
| 150 | } | ||
| 151 | } | ||
| 152 | } | ||
| 153 | |||
| 154 | seq_macro::seq!(N in 8..=127 { | ||
| 155 | /// Multiplication factor for the PLL VCO input clock. | ||
| 156 | #[derive(Clone, Copy)] | ||
| 157 | pub enum PllN { | ||
| 158 | #( | ||
| 159 | Mul~N, | ||
| 160 | )* | ||
| 161 | } | ||
| 162 | |||
| 163 | impl From<PllN> for u8 { | ||
| 164 | /// Returns the register value for the N multiplication factor. | ||
| 165 | fn from(val: PllN) -> u8 { | ||
| 166 | match val { | ||
| 167 | #( | ||
| 168 | PllN::Mul~N => N, | ||
| 169 | )* | ||
| 170 | } | ||
| 171 | } | ||
| 172 | } | ||
| 173 | |||
| 174 | impl PllN { | ||
| 175 | /// Returns the numeric value of the N multiplication factor. | ||
| 176 | pub fn to_mul(self) -> u32 { | ||
| 177 | match self { | ||
| 178 | #( | ||
| 179 | PllN::Mul~N => N, | ||
| 180 | )* | ||
| 181 | } | ||
| 182 | } | ||
| 183 | } | ||
| 184 | }); | ||
| 185 | |||
| 186 | /// PLL Pre-division. This must be set such that the PLL input is between 2.66 MHz and 16 MHz. | ||
| 187 | #[derive(Copy, Clone)] | ||
| 188 | pub enum PllM { | ||
| 189 | Div1, | ||
| 190 | Div2, | ||
| 191 | Div3, | ||
| 192 | Div4, | ||
| 193 | Div5, | ||
| 194 | Div6, | ||
| 195 | Div7, | ||
| 196 | Div8, | ||
| 197 | Div9, | ||
| 198 | Div10, | ||
| 199 | Div11, | ||
| 200 | Div12, | ||
| 201 | Div13, | ||
| 202 | Div14, | ||
| 203 | Div15, | ||
| 204 | Div16, | ||
| 205 | } | ||
| 206 | |||
| 207 | impl PllM { | ||
| 208 | /// Returns the numeric value of the M pre-division. | ||
| 209 | pub fn to_div(self) -> u32 { | ||
| 210 | let val: u8 = self.into(); | ||
| 211 | val as u32 + 1 | ||
| 212 | } | ||
| 213 | } | ||
| 214 | |||
| 215 | impl From<PllM> for u8 { | ||
| 216 | /// Returns the register value for the M pre-division. | ||
| 217 | fn from(val: PllM) -> u8 { | ||
| 218 | match val { | ||
| 219 | PllM::Div1 => 0b0000, | ||
| 220 | PllM::Div2 => 0b0001, | ||
| 221 | PllM::Div3 => 0b0010, | ||
| 222 | PllM::Div4 => 0b0011, | ||
| 223 | PllM::Div5 => 0b0100, | ||
| 224 | PllM::Div6 => 0b0101, | ||
| 225 | PllM::Div7 => 0b0110, | ||
| 226 | PllM::Div8 => 0b0111, | ||
| 227 | PllM::Div9 => 0b1000, | ||
| 228 | PllM::Div10 => 0b1001, | ||
| 229 | PllM::Div11 => 0b1010, | ||
| 230 | PllM::Div12 => 0b1011, | ||
| 231 | PllM::Div13 => 0b1100, | ||
| 232 | PllM::Div14 => 0b1101, | ||
| 233 | PllM::Div15 => 0b1110, | ||
| 234 | PllM::Div16 => 0b1111, | ||
| 235 | } | 37 | } |
| 236 | } | 38 | } |
| 237 | } | 39 | } |
| @@ -261,32 +63,6 @@ pub struct Pll { | |||
| 261 | pub div_r: Option<PllR>, | 63 | pub div_r: Option<PllR>, |
| 262 | } | 64 | } |
| 263 | 65 | ||
| 264 | fn ahb_div(ahb: AHBPrescaler) -> u32 { | ||
| 265 | match ahb { | ||
| 266 | AHBPrescaler::DIV1 => 1, | ||
| 267 | AHBPrescaler::DIV2 => 2, | ||
| 268 | AHBPrescaler::DIV4 => 4, | ||
| 269 | AHBPrescaler::DIV8 => 8, | ||
| 270 | AHBPrescaler::DIV16 => 16, | ||
| 271 | AHBPrescaler::DIV64 => 64, | ||
| 272 | AHBPrescaler::DIV128 => 128, | ||
| 273 | AHBPrescaler::DIV256 => 256, | ||
| 274 | AHBPrescaler::DIV512 => 512, | ||
| 275 | _ => unreachable!(), | ||
| 276 | } | ||
| 277 | } | ||
| 278 | |||
| 279 | fn apb_div(apb: APBPrescaler) -> u32 { | ||
| 280 | match apb { | ||
| 281 | APBPrescaler::DIV1 => 1, | ||
| 282 | APBPrescaler::DIV2 => 2, | ||
| 283 | APBPrescaler::DIV4 => 4, | ||
| 284 | APBPrescaler::DIV8 => 8, | ||
| 285 | APBPrescaler::DIV16 => 16, | ||
| 286 | _ => unreachable!(), | ||
| 287 | } | ||
| 288 | } | ||
| 289 | |||
| 290 | /// Sets the source for the 48MHz clock to the USB and RNG peripherals. | 66 | /// Sets the source for the 48MHz clock to the USB and RNG peripherals. |
| 291 | pub enum Clock48MhzSrc { | 67 | pub enum Clock48MhzSrc { |
| 292 | /// Use the High Speed Internal Oscillator. For USB usage, the CRS must be used to calibrate the | 68 | /// Use the High Speed Internal Oscillator. For USB usage, the CRS must be used to calibrate the |
| @@ -322,6 +98,8 @@ pub struct Config { | |||
| 322 | pub clock_48mhz_src: Option<Clock48MhzSrc>, | 98 | pub clock_48mhz_src: Option<Clock48MhzSrc>, |
| 323 | pub adc12_clock_source: AdcClockSource, | 99 | pub adc12_clock_source: AdcClockSource, |
| 324 | pub adc345_clock_source: AdcClockSource, | 100 | pub adc345_clock_source: AdcClockSource, |
| 101 | |||
| 102 | pub ls: super::LsConfig, | ||
| 325 | } | 103 | } |
| 326 | 104 | ||
| 327 | /// Configuration for the Clock Recovery System (CRS) used to trim the HSI48 oscillator. | 105 | /// Configuration for the Clock Recovery System (CRS) used to trim the HSI48 oscillator. |
| @@ -340,9 +118,10 @@ impl Default for Config { | |||
| 340 | apb2_pre: APBPrescaler::DIV1, | 118 | apb2_pre: APBPrescaler::DIV1, |
| 341 | low_power_run: false, | 119 | low_power_run: false, |
| 342 | pll: None, | 120 | pll: None, |
| 343 | clock_48mhz_src: None, | 121 | clock_48mhz_src: Some(Clock48MhzSrc::Hsi48(None)), |
| 344 | adc12_clock_source: Default::default(), | 122 | adc12_clock_source: Adcsel::DISABLE, |
| 345 | adc345_clock_source: Default::default(), | 123 | adc345_clock_source: Adcsel::DISABLE, |
| 124 | ls: Default::default(), | ||
| 346 | } | 125 | } |
| 347 | } | 126 | } |
| 348 | } | 127 | } |
| @@ -360,12 +139,12 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 360 | RCC.cr().write(|w| w.set_hsion(true)); | 139 | RCC.cr().write(|w| w.set_hsion(true)); |
| 361 | while !RCC.cr().read().hsirdy() {} | 140 | while !RCC.cr().read().hsirdy() {} |
| 362 | 141 | ||
| 363 | HSI_FREQ.0 | 142 | HSI_FREQ |
| 364 | } | 143 | } |
| 365 | PllSrc::HSE(freq) => { | 144 | PllSrc::HSE(freq) => { |
| 366 | RCC.cr().write(|w| w.set_hseon(true)); | 145 | RCC.cr().write(|w| w.set_hseon(true)); |
| 367 | while !RCC.cr().read().hserdy() {} | 146 | while !RCC.cr().read().hserdy() {} |
| 368 | freq.0 | 147 | freq |
| 369 | } | 148 | } |
| 370 | }; | 149 | }; |
| 371 | 150 | ||
| @@ -373,36 +152,36 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 373 | RCC.cr().modify(|w| w.set_pllon(false)); | 152 | RCC.cr().modify(|w| w.set_pllon(false)); |
| 374 | while RCC.cr().read().pllrdy() {} | 153 | while RCC.cr().read().pllrdy() {} |
| 375 | 154 | ||
| 376 | let internal_freq = src_freq / pll_config.prediv_m.to_div() * pll_config.mul_n.to_mul(); | 155 | let internal_freq = src_freq / pll_config.prediv_m * pll_config.mul_n; |
| 377 | 156 | ||
| 378 | RCC.pllcfgr().write(|w| { | 157 | RCC.pllcfgr().write(|w| { |
| 379 | w.set_plln(pll_config.mul_n.into()); | 158 | w.set_plln(pll_config.mul_n); |
| 380 | w.set_pllm(pll_config.prediv_m.into()); | 159 | w.set_pllm(pll_config.prediv_m); |
| 381 | w.set_pllsrc(pll_config.source.into()); | 160 | w.set_pllsrc(pll_config.source.into()); |
| 382 | }); | 161 | }); |
| 383 | 162 | ||
| 384 | let pll_p_freq = pll_config.div_p.map(|div_p| { | 163 | let pll_p_freq = pll_config.div_p.map(|div_p| { |
| 385 | RCC.pllcfgr().modify(|w| { | 164 | RCC.pllcfgr().modify(|w| { |
| 386 | w.set_pllpdiv(div_p.into()); | 165 | w.set_pllp(div_p); |
| 387 | w.set_pllpen(true); | 166 | w.set_pllpen(true); |
| 388 | }); | 167 | }); |
| 389 | Hertz(internal_freq / div_p.to_div()) | 168 | internal_freq / div_p |
| 390 | }); | 169 | }); |
| 391 | 170 | ||
| 392 | let pll_q_freq = pll_config.div_q.map(|div_q| { | 171 | let pll_q_freq = pll_config.div_q.map(|div_q| { |
| 393 | RCC.pllcfgr().modify(|w| { | 172 | RCC.pllcfgr().modify(|w| { |
| 394 | w.set_pllq(div_q.into()); | 173 | w.set_pllq(div_q); |
| 395 | w.set_pllqen(true); | 174 | w.set_pllqen(true); |
| 396 | }); | 175 | }); |
| 397 | Hertz(internal_freq / div_q.to_div()) | 176 | internal_freq / div_q |
| 398 | }); | 177 | }); |
| 399 | 178 | ||
| 400 | let pll_r_freq = pll_config.div_r.map(|div_r| { | 179 | let pll_r_freq = pll_config.div_r.map(|div_r| { |
| 401 | RCC.pllcfgr().modify(|w| { | 180 | RCC.pllcfgr().modify(|w| { |
| 402 | w.set_pllr(div_r.into()); | 181 | w.set_pllr(div_r); |
| 403 | w.set_pllren(true); | 182 | w.set_pllren(true); |
| 404 | }); | 183 | }); |
| 405 | Hertz(internal_freq / div_r.to_div()) | 184 | internal_freq / div_r |
| 406 | }); | 185 | }); |
| 407 | 186 | ||
| 408 | // Enable the PLL | 187 | // Enable the PLL |
| @@ -422,14 +201,14 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 422 | RCC.cr().write(|w| w.set_hsion(true)); | 201 | RCC.cr().write(|w| w.set_hsion(true)); |
| 423 | while !RCC.cr().read().hsirdy() {} | 202 | while !RCC.cr().read().hsirdy() {} |
| 424 | 203 | ||
| 425 | (HSI_FREQ.0, Sw::HSI16) | 204 | (HSI_FREQ, Sw::HSI) |
| 426 | } | 205 | } |
| 427 | ClockSrc::HSE(freq) => { | 206 | ClockSrc::HSE(freq) => { |
| 428 | // Enable HSE | 207 | // Enable HSE |
| 429 | RCC.cr().write(|w| w.set_hseon(true)); | 208 | RCC.cr().write(|w| w.set_hseon(true)); |
| 430 | while !RCC.cr().read().hserdy() {} | 209 | while !RCC.cr().read().hserdy() {} |
| 431 | 210 | ||
| 432 | (freq.0, Sw::HSE) | 211 | (freq, Sw::HSE) |
| 433 | } | 212 | } |
| 434 | ClockSrc::PLL => { | 213 | ClockSrc::PLL => { |
| 435 | assert!(pll_freq.is_some()); | 214 | assert!(pll_freq.is_some()); |
| @@ -470,35 +249,32 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 470 | } | 249 | } |
| 471 | } | 250 | } |
| 472 | 251 | ||
| 473 | (freq, Sw::PLLRCLK) | 252 | (Hertz(freq), Sw::PLL1_R) |
| 474 | } | 253 | } |
| 475 | }; | 254 | }; |
| 476 | 255 | ||
| 477 | RCC.cfgr().modify(|w| { | 256 | RCC.cfgr().modify(|w| { |
| 478 | w.set_sw(sw); | 257 | w.set_sw(sw); |
| 479 | w.set_hpre(config.ahb_pre.into()); | 258 | w.set_hpre(config.ahb_pre); |
| 480 | w.set_ppre1(config.apb1_pre.into()); | 259 | w.set_ppre1(config.apb1_pre); |
| 481 | w.set_ppre2(config.apb2_pre.into()); | 260 | w.set_ppre2(config.apb2_pre); |
| 482 | }); | 261 | }); |
| 483 | 262 | ||
| 484 | let ahb_freq: u32 = match config.ahb_pre { | 263 | let ahb_freq = sys_clk / config.ahb_pre; |
| 485 | AHBPrescaler::DIV1 => sys_clk, | ||
| 486 | pre => sys_clk / ahb_div(pre), | ||
| 487 | }; | ||
| 488 | 264 | ||
| 489 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | 265 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { |
| 490 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 266 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 491 | pre => { | 267 | pre => { |
| 492 | let freq = ahb_freq / apb_div(pre); | 268 | let freq = ahb_freq / pre; |
| 493 | (freq, freq * 2) | 269 | (freq, freq * 2u32) |
| 494 | } | 270 | } |
| 495 | }; | 271 | }; |
| 496 | 272 | ||
| 497 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | 273 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { |
| 498 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 274 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 499 | pre => { | 275 | pre => { |
| 500 | let freq = ahb_freq / apb_div(pre); | 276 | let freq = ahb_freq / pre; |
| 501 | (freq, freq * 2) | 277 | (freq, freq * 2u32) |
| 502 | } | 278 | } |
| 503 | }; | 279 | }; |
| 504 | 280 | ||
| @@ -510,7 +286,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 510 | let pllq_freq = pll_freq.as_ref().and_then(|f| f.pll_q); | 286 | let pllq_freq = pll_freq.as_ref().and_then(|f| f.pll_q); |
| 511 | assert!(pllq_freq.is_some() && pllq_freq.unwrap().0 == 48_000_000); | 287 | assert!(pllq_freq.is_some() && pllq_freq.unwrap().0 == 48_000_000); |
| 512 | 288 | ||
| 513 | crate::pac::rcc::vals::Clk48sel::PLLQCLK | 289 | crate::pac::rcc::vals::Clk48sel::PLL1_Q |
| 514 | } | 290 | } |
| 515 | Clock48MhzSrc::Hsi48(crs_config) => { | 291 | Clock48MhzSrc::Hsi48(crs_config) => { |
| 516 | // Enable HSI48 | 292 | // Enable HSI48 |
| @@ -520,7 +296,7 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 520 | 296 | ||
| 521 | // Enable and setup CRS if needed | 297 | // Enable and setup CRS if needed |
| 522 | if let Some(crs_config) = crs_config { | 298 | if let Some(crs_config) = crs_config { |
| 523 | crate::peripherals::CRS::enable(); | 299 | crate::peripherals::CRS::enable_and_reset(); |
| 524 | 300 | ||
| 525 | let sync_src = match crs_config.sync_src { | 301 | let sync_src = match crs_config.sync_src { |
| 526 | CrsSyncSource::Gpio => crate::pac::crs::vals::Syncsrc::GPIO, | 302 | CrsSyncSource::Gpio => crate::pac::crs::vals::Syncsrc::GPIO, |
| @@ -546,43 +322,41 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 546 | RCC.ccipr().modify(|w| w.set_clk48sel(source)); | 322 | RCC.ccipr().modify(|w| w.set_clk48sel(source)); |
| 547 | } | 323 | } |
| 548 | 324 | ||
| 549 | RCC.ccipr() | 325 | RCC.ccipr().modify(|w| w.set_adc12sel(config.adc12_clock_source)); |
| 550 | .modify(|w| w.set_adc12sel(config.adc12_clock_source.adcsel())); | 326 | RCC.ccipr().modify(|w| w.set_adc345sel(config.adc345_clock_source)); |
| 551 | RCC.ccipr() | ||
| 552 | .modify(|w| w.set_adc345sel(config.adc345_clock_source.adcsel())); | ||
| 553 | 327 | ||
| 554 | let adc12_ck = match config.adc12_clock_source { | 328 | let adc12_ck = match config.adc12_clock_source { |
| 555 | AdcClockSource::NoClk => None, | 329 | AdcClockSource::DISABLE => None, |
| 556 | AdcClockSource::PllP => match &pll_freq { | 330 | AdcClockSource::PLL1_P => pll_freq.as_ref().unwrap().pll_p, |
| 557 | Some(pll) => pll.pll_p, | 331 | AdcClockSource::SYS => Some(sys_clk), |
| 558 | None => None, | 332 | _ => unreachable!(), |
| 559 | }, | ||
| 560 | AdcClockSource::SysClk => Some(Hertz(sys_clk)), | ||
| 561 | }; | 333 | }; |
| 562 | 334 | ||
| 563 | let adc345_ck = match config.adc345_clock_source { | 335 | let adc345_ck = match config.adc345_clock_source { |
| 564 | AdcClockSource::NoClk => None, | 336 | AdcClockSource::DISABLE => None, |
| 565 | AdcClockSource::PllP => match &pll_freq { | 337 | AdcClockSource::PLL1_P => pll_freq.as_ref().unwrap().pll_p, |
| 566 | Some(pll) => pll.pll_p, | 338 | AdcClockSource::SYS => Some(sys_clk), |
| 567 | None => None, | 339 | _ => unreachable!(), |
| 568 | }, | ||
| 569 | AdcClockSource::SysClk => Some(Hertz(sys_clk)), | ||
| 570 | }; | 340 | }; |
| 571 | 341 | ||
| 572 | if config.low_power_run { | 342 | if config.low_power_run { |
| 573 | assert!(sys_clk <= 2_000_000); | 343 | assert!(sys_clk <= Hertz(2_000_000)); |
| 574 | PWR.cr1().modify(|w| w.set_lpr(true)); | 344 | PWR.cr1().modify(|w| w.set_lpr(true)); |
| 575 | } | 345 | } |
| 576 | 346 | ||
| 347 | let rtc = config.ls.init(); | ||
| 348 | |||
| 577 | set_freqs(Clocks { | 349 | set_freqs(Clocks { |
| 578 | sys: Hertz(sys_clk), | 350 | sys: sys_clk, |
| 579 | ahb1: Hertz(ahb_freq), | 351 | hclk1: ahb_freq, |
| 580 | ahb2: Hertz(ahb_freq), | 352 | hclk2: ahb_freq, |
| 581 | apb1: Hertz(apb1_freq), | 353 | pclk1: apb1_freq, |
| 582 | apb1_tim: Hertz(apb1_tim_freq), | 354 | pclk1_tim: apb1_tim_freq, |
| 583 | apb2: Hertz(apb2_freq), | 355 | pclk2: apb2_freq, |
| 584 | apb2_tim: Hertz(apb2_tim_freq), | 356 | pclk2_tim: apb2_tim_freq, |
| 585 | adc: adc12_ck, | 357 | adc: adc12_ck, |
| 586 | adc34: adc345_ck, | 358 | adc34: adc345_ck, |
| 359 | pll1_p: None, | ||
| 360 | rtc, | ||
| 587 | }); | 361 | }); |
| 588 | } | 362 | } |
diff --git a/embassy-stm32/src/rcc/h.rs b/embassy-stm32/src/rcc/h.rs index 43e8db22e..5dbcfea90 100644 --- a/embassy-stm32/src/rcc/h.rs +++ b/embassy-stm32/src/rcc/h.rs | |||
| @@ -6,8 +6,8 @@ use crate::pac::pwr::vals::Vos; | |||
| 6 | pub use crate::pac::rcc::vals::Adcdacsel as AdcClockSource; | 6 | pub use crate::pac::rcc::vals::Adcdacsel as AdcClockSource; |
| 7 | #[cfg(stm32h7)] | 7 | #[cfg(stm32h7)] |
| 8 | pub use crate::pac::rcc::vals::Adcsel as AdcClockSource; | 8 | pub use crate::pac::rcc::vals::Adcsel as AdcClockSource; |
| 9 | pub use crate::pac::rcc::vals::Ckpersel as PerClockSource; | ||
| 10 | use crate::pac::rcc::vals::{Ckpersel, Hsidiv, Pllrge, Pllsrc, Pllvcosel, Sw, Timpre}; | 9 | use crate::pac::rcc::vals::{Ckpersel, Hsidiv, Pllrge, Pllsrc, Pllvcosel, Sw, Timpre}; |
| 10 | pub use crate::pac::rcc::vals::{Ckpersel as PerClockSource, Plldiv as PllDiv, Pllm as PllPreDiv, Plln as PllMul}; | ||
| 11 | use crate::pac::{FLASH, PWR, RCC}; | 11 | use crate::pac::{FLASH, PWR, RCC}; |
| 12 | use crate::rcc::{set_freqs, Clocks}; | 12 | use crate::rcc::{set_freqs, Clocks}; |
| 13 | use crate::time::Hertz; | 13 | use crate::time::Hertz; |
| @@ -21,18 +21,15 @@ pub const CSI_FREQ: Hertz = Hertz(4_000_000); | |||
| 21 | /// HSI48 speed | 21 | /// HSI48 speed |
| 22 | pub const HSI48_FREQ: Hertz = Hertz(48_000_000); | 22 | pub const HSI48_FREQ: Hertz = Hertz(48_000_000); |
| 23 | 23 | ||
| 24 | /// LSI speed | 24 | const VCO_RANGE: RangeInclusive<Hertz> = Hertz(150_000_000)..=Hertz(420_000_000); |
| 25 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 26 | |||
| 27 | const VCO_RANGE: RangeInclusive<u32> = 150_000_000..=420_000_000; | ||
| 28 | #[cfg(any(stm32h5, pwr_h7rm0455))] | 25 | #[cfg(any(stm32h5, pwr_h7rm0455))] |
| 29 | const VCO_WIDE_RANGE: RangeInclusive<u32> = 128_000_000..=560_000_000; | 26 | const VCO_WIDE_RANGE: RangeInclusive<Hertz> = Hertz(128_000_000)..=Hertz(560_000_000); |
| 30 | #[cfg(pwr_h7rm0468)] | 27 | #[cfg(pwr_h7rm0468)] |
| 31 | const VCO_WIDE_RANGE: RangeInclusive<u32> = 192_000_000..=836_000_000; | 28 | const VCO_WIDE_RANGE: RangeInclusive<Hertz> = Hertz(192_000_000)..=Hertz(836_000_000); |
| 32 | #[cfg(any(pwr_h7rm0399, pwr_h7rm0433))] | 29 | #[cfg(any(pwr_h7rm0399, pwr_h7rm0433))] |
| 33 | const VCO_WIDE_RANGE: RangeInclusive<u32> = 192_000_000..=960_000_000; | 30 | const VCO_WIDE_RANGE: RangeInclusive<Hertz> = Hertz(192_000_000)..=Hertz(960_000_000); |
| 34 | 31 | ||
| 35 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | 32 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Ppre as APBPrescaler}; |
| 36 | 33 | ||
| 37 | #[derive(Clone, Copy, Eq, PartialEq)] | 34 | #[derive(Clone, Copy, Eq, PartialEq)] |
| 38 | pub enum VoltageScale { | 35 | pub enum VoltageScale { |
| @@ -46,9 +43,9 @@ pub enum VoltageScale { | |||
| 46 | pub enum HseMode { | 43 | pub enum HseMode { |
| 47 | /// crystal/ceramic oscillator (HSEBYP=0) | 44 | /// crystal/ceramic oscillator (HSEBYP=0) |
| 48 | Oscillator, | 45 | Oscillator, |
| 49 | /// external analog clock (low swing) (HSEBYP=1, HSEEXT=0) | 46 | /// external analog clock (low swing) (HSEBYP=1, HSEEXT=0) |
| 50 | Bypass, | 47 | Bypass, |
| 51 | /// external digital clock (full swing) (HSEBYP=1, HSEEXT=1) | 48 | /// external digital clock (full swing) (HSEBYP=1, HSEEXT=1) |
| 52 | #[cfg(any(rcc_h5, rcc_h50))] | 49 | #[cfg(any(rcc_h5, rcc_h50))] |
| 53 | BypassDigital, | 50 | BypassDigital, |
| 54 | } | 51 | } |
| @@ -98,19 +95,19 @@ pub struct Pll { | |||
| 98 | #[cfg(stm32h5)] | 95 | #[cfg(stm32h5)] |
| 99 | pub source: PllSource, | 96 | pub source: PllSource, |
| 100 | 97 | ||
| 101 | /// PLL pre-divider (DIVM). Must be between 1 and 63. | 98 | /// PLL pre-divider (DIVM). |
| 102 | pub prediv: u8, | 99 | pub prediv: PllPreDiv, |
| 103 | 100 | ||
| 104 | /// PLL multiplication factor. Must be between 4 and 512. | 101 | /// PLL multiplication factor. |
| 105 | pub mul: u16, | 102 | pub mul: PllMul, |
| 106 | 103 | ||
| 107 | /// PLL P division factor. If None, PLL P output is disabled. Must be between 1 and 128. | 104 | /// PLL P division factor. If None, PLL P output is disabled. |
| 108 | /// On PLL1, it must be even (in particular, it cannot be 1.) | 105 | /// On PLL1, it must be even (in particular, it cannot be 1.) |
| 109 | pub divp: Option<u16>, | 106 | pub divp: Option<PllDiv>, |
| 110 | /// PLL Q division factor. If None, PLL Q output is disabled. Must be between 1 and 128. | 107 | /// PLL Q division factor. If None, PLL Q output is disabled. |
| 111 | pub divq: Option<u16>, | 108 | pub divq: Option<PllDiv>, |
| 112 | /// PLL R division factor. If None, PLL R output is disabled. Must be between 1 and 128. | 109 | /// PLL R division factor. If None, PLL R output is disabled. |
| 113 | pub divr: Option<u16>, | 110 | pub divr: Option<PllDiv>, |
| 114 | } | 111 | } |
| 115 | 112 | ||
| 116 | fn apb_div_tim(apb: &APBPrescaler, clk: Hertz, tim: TimerPrescaler) -> Hertz { | 113 | fn apb_div_tim(apb: &APBPrescaler, clk: Hertz, tim: TimerPrescaler) -> Hertz { |
| @@ -181,6 +178,7 @@ pub struct Config { | |||
| 181 | pub adc_clock_source: AdcClockSource, | 178 | pub adc_clock_source: AdcClockSource, |
| 182 | pub timer_prescaler: TimerPrescaler, | 179 | pub timer_prescaler: TimerPrescaler, |
| 183 | pub voltage_scale: VoltageScale, | 180 | pub voltage_scale: VoltageScale, |
| 181 | pub ls: super::LsConfig, | ||
| 184 | } | 182 | } |
| 185 | 183 | ||
| 186 | impl Default for Config { | 184 | impl Default for Config { |
| @@ -210,6 +208,7 @@ impl Default for Config { | |||
| 210 | adc_clock_source: AdcClockSource::from_bits(0), // PLL2_P on H7, HCLK on H5 | 208 | adc_clock_source: AdcClockSource::from_bits(0), // PLL2_P on H7, HCLK on H5 |
| 211 | timer_prescaler: TimerPrescaler::DefaultX2, | 209 | timer_prescaler: TimerPrescaler::DefaultX2, |
| 212 | voltage_scale: VoltageScale::Scale0, | 210 | voltage_scale: VoltageScale::Scale0, |
| 211 | ls: Default::default(), | ||
| 213 | } | 212 | } |
| 214 | } | 213 | } |
| 215 | } | 214 | } |
| @@ -372,14 +371,14 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 372 | let pll1 = init_pll(0, config.pll1, &pll_input); | 371 | let pll1 = init_pll(0, config.pll1, &pll_input); |
| 373 | let pll2 = init_pll(1, config.pll2, &pll_input); | 372 | let pll2 = init_pll(1, config.pll2, &pll_input); |
| 374 | #[cfg(any(rcc_h5, stm32h7))] | 373 | #[cfg(any(rcc_h5, stm32h7))] |
| 375 | let _pll3 = init_pll(2, config.pll3, &pll_input); | 374 | let pll3 = init_pll(2, config.pll3, &pll_input); |
| 376 | 375 | ||
| 377 | // Configure sysclk | 376 | // Configure sysclk |
| 378 | let (sys, sw) = match config.sys { | 377 | let (sys, sw) = match config.sys { |
| 379 | Sysclk::HSI => (unwrap!(hsi), Sw::HSI), | 378 | Sysclk::HSI => (unwrap!(hsi), Sw::HSI), |
| 380 | Sysclk::HSE => (unwrap!(hse), Sw::HSE), | 379 | Sysclk::HSE => (unwrap!(hse), Sw::HSE), |
| 381 | Sysclk::CSI => (unwrap!(csi), Sw::CSI), | 380 | Sysclk::CSI => (unwrap!(csi), Sw::CSI), |
| 382 | Sysclk::Pll1P => (unwrap!(pll1.p), Sw::PLL1), | 381 | Sysclk::Pll1P => (unwrap!(pll1.p), Sw::PLL1_P), |
| 383 | }; | 382 | }; |
| 384 | 383 | ||
| 385 | // Check limits. | 384 | // Check limits. |
| @@ -431,23 +430,25 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 431 | #[cfg(stm32h7)] | 430 | #[cfg(stm32h7)] |
| 432 | let adc = match config.adc_clock_source { | 431 | let adc = match config.adc_clock_source { |
| 433 | AdcClockSource::PLL2_P => pll2.p, | 432 | AdcClockSource::PLL2_P => pll2.p, |
| 434 | AdcClockSource::PLL3_R => _pll3.r, | 433 | AdcClockSource::PLL3_R => pll3.r, |
| 435 | AdcClockSource::PER => _per_ck, | 434 | AdcClockSource::PER => _per_ck, |
| 436 | _ => unreachable!(), | 435 | _ => unreachable!(), |
| 437 | }; | 436 | }; |
| 438 | #[cfg(stm32h5)] | 437 | #[cfg(stm32h5)] |
| 439 | let adc = match config.adc_clock_source { | 438 | let adc = match config.adc_clock_source { |
| 440 | AdcClockSource::HCLK => Some(hclk), | 439 | AdcClockSource::HCLK1 => Some(hclk), |
| 441 | AdcClockSource::SYSCLK => Some(sys), | 440 | AdcClockSource::SYS => Some(sys), |
| 442 | AdcClockSource::PLL2_R => pll2.r, | 441 | AdcClockSource::PLL2_R => pll2.r, |
| 443 | AdcClockSource::HSE => hse, | 442 | AdcClockSource::HSE => hse, |
| 444 | AdcClockSource::HSI_KER => hsi, | 443 | AdcClockSource::HSI => hsi, |
| 445 | AdcClockSource::CSI_KER => csi, | 444 | AdcClockSource::CSI => csi, |
| 446 | _ => unreachable!(), | 445 | _ => unreachable!(), |
| 447 | }; | 446 | }; |
| 448 | 447 | ||
| 449 | flash_setup(hclk, config.voltage_scale); | 448 | flash_setup(hclk, config.voltage_scale); |
| 450 | 449 | ||
| 450 | let rtc = config.ls.init(); | ||
| 451 | |||
| 451 | #[cfg(stm32h7)] | 452 | #[cfg(stm32h7)] |
| 452 | { | 453 | { |
| 453 | RCC.d1cfgr().modify(|w| { | 454 | RCC.d1cfgr().modify(|w| { |
| @@ -514,18 +515,65 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 514 | 515 | ||
| 515 | set_freqs(Clocks { | 516 | set_freqs(Clocks { |
| 516 | sys, | 517 | sys, |
| 517 | ahb1: hclk, | 518 | hclk1: hclk, |
| 518 | ahb2: hclk, | 519 | hclk2: hclk, |
| 519 | ahb3: hclk, | 520 | hclk3: hclk, |
| 520 | ahb4: hclk, | 521 | hclk4: hclk, |
| 521 | apb1, | 522 | pclk1: apb1, |
| 522 | apb2, | 523 | pclk2: apb2, |
| 523 | apb3, | 524 | pclk3: apb3, |
| 525 | #[cfg(stm32h7)] | ||
| 526 | pclk4: apb4, | ||
| 527 | #[cfg(stm32h5)] | ||
| 528 | pclk4: Hertz(1), | ||
| 529 | pclk1_tim: apb1_tim, | ||
| 530 | pclk2_tim: apb2_tim, | ||
| 531 | adc, | ||
| 532 | rtc, | ||
| 533 | |||
| 534 | #[cfg(any(stm32h5, stm32h7))] | ||
| 535 | hsi: None, | ||
| 536 | #[cfg(stm32h5)] | ||
| 537 | hsi48: None, | ||
| 538 | #[cfg(stm32h5)] | ||
| 539 | lsi: None, | ||
| 540 | #[cfg(any(stm32h5, stm32h7))] | ||
| 541 | csi: None, | ||
| 542 | |||
| 543 | #[cfg(any(stm32h5, stm32h7))] | ||
| 544 | lse: None, | ||
| 545 | #[cfg(any(stm32h5, stm32h7))] | ||
| 546 | hse: None, | ||
| 547 | |||
| 548 | #[cfg(any(stm32h5, stm32h7))] | ||
| 549 | pll1_q: pll1.q, | ||
| 550 | #[cfg(any(stm32h5, stm32h7))] | ||
| 551 | pll2_p: pll2.p, | ||
| 552 | #[cfg(any(stm32h5, stm32h7))] | ||
| 553 | pll2_q: pll2.q, | ||
| 554 | #[cfg(any(stm32h5, stm32h7))] | ||
| 555 | pll2_r: pll2.r, | ||
| 556 | #[cfg(any(rcc_h5, stm32h7))] | ||
| 557 | pll3_p: pll3.p, | ||
| 558 | #[cfg(any(rcc_h5, stm32h7))] | ||
| 559 | pll3_q: pll3.q, | ||
| 560 | #[cfg(any(rcc_h5, stm32h7))] | ||
| 561 | pll3_r: pll3.r, | ||
| 562 | |||
| 563 | #[cfg(rcc_h50)] | ||
| 564 | pll3_p: None, | ||
| 565 | #[cfg(rcc_h50)] | ||
| 566 | pll3_q: None, | ||
| 567 | #[cfg(rcc_h50)] | ||
| 568 | pll3_r: None, | ||
| 569 | |||
| 570 | #[cfg(stm32h5)] | ||
| 571 | audioclk: None, | ||
| 572 | #[cfg(any(stm32h5, stm32h7))] | ||
| 573 | per: None, | ||
| 574 | |||
| 524 | #[cfg(stm32h7)] | 575 | #[cfg(stm32h7)] |
| 525 | apb4, | 576 | rcc_pclk_d3: None, |
| 526 | apb1_tim, | ||
| 527 | apb2_tim, | ||
| 528 | adc: adc, | ||
| 529 | }); | 577 | }); |
| 530 | } | 578 | } |
| 531 | 579 | ||
| @@ -553,9 +601,9 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput { | |||
| 553 | 601 | ||
| 554 | // "To save power when PLL1 is not used, the value of PLL1M must be set to 0."" | 602 | // "To save power when PLL1 is not used, the value of PLL1M must be set to 0."" |
| 555 | #[cfg(stm32h7)] | 603 | #[cfg(stm32h7)] |
| 556 | RCC.pllckselr().write(|w| w.set_divm(num, 0)); | 604 | RCC.pllckselr().write(|w| w.set_divm(num, PllPreDiv::from_bits(0))); |
| 557 | #[cfg(stm32h5)] | 605 | #[cfg(stm32h5)] |
| 558 | RCC.pllcfgr(num).write(|w| w.set_divm(0)); | 606 | RCC.pllcfgr(num).write(|w| w.set_divm(PllPreDiv::from_bits(0))); |
| 559 | 607 | ||
| 560 | return PllOutput { | 608 | return PllOutput { |
| 561 | p: None, | 609 | p: None, |
| @@ -564,9 +612,6 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput { | |||
| 564 | }; | 612 | }; |
| 565 | }; | 613 | }; |
| 566 | 614 | ||
| 567 | assert!(1 <= config.prediv && config.prediv <= 63); | ||
| 568 | assert!(4 <= config.mul && config.mul <= 512); | ||
| 569 | |||
| 570 | #[cfg(stm32h5)] | 615 | #[cfg(stm32h5)] |
| 571 | let source = config.source; | 616 | let source = config.source; |
| 572 | #[cfg(stm32h7)] | 617 | #[cfg(stm32h7)] |
| @@ -593,31 +638,25 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput { | |||
| 593 | let wide_allowed = ref_range != Pllrge::RANGE1; | 638 | let wide_allowed = ref_range != Pllrge::RANGE1; |
| 594 | 639 | ||
| 595 | let vco_clk = ref_clk * config.mul; | 640 | let vco_clk = ref_clk * config.mul; |
| 596 | let vco_range = if VCO_RANGE.contains(&vco_clk.0) { | 641 | let vco_range = if VCO_RANGE.contains(&vco_clk) { |
| 597 | Pllvcosel::MEDIUMVCO | 642 | Pllvcosel::MEDIUMVCO |
| 598 | } else if wide_allowed && VCO_WIDE_RANGE.contains(&vco_clk.0) { | 643 | } else if wide_allowed && VCO_WIDE_RANGE.contains(&vco_clk) { |
| 599 | Pllvcosel::WIDEVCO | 644 | Pllvcosel::WIDEVCO |
| 600 | } else { | 645 | } else { |
| 601 | panic!("pll vco_clk out of range: {} mhz", vco_clk.0) | 646 | panic!("pll vco_clk out of range: {} mhz", vco_clk.0) |
| 602 | }; | 647 | }; |
| 603 | 648 | ||
| 604 | let p = config.divp.map(|div| { | 649 | let p = config.divp.map(|div| { |
| 605 | assert!(1 <= div && div <= 128); | ||
| 606 | if num == 0 { | 650 | if num == 0 { |
| 607 | // on PLL1, DIVP must be even. | 651 | // on PLL1, DIVP must be even. |
| 608 | assert!(div % 2 == 0); | 652 | // The enum value is 1 less than the divider, so check it's odd. |
| 653 | assert!(div.to_bits() % 2 == 1); | ||
| 609 | } | 654 | } |
| 610 | 655 | ||
| 611 | vco_clk / div | 656 | vco_clk / div |
| 612 | }); | 657 | }); |
| 613 | let q = config.divq.map(|div| { | 658 | let q = config.divq.map(|div| vco_clk / div); |
| 614 | assert!(1 <= div && div <= 128); | 659 | let r = config.divr.map(|div| vco_clk / div); |
| 615 | vco_clk / div | ||
| 616 | }); | ||
| 617 | let r = config.divr.map(|div| { | ||
| 618 | assert!(1 <= div && div <= 128); | ||
| 619 | vco_clk / div | ||
| 620 | }); | ||
| 621 | 660 | ||
| 622 | #[cfg(stm32h5)] | 661 | #[cfg(stm32h5)] |
| 623 | RCC.pllcfgr(num).write(|w| { | 662 | RCC.pllcfgr(num).write(|w| { |
| @@ -648,10 +687,10 @@ fn init_pll(num: usize, config: Option<Pll>, input: &PllInput) -> PllOutput { | |||
| 648 | } | 687 | } |
| 649 | 688 | ||
| 650 | RCC.plldivr(num).write(|w| { | 689 | RCC.plldivr(num).write(|w| { |
| 651 | w.set_plln(config.mul - 1); | 690 | w.set_plln(config.mul); |
| 652 | w.set_pllp((config.divp.unwrap_or(1) - 1) as u8); | 691 | w.set_pllp(config.divp.unwrap_or(PllDiv::DIV2)); |
| 653 | w.set_pllq((config.divq.unwrap_or(1) - 1) as u8); | 692 | w.set_pllq(config.divq.unwrap_or(PllDiv::DIV2)); |
| 654 | w.set_pllr((config.divr.unwrap_or(1) - 1) as u8); | 693 | w.set_pllr(config.divr.unwrap_or(PllDiv::DIV2)); |
| 655 | }); | 694 | }); |
| 656 | 695 | ||
| 657 | RCC.cr().modify(|w| w.set_pllon(num, true)); | 696 | RCC.cr().modify(|w| w.set_pllon(num, true)); |
diff --git a/embassy-stm32/src/rcc/l0.rs b/embassy-stm32/src/rcc/l0.rs deleted file mode 100644 index 7358be31b..000000000 --- a/embassy-stm32/src/rcc/l0.rs +++ /dev/null | |||
| @@ -1,349 +0,0 @@ | |||
| 1 | use super::bd::BackupDomain; | ||
| 2 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 3 | use super::RtcClockSource; | ||
| 4 | pub use crate::pac::pwr::vals::Vos as VoltageScale; | ||
| 5 | use crate::pac::rcc::vals::{Hpre, Msirange, Plldiv, Pllmul, Pllsrc, Ppre, Sw}; | ||
| 6 | #[cfg(crs)] | ||
| 7 | use crate::pac::{crs, CRS, SYSCFG}; | ||
| 8 | use crate::pac::{FLASH, PWR, RCC}; | ||
| 9 | use crate::rcc::{set_freqs, Clocks}; | ||
| 10 | use crate::time::Hertz; | ||
| 11 | |||
| 12 | /// HSI speed | ||
| 13 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 14 | |||
| 15 | /// LSI speed | ||
| 16 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 17 | |||
| 18 | /// System clock mux source | ||
| 19 | #[derive(Clone, Copy)] | ||
| 20 | pub enum ClockSrc { | ||
| 21 | MSI(MSIRange), | ||
| 22 | PLL(PLLSource, PLLMul, PLLDiv), | ||
| 23 | HSE(Hertz), | ||
| 24 | HSI16, | ||
| 25 | } | ||
| 26 | |||
| 27 | /// MSI Clock Range | ||
| 28 | /// | ||
| 29 | /// These ranges control the frequency of the MSI. Internally, these ranges map | ||
| 30 | /// to the `MSIRANGE` bits in the `RCC_ICSCR` register. | ||
| 31 | #[derive(Clone, Copy)] | ||
| 32 | pub enum MSIRange { | ||
| 33 | /// Around 65.536 kHz | ||
| 34 | Range0, | ||
| 35 | /// Around 131.072 kHz | ||
| 36 | Range1, | ||
| 37 | /// Around 262.144 kHz | ||
| 38 | Range2, | ||
| 39 | /// Around 524.288 kHz | ||
| 40 | Range3, | ||
| 41 | /// Around 1.048 MHz | ||
| 42 | Range4, | ||
| 43 | /// Around 2.097 MHz (reset value) | ||
| 44 | Range5, | ||
| 45 | /// Around 4.194 MHz | ||
| 46 | Range6, | ||
| 47 | } | ||
| 48 | |||
| 49 | impl Default for MSIRange { | ||
| 50 | fn default() -> MSIRange { | ||
| 51 | MSIRange::Range5 | ||
| 52 | } | ||
| 53 | } | ||
| 54 | |||
| 55 | /// PLL divider | ||
| 56 | #[derive(Clone, Copy)] | ||
| 57 | pub enum PLLDiv { | ||
| 58 | Div2, | ||
| 59 | Div3, | ||
| 60 | Div4, | ||
| 61 | } | ||
| 62 | |||
| 63 | /// PLL multiplier | ||
| 64 | #[derive(Clone, Copy)] | ||
| 65 | pub enum PLLMul { | ||
| 66 | Mul3, | ||
| 67 | Mul4, | ||
| 68 | Mul6, | ||
| 69 | Mul8, | ||
| 70 | Mul12, | ||
| 71 | Mul16, | ||
| 72 | Mul24, | ||
| 73 | Mul32, | ||
| 74 | Mul48, | ||
| 75 | } | ||
| 76 | |||
| 77 | /// PLL clock input source | ||
| 78 | #[derive(Clone, Copy)] | ||
| 79 | pub enum PLLSource { | ||
| 80 | HSI16, | ||
| 81 | HSE(Hertz), | ||
| 82 | } | ||
| 83 | |||
| 84 | impl From<PLLMul> for Pllmul { | ||
| 85 | fn from(val: PLLMul) -> Pllmul { | ||
| 86 | match val { | ||
| 87 | PLLMul::Mul3 => Pllmul::MUL3, | ||
| 88 | PLLMul::Mul4 => Pllmul::MUL4, | ||
| 89 | PLLMul::Mul6 => Pllmul::MUL6, | ||
| 90 | PLLMul::Mul8 => Pllmul::MUL8, | ||
| 91 | PLLMul::Mul12 => Pllmul::MUL12, | ||
| 92 | PLLMul::Mul16 => Pllmul::MUL16, | ||
| 93 | PLLMul::Mul24 => Pllmul::MUL24, | ||
| 94 | PLLMul::Mul32 => Pllmul::MUL32, | ||
| 95 | PLLMul::Mul48 => Pllmul::MUL48, | ||
| 96 | } | ||
| 97 | } | ||
| 98 | } | ||
| 99 | |||
| 100 | impl From<PLLDiv> for Plldiv { | ||
| 101 | fn from(val: PLLDiv) -> Plldiv { | ||
| 102 | match val { | ||
| 103 | PLLDiv::Div2 => Plldiv::DIV2, | ||
| 104 | PLLDiv::Div3 => Plldiv::DIV3, | ||
| 105 | PLLDiv::Div4 => Plldiv::DIV4, | ||
| 106 | } | ||
| 107 | } | ||
| 108 | } | ||
| 109 | |||
| 110 | impl From<PLLSource> for Pllsrc { | ||
| 111 | fn from(val: PLLSource) -> Pllsrc { | ||
| 112 | match val { | ||
| 113 | PLLSource::HSI16 => Pllsrc::HSI16, | ||
| 114 | PLLSource::HSE(_) => Pllsrc::HSE, | ||
| 115 | } | ||
| 116 | } | ||
| 117 | } | ||
| 118 | |||
| 119 | impl From<MSIRange> for Msirange { | ||
| 120 | fn from(val: MSIRange) -> Msirange { | ||
| 121 | match val { | ||
| 122 | MSIRange::Range0 => Msirange::RANGE0, | ||
| 123 | MSIRange::Range1 => Msirange::RANGE1, | ||
| 124 | MSIRange::Range2 => Msirange::RANGE2, | ||
| 125 | MSIRange::Range3 => Msirange::RANGE3, | ||
| 126 | MSIRange::Range4 => Msirange::RANGE4, | ||
| 127 | MSIRange::Range5 => Msirange::RANGE5, | ||
| 128 | MSIRange::Range6 => Msirange::RANGE6, | ||
| 129 | } | ||
| 130 | } | ||
| 131 | } | ||
| 132 | |||
| 133 | /// Clocks configutation | ||
| 134 | pub struct Config { | ||
| 135 | pub mux: ClockSrc, | ||
| 136 | pub ahb_pre: AHBPrescaler, | ||
| 137 | pub apb1_pre: APBPrescaler, | ||
| 138 | pub apb2_pre: APBPrescaler, | ||
| 139 | #[cfg(crs)] | ||
| 140 | pub enable_hsi48: bool, | ||
| 141 | pub rtc: Option<RtcClockSource>, | ||
| 142 | pub lse: Option<Hertz>, | ||
| 143 | pub lsi: bool, | ||
| 144 | pub voltage_scale: VoltageScale, | ||
| 145 | } | ||
| 146 | |||
| 147 | impl Default for Config { | ||
| 148 | #[inline] | ||
| 149 | fn default() -> Config { | ||
| 150 | Config { | ||
| 151 | mux: ClockSrc::MSI(MSIRange::default()), | ||
| 152 | ahb_pre: AHBPrescaler::DIV1, | ||
| 153 | apb1_pre: APBPrescaler::DIV1, | ||
| 154 | apb2_pre: APBPrescaler::DIV1, | ||
| 155 | #[cfg(crs)] | ||
| 156 | enable_hsi48: false, | ||
| 157 | rtc: None, | ||
| 158 | lse: None, | ||
| 159 | lsi: false, | ||
| 160 | voltage_scale: VoltageScale::RANGE1, | ||
| 161 | } | ||
| 162 | } | ||
| 163 | } | ||
| 164 | |||
| 165 | pub(crate) unsafe fn init(config: Config) { | ||
| 166 | // Set voltage scale | ||
| 167 | while PWR.csr().read().vosf() {} | ||
| 168 | PWR.cr().write(|w| w.set_vos(config.voltage_scale)); | ||
| 169 | while PWR.csr().read().vosf() {} | ||
| 170 | |||
| 171 | let (sys_clk, sw) = match config.mux { | ||
| 172 | ClockSrc::MSI(range) => { | ||
| 173 | // Set MSI range | ||
| 174 | RCC.icscr().write(|w| w.set_msirange(range.into())); | ||
| 175 | |||
| 176 | // Enable MSI | ||
| 177 | RCC.cr().write(|w| w.set_msion(true)); | ||
| 178 | while !RCC.cr().read().msirdy() {} | ||
| 179 | |||
| 180 | let freq = 32_768 * (1 << (range as u8 + 1)); | ||
| 181 | (freq, Sw::MSI) | ||
| 182 | } | ||
| 183 | ClockSrc::HSI16 => { | ||
| 184 | // Enable HSI16 | ||
| 185 | RCC.cr().write(|w| w.set_hsi16on(true)); | ||
| 186 | while !RCC.cr().read().hsi16rdyf() {} | ||
| 187 | |||
| 188 | (HSI_FREQ.0, Sw::HSI16) | ||
| 189 | } | ||
| 190 | ClockSrc::HSE(freq) => { | ||
| 191 | // Enable HSE | ||
| 192 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 193 | while !RCC.cr().read().hserdy() {} | ||
| 194 | |||
| 195 | (freq.0, Sw::HSE) | ||
| 196 | } | ||
| 197 | ClockSrc::PLL(src, mul, div) => { | ||
| 198 | let freq = match src { | ||
| 199 | PLLSource::HSE(freq) => { | ||
| 200 | // Enable HSE | ||
| 201 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 202 | while !RCC.cr().read().hserdy() {} | ||
| 203 | freq.0 | ||
| 204 | } | ||
| 205 | PLLSource::HSI16 => { | ||
| 206 | // Enable HSI | ||
| 207 | RCC.cr().write(|w| w.set_hsi16on(true)); | ||
| 208 | while !RCC.cr().read().hsi16rdyf() {} | ||
| 209 | HSI_FREQ.0 | ||
| 210 | } | ||
| 211 | }; | ||
| 212 | |||
| 213 | // Disable PLL | ||
| 214 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 215 | while RCC.cr().read().pllrdy() {} | ||
| 216 | |||
| 217 | let freq = match mul { | ||
| 218 | PLLMul::Mul3 => freq * 3, | ||
| 219 | PLLMul::Mul4 => freq * 4, | ||
| 220 | PLLMul::Mul6 => freq * 6, | ||
| 221 | PLLMul::Mul8 => freq * 8, | ||
| 222 | PLLMul::Mul12 => freq * 12, | ||
| 223 | PLLMul::Mul16 => freq * 16, | ||
| 224 | PLLMul::Mul24 => freq * 24, | ||
| 225 | PLLMul::Mul32 => freq * 32, | ||
| 226 | PLLMul::Mul48 => freq * 48, | ||
| 227 | }; | ||
| 228 | |||
| 229 | let freq = match div { | ||
| 230 | PLLDiv::Div2 => freq / 2, | ||
| 231 | PLLDiv::Div3 => freq / 3, | ||
| 232 | PLLDiv::Div4 => freq / 4, | ||
| 233 | }; | ||
| 234 | assert!(freq <= 32_000_000); | ||
| 235 | |||
| 236 | RCC.cfgr().write(move |w| { | ||
| 237 | w.set_pllmul(mul.into()); | ||
| 238 | w.set_plldiv(div.into()); | ||
| 239 | w.set_pllsrc(src.into()); | ||
| 240 | }); | ||
| 241 | |||
| 242 | // Enable PLL | ||
| 243 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 244 | while !RCC.cr().read().pllrdy() {} | ||
| 245 | |||
| 246 | (freq, Sw::PLL) | ||
| 247 | } | ||
| 248 | }; | ||
| 249 | |||
| 250 | BackupDomain::configure_ls( | ||
| 251 | config.rtc.unwrap_or(RtcClockSource::NOCLOCK), | ||
| 252 | config.lsi, | ||
| 253 | config.lse.map(|_| Default::default()), | ||
| 254 | ); | ||
| 255 | |||
| 256 | let wait_states = match config.voltage_scale { | ||
| 257 | VoltageScale::RANGE1 => match sys_clk { | ||
| 258 | ..=16_000_000 => 0, | ||
| 259 | _ => 1, | ||
| 260 | }, | ||
| 261 | VoltageScale::RANGE2 => match sys_clk { | ||
| 262 | ..=8_000_000 => 0, | ||
| 263 | _ => 1, | ||
| 264 | }, | ||
| 265 | VoltageScale::RANGE3 => 0, | ||
| 266 | _ => unreachable!(), | ||
| 267 | }; | ||
| 268 | FLASH.acr().modify(|w| { | ||
| 269 | w.set_latency(wait_states != 0); | ||
| 270 | }); | ||
| 271 | |||
| 272 | RCC.cfgr().modify(|w| { | ||
| 273 | w.set_sw(sw); | ||
| 274 | w.set_hpre(config.ahb_pre.into()); | ||
| 275 | w.set_ppre1(config.apb1_pre.into()); | ||
| 276 | w.set_ppre2(config.apb2_pre.into()); | ||
| 277 | }); | ||
| 278 | |||
| 279 | let ahb_freq: u32 = match config.ahb_pre { | ||
| 280 | AHBPrescaler::DIV1 => sys_clk, | ||
| 281 | pre => { | ||
| 282 | let pre: Hpre = pre.into(); | ||
| 283 | let pre = 1 << (pre.to_bits() as u32 - 7); | ||
| 284 | sys_clk / pre | ||
| 285 | } | ||
| 286 | }; | ||
| 287 | |||
| 288 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 289 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 290 | pre => { | ||
| 291 | let pre: Ppre = pre.into(); | ||
| 292 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 293 | let freq = ahb_freq / pre as u32; | ||
| 294 | (freq, freq * 2) | ||
| 295 | } | ||
| 296 | }; | ||
| 297 | |||
| 298 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 299 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 300 | pre => { | ||
| 301 | let pre: Ppre = pre.into(); | ||
| 302 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 303 | let freq = ahb_freq / pre as u32; | ||
| 304 | (freq, freq * 2) | ||
| 305 | } | ||
| 306 | }; | ||
| 307 | |||
| 308 | #[cfg(crs)] | ||
| 309 | if config.enable_hsi48 { | ||
| 310 | // Reset CRS peripheral | ||
| 311 | RCC.apb1rstr().modify(|w| w.set_crsrst(true)); | ||
| 312 | RCC.apb1rstr().modify(|w| w.set_crsrst(false)); | ||
| 313 | |||
| 314 | // Enable CRS peripheral | ||
| 315 | RCC.apb1enr().modify(|w| w.set_crsen(true)); | ||
| 316 | |||
| 317 | // Initialize CRS | ||
| 318 | CRS.cfgr().write(|w| | ||
| 319 | |||
| 320 | // Select LSE as synchronization source | ||
| 321 | w.set_syncsrc(crs::vals::Syncsrc::LSE)); | ||
| 322 | CRS.cr().modify(|w| { | ||
| 323 | w.set_autotrimen(true); | ||
| 324 | w.set_cen(true); | ||
| 325 | }); | ||
| 326 | |||
| 327 | // Enable VREFINT reference for HSI48 oscillator | ||
| 328 | SYSCFG.cfgr3().modify(|w| { | ||
| 329 | w.set_enref_hsi48(true); | ||
| 330 | w.set_en_vrefint(true); | ||
| 331 | }); | ||
| 332 | |||
| 333 | // Select HSI48 as USB clock | ||
| 334 | RCC.ccipr().modify(|w| w.set_hsi48msel(true)); | ||
| 335 | |||
| 336 | // Enable dedicated USB clock | ||
| 337 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 338 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 339 | } | ||
| 340 | |||
| 341 | set_freqs(Clocks { | ||
| 342 | sys: Hertz(sys_clk), | ||
| 343 | ahb1: Hertz(ahb_freq), | ||
| 344 | apb1: Hertz(apb1_freq), | ||
| 345 | apb2: Hertz(apb2_freq), | ||
| 346 | apb1_tim: Hertz(apb1_tim_freq), | ||
| 347 | apb2_tim: Hertz(apb2_tim_freq), | ||
| 348 | }); | ||
| 349 | } | ||
diff --git a/embassy-stm32/src/rcc/l0l1.rs b/embassy-stm32/src/rcc/l0l1.rs new file mode 100644 index 000000000..f10c5962a --- /dev/null +++ b/embassy-stm32/src/rcc/l0l1.rs | |||
| @@ -0,0 +1,219 @@ | |||
| 1 | pub use crate::pac::pwr::vals::Vos as VoltageScale; | ||
| 2 | pub use crate::pac::rcc::vals::{ | ||
| 3 | Hpre as AHBPrescaler, Msirange as MSIRange, Plldiv as PLLDiv, Pllmul as PLLMul, Ppre as APBPrescaler, | ||
| 4 | }; | ||
| 5 | use crate::pac::rcc::vals::{Pllsrc, Sw}; | ||
| 6 | #[cfg(crs)] | ||
| 7 | use crate::pac::{crs, CRS, SYSCFG}; | ||
| 8 | use crate::pac::{FLASH, PWR, RCC}; | ||
| 9 | use crate::rcc::{set_freqs, Clocks}; | ||
| 10 | use crate::time::Hertz; | ||
| 11 | |||
| 12 | /// HSI speed | ||
| 13 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 14 | |||
| 15 | /// System clock mux source | ||
| 16 | #[derive(Clone, Copy)] | ||
| 17 | pub enum ClockSrc { | ||
| 18 | MSI(MSIRange), | ||
| 19 | PLL(PLLSource, PLLMul, PLLDiv), | ||
| 20 | HSE(Hertz), | ||
| 21 | HSI16, | ||
| 22 | } | ||
| 23 | |||
| 24 | /// PLL clock input source | ||
| 25 | #[derive(Clone, Copy)] | ||
| 26 | pub enum PLLSource { | ||
| 27 | HSI16, | ||
| 28 | HSE(Hertz), | ||
| 29 | } | ||
| 30 | |||
| 31 | impl From<PLLSource> for Pllsrc { | ||
| 32 | fn from(val: PLLSource) -> Pllsrc { | ||
| 33 | match val { | ||
| 34 | PLLSource::HSI16 => Pllsrc::HSI, | ||
| 35 | PLLSource::HSE(_) => Pllsrc::HSE, | ||
| 36 | } | ||
| 37 | } | ||
| 38 | } | ||
| 39 | |||
| 40 | /// Clocks configutation | ||
| 41 | pub struct Config { | ||
| 42 | pub mux: ClockSrc, | ||
| 43 | pub ahb_pre: AHBPrescaler, | ||
| 44 | pub apb1_pre: APBPrescaler, | ||
| 45 | pub apb2_pre: APBPrescaler, | ||
| 46 | #[cfg(crs)] | ||
| 47 | pub enable_hsi48: bool, | ||
| 48 | pub ls: super::LsConfig, | ||
| 49 | pub voltage_scale: VoltageScale, | ||
| 50 | } | ||
| 51 | |||
| 52 | impl Default for Config { | ||
| 53 | #[inline] | ||
| 54 | fn default() -> Config { | ||
| 55 | Config { | ||
| 56 | mux: ClockSrc::MSI(MSIRange::RANGE5), | ||
| 57 | ahb_pre: AHBPrescaler::DIV1, | ||
| 58 | apb1_pre: APBPrescaler::DIV1, | ||
| 59 | apb2_pre: APBPrescaler::DIV1, | ||
| 60 | #[cfg(crs)] | ||
| 61 | enable_hsi48: false, | ||
| 62 | voltage_scale: VoltageScale::RANGE1, | ||
| 63 | ls: Default::default(), | ||
| 64 | } | ||
| 65 | } | ||
| 66 | } | ||
| 67 | |||
| 68 | pub(crate) unsafe fn init(config: Config) { | ||
| 69 | // Set voltage scale | ||
| 70 | while PWR.csr().read().vosf() {} | ||
| 71 | PWR.cr().write(|w| w.set_vos(config.voltage_scale)); | ||
| 72 | while PWR.csr().read().vosf() {} | ||
| 73 | |||
| 74 | let (sys_clk, sw) = match config.mux { | ||
| 75 | ClockSrc::MSI(range) => { | ||
| 76 | // Set MSI range | ||
| 77 | RCC.icscr().write(|w| w.set_msirange(range)); | ||
| 78 | |||
| 79 | // Enable MSI | ||
| 80 | RCC.cr().write(|w| w.set_msion(true)); | ||
| 81 | while !RCC.cr().read().msirdy() {} | ||
| 82 | |||
| 83 | let freq = 32_768 * (1 << (range as u8 + 1)); | ||
| 84 | (Hertz(freq), Sw::MSI) | ||
| 85 | } | ||
| 86 | ClockSrc::HSI16 => { | ||
| 87 | // Enable HSI16 | ||
| 88 | RCC.cr().write(|w| w.set_hsi16on(true)); | ||
| 89 | while !RCC.cr().read().hsi16rdy() {} | ||
| 90 | |||
| 91 | (HSI_FREQ, Sw::HSI) | ||
| 92 | } | ||
| 93 | ClockSrc::HSE(freq) => { | ||
| 94 | // Enable HSE | ||
| 95 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 96 | while !RCC.cr().read().hserdy() {} | ||
| 97 | |||
| 98 | (freq, Sw::HSE) | ||
| 99 | } | ||
| 100 | ClockSrc::PLL(src, mul, div) => { | ||
| 101 | let freq = match src { | ||
| 102 | PLLSource::HSE(freq) => { | ||
| 103 | // Enable HSE | ||
| 104 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 105 | while !RCC.cr().read().hserdy() {} | ||
| 106 | freq | ||
| 107 | } | ||
| 108 | PLLSource::HSI16 => { | ||
| 109 | // Enable HSI | ||
| 110 | RCC.cr().write(|w| w.set_hsi16on(true)); | ||
| 111 | while !RCC.cr().read().hsi16rdy() {} | ||
| 112 | HSI_FREQ | ||
| 113 | } | ||
| 114 | }; | ||
| 115 | |||
| 116 | // Disable PLL | ||
| 117 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 118 | while RCC.cr().read().pllrdy() {} | ||
| 119 | |||
| 120 | let freq = freq * mul / div; | ||
| 121 | |||
| 122 | assert!(freq <= Hertz(32_000_000)); | ||
| 123 | |||
| 124 | RCC.cfgr().write(move |w| { | ||
| 125 | w.set_pllmul(mul); | ||
| 126 | w.set_plldiv(div); | ||
| 127 | w.set_pllsrc(src.into()); | ||
| 128 | }); | ||
| 129 | |||
| 130 | // Enable PLL | ||
| 131 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 132 | while !RCC.cr().read().pllrdy() {} | ||
| 133 | |||
| 134 | (freq, Sw::PLL1_P) | ||
| 135 | } | ||
| 136 | }; | ||
| 137 | |||
| 138 | let rtc = config.ls.init(); | ||
| 139 | |||
| 140 | let wait_states = match (config.voltage_scale, sys_clk.0) { | ||
| 141 | (VoltageScale::RANGE1, ..=16_000_000) => 0, | ||
| 142 | (VoltageScale::RANGE2, ..=8_000_000) => 0, | ||
| 143 | (VoltageScale::RANGE3, ..=4_200_000) => 0, | ||
| 144 | _ => 1, | ||
| 145 | }; | ||
| 146 | |||
| 147 | #[cfg(stm32l1)] | ||
| 148 | FLASH.acr().write(|w| w.set_acc64(true)); | ||
| 149 | FLASH.acr().modify(|w| w.set_prften(true)); | ||
| 150 | FLASH.acr().modify(|w| w.set_latency(wait_states != 0)); | ||
| 151 | |||
| 152 | RCC.cfgr().modify(|w| { | ||
| 153 | w.set_sw(sw); | ||
| 154 | w.set_hpre(config.ahb_pre); | ||
| 155 | w.set_ppre1(config.apb1_pre); | ||
| 156 | w.set_ppre2(config.apb2_pre); | ||
| 157 | }); | ||
| 158 | |||
| 159 | let ahb_freq = sys_clk / config.ahb_pre; | ||
| 160 | |||
| 161 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 162 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 163 | pre => { | ||
| 164 | let freq = ahb_freq / pre; | ||
| 165 | (freq, freq * 2u32) | ||
| 166 | } | ||
| 167 | }; | ||
| 168 | |||
| 169 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 170 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 171 | pre => { | ||
| 172 | let freq = ahb_freq / pre; | ||
| 173 | (freq, freq * 2u32) | ||
| 174 | } | ||
| 175 | }; | ||
| 176 | |||
| 177 | #[cfg(crs)] | ||
| 178 | if config.enable_hsi48 { | ||
| 179 | // Reset CRS peripheral | ||
| 180 | RCC.apb1rstr().modify(|w| w.set_crsrst(true)); | ||
| 181 | RCC.apb1rstr().modify(|w| w.set_crsrst(false)); | ||
| 182 | |||
| 183 | // Enable CRS peripheral | ||
| 184 | RCC.apb1enr().modify(|w| w.set_crsen(true)); | ||
| 185 | |||
| 186 | // Initialize CRS | ||
| 187 | CRS.cfgr().write(|w| | ||
| 188 | |||
| 189 | // Select LSE as synchronization source | ||
| 190 | w.set_syncsrc(crs::vals::Syncsrc::LSE)); | ||
| 191 | CRS.cr().modify(|w| { | ||
| 192 | w.set_autotrimen(true); | ||
| 193 | w.set_cen(true); | ||
| 194 | }); | ||
| 195 | |||
| 196 | // Enable VREFINT reference for HSI48 oscillator | ||
| 197 | SYSCFG.cfgr3().modify(|w| { | ||
| 198 | w.set_enref_hsi48(true); | ||
| 199 | w.set_en_vrefint(true); | ||
| 200 | }); | ||
| 201 | |||
| 202 | // Select HSI48 as USB clock | ||
| 203 | RCC.ccipr().modify(|w| w.set_hsi48msel(true)); | ||
| 204 | |||
| 205 | // Enable dedicated USB clock | ||
| 206 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 207 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 208 | } | ||
| 209 | |||
| 210 | set_freqs(Clocks { | ||
| 211 | sys: sys_clk, | ||
| 212 | hclk1: ahb_freq, | ||
| 213 | pclk1: apb1_freq, | ||
| 214 | pclk2: apb2_freq, | ||
| 215 | pclk1_tim: apb1_tim_freq, | ||
| 216 | pclk2_tim: apb2_tim_freq, | ||
| 217 | rtc, | ||
| 218 | }); | ||
| 219 | } | ||
diff --git a/embassy-stm32/src/rcc/l1.rs b/embassy-stm32/src/rcc/l1.rs deleted file mode 100644 index 90524fb37..000000000 --- a/embassy-stm32/src/rcc/l1.rs +++ /dev/null | |||
| @@ -1,279 +0,0 @@ | |||
| 1 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 2 | use crate::pac::rcc::vals::{Hpre, Msirange, Plldiv, Pllmul, Pllsrc, Ppre, Sw}; | ||
| 3 | use crate::pac::{FLASH, RCC}; | ||
| 4 | use crate::rcc::{set_freqs, Clocks}; | ||
| 5 | use crate::time::Hertz; | ||
| 6 | |||
| 7 | /// HSI speed | ||
| 8 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 9 | |||
| 10 | /// LSI speed | ||
| 11 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 12 | |||
| 13 | /// System clock mux source | ||
| 14 | #[derive(Clone, Copy)] | ||
| 15 | pub enum ClockSrc { | ||
| 16 | MSI(MSIRange), | ||
| 17 | PLL(PLLSource, PLLMul, PLLDiv), | ||
| 18 | HSE(Hertz), | ||
| 19 | HSI, | ||
| 20 | } | ||
| 21 | |||
| 22 | /// MSI Clock Range | ||
| 23 | /// | ||
| 24 | /// These ranges control the frequency of the MSI. Internally, these ranges map | ||
| 25 | /// to the `MSIRANGE` bits in the `RCC_ICSCR` register. | ||
| 26 | #[derive(Clone, Copy)] | ||
| 27 | pub enum MSIRange { | ||
| 28 | /// Around 65.536 kHz | ||
| 29 | Range0, | ||
| 30 | /// Around 131.072 kHz | ||
| 31 | Range1, | ||
| 32 | /// Around 262.144 kHz | ||
| 33 | Range2, | ||
| 34 | /// Around 524.288 kHz | ||
| 35 | Range3, | ||
| 36 | /// Around 1.048 MHz | ||
| 37 | Range4, | ||
| 38 | /// Around 2.097 MHz (reset value) | ||
| 39 | Range5, | ||
| 40 | /// Around 4.194 MHz | ||
| 41 | Range6, | ||
| 42 | } | ||
| 43 | |||
| 44 | impl Default for MSIRange { | ||
| 45 | fn default() -> MSIRange { | ||
| 46 | MSIRange::Range5 | ||
| 47 | } | ||
| 48 | } | ||
| 49 | |||
| 50 | /// PLL divider | ||
| 51 | #[derive(Clone, Copy)] | ||
| 52 | pub enum PLLDiv { | ||
| 53 | Div2, | ||
| 54 | Div3, | ||
| 55 | Div4, | ||
| 56 | } | ||
| 57 | |||
| 58 | /// PLL multiplier | ||
| 59 | #[derive(Clone, Copy)] | ||
| 60 | pub enum PLLMul { | ||
| 61 | Mul3, | ||
| 62 | Mul4, | ||
| 63 | Mul6, | ||
| 64 | Mul8, | ||
| 65 | Mul12, | ||
| 66 | Mul16, | ||
| 67 | Mul24, | ||
| 68 | Mul32, | ||
| 69 | Mul48, | ||
| 70 | } | ||
| 71 | |||
| 72 | /// PLL clock input source | ||
| 73 | #[derive(Clone, Copy)] | ||
| 74 | pub enum PLLSource { | ||
| 75 | HSI, | ||
| 76 | HSE(Hertz), | ||
| 77 | } | ||
| 78 | |||
| 79 | impl From<PLLMul> for Pllmul { | ||
| 80 | fn from(val: PLLMul) -> Pllmul { | ||
| 81 | match val { | ||
| 82 | PLLMul::Mul3 => Pllmul::MUL3, | ||
| 83 | PLLMul::Mul4 => Pllmul::MUL4, | ||
| 84 | PLLMul::Mul6 => Pllmul::MUL6, | ||
| 85 | PLLMul::Mul8 => Pllmul::MUL8, | ||
| 86 | PLLMul::Mul12 => Pllmul::MUL12, | ||
| 87 | PLLMul::Mul16 => Pllmul::MUL16, | ||
| 88 | PLLMul::Mul24 => Pllmul::MUL24, | ||
| 89 | PLLMul::Mul32 => Pllmul::MUL32, | ||
| 90 | PLLMul::Mul48 => Pllmul::MUL48, | ||
| 91 | } | ||
| 92 | } | ||
| 93 | } | ||
| 94 | |||
| 95 | impl From<PLLDiv> for Plldiv { | ||
| 96 | fn from(val: PLLDiv) -> Plldiv { | ||
| 97 | match val { | ||
| 98 | PLLDiv::Div2 => Plldiv::DIV2, | ||
| 99 | PLLDiv::Div3 => Plldiv::DIV3, | ||
| 100 | PLLDiv::Div4 => Plldiv::DIV4, | ||
| 101 | } | ||
| 102 | } | ||
| 103 | } | ||
| 104 | |||
| 105 | impl From<PLLSource> for Pllsrc { | ||
| 106 | fn from(val: PLLSource) -> Pllsrc { | ||
| 107 | match val { | ||
| 108 | PLLSource::HSI => Pllsrc::HSI, | ||
| 109 | PLLSource::HSE(_) => Pllsrc::HSE, | ||
| 110 | } | ||
| 111 | } | ||
| 112 | } | ||
| 113 | |||
| 114 | impl From<MSIRange> for Msirange { | ||
| 115 | fn from(val: MSIRange) -> Msirange { | ||
| 116 | match val { | ||
| 117 | MSIRange::Range0 => Msirange::RANGE0, | ||
| 118 | MSIRange::Range1 => Msirange::RANGE1, | ||
| 119 | MSIRange::Range2 => Msirange::RANGE2, | ||
| 120 | MSIRange::Range3 => Msirange::RANGE3, | ||
| 121 | MSIRange::Range4 => Msirange::RANGE4, | ||
| 122 | MSIRange::Range5 => Msirange::RANGE5, | ||
| 123 | MSIRange::Range6 => Msirange::RANGE6, | ||
| 124 | } | ||
| 125 | } | ||
| 126 | } | ||
| 127 | |||
| 128 | /// Clocks configutation | ||
| 129 | pub struct Config { | ||
| 130 | pub mux: ClockSrc, | ||
| 131 | pub ahb_pre: AHBPrescaler, | ||
| 132 | pub apb1_pre: APBPrescaler, | ||
| 133 | pub apb2_pre: APBPrescaler, | ||
| 134 | } | ||
| 135 | |||
| 136 | impl Default for Config { | ||
| 137 | #[inline] | ||
| 138 | fn default() -> Config { | ||
| 139 | Config { | ||
| 140 | mux: ClockSrc::MSI(MSIRange::default()), | ||
| 141 | ahb_pre: AHBPrescaler::DIV1, | ||
| 142 | apb1_pre: APBPrescaler::DIV1, | ||
| 143 | apb2_pre: APBPrescaler::DIV1, | ||
| 144 | } | ||
| 145 | } | ||
| 146 | } | ||
| 147 | |||
| 148 | pub(crate) unsafe fn init(config: Config) { | ||
| 149 | let (sys_clk, sw) = match config.mux { | ||
| 150 | ClockSrc::MSI(range) => { | ||
| 151 | // Set MSI range | ||
| 152 | RCC.icscr().write(|w| w.set_msirange(range.into())); | ||
| 153 | |||
| 154 | // Enable MSI | ||
| 155 | RCC.cr().write(|w| w.set_msion(true)); | ||
| 156 | while !RCC.cr().read().msirdy() {} | ||
| 157 | |||
| 158 | let freq = 32_768 * (1 << (range as u8 + 1)); | ||
| 159 | (freq, Sw::MSI) | ||
| 160 | } | ||
| 161 | ClockSrc::HSI => { | ||
| 162 | // Enable HSI | ||
| 163 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 164 | while !RCC.cr().read().hsirdy() {} | ||
| 165 | |||
| 166 | (HSI_FREQ.0, Sw::HSI) | ||
| 167 | } | ||
| 168 | ClockSrc::HSE(freq) => { | ||
| 169 | // Enable HSE | ||
| 170 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 171 | while !RCC.cr().read().hserdy() {} | ||
| 172 | |||
| 173 | (freq.0, Sw::HSE) | ||
| 174 | } | ||
| 175 | ClockSrc::PLL(src, mul, div) => { | ||
| 176 | let freq = match src { | ||
| 177 | PLLSource::HSE(freq) => { | ||
| 178 | // Enable HSE | ||
| 179 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 180 | while !RCC.cr().read().hserdy() {} | ||
| 181 | freq.0 | ||
| 182 | } | ||
| 183 | PLLSource::HSI => { | ||
| 184 | // Enable HSI | ||
| 185 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 186 | while !RCC.cr().read().hsirdy() {} | ||
| 187 | HSI_FREQ.0 | ||
| 188 | } | ||
| 189 | }; | ||
| 190 | |||
| 191 | // Disable PLL | ||
| 192 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 193 | while RCC.cr().read().pllrdy() {} | ||
| 194 | |||
| 195 | let freq = match mul { | ||
| 196 | PLLMul::Mul3 => freq * 3, | ||
| 197 | PLLMul::Mul4 => freq * 4, | ||
| 198 | PLLMul::Mul6 => freq * 6, | ||
| 199 | PLLMul::Mul8 => freq * 8, | ||
| 200 | PLLMul::Mul12 => freq * 12, | ||
| 201 | PLLMul::Mul16 => freq * 16, | ||
| 202 | PLLMul::Mul24 => freq * 24, | ||
| 203 | PLLMul::Mul32 => freq * 32, | ||
| 204 | PLLMul::Mul48 => freq * 48, | ||
| 205 | }; | ||
| 206 | |||
| 207 | let freq = match div { | ||
| 208 | PLLDiv::Div2 => freq / 2, | ||
| 209 | PLLDiv::Div3 => freq / 3, | ||
| 210 | PLLDiv::Div4 => freq / 4, | ||
| 211 | }; | ||
| 212 | assert!(freq <= 32_000_000); | ||
| 213 | |||
| 214 | RCC.cfgr().write(move |w| { | ||
| 215 | w.set_pllmul(mul.into()); | ||
| 216 | w.set_plldiv(div.into()); | ||
| 217 | w.set_pllsrc(src.into()); | ||
| 218 | }); | ||
| 219 | |||
| 220 | // Enable PLL | ||
| 221 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 222 | while !RCC.cr().read().pllrdy() {} | ||
| 223 | |||
| 224 | (freq, Sw::PLL) | ||
| 225 | } | ||
| 226 | }; | ||
| 227 | |||
| 228 | // Set flash 64-bit access, prefetch and wait states | ||
| 229 | if sys_clk >= 16_000_000 { | ||
| 230 | FLASH.acr().write(|w| w.set_acc64(true)); | ||
| 231 | FLASH.acr().modify(|w| w.set_prften(true)); | ||
| 232 | FLASH.acr().modify(|w| w.set_latency(true)); | ||
| 233 | } | ||
| 234 | |||
| 235 | RCC.cfgr().modify(|w| { | ||
| 236 | w.set_sw(sw); | ||
| 237 | w.set_hpre(config.ahb_pre.into()); | ||
| 238 | w.set_ppre1(config.apb1_pre.into()); | ||
| 239 | w.set_ppre2(config.apb2_pre.into()); | ||
| 240 | }); | ||
| 241 | |||
| 242 | let ahb_freq: u32 = match config.ahb_pre { | ||
| 243 | AHBPrescaler::DIV1 => sys_clk, | ||
| 244 | pre => { | ||
| 245 | let pre: Hpre = pre.into(); | ||
| 246 | let pre = 1 << (pre.to_bits() as u32 - 7); | ||
| 247 | sys_clk / pre | ||
| 248 | } | ||
| 249 | }; | ||
| 250 | |||
| 251 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 252 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 253 | pre => { | ||
| 254 | let pre: Ppre = pre.into(); | ||
| 255 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 256 | let freq = ahb_freq / pre as u32; | ||
| 257 | (freq, freq * 2) | ||
| 258 | } | ||
| 259 | }; | ||
| 260 | |||
| 261 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 262 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 263 | pre => { | ||
| 264 | let pre: Ppre = pre.into(); | ||
| 265 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 266 | let freq = ahb_freq / pre as u32; | ||
| 267 | (freq, freq * 2) | ||
| 268 | } | ||
| 269 | }; | ||
| 270 | |||
| 271 | set_freqs(Clocks { | ||
| 272 | sys: Hertz(sys_clk), | ||
| 273 | ahb1: Hertz(ahb_freq), | ||
| 274 | apb1: Hertz(apb1_freq), | ||
| 275 | apb2: Hertz(apb2_freq), | ||
| 276 | apb1_tim: Hertz(apb1_tim_freq), | ||
| 277 | apb2_tim: Hertz(apb2_tim_freq), | ||
| 278 | }); | ||
| 279 | } | ||
diff --git a/embassy-stm32/src/rcc/l4.rs b/embassy-stm32/src/rcc/l4.rs deleted file mode 100644 index 6f1f7458c..000000000 --- a/embassy-stm32/src/rcc/l4.rs +++ /dev/null | |||
| @@ -1,619 +0,0 @@ | |||
| 1 | use core::marker::PhantomData; | ||
| 2 | |||
| 3 | use embassy_hal_internal::into_ref; | ||
| 4 | use stm32_metapac::rcc::regs::Cfgr; | ||
| 5 | use stm32_metapac::rcc::vals::{Mcopre, Mcosel}; | ||
| 6 | |||
| 7 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 8 | use crate::gpio::sealed::AFType; | ||
| 9 | use crate::gpio::Speed; | ||
| 10 | use crate::pac::rcc::vals::{Hpre, Msirange, Pllsrc, Ppre, Sw}; | ||
| 11 | use crate::pac::{FLASH, RCC}; | ||
| 12 | use crate::rcc::bd::{BackupDomain, RtcClockSource}; | ||
| 13 | use crate::rcc::{set_freqs, Clocks}; | ||
| 14 | use crate::time::Hertz; | ||
| 15 | use crate::{peripherals, Peripheral}; | ||
| 16 | |||
| 17 | /// HSI speed | ||
| 18 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 19 | |||
| 20 | /// LSI speed | ||
| 21 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 22 | |||
| 23 | /// System clock mux source | ||
| 24 | #[derive(Clone, Copy)] | ||
| 25 | pub enum ClockSrc { | ||
| 26 | MSI(MSIRange), | ||
| 27 | PLL(PLLSource, PLLClkDiv, PLLSrcDiv, PLLMul, Option<PLL48Div>), | ||
| 28 | HSE(Hertz), | ||
| 29 | HSI16, | ||
| 30 | } | ||
| 31 | |||
| 32 | /// MSI Clock Range | ||
| 33 | /// | ||
| 34 | /// These ranges control the frequency of the MSI. Internally, these ranges map | ||
| 35 | /// to the `MSIRANGE` bits in the `RCC_ICSCR` register. | ||
| 36 | #[derive(Clone, Copy)] | ||
| 37 | pub enum MSIRange { | ||
| 38 | /// Around 100 kHz | ||
| 39 | Range0, | ||
| 40 | /// Around 200 kHz | ||
| 41 | Range1, | ||
| 42 | /// Around 400 kHz | ||
| 43 | Range2, | ||
| 44 | /// Around 800 kHz | ||
| 45 | Range3, | ||
| 46 | /// Around 1 MHz | ||
| 47 | Range4, | ||
| 48 | /// Around 2 MHz | ||
| 49 | Range5, | ||
| 50 | /// Around 4 MHz (reset value) | ||
| 51 | Range6, | ||
| 52 | /// Around 8 MHz | ||
| 53 | Range7, | ||
| 54 | /// Around 16 MHz | ||
| 55 | Range8, | ||
| 56 | /// Around 24 MHz | ||
| 57 | Range9, | ||
| 58 | /// Around 32 MHz | ||
| 59 | Range10, | ||
| 60 | /// Around 48 MHz | ||
| 61 | Range11, | ||
| 62 | } | ||
| 63 | |||
| 64 | impl Default for MSIRange { | ||
| 65 | fn default() -> MSIRange { | ||
| 66 | MSIRange::Range6 | ||
| 67 | } | ||
| 68 | } | ||
| 69 | |||
| 70 | pub type PLL48Div = PLLClkDiv; | ||
| 71 | pub type PLLSAI1RDiv = PLLClkDiv; | ||
| 72 | pub type PLLSAI1QDiv = PLLClkDiv; | ||
| 73 | pub type PLLSAI1PDiv = PLLClkDiv; | ||
| 74 | |||
| 75 | /// PLL divider | ||
| 76 | #[derive(Clone, Copy)] | ||
| 77 | pub enum PLLDiv { | ||
| 78 | Div2, | ||
| 79 | Div3, | ||
| 80 | Div4, | ||
| 81 | } | ||
| 82 | |||
| 83 | /// PLL clock input source | ||
| 84 | #[derive(Clone, Copy)] | ||
| 85 | pub enum PLLSource { | ||
| 86 | HSI16, | ||
| 87 | HSE(Hertz), | ||
| 88 | MSI(MSIRange), | ||
| 89 | } | ||
| 90 | |||
| 91 | seq_macro::seq!(N in 8..=86 { | ||
| 92 | #[derive(Clone, Copy)] | ||
| 93 | pub enum PLLMul { | ||
| 94 | #( | ||
| 95 | Mul~N, | ||
| 96 | )* | ||
| 97 | } | ||
| 98 | |||
| 99 | impl From<PLLMul> for u8 { | ||
| 100 | fn from(val: PLLMul) -> u8 { | ||
| 101 | match val { | ||
| 102 | #( | ||
| 103 | PLLMul::Mul~N => N, | ||
| 104 | )* | ||
| 105 | } | ||
| 106 | } | ||
| 107 | } | ||
| 108 | |||
| 109 | impl PLLMul { | ||
| 110 | pub fn to_mul(self) -> u32 { | ||
| 111 | match self { | ||
| 112 | #( | ||
| 113 | PLLMul::Mul~N => N, | ||
| 114 | )* | ||
| 115 | } | ||
| 116 | } | ||
| 117 | } | ||
| 118 | }); | ||
| 119 | |||
| 120 | #[derive(Clone, Copy)] | ||
| 121 | pub enum PLLClkDiv { | ||
| 122 | Div2, | ||
| 123 | Div4, | ||
| 124 | Div6, | ||
| 125 | Div8, | ||
| 126 | } | ||
| 127 | |||
| 128 | impl PLLClkDiv { | ||
| 129 | pub fn to_div(self) -> u32 { | ||
| 130 | let val: u8 = self.into(); | ||
| 131 | (val as u32 + 1) * 2 | ||
| 132 | } | ||
| 133 | } | ||
| 134 | |||
| 135 | impl From<PLLClkDiv> for u8 { | ||
| 136 | fn from(val: PLLClkDiv) -> u8 { | ||
| 137 | match val { | ||
| 138 | PLLClkDiv::Div2 => 0b00, | ||
| 139 | PLLClkDiv::Div4 => 0b01, | ||
| 140 | PLLClkDiv::Div6 => 0b10, | ||
| 141 | PLLClkDiv::Div8 => 0b11, | ||
| 142 | } | ||
| 143 | } | ||
| 144 | } | ||
| 145 | |||
| 146 | #[derive(Clone, Copy)] | ||
| 147 | pub enum PLLSrcDiv { | ||
| 148 | Div1, | ||
| 149 | Div2, | ||
| 150 | Div3, | ||
| 151 | Div4, | ||
| 152 | Div5, | ||
| 153 | Div6, | ||
| 154 | Div7, | ||
| 155 | Div8, | ||
| 156 | } | ||
| 157 | |||
| 158 | impl PLLSrcDiv { | ||
| 159 | pub fn to_div(self) -> u32 { | ||
| 160 | let val: u8 = self.into(); | ||
| 161 | val as u32 + 1 | ||
| 162 | } | ||
| 163 | } | ||
| 164 | |||
| 165 | impl From<PLLSrcDiv> for u8 { | ||
| 166 | fn from(val: PLLSrcDiv) -> u8 { | ||
| 167 | match val { | ||
| 168 | PLLSrcDiv::Div1 => 0b000, | ||
| 169 | PLLSrcDiv::Div2 => 0b001, | ||
| 170 | PLLSrcDiv::Div3 => 0b010, | ||
| 171 | PLLSrcDiv::Div4 => 0b011, | ||
| 172 | PLLSrcDiv::Div5 => 0b100, | ||
| 173 | PLLSrcDiv::Div6 => 0b101, | ||
| 174 | PLLSrcDiv::Div7 => 0b110, | ||
| 175 | PLLSrcDiv::Div8 => 0b111, | ||
| 176 | } | ||
| 177 | } | ||
| 178 | } | ||
| 179 | |||
| 180 | impl From<PLLSource> for Pllsrc { | ||
| 181 | fn from(val: PLLSource) -> Pllsrc { | ||
| 182 | match val { | ||
| 183 | PLLSource::HSI16 => Pllsrc::HSI16, | ||
| 184 | PLLSource::HSE(_) => Pllsrc::HSE, | ||
| 185 | PLLSource::MSI(_) => Pllsrc::MSI, | ||
| 186 | } | ||
| 187 | } | ||
| 188 | } | ||
| 189 | |||
| 190 | impl From<MSIRange> for Msirange { | ||
| 191 | fn from(val: MSIRange) -> Msirange { | ||
| 192 | match val { | ||
| 193 | MSIRange::Range0 => Msirange::RANGE100K, | ||
| 194 | MSIRange::Range1 => Msirange::RANGE200K, | ||
| 195 | MSIRange::Range2 => Msirange::RANGE400K, | ||
| 196 | MSIRange::Range3 => Msirange::RANGE800K, | ||
| 197 | MSIRange::Range4 => Msirange::RANGE1M, | ||
| 198 | MSIRange::Range5 => Msirange::RANGE2M, | ||
| 199 | MSIRange::Range6 => Msirange::RANGE4M, | ||
| 200 | MSIRange::Range7 => Msirange::RANGE8M, | ||
| 201 | MSIRange::Range8 => Msirange::RANGE16M, | ||
| 202 | MSIRange::Range9 => Msirange::RANGE24M, | ||
| 203 | MSIRange::Range10 => Msirange::RANGE32M, | ||
| 204 | MSIRange::Range11 => Msirange::RANGE48M, | ||
| 205 | } | ||
| 206 | } | ||
| 207 | } | ||
| 208 | |||
| 209 | impl From<MSIRange> for u32 { | ||
| 210 | fn from(val: MSIRange) -> u32 { | ||
| 211 | match val { | ||
| 212 | MSIRange::Range0 => 100_000, | ||
| 213 | MSIRange::Range1 => 200_000, | ||
| 214 | MSIRange::Range2 => 400_000, | ||
| 215 | MSIRange::Range3 => 800_000, | ||
| 216 | MSIRange::Range4 => 1_000_000, | ||
| 217 | MSIRange::Range5 => 2_000_000, | ||
| 218 | MSIRange::Range6 => 4_000_000, | ||
| 219 | MSIRange::Range7 => 8_000_000, | ||
| 220 | MSIRange::Range8 => 16_000_000, | ||
| 221 | MSIRange::Range9 => 24_000_000, | ||
| 222 | MSIRange::Range10 => 32_000_000, | ||
| 223 | MSIRange::Range11 => 48_000_000, | ||
| 224 | } | ||
| 225 | } | ||
| 226 | } | ||
| 227 | |||
| 228 | /// Clocks configutation | ||
| 229 | pub struct Config { | ||
| 230 | pub mux: ClockSrc, | ||
| 231 | pub ahb_pre: AHBPrescaler, | ||
| 232 | pub apb1_pre: APBPrescaler, | ||
| 233 | pub apb2_pre: APBPrescaler, | ||
| 234 | pub pllsai1: Option<( | ||
| 235 | PLLMul, | ||
| 236 | PLLSrcDiv, | ||
| 237 | Option<PLLSAI1RDiv>, | ||
| 238 | Option<PLLSAI1QDiv>, | ||
| 239 | Option<PLLSAI1PDiv>, | ||
| 240 | )>, | ||
| 241 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 242 | pub hsi48: bool, | ||
| 243 | pub rtc_mux: RtcClockSource, | ||
| 244 | pub lse: Option<Hertz>, | ||
| 245 | pub lsi: bool, | ||
| 246 | } | ||
| 247 | |||
| 248 | impl Default for Config { | ||
| 249 | #[inline] | ||
| 250 | fn default() -> Config { | ||
| 251 | Config { | ||
| 252 | mux: ClockSrc::MSI(MSIRange::Range6), | ||
| 253 | ahb_pre: AHBPrescaler::DIV1, | ||
| 254 | apb1_pre: APBPrescaler::DIV1, | ||
| 255 | apb2_pre: APBPrescaler::DIV1, | ||
| 256 | pllsai1: None, | ||
| 257 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 258 | hsi48: false, | ||
| 259 | rtc_mux: RtcClockSource::LSI, | ||
| 260 | lsi: true, | ||
| 261 | lse: None, | ||
| 262 | } | ||
| 263 | } | ||
| 264 | } | ||
| 265 | |||
| 266 | pub enum McoClock { | ||
| 267 | DIV1, | ||
| 268 | DIV2, | ||
| 269 | DIV4, | ||
| 270 | DIV8, | ||
| 271 | DIV16, | ||
| 272 | } | ||
| 273 | |||
| 274 | impl McoClock { | ||
| 275 | fn into_raw(&self) -> Mcopre { | ||
| 276 | match self { | ||
| 277 | McoClock::DIV1 => Mcopre::DIV1, | ||
| 278 | McoClock::DIV2 => Mcopre::DIV2, | ||
| 279 | McoClock::DIV4 => Mcopre::DIV4, | ||
| 280 | McoClock::DIV8 => Mcopre::DIV8, | ||
| 281 | McoClock::DIV16 => Mcopre::DIV16, | ||
| 282 | } | ||
| 283 | } | ||
| 284 | } | ||
| 285 | |||
| 286 | #[derive(Copy, Clone)] | ||
| 287 | pub enum Mco1Source { | ||
| 288 | Disabled, | ||
| 289 | Lse, | ||
| 290 | Lsi, | ||
| 291 | Hse, | ||
| 292 | Hsi16, | ||
| 293 | PllClk, | ||
| 294 | SysClk, | ||
| 295 | Msi, | ||
| 296 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 297 | Hsi48, | ||
| 298 | } | ||
| 299 | |||
| 300 | impl Default for Mco1Source { | ||
| 301 | fn default() -> Self { | ||
| 302 | Self::Hsi16 | ||
| 303 | } | ||
| 304 | } | ||
| 305 | |||
| 306 | pub trait McoSource { | ||
| 307 | type Raw; | ||
| 308 | |||
| 309 | fn into_raw(&self) -> Self::Raw; | ||
| 310 | } | ||
| 311 | |||
| 312 | impl McoSource for Mco1Source { | ||
| 313 | type Raw = Mcosel; | ||
| 314 | fn into_raw(&self) -> Self::Raw { | ||
| 315 | match self { | ||
| 316 | Mco1Source::Disabled => Mcosel::NOCLOCK, | ||
| 317 | Mco1Source::Lse => Mcosel::LSE, | ||
| 318 | Mco1Source::Lsi => Mcosel::LSI, | ||
| 319 | Mco1Source::Hse => Mcosel::HSE, | ||
| 320 | Mco1Source::Hsi16 => Mcosel::HSI16, | ||
| 321 | Mco1Source::PllClk => Mcosel::PLL, | ||
| 322 | Mco1Source::SysClk => Mcosel::SYSCLK, | ||
| 323 | Mco1Source::Msi => Mcosel::MSI, | ||
| 324 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 325 | Mco1Source::Hsi48 => Mcosel::HSI48, | ||
| 326 | } | ||
| 327 | } | ||
| 328 | } | ||
| 329 | |||
| 330 | pub(crate) mod sealed { | ||
| 331 | use stm32_metapac::rcc::vals::Mcopre; | ||
| 332 | pub trait McoInstance { | ||
| 333 | type Source; | ||
| 334 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: Mcopre); | ||
| 335 | } | ||
| 336 | } | ||
| 337 | |||
| 338 | pub trait McoInstance: sealed::McoInstance + 'static {} | ||
| 339 | |||
| 340 | pin_trait!(McoPin, McoInstance); | ||
| 341 | |||
| 342 | impl sealed::McoInstance for peripherals::MCO { | ||
| 343 | type Source = Mcosel; | ||
| 344 | |||
| 345 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: Mcopre) { | ||
| 346 | RCC.cfgr().modify(|w| { | ||
| 347 | w.set_mcosel(source); | ||
| 348 | w.set_mcopre(prescaler); | ||
| 349 | }); | ||
| 350 | |||
| 351 | match source { | ||
| 352 | Mcosel::HSI16 => { | ||
| 353 | RCC.cr().modify(|w| w.set_hsion(true)); | ||
| 354 | while !RCC.cr().read().hsirdy() {} | ||
| 355 | } | ||
| 356 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 357 | Mcosel::HSI48 => { | ||
| 358 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 359 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 360 | } | ||
| 361 | _ => {} | ||
| 362 | } | ||
| 363 | } | ||
| 364 | } | ||
| 365 | |||
| 366 | impl McoInstance for peripherals::MCO {} | ||
| 367 | |||
| 368 | pub struct Mco<'d, T: McoInstance> { | ||
| 369 | phantom: PhantomData<&'d mut T>, | ||
| 370 | } | ||
| 371 | |||
| 372 | impl<'d, T: McoInstance> Mco<'d, T> { | ||
| 373 | pub fn new( | ||
| 374 | _peri: impl Peripheral<P = T> + 'd, | ||
| 375 | pin: impl Peripheral<P = impl McoPin<T>> + 'd, | ||
| 376 | source: impl McoSource<Raw = T::Source>, | ||
| 377 | prescaler: McoClock, | ||
| 378 | ) -> Self { | ||
| 379 | into_ref!(pin); | ||
| 380 | |||
| 381 | critical_section::with(|_| unsafe { | ||
| 382 | T::apply_clock_settings(source.into_raw(), prescaler.into_raw()); | ||
| 383 | pin.set_as_af(pin.af_num(), AFType::OutputPushPull); | ||
| 384 | pin.set_speed(Speed::VeryHigh); | ||
| 385 | }); | ||
| 386 | |||
| 387 | Self { phantom: PhantomData } | ||
| 388 | } | ||
| 389 | } | ||
| 390 | |||
| 391 | pub(crate) unsafe fn init(config: Config) { | ||
| 392 | // Switch to MSI to prevent problems with PLL configuration. | ||
| 393 | if !RCC.cr().read().msion() { | ||
| 394 | // Turn on MSI and configure it to 4MHz. | ||
| 395 | RCC.cr().modify(|w| { | ||
| 396 | w.set_msirgsel(true); // MSI Range is provided by MSIRANGE[3:0]. | ||
| 397 | w.set_msirange(MSIRange::default().into()); | ||
| 398 | w.set_msipllen(false); | ||
| 399 | w.set_msion(true) | ||
| 400 | }); | ||
| 401 | |||
| 402 | // Wait until MSI is running | ||
| 403 | while !RCC.cr().read().msirdy() {} | ||
| 404 | } | ||
| 405 | if RCC.cfgr().read().sws() != Sw::MSI { | ||
| 406 | // Set MSI as a clock source, reset prescalers. | ||
| 407 | RCC.cfgr().write_value(Cfgr::default()); | ||
| 408 | // Wait for clock switch status bits to change. | ||
| 409 | while RCC.cfgr().read().sws() != Sw::MSI {} | ||
| 410 | } | ||
| 411 | |||
| 412 | BackupDomain::configure_ls(config.rtc_mux, config.lsi, config.lse.map(|_| Default::default())); | ||
| 413 | |||
| 414 | let (sys_clk, sw) = match config.mux { | ||
| 415 | ClockSrc::MSI(range) => { | ||
| 416 | // Enable MSI | ||
| 417 | RCC.cr().write(|w| { | ||
| 418 | let bits: Msirange = range.into(); | ||
| 419 | w.set_msirange(bits); | ||
| 420 | w.set_msirgsel(true); | ||
| 421 | w.set_msion(true); | ||
| 422 | |||
| 423 | if let RtcClockSource::LSE = config.rtc_mux { | ||
| 424 | // If LSE is enabled, enable calibration of MSI | ||
| 425 | w.set_msipllen(true); | ||
| 426 | } else { | ||
| 427 | w.set_msipllen(false); | ||
| 428 | } | ||
| 429 | }); | ||
| 430 | while !RCC.cr().read().msirdy() {} | ||
| 431 | |||
| 432 | // Enable as clock source for USB, RNG if running at 48 MHz | ||
| 433 | if let MSIRange::Range11 = range { | ||
| 434 | RCC.ccipr().modify(|w| { | ||
| 435 | w.set_clk48sel(0b11); | ||
| 436 | }); | ||
| 437 | } | ||
| 438 | (range.into(), Sw::MSI) | ||
| 439 | } | ||
| 440 | ClockSrc::HSI16 => { | ||
| 441 | // Enable HSI16 | ||
| 442 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 443 | while !RCC.cr().read().hsirdy() {} | ||
| 444 | |||
| 445 | (HSI_FREQ.0, Sw::HSI16) | ||
| 446 | } | ||
| 447 | ClockSrc::HSE(freq) => { | ||
| 448 | // Enable HSE | ||
| 449 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 450 | while !RCC.cr().read().hserdy() {} | ||
| 451 | |||
| 452 | (freq.0, Sw::HSE) | ||
| 453 | } | ||
| 454 | ClockSrc::PLL(src, div, prediv, mul, pll48div) => { | ||
| 455 | let src_freq = match src { | ||
| 456 | PLLSource::HSE(freq) => { | ||
| 457 | // Enable HSE | ||
| 458 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 459 | while !RCC.cr().read().hserdy() {} | ||
| 460 | freq.0 | ||
| 461 | } | ||
| 462 | PLLSource::HSI16 => { | ||
| 463 | // Enable HSI | ||
| 464 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 465 | while !RCC.cr().read().hsirdy() {} | ||
| 466 | HSI_FREQ.0 | ||
| 467 | } | ||
| 468 | PLLSource::MSI(range) => { | ||
| 469 | // Enable MSI | ||
| 470 | RCC.cr().write(|w| { | ||
| 471 | let bits: Msirange = range.into(); | ||
| 472 | w.set_msirange(bits); | ||
| 473 | w.set_msipllen(false); // should be turned on if LSE is started | ||
| 474 | w.set_msirgsel(true); | ||
| 475 | w.set_msion(true); | ||
| 476 | }); | ||
| 477 | while !RCC.cr().read().msirdy() {} | ||
| 478 | range.into() | ||
| 479 | } | ||
| 480 | }; | ||
| 481 | |||
| 482 | // Disable PLL | ||
| 483 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 484 | while RCC.cr().read().pllrdy() {} | ||
| 485 | |||
| 486 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / div.to_div(); | ||
| 487 | |||
| 488 | #[cfg(any(stm32l4px, stm32l4qx, stm32l4rx, stm32l4sx))] | ||
| 489 | assert!(freq <= 120_000_000); | ||
| 490 | #[cfg(not(any(stm32l4px, stm32l4qx, stm32l4rx, stm32l4sx)))] | ||
| 491 | assert!(freq <= 80_000_000); | ||
| 492 | |||
| 493 | RCC.pllcfgr().write(move |w| { | ||
| 494 | w.set_plln(mul.into()); | ||
| 495 | w.set_pllm(prediv.into()); | ||
| 496 | w.set_pllr(div.into()); | ||
| 497 | if let Some(pll48div) = pll48div { | ||
| 498 | w.set_pllq(pll48div.into()); | ||
| 499 | w.set_pllqen(true); | ||
| 500 | } | ||
| 501 | w.set_pllsrc(src.into()); | ||
| 502 | }); | ||
| 503 | |||
| 504 | // Enable as clock source for USB, RNG if PLL48 divisor is provided | ||
| 505 | if let Some(pll48div) = pll48div { | ||
| 506 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / pll48div.to_div(); | ||
| 507 | assert!(freq == 48_000_000); | ||
| 508 | RCC.ccipr().modify(|w| { | ||
| 509 | w.set_clk48sel(0b10); | ||
| 510 | }); | ||
| 511 | } | ||
| 512 | |||
| 513 | if let Some((mul, prediv, r_div, q_div, p_div)) = config.pllsai1 { | ||
| 514 | RCC.pllsai1cfgr().write(move |w| { | ||
| 515 | w.set_pllsai1n(mul.into()); | ||
| 516 | w.set_pllsai1m(prediv.into()); | ||
| 517 | if let Some(r_div) = r_div { | ||
| 518 | w.set_pllsai1r(r_div.into()); | ||
| 519 | w.set_pllsai1ren(true); | ||
| 520 | } | ||
| 521 | if let Some(q_div) = q_div { | ||
| 522 | w.set_pllsai1q(q_div.into()); | ||
| 523 | w.set_pllsai1qen(true); | ||
| 524 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / q_div.to_div(); | ||
| 525 | if freq == 48_000_000 { | ||
| 526 | RCC.ccipr().modify(|w| { | ||
| 527 | w.set_clk48sel(0b1); | ||
| 528 | }); | ||
| 529 | } | ||
| 530 | } | ||
| 531 | if let Some(p_div) = p_div { | ||
| 532 | w.set_pllsai1pdiv(p_div.into()); | ||
| 533 | w.set_pllsai1pen(true); | ||
| 534 | } | ||
| 535 | }); | ||
| 536 | |||
| 537 | RCC.cr().modify(|w| w.set_pllsai1on(true)); | ||
| 538 | } | ||
| 539 | |||
| 540 | // Enable PLL | ||
| 541 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 542 | while !RCC.cr().read().pllrdy() {} | ||
| 543 | RCC.pllcfgr().modify(|w| w.set_pllren(true)); | ||
| 544 | |||
| 545 | (freq, Sw::PLL) | ||
| 546 | } | ||
| 547 | }; | ||
| 548 | |||
| 549 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 550 | if config.hsi48 { | ||
| 551 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 552 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 553 | |||
| 554 | // Enable as clock source for USB, RNG and SDMMC | ||
| 555 | RCC.ccipr().modify(|w| w.set_clk48sel(0)); | ||
| 556 | } | ||
| 557 | |||
| 558 | // Set flash wait states | ||
| 559 | FLASH.acr().modify(|w| { | ||
| 560 | w.set_latency(if sys_clk <= 16_000_000 { | ||
| 561 | 0b000 | ||
| 562 | } else if sys_clk <= 32_000_000 { | ||
| 563 | 0b001 | ||
| 564 | } else if sys_clk <= 48_000_000 { | ||
| 565 | 0b010 | ||
| 566 | } else if sys_clk <= 64_000_000 { | ||
| 567 | 0b011 | ||
| 568 | } else { | ||
| 569 | 0b100 | ||
| 570 | }); | ||
| 571 | }); | ||
| 572 | |||
| 573 | RCC.cfgr().modify(|w| { | ||
| 574 | w.set_sw(sw); | ||
| 575 | w.set_hpre(config.ahb_pre.into()); | ||
| 576 | w.set_ppre1(config.apb1_pre.into()); | ||
| 577 | w.set_ppre2(config.apb2_pre.into()); | ||
| 578 | }); | ||
| 579 | |||
| 580 | let ahb_freq: u32 = match config.ahb_pre { | ||
| 581 | AHBPrescaler::DIV1 => sys_clk, | ||
| 582 | pre => { | ||
| 583 | let pre: Hpre = pre.into(); | ||
| 584 | let pre = 1 << (pre.to_bits() as u32 - 7); | ||
| 585 | sys_clk / pre | ||
| 586 | } | ||
| 587 | }; | ||
| 588 | |||
| 589 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 590 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 591 | pre => { | ||
| 592 | let pre: Ppre = pre.into(); | ||
| 593 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 594 | let freq = ahb_freq / pre as u32; | ||
| 595 | (freq, freq * 2) | ||
| 596 | } | ||
| 597 | }; | ||
| 598 | |||
| 599 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 600 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 601 | pre => { | ||
| 602 | let pre: Ppre = pre.into(); | ||
| 603 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 604 | let freq = ahb_freq / pre as u32; | ||
| 605 | (freq, freq * 2) | ||
| 606 | } | ||
| 607 | }; | ||
| 608 | |||
| 609 | set_freqs(Clocks { | ||
| 610 | sys: Hertz(sys_clk), | ||
| 611 | ahb1: Hertz(ahb_freq), | ||
| 612 | ahb2: Hertz(ahb_freq), | ||
| 613 | ahb3: Hertz(ahb_freq), | ||
| 614 | apb1: Hertz(apb1_freq), | ||
| 615 | apb2: Hertz(apb2_freq), | ||
| 616 | apb1_tim: Hertz(apb1_tim_freq), | ||
| 617 | apb2_tim: Hertz(apb2_tim_freq), | ||
| 618 | }); | ||
| 619 | } | ||
diff --git a/embassy-stm32/src/rcc/l4l5.rs b/embassy-stm32/src/rcc/l4l5.rs new file mode 100644 index 000000000..683b47c05 --- /dev/null +++ b/embassy-stm32/src/rcc/l4l5.rs | |||
| @@ -0,0 +1,441 @@ | |||
| 1 | use crate::pac::rcc::regs::Cfgr; | ||
| 2 | use crate::pac::rcc::vals::Msirgsel; | ||
| 3 | pub use crate::pac::rcc::vals::{ | ||
| 4 | Clk48sel as Clk48Src, Hpre as AHBPrescaler, Msirange as MSIRange, Pllm as PllPreDiv, Plln as PllMul, | ||
| 5 | Pllp as PllPDiv, Pllq as PllQDiv, Pllr as PllRDiv, Pllsrc as PLLSource, Ppre as APBPrescaler, Sw as ClockSrc, | ||
| 6 | }; | ||
| 7 | use crate::pac::{FLASH, RCC}; | ||
| 8 | use crate::rcc::{set_freqs, Clocks}; | ||
| 9 | use crate::time::Hertz; | ||
| 10 | |||
| 11 | /// HSI speed | ||
| 12 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 13 | |||
| 14 | #[derive(Clone, Copy)] | ||
| 15 | pub struct Pll { | ||
| 16 | /// PLL source | ||
| 17 | pub source: PLLSource, | ||
| 18 | |||
| 19 | /// PLL pre-divider (DIVM). | ||
| 20 | pub prediv: PllPreDiv, | ||
| 21 | |||
| 22 | /// PLL multiplication factor. | ||
| 23 | pub mul: PllMul, | ||
| 24 | |||
| 25 | /// PLL P division factor. If None, PLL P output is disabled. | ||
| 26 | pub divp: Option<PllPDiv>, | ||
| 27 | /// PLL Q division factor. If None, PLL Q output is disabled. | ||
| 28 | pub divq: Option<PllQDiv>, | ||
| 29 | /// PLL R division factor. If None, PLL R output is disabled. | ||
| 30 | pub divr: Option<PllRDiv>, | ||
| 31 | } | ||
| 32 | |||
| 33 | /// Clocks configutation | ||
| 34 | pub struct Config { | ||
| 35 | // base clock sources | ||
| 36 | pub msi: Option<MSIRange>, | ||
| 37 | pub hsi16: bool, | ||
| 38 | pub hse: Option<Hertz>, | ||
| 39 | #[cfg(not(any(stm32l47x, stm32l48x)))] | ||
| 40 | pub hsi48: bool, | ||
| 41 | |||
| 42 | // pll | ||
| 43 | pub pll: Option<Pll>, | ||
| 44 | pub pllsai1: Option<Pll>, | ||
| 45 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 46 | pub pllsai2: Option<Pll>, | ||
| 47 | |||
| 48 | // sysclk, buses. | ||
| 49 | pub mux: ClockSrc, | ||
| 50 | pub ahb_pre: AHBPrescaler, | ||
| 51 | pub apb1_pre: APBPrescaler, | ||
| 52 | pub apb2_pre: APBPrescaler, | ||
| 53 | |||
| 54 | // muxes | ||
| 55 | pub clk48_src: Clk48Src, | ||
| 56 | |||
| 57 | // low speed LSI/LSE/RTC | ||
| 58 | pub ls: super::LsConfig, | ||
| 59 | } | ||
| 60 | |||
| 61 | impl Default for Config { | ||
| 62 | #[inline] | ||
| 63 | fn default() -> Config { | ||
| 64 | Config { | ||
| 65 | hse: None, | ||
| 66 | hsi16: false, | ||
| 67 | msi: Some(MSIRange::RANGE4M), | ||
| 68 | mux: ClockSrc::MSI, | ||
| 69 | ahb_pre: AHBPrescaler::DIV1, | ||
| 70 | apb1_pre: APBPrescaler::DIV1, | ||
| 71 | apb2_pre: APBPrescaler::DIV1, | ||
| 72 | pll: None, | ||
| 73 | pllsai1: None, | ||
| 74 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 75 | pllsai2: None, | ||
| 76 | #[cfg(not(any(stm32l471, stm32l475, stm32l476, stm32l486)))] | ||
| 77 | hsi48: true, | ||
| 78 | clk48_src: Clk48Src::HSI48, | ||
| 79 | ls: Default::default(), | ||
| 80 | } | ||
| 81 | } | ||
| 82 | } | ||
| 83 | |||
| 84 | pub(crate) unsafe fn init(config: Config) { | ||
| 85 | // Switch to MSI to prevent problems with PLL configuration. | ||
| 86 | if !RCC.cr().read().msion() { | ||
| 87 | // Turn on MSI and configure it to 4MHz. | ||
| 88 | RCC.cr().modify(|w| { | ||
| 89 | w.set_msirgsel(Msirgsel::CR); | ||
| 90 | w.set_msirange(MSIRange::RANGE4M); | ||
| 91 | w.set_msipllen(false); | ||
| 92 | w.set_msion(true) | ||
| 93 | }); | ||
| 94 | |||
| 95 | // Wait until MSI is running | ||
| 96 | while !RCC.cr().read().msirdy() {} | ||
| 97 | } | ||
| 98 | if RCC.cfgr().read().sws() != ClockSrc::MSI { | ||
| 99 | // Set MSI as a clock source, reset prescalers. | ||
| 100 | RCC.cfgr().write_value(Cfgr::default()); | ||
| 101 | // Wait for clock switch status bits to change. | ||
| 102 | while RCC.cfgr().read().sws() != ClockSrc::MSI {} | ||
| 103 | } | ||
| 104 | |||
| 105 | #[cfg(stm32l5)] | ||
| 106 | crate::pac::PWR.cr1().modify(|w| { | ||
| 107 | w.set_vos(crate::pac::pwr::vals::Vos::RANGE0); | ||
| 108 | }); | ||
| 109 | |||
| 110 | let rtc = config.ls.init(); | ||
| 111 | |||
| 112 | let msi = config.msi.map(|range| { | ||
| 113 | // Enable MSI | ||
| 114 | RCC.cr().write(|w| { | ||
| 115 | w.set_msirange(range); | ||
| 116 | w.set_msirgsel(Msirgsel::CR); | ||
| 117 | w.set_msion(true); | ||
| 118 | |||
| 119 | // If LSE is enabled, enable calibration of MSI | ||
| 120 | w.set_msipllen(config.ls.lse.is_some()); | ||
| 121 | }); | ||
| 122 | while !RCC.cr().read().msirdy() {} | ||
| 123 | |||
| 124 | // Enable as clock source for USB, RNG if running at 48 MHz | ||
| 125 | if range == MSIRange::RANGE48M {} | ||
| 126 | |||
| 127 | msirange_to_hertz(range) | ||
| 128 | }); | ||
| 129 | |||
| 130 | let hsi16 = config.hsi16.then(|| { | ||
| 131 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 132 | while !RCC.cr().read().hsirdy() {} | ||
| 133 | |||
| 134 | HSI_FREQ | ||
| 135 | }); | ||
| 136 | |||
| 137 | let hse = config.hse.map(|freq| { | ||
| 138 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 139 | while !RCC.cr().read().hserdy() {} | ||
| 140 | |||
| 141 | freq | ||
| 142 | }); | ||
| 143 | |||
| 144 | #[cfg(not(any(stm32l47x, stm32l48x)))] | ||
| 145 | let hsi48 = config.hsi48.then(|| { | ||
| 146 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 147 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 148 | |||
| 149 | Hertz(48_000_000) | ||
| 150 | }); | ||
| 151 | #[cfg(any(stm32l47x, stm32l48x))] | ||
| 152 | let hsi48 = None; | ||
| 153 | |||
| 154 | let _plls = [ | ||
| 155 | &config.pll, | ||
| 156 | &config.pllsai1, | ||
| 157 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 158 | &config.pllsai2, | ||
| 159 | ]; | ||
| 160 | |||
| 161 | // L4 has shared PLLSRC, PLLM, check it's equal in all PLLs. | ||
| 162 | #[cfg(all(stm32l4, not(rcc_l4plus)))] | ||
| 163 | match get_equal(_plls.into_iter().flatten().map(|p| (p.source, p.prediv))) { | ||
| 164 | Err(()) => panic!("Source must be equal across all enabled PLLs."), | ||
| 165 | Ok(None) => {} | ||
| 166 | Ok(Some((source, prediv))) => RCC.pllcfgr().write(|w| { | ||
| 167 | w.set_pllm(prediv); | ||
| 168 | w.set_pllsrc(source); | ||
| 169 | }), | ||
| 170 | }; | ||
| 171 | |||
| 172 | // L4+ has shared PLLSRC, check it's equal in all PLLs. | ||
| 173 | #[cfg(any(rcc_l4plus))] | ||
| 174 | match get_equal(_plls.into_iter().flatten().map(|p| p.source)) { | ||
| 175 | Err(()) => panic!("Source must be equal across all enabled PLLs."), | ||
| 176 | Ok(None) => {} | ||
| 177 | Ok(Some(source)) => RCC.pllcfgr().write(|w| { | ||
| 178 | w.set_pllsrc(source); | ||
| 179 | }), | ||
| 180 | }; | ||
| 181 | |||
| 182 | let pll_input = PllInput { hse, hsi16, msi }; | ||
| 183 | let pll = init_pll(PllInstance::Pll, config.pll, &pll_input); | ||
| 184 | let pllsai1 = init_pll(PllInstance::Pllsai1, config.pllsai1, &pll_input); | ||
| 185 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 186 | let _pllsai2 = init_pll(PllInstance::Pllsai2, config.pllsai2, &pll_input); | ||
| 187 | |||
| 188 | let sys_clk = match config.mux { | ||
| 189 | ClockSrc::HSE => hse.unwrap(), | ||
| 190 | ClockSrc::HSI => hsi16.unwrap(), | ||
| 191 | ClockSrc::MSI => msi.unwrap(), | ||
| 192 | #[cfg(rcc_l4)] | ||
| 193 | ClockSrc::PLL1_P => pll._r.unwrap(), | ||
| 194 | #[cfg(not(rcc_l4))] | ||
| 195 | ClockSrc::PLL1_R => pll._r.unwrap(), | ||
| 196 | }; | ||
| 197 | |||
| 198 | #[cfg(stm32l4)] | ||
| 199 | RCC.ccipr().modify(|w| w.set_clk48sel(config.clk48_src)); | ||
| 200 | #[cfg(stm32l5)] | ||
| 201 | RCC.ccipr1().modify(|w| w.set_clk48sel(config.clk48_src)); | ||
| 202 | let _clk48 = match config.clk48_src { | ||
| 203 | Clk48Src::HSI48 => hsi48, | ||
| 204 | Clk48Src::MSI => msi, | ||
| 205 | Clk48Src::PLLSAI1_Q => pllsai1._q, | ||
| 206 | Clk48Src::PLL1_Q => pll._q, | ||
| 207 | }; | ||
| 208 | |||
| 209 | #[cfg(rcc_l4plus)] | ||
| 210 | assert!(sys_clk.0 <= 120_000_000); | ||
| 211 | #[cfg(all(stm32l4, not(rcc_l4plus)))] | ||
| 212 | assert!(sys_clk.0 <= 80_000_000); | ||
| 213 | |||
| 214 | // Set flash wait states | ||
| 215 | #[cfg(stm32l4)] | ||
| 216 | FLASH.acr().modify(|w| { | ||
| 217 | w.set_latency(match sys_clk.0 { | ||
| 218 | 0..=16_000_000 => 0, | ||
| 219 | 0..=32_000_000 => 1, | ||
| 220 | 0..=48_000_000 => 2, | ||
| 221 | 0..=64_000_000 => 3, | ||
| 222 | _ => 4, | ||
| 223 | }) | ||
| 224 | }); | ||
| 225 | // VCORE Range 0 (performance), others TODO | ||
| 226 | #[cfg(stm32l5)] | ||
| 227 | FLASH.acr().modify(|w| { | ||
| 228 | w.set_latency(match sys_clk.0 { | ||
| 229 | 0..=20_000_000 => 0, | ||
| 230 | 0..=40_000_000 => 1, | ||
| 231 | 0..=60_000_000 => 2, | ||
| 232 | 0..=80_000_000 => 3, | ||
| 233 | 0..=100_000_000 => 4, | ||
| 234 | _ => 5, | ||
| 235 | }) | ||
| 236 | }); | ||
| 237 | |||
| 238 | RCC.cfgr().modify(|w| { | ||
| 239 | w.set_sw(config.mux); | ||
| 240 | w.set_hpre(config.ahb_pre); | ||
| 241 | w.set_ppre1(config.apb1_pre); | ||
| 242 | w.set_ppre2(config.apb2_pre); | ||
| 243 | }); | ||
| 244 | while RCC.cfgr().read().sws() != config.mux {} | ||
| 245 | |||
| 246 | let ahb_freq = sys_clk / config.ahb_pre; | ||
| 247 | |||
| 248 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 249 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 250 | pre => { | ||
| 251 | let freq = ahb_freq / pre; | ||
| 252 | (freq, freq * 2u32) | ||
| 253 | } | ||
| 254 | }; | ||
| 255 | |||
| 256 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 257 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 258 | pre => { | ||
| 259 | let freq = ahb_freq / pre; | ||
| 260 | (freq, freq * 2u32) | ||
| 261 | } | ||
| 262 | }; | ||
| 263 | |||
| 264 | set_freqs(Clocks { | ||
| 265 | sys: sys_clk, | ||
| 266 | hclk1: ahb_freq, | ||
| 267 | hclk2: ahb_freq, | ||
| 268 | hclk3: ahb_freq, | ||
| 269 | pclk1: apb1_freq, | ||
| 270 | pclk2: apb2_freq, | ||
| 271 | pclk1_tim: apb1_tim_freq, | ||
| 272 | pclk2_tim: apb2_tim_freq, | ||
| 273 | #[cfg(rcc_l4)] | ||
| 274 | hsi: None, | ||
| 275 | #[cfg(rcc_l4)] | ||
| 276 | lse: None, | ||
| 277 | #[cfg(rcc_l4)] | ||
| 278 | pllsai1_p: None, | ||
| 279 | #[cfg(rcc_l4)] | ||
| 280 | pllsai2_p: None, | ||
| 281 | #[cfg(rcc_l4)] | ||
| 282 | pll1_p: None, | ||
| 283 | #[cfg(rcc_l4)] | ||
| 284 | pll1_q: None, | ||
| 285 | #[cfg(rcc_l4)] | ||
| 286 | sai1_extclk: None, | ||
| 287 | #[cfg(rcc_l4)] | ||
| 288 | sai2_extclk: None, | ||
| 289 | rtc, | ||
| 290 | }); | ||
| 291 | } | ||
| 292 | |||
| 293 | fn msirange_to_hertz(range: MSIRange) -> Hertz { | ||
| 294 | match range { | ||
| 295 | MSIRange::RANGE100K => Hertz(100_000), | ||
| 296 | MSIRange::RANGE200K => Hertz(200_000), | ||
| 297 | MSIRange::RANGE400K => Hertz(400_000), | ||
| 298 | MSIRange::RANGE800K => Hertz(800_000), | ||
| 299 | MSIRange::RANGE1M => Hertz(1_000_000), | ||
| 300 | MSIRange::RANGE2M => Hertz(2_000_000), | ||
| 301 | MSIRange::RANGE4M => Hertz(4_000_000), | ||
| 302 | MSIRange::RANGE8M => Hertz(8_000_000), | ||
| 303 | MSIRange::RANGE16M => Hertz(16_000_000), | ||
| 304 | MSIRange::RANGE24M => Hertz(24_000_000), | ||
| 305 | MSIRange::RANGE32M => Hertz(32_000_000), | ||
| 306 | MSIRange::RANGE48M => Hertz(48_000_000), | ||
| 307 | _ => unreachable!(), | ||
| 308 | } | ||
| 309 | } | ||
| 310 | |||
| 311 | #[allow(unused)] | ||
| 312 | fn get_equal<T: Eq>(mut iter: impl Iterator<Item = T>) -> Result<Option<T>, ()> { | ||
| 313 | let Some(x) = iter.next() else { return Ok(None) }; | ||
| 314 | if !iter.all(|y| y == x) { | ||
| 315 | return Err(()); | ||
| 316 | } | ||
| 317 | return Ok(Some(x)); | ||
| 318 | } | ||
| 319 | |||
| 320 | struct PllInput { | ||
| 321 | hsi16: Option<Hertz>, | ||
| 322 | hse: Option<Hertz>, | ||
| 323 | msi: Option<Hertz>, | ||
| 324 | } | ||
| 325 | |||
| 326 | #[derive(Default)] | ||
| 327 | struct PllOutput { | ||
| 328 | _p: Option<Hertz>, | ||
| 329 | _q: Option<Hertz>, | ||
| 330 | _r: Option<Hertz>, | ||
| 331 | } | ||
| 332 | |||
| 333 | #[derive(PartialEq, Eq, Clone, Copy)] | ||
| 334 | enum PllInstance { | ||
| 335 | Pll, | ||
| 336 | Pllsai1, | ||
| 337 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 338 | Pllsai2, | ||
| 339 | } | ||
| 340 | |||
| 341 | fn init_pll(instance: PllInstance, config: Option<Pll>, input: &PllInput) -> PllOutput { | ||
| 342 | // Disable PLL | ||
| 343 | match instance { | ||
| 344 | PllInstance::Pll => { | ||
| 345 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 346 | while RCC.cr().read().pllrdy() {} | ||
| 347 | } | ||
| 348 | PllInstance::Pllsai1 => { | ||
| 349 | RCC.cr().modify(|w| w.set_pllsai1on(false)); | ||
| 350 | while RCC.cr().read().pllsai1rdy() {} | ||
| 351 | } | ||
| 352 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 353 | PllInstance::Pllsai2 => { | ||
| 354 | RCC.cr().modify(|w| w.set_pllsai2on(false)); | ||
| 355 | while RCC.cr().read().pllsai2rdy() {} | ||
| 356 | } | ||
| 357 | } | ||
| 358 | |||
| 359 | let Some(pll) = config else { return PllOutput::default() }; | ||
| 360 | |||
| 361 | let pll_src = match pll.source { | ||
| 362 | PLLSource::NONE => panic!("must not select PLL source as NONE"), | ||
| 363 | PLLSource::HSE => input.hse, | ||
| 364 | PLLSource::HSI => input.hsi16, | ||
| 365 | PLLSource::MSI => input.msi, | ||
| 366 | }; | ||
| 367 | |||
| 368 | let pll_src = pll_src.unwrap(); | ||
| 369 | |||
| 370 | let vco_freq = pll_src / pll.prediv * pll.mul; | ||
| 371 | |||
| 372 | let p = pll.divp.map(|div| vco_freq / div); | ||
| 373 | let q = pll.divq.map(|div| vco_freq / div); | ||
| 374 | let r = pll.divr.map(|div| vco_freq / div); | ||
| 375 | |||
| 376 | #[cfg(stm32l5)] | ||
| 377 | if instance == PllInstance::Pllsai2 { | ||
| 378 | assert!(q.is_none(), "PLLSAI2_Q is not available on L5"); | ||
| 379 | assert!(r.is_none(), "PLLSAI2_R is not available on L5"); | ||
| 380 | } | ||
| 381 | |||
| 382 | macro_rules! write_fields { | ||
| 383 | ($w:ident) => { | ||
| 384 | $w.set_plln(pll.mul); | ||
| 385 | if let Some(divp) = pll.divp { | ||
| 386 | $w.set_pllp(divp); | ||
| 387 | $w.set_pllpen(true); | ||
| 388 | } | ||
| 389 | if let Some(divq) = pll.divq { | ||
| 390 | $w.set_pllq(divq); | ||
| 391 | $w.set_pllqen(true); | ||
| 392 | } | ||
| 393 | if let Some(divr) = pll.divr { | ||
| 394 | $w.set_pllr(divr); | ||
| 395 | $w.set_pllren(true); | ||
| 396 | } | ||
| 397 | }; | ||
| 398 | } | ||
| 399 | |||
| 400 | match instance { | ||
| 401 | PllInstance::Pll => RCC.pllcfgr().write(|w| { | ||
| 402 | w.set_pllm(pll.prediv); | ||
| 403 | w.set_pllsrc(pll.source); | ||
| 404 | write_fields!(w); | ||
| 405 | }), | ||
| 406 | PllInstance::Pllsai1 => RCC.pllsai1cfgr().write(|w| { | ||
| 407 | #[cfg(any(rcc_l4plus, stm32l5))] | ||
| 408 | w.set_pllm(pll.prediv); | ||
| 409 | #[cfg(stm32l5)] | ||
| 410 | w.set_pllsrc(pll.source); | ||
| 411 | write_fields!(w); | ||
| 412 | }), | ||
| 413 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 414 | PllInstance::Pllsai2 => RCC.pllsai2cfgr().write(|w| { | ||
| 415 | #[cfg(any(rcc_l4plus, stm32l5))] | ||
| 416 | w.set_pllm(pll.prediv); | ||
| 417 | #[cfg(stm32l5)] | ||
| 418 | w.set_pllsrc(pll.source); | ||
| 419 | write_fields!(w); | ||
| 420 | }), | ||
| 421 | } | ||
| 422 | |||
| 423 | // Enable PLL | ||
| 424 | match instance { | ||
| 425 | PllInstance::Pll => { | ||
| 426 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 427 | while !RCC.cr().read().pllrdy() {} | ||
| 428 | } | ||
| 429 | PllInstance::Pllsai1 => { | ||
| 430 | RCC.cr().modify(|w| w.set_pllsai1on(true)); | ||
| 431 | while !RCC.cr().read().pllsai1rdy() {} | ||
| 432 | } | ||
| 433 | #[cfg(any(stm32l47x, stm32l48x, stm32l49x, stm32l4ax, rcc_l4plus, stm32l5))] | ||
| 434 | PllInstance::Pllsai2 => { | ||
| 435 | RCC.cr().modify(|w| w.set_pllsai2on(true)); | ||
| 436 | while !RCC.cr().read().pllsai2rdy() {} | ||
| 437 | } | ||
| 438 | } | ||
| 439 | |||
| 440 | PllOutput { _p: p, _q: q, _r: r } | ||
| 441 | } | ||
diff --git a/embassy-stm32/src/rcc/l5.rs b/embassy-stm32/src/rcc/l5.rs deleted file mode 100644 index 652bdcb7b..000000000 --- a/embassy-stm32/src/rcc/l5.rs +++ /dev/null | |||
| @@ -1,443 +0,0 @@ | |||
| 1 | use stm32_metapac::PWR; | ||
| 2 | |||
| 3 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 4 | use crate::pac::rcc::vals::{Hpre, Msirange, Pllsrc, Ppre, Sw}; | ||
| 5 | use crate::pac::{FLASH, RCC}; | ||
| 6 | use crate::rcc::{set_freqs, Clocks}; | ||
| 7 | use crate::time::Hertz; | ||
| 8 | |||
| 9 | /// HSI speed | ||
| 10 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | ||
| 11 | |||
| 12 | /// LSI speed | ||
| 13 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 14 | |||
| 15 | /// System clock mux source | ||
| 16 | #[derive(Clone, Copy)] | ||
| 17 | pub enum ClockSrc { | ||
| 18 | MSI(MSIRange), | ||
| 19 | PLL(PLLSource, PLLClkDiv, PLLSrcDiv, PLLMul, Option<PLL48Div>), | ||
| 20 | HSE(Hertz), | ||
| 21 | HSI16, | ||
| 22 | } | ||
| 23 | |||
| 24 | /// MSI Clock Range | ||
| 25 | /// | ||
| 26 | /// These ranges control the frequency of the MSI. Internally, these ranges map | ||
| 27 | /// to the `MSIRANGE` bits in the `RCC_ICSCR` register. | ||
| 28 | #[derive(Clone, Copy)] | ||
| 29 | pub enum MSIRange { | ||
| 30 | /// Around 100 kHz | ||
| 31 | Range0, | ||
| 32 | /// Around 200 kHz | ||
| 33 | Range1, | ||
| 34 | /// Around 400 kHz | ||
| 35 | Range2, | ||
| 36 | /// Around 800 kHz | ||
| 37 | Range3, | ||
| 38 | /// Around 1 MHz | ||
| 39 | Range4, | ||
| 40 | /// Around 2 MHz | ||
| 41 | Range5, | ||
| 42 | /// Around 4 MHz (reset value) | ||
| 43 | Range6, | ||
| 44 | /// Around 8 MHz | ||
| 45 | Range7, | ||
| 46 | /// Around 16 MHz | ||
| 47 | Range8, | ||
| 48 | /// Around 24 MHz | ||
| 49 | Range9, | ||
| 50 | /// Around 32 MHz | ||
| 51 | Range10, | ||
| 52 | /// Around 48 MHz | ||
| 53 | Range11, | ||
| 54 | } | ||
| 55 | |||
| 56 | impl Default for MSIRange { | ||
| 57 | fn default() -> MSIRange { | ||
| 58 | MSIRange::Range6 | ||
| 59 | } | ||
| 60 | } | ||
| 61 | |||
| 62 | pub type PLL48Div = PLLClkDiv; | ||
| 63 | pub type PLLSAI1RDiv = PLLClkDiv; | ||
| 64 | pub type PLLSAI1QDiv = PLLClkDiv; | ||
| 65 | pub type PLLSAI1PDiv = PLLClkDiv; | ||
| 66 | |||
| 67 | /// PLL divider | ||
| 68 | #[derive(Clone, Copy)] | ||
| 69 | pub enum PLLDiv { | ||
| 70 | Div2, | ||
| 71 | Div3, | ||
| 72 | Div4, | ||
| 73 | } | ||
| 74 | |||
| 75 | /// PLL clock input source | ||
| 76 | #[derive(Clone, Copy)] | ||
| 77 | pub enum PLLSource { | ||
| 78 | HSI16, | ||
| 79 | HSE(Hertz), | ||
| 80 | MSI(MSIRange), | ||
| 81 | } | ||
| 82 | |||
| 83 | seq_macro::seq!(N in 8..=86 { | ||
| 84 | #[derive(Clone, Copy)] | ||
| 85 | pub enum PLLMul { | ||
| 86 | #( | ||
| 87 | Mul~N, | ||
| 88 | )* | ||
| 89 | } | ||
| 90 | |||
| 91 | impl From<PLLMul> for u8 { | ||
| 92 | fn from(val: PLLMul) -> u8 { | ||
| 93 | match val { | ||
| 94 | #( | ||
| 95 | PLLMul::Mul~N => N, | ||
| 96 | )* | ||
| 97 | } | ||
| 98 | } | ||
| 99 | } | ||
| 100 | |||
| 101 | impl PLLMul { | ||
| 102 | pub fn to_mul(self) -> u32 { | ||
| 103 | match self { | ||
| 104 | #( | ||
| 105 | PLLMul::Mul~N => N, | ||
| 106 | )* | ||
| 107 | } | ||
| 108 | } | ||
| 109 | } | ||
| 110 | }); | ||
| 111 | |||
| 112 | #[derive(Clone, Copy)] | ||
| 113 | pub enum PLLClkDiv { | ||
| 114 | Div2, | ||
| 115 | Div4, | ||
| 116 | Div6, | ||
| 117 | Div8, | ||
| 118 | } | ||
| 119 | |||
| 120 | impl PLLClkDiv { | ||
| 121 | pub fn to_div(self) -> u32 { | ||
| 122 | let val: u8 = self.into(); | ||
| 123 | (val as u32 + 1) * 2 | ||
| 124 | } | ||
| 125 | } | ||
| 126 | |||
| 127 | impl From<PLLClkDiv> for u8 { | ||
| 128 | fn from(val: PLLClkDiv) -> u8 { | ||
| 129 | match val { | ||
| 130 | PLLClkDiv::Div2 => 0b00, | ||
| 131 | PLLClkDiv::Div4 => 0b01, | ||
| 132 | PLLClkDiv::Div6 => 0b10, | ||
| 133 | PLLClkDiv::Div8 => 0b11, | ||
| 134 | } | ||
| 135 | } | ||
| 136 | } | ||
| 137 | |||
| 138 | #[derive(Clone, Copy)] | ||
| 139 | pub enum PLLSrcDiv { | ||
| 140 | Div1, | ||
| 141 | Div2, | ||
| 142 | Div3, | ||
| 143 | Div4, | ||
| 144 | Div5, | ||
| 145 | Div6, | ||
| 146 | Div7, | ||
| 147 | Div8, | ||
| 148 | } | ||
| 149 | |||
| 150 | impl PLLSrcDiv { | ||
| 151 | pub fn to_div(self) -> u32 { | ||
| 152 | let val: u8 = self.into(); | ||
| 153 | val as u32 + 1 | ||
| 154 | } | ||
| 155 | } | ||
| 156 | |||
| 157 | impl From<PLLSrcDiv> for u8 { | ||
| 158 | fn from(val: PLLSrcDiv) -> u8 { | ||
| 159 | match val { | ||
| 160 | PLLSrcDiv::Div1 => 0b000, | ||
| 161 | PLLSrcDiv::Div2 => 0b001, | ||
| 162 | PLLSrcDiv::Div3 => 0b010, | ||
| 163 | PLLSrcDiv::Div4 => 0b011, | ||
| 164 | PLLSrcDiv::Div5 => 0b100, | ||
| 165 | PLLSrcDiv::Div6 => 0b101, | ||
| 166 | PLLSrcDiv::Div7 => 0b110, | ||
| 167 | PLLSrcDiv::Div8 => 0b111, | ||
| 168 | } | ||
| 169 | } | ||
| 170 | } | ||
| 171 | |||
| 172 | impl From<PLLSource> for Pllsrc { | ||
| 173 | fn from(val: PLLSource) -> Pllsrc { | ||
| 174 | match val { | ||
| 175 | PLLSource::HSI16 => Pllsrc::HSI16, | ||
| 176 | PLLSource::HSE(_) => Pllsrc::HSE, | ||
| 177 | PLLSource::MSI(_) => Pllsrc::MSI, | ||
| 178 | } | ||
| 179 | } | ||
| 180 | } | ||
| 181 | |||
| 182 | impl From<MSIRange> for Msirange { | ||
| 183 | fn from(val: MSIRange) -> Msirange { | ||
| 184 | match val { | ||
| 185 | MSIRange::Range0 => Msirange::RANGE100K, | ||
| 186 | MSIRange::Range1 => Msirange::RANGE200K, | ||
| 187 | MSIRange::Range2 => Msirange::RANGE400K, | ||
| 188 | MSIRange::Range3 => Msirange::RANGE800K, | ||
| 189 | MSIRange::Range4 => Msirange::RANGE1M, | ||
| 190 | MSIRange::Range5 => Msirange::RANGE2M, | ||
| 191 | MSIRange::Range6 => Msirange::RANGE4M, | ||
| 192 | MSIRange::Range7 => Msirange::RANGE8M, | ||
| 193 | MSIRange::Range8 => Msirange::RANGE16M, | ||
| 194 | MSIRange::Range9 => Msirange::RANGE24M, | ||
| 195 | MSIRange::Range10 => Msirange::RANGE32M, | ||
| 196 | MSIRange::Range11 => Msirange::RANGE48M, | ||
| 197 | } | ||
| 198 | } | ||
| 199 | } | ||
| 200 | |||
| 201 | impl From<MSIRange> for u32 { | ||
| 202 | fn from(val: MSIRange) -> u32 { | ||
| 203 | match val { | ||
| 204 | MSIRange::Range0 => 100_000, | ||
| 205 | MSIRange::Range1 => 200_000, | ||
| 206 | MSIRange::Range2 => 400_000, | ||
| 207 | MSIRange::Range3 => 800_000, | ||
| 208 | MSIRange::Range4 => 1_000_000, | ||
| 209 | MSIRange::Range5 => 2_000_000, | ||
| 210 | MSIRange::Range6 => 4_000_000, | ||
| 211 | MSIRange::Range7 => 8_000_000, | ||
| 212 | MSIRange::Range8 => 16_000_000, | ||
| 213 | MSIRange::Range9 => 24_000_000, | ||
| 214 | MSIRange::Range10 => 32_000_000, | ||
| 215 | MSIRange::Range11 => 48_000_000, | ||
| 216 | } | ||
| 217 | } | ||
| 218 | } | ||
| 219 | |||
| 220 | /// Clocks configutation | ||
| 221 | pub struct Config { | ||
| 222 | pub mux: ClockSrc, | ||
| 223 | pub ahb_pre: AHBPrescaler, | ||
| 224 | pub apb1_pre: APBPrescaler, | ||
| 225 | pub apb2_pre: APBPrescaler, | ||
| 226 | pub pllsai1: Option<( | ||
| 227 | PLLMul, | ||
| 228 | PLLSrcDiv, | ||
| 229 | Option<PLLSAI1RDiv>, | ||
| 230 | Option<PLLSAI1QDiv>, | ||
| 231 | Option<PLLSAI1PDiv>, | ||
| 232 | )>, | ||
| 233 | pub hsi48: bool, | ||
| 234 | } | ||
| 235 | |||
| 236 | impl Default for Config { | ||
| 237 | #[inline] | ||
| 238 | fn default() -> Config { | ||
| 239 | Config { | ||
| 240 | mux: ClockSrc::MSI(MSIRange::Range6), | ||
| 241 | ahb_pre: AHBPrescaler::DIV1, | ||
| 242 | apb1_pre: APBPrescaler::DIV1, | ||
| 243 | apb2_pre: APBPrescaler::DIV1, | ||
| 244 | pllsai1: None, | ||
| 245 | hsi48: false, | ||
| 246 | } | ||
| 247 | } | ||
| 248 | } | ||
| 249 | |||
| 250 | pub(crate) unsafe fn init(config: Config) { | ||
| 251 | PWR.cr1().modify(|w| w.set_vos(stm32_metapac::pwr::vals::Vos::RANGE0)); | ||
| 252 | let (sys_clk, sw) = match config.mux { | ||
| 253 | ClockSrc::MSI(range) => { | ||
| 254 | // Enable MSI | ||
| 255 | RCC.cr().write(|w| { | ||
| 256 | let bits: Msirange = range.into(); | ||
| 257 | w.set_msirange(bits); | ||
| 258 | w.set_msipllen(false); | ||
| 259 | w.set_msirgsel(true); | ||
| 260 | w.set_msion(true); | ||
| 261 | }); | ||
| 262 | while !RCC.cr().read().msirdy() {} | ||
| 263 | |||
| 264 | // Enable as clock source for USB, RNG if running at 48 MHz | ||
| 265 | if let MSIRange::Range11 = range { | ||
| 266 | RCC.ccipr1().modify(|w| { | ||
| 267 | w.set_clk48msel(0b11); | ||
| 268 | }); | ||
| 269 | } | ||
| 270 | (range.into(), Sw::MSI) | ||
| 271 | } | ||
| 272 | ClockSrc::HSI16 => { | ||
| 273 | // Enable HSI16 | ||
| 274 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 275 | while !RCC.cr().read().hsirdy() {} | ||
| 276 | |||
| 277 | (HSI_FREQ.0, Sw::HSI16) | ||
| 278 | } | ||
| 279 | ClockSrc::HSE(freq) => { | ||
| 280 | // Enable HSE | ||
| 281 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 282 | while !RCC.cr().read().hserdy() {} | ||
| 283 | |||
| 284 | (freq.0, Sw::HSE) | ||
| 285 | } | ||
| 286 | ClockSrc::PLL(src, div, prediv, mul, pll48div) => { | ||
| 287 | let src_freq = match src { | ||
| 288 | PLLSource::HSE(freq) => { | ||
| 289 | // Enable HSE | ||
| 290 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 291 | while !RCC.cr().read().hserdy() {} | ||
| 292 | freq.0 | ||
| 293 | } | ||
| 294 | PLLSource::HSI16 => { | ||
| 295 | // Enable HSI | ||
| 296 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 297 | while !RCC.cr().read().hsirdy() {} | ||
| 298 | HSI_FREQ.0 | ||
| 299 | } | ||
| 300 | PLLSource::MSI(range) => { | ||
| 301 | // Enable MSI | ||
| 302 | RCC.cr().write(|w| { | ||
| 303 | let bits: Msirange = range.into(); | ||
| 304 | w.set_msirange(bits); | ||
| 305 | w.set_msipllen(false); // should be turned on if LSE is started | ||
| 306 | w.set_msirgsel(true); | ||
| 307 | w.set_msion(true); | ||
| 308 | }); | ||
| 309 | while !RCC.cr().read().msirdy() {} | ||
| 310 | range.into() | ||
| 311 | } | ||
| 312 | }; | ||
| 313 | |||
| 314 | // Disable PLL | ||
| 315 | RCC.cr().modify(|w| w.set_pllon(false)); | ||
| 316 | while RCC.cr().read().pllrdy() {} | ||
| 317 | |||
| 318 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / div.to_div(); | ||
| 319 | |||
| 320 | RCC.pllcfgr().write(move |w| { | ||
| 321 | w.set_plln(mul.into()); | ||
| 322 | w.set_pllm(prediv.into()); | ||
| 323 | w.set_pllr(div.into()); | ||
| 324 | if let Some(pll48div) = pll48div { | ||
| 325 | w.set_pllq(pll48div.into()); | ||
| 326 | w.set_pllqen(true); | ||
| 327 | } | ||
| 328 | w.set_pllsrc(src.into()); | ||
| 329 | }); | ||
| 330 | |||
| 331 | // Enable as clock source for USB, RNG if PLL48 divisor is provided | ||
| 332 | if let Some(pll48div) = pll48div { | ||
| 333 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / pll48div.to_div(); | ||
| 334 | assert!(freq == 48_000_000); | ||
| 335 | RCC.ccipr1().modify(|w| { | ||
| 336 | w.set_clk48msel(0b10); | ||
| 337 | }); | ||
| 338 | } | ||
| 339 | |||
| 340 | if let Some((mul, prediv, r_div, q_div, p_div)) = config.pllsai1 { | ||
| 341 | RCC.pllsai1cfgr().write(move |w| { | ||
| 342 | w.set_pllsai1n(mul.into()); | ||
| 343 | w.set_pllsai1m(prediv.into()); | ||
| 344 | if let Some(r_div) = r_div { | ||
| 345 | w.set_pllsai1r(r_div.into()); | ||
| 346 | w.set_pllsai1ren(true); | ||
| 347 | } | ||
| 348 | if let Some(q_div) = q_div { | ||
| 349 | w.set_pllsai1q(q_div.into()); | ||
| 350 | w.set_pllsai1qen(true); | ||
| 351 | let freq = (src_freq / prediv.to_div() * mul.to_mul()) / q_div.to_div(); | ||
| 352 | if freq == 48_000_000 { | ||
| 353 | RCC.ccipr1().modify(|w| { | ||
| 354 | w.set_clk48msel(0b1); | ||
| 355 | }); | ||
| 356 | } | ||
| 357 | } | ||
| 358 | if let Some(p_div) = p_div { | ||
| 359 | w.set_pllsai1pdiv(p_div.into()); | ||
| 360 | w.set_pllsai1pen(true); | ||
| 361 | } | ||
| 362 | }); | ||
| 363 | |||
| 364 | RCC.cr().modify(|w| w.set_pllsai1on(true)); | ||
| 365 | } | ||
| 366 | |||
| 367 | // Enable PLL | ||
| 368 | RCC.cr().modify(|w| w.set_pllon(true)); | ||
| 369 | while !RCC.cr().read().pllrdy() {} | ||
| 370 | RCC.pllcfgr().modify(|w| w.set_pllren(true)); | ||
| 371 | |||
| 372 | (freq, Sw::PLL) | ||
| 373 | } | ||
| 374 | }; | ||
| 375 | |||
| 376 | if config.hsi48 { | ||
| 377 | RCC.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 378 | while !RCC.crrcr().read().hsi48rdy() {} | ||
| 379 | |||
| 380 | // Enable as clock source for USB, RNG and SDMMC | ||
| 381 | RCC.ccipr1().modify(|w| w.set_clk48msel(0)); | ||
| 382 | } | ||
| 383 | |||
| 384 | // Set flash wait states | ||
| 385 | // VCORE Range 0 (performance), others TODO | ||
| 386 | FLASH.acr().modify(|w| { | ||
| 387 | w.set_latency(match sys_clk { | ||
| 388 | 0..=20_000_000 => 0, | ||
| 389 | 0..=40_000_000 => 1, | ||
| 390 | 0..=60_000_000 => 2, | ||
| 391 | 0..=80_000_000 => 3, | ||
| 392 | 0..=100_000_000 => 4, | ||
| 393 | _ => 5, | ||
| 394 | }) | ||
| 395 | }); | ||
| 396 | |||
| 397 | RCC.cfgr().modify(|w| { | ||
| 398 | w.set_sw(sw); | ||
| 399 | w.set_hpre(config.ahb_pre.into()); | ||
| 400 | w.set_ppre1(config.apb1_pre.into()); | ||
| 401 | w.set_ppre2(config.apb2_pre.into()); | ||
| 402 | }); | ||
| 403 | |||
| 404 | let ahb_freq: u32 = match config.ahb_pre { | ||
| 405 | AHBPrescaler::DIV1 => sys_clk, | ||
| 406 | pre => { | ||
| 407 | let pre: Hpre = pre.into(); | ||
| 408 | let pre = 1 << (pre.to_bits() as u32 - 7); | ||
| 409 | sys_clk / pre | ||
| 410 | } | ||
| 411 | }; | ||
| 412 | |||
| 413 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | ||
| 414 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 415 | pre => { | ||
| 416 | let pre: Ppre = pre.into(); | ||
| 417 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 418 | let freq = ahb_freq / pre as u32; | ||
| 419 | (freq, freq * 2) | ||
| 420 | } | ||
| 421 | }; | ||
| 422 | |||
| 423 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | ||
| 424 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | ||
| 425 | pre => { | ||
| 426 | let pre: Ppre = pre.into(); | ||
| 427 | let pre: u8 = 1 << (pre.to_bits() - 3); | ||
| 428 | let freq = ahb_freq / pre as u32; | ||
| 429 | (freq, freq * 2) | ||
| 430 | } | ||
| 431 | }; | ||
| 432 | |||
| 433 | set_freqs(Clocks { | ||
| 434 | sys: Hertz(sys_clk), | ||
| 435 | ahb1: Hertz(ahb_freq), | ||
| 436 | ahb2: Hertz(ahb_freq), | ||
| 437 | ahb3: Hertz(ahb_freq), | ||
| 438 | apb1: Hertz(apb1_freq), | ||
| 439 | apb2: Hertz(apb2_freq), | ||
| 440 | apb1_tim: Hertz(apb1_tim_freq), | ||
| 441 | apb2_tim: Hertz(apb2_tim_freq), | ||
| 442 | }); | ||
| 443 | } | ||
diff --git a/embassy-stm32/src/rcc/mco.rs b/embassy-stm32/src/rcc/mco.rs index 2453ed821..eaaf8071c 100644 --- a/embassy-stm32/src/rcc/mco.rs +++ b/embassy-stm32/src/rcc/mco.rs | |||
| @@ -4,14 +4,19 @@ use embassy_hal_internal::into_ref; | |||
| 4 | 4 | ||
| 5 | use crate::gpio::sealed::AFType; | 5 | use crate::gpio::sealed::AFType; |
| 6 | use crate::gpio::Speed; | 6 | use crate::gpio::Speed; |
| 7 | pub use crate::pac::rcc::vals::{Mco1 as Mco1Source, Mco2 as Mco2Source}; | 7 | #[cfg(not(stm32f1))] |
| 8 | pub use crate::pac::rcc::vals::Mcopre as McoPrescaler; | ||
| 9 | #[cfg(not(any(rcc_f2, rcc_f410, rcc_f4, rcc_f7, rcc_h50, rcc_h5, rcc_h7ab, rcc_h7rm0433, rcc_h7)))] | ||
| 10 | pub use crate::pac::rcc::vals::Mcosel as McoSource; | ||
| 11 | #[cfg(any(rcc_f2, rcc_f410, rcc_f4, rcc_f7, rcc_h50, rcc_h5, rcc_h7ab, rcc_h7rm0433, rcc_h7))] | ||
| 12 | pub use crate::pac::rcc::vals::{Mco1sel as Mco1Source, Mco2sel as Mco2Source}; | ||
| 8 | use crate::pac::RCC; | 13 | use crate::pac::RCC; |
| 9 | use crate::{peripherals, Peripheral}; | 14 | use crate::{peripherals, Peripheral}; |
| 10 | 15 | ||
| 11 | pub(crate) mod sealed { | 16 | pub(crate) mod sealed { |
| 12 | pub trait McoInstance { | 17 | pub trait McoInstance { |
| 13 | type Source; | 18 | type Source; |
| 14 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: u8); | 19 | unsafe fn apply_clock_settings(source: Self::Source, #[cfg(not(stm32f1))] prescaler: super::McoPrescaler); |
| 15 | } | 20 | } |
| 16 | } | 21 | } |
| 17 | 22 | ||
| @@ -24,9 +29,15 @@ macro_rules! impl_peri { | |||
| 24 | impl sealed::McoInstance for peripherals::$peri { | 29 | impl sealed::McoInstance for peripherals::$peri { |
| 25 | type Source = $source; | 30 | type Source = $source; |
| 26 | 31 | ||
| 27 | unsafe fn apply_clock_settings(source: Self::Source, prescaler: u8) { | 32 | unsafe fn apply_clock_settings(source: Self::Source, #[cfg(not(stm32f1))] prescaler: McoPrescaler) { |
| 28 | RCC.cfgr().modify(|w| { | 33 | #[cfg(not(any(stm32u5, stm32wba)))] |
| 34 | let r = RCC.cfgr(); | ||
| 35 | #[cfg(any(stm32u5, stm32wba))] | ||
| 36 | let r = RCC.cfgr1(); | ||
| 37 | |||
| 38 | r.modify(|w| { | ||
| 29 | w.$set_source(source); | 39 | w.$set_source(source); |
| 40 | #[cfg(not(stm32f1))] | ||
| 30 | w.$set_prescaler(prescaler); | 41 | w.$set_prescaler(prescaler); |
| 31 | }); | 42 | }); |
| 32 | } | 43 | } |
| @@ -36,8 +47,16 @@ macro_rules! impl_peri { | |||
| 36 | }; | 47 | }; |
| 37 | } | 48 | } |
| 38 | 49 | ||
| 39 | impl_peri!(MCO1, Mco1Source, set_mco1, set_mco1pre); | 50 | #[cfg(any(rcc_c0, rcc_g0))] |
| 40 | impl_peri!(MCO2, Mco2Source, set_mco2, set_mco2pre); | 51 | #[allow(unused_imports)] |
| 52 | use self::{McoSource as Mco1Source, McoSource as Mco2Source}; | ||
| 53 | |||
| 54 | #[cfg(mco)] | ||
| 55 | impl_peri!(MCO, McoSource, set_mcosel, set_mcopre); | ||
| 56 | #[cfg(mco1)] | ||
| 57 | impl_peri!(MCO1, Mco1Source, set_mco1sel, set_mco1pre); | ||
| 58 | #[cfg(mco2)] | ||
| 59 | impl_peri!(MCO2, Mco2Source, set_mco2sel, set_mco2pre); | ||
| 41 | 60 | ||
| 42 | pub struct Mco<'d, T: McoInstance> { | 61 | pub struct Mco<'d, T: McoInstance> { |
| 43 | phantom: PhantomData<&'d mut T>, | 62 | phantom: PhantomData<&'d mut T>, |
| @@ -45,23 +64,20 @@ pub struct Mco<'d, T: McoInstance> { | |||
| 45 | 64 | ||
| 46 | impl<'d, T: McoInstance> Mco<'d, T> { | 65 | impl<'d, T: McoInstance> Mco<'d, T> { |
| 47 | /// Create a new MCO instance. | 66 | /// Create a new MCO instance. |
| 48 | /// | ||
| 49 | /// `prescaler` must be between 1 and 15. | ||
| 50 | pub fn new( | 67 | pub fn new( |
| 51 | _peri: impl Peripheral<P = T> + 'd, | 68 | _peri: impl Peripheral<P = T> + 'd, |
| 52 | pin: impl Peripheral<P = impl McoPin<T>> + 'd, | 69 | pin: impl Peripheral<P = impl McoPin<T>> + 'd, |
| 53 | source: T::Source, | 70 | source: T::Source, |
| 54 | prescaler: u8, | 71 | #[cfg(not(stm32f1))] prescaler: McoPrescaler, |
| 55 | ) -> Self { | 72 | ) -> Self { |
| 56 | into_ref!(pin); | 73 | into_ref!(pin); |
| 57 | 74 | ||
| 58 | assert!( | ||
| 59 | 1 <= prescaler && prescaler <= 15, | ||
| 60 | "Mco prescaler must be between 1 and 15. Refer to the reference manual for more information." | ||
| 61 | ); | ||
| 62 | |||
| 63 | critical_section::with(|_| unsafe { | 75 | critical_section::with(|_| unsafe { |
| 64 | T::apply_clock_settings(source, prescaler); | 76 | T::apply_clock_settings( |
| 77 | source, | ||
| 78 | #[cfg(not(stm32f1))] | ||
| 79 | prescaler, | ||
| 80 | ); | ||
| 65 | pin.set_as_af(pin.af_num(), AFType::OutputPushPull); | 81 | pin.set_as_af(pin.af_num(), AFType::OutputPushPull); |
| 66 | pin.set_speed(Speed::VeryHigh); | 82 | pin.set_speed(Speed::VeryHigh); |
| 67 | }); | 83 | }); |
diff --git a/embassy-stm32/src/rcc/mod.rs b/embassy-stm32/src/rcc/mod.rs index 9ccf2ac4f..49174b27f 100644 --- a/embassy-stm32/src/rcc/mod.rs +++ b/embassy-stm32/src/rcc/mod.rs | |||
| @@ -2,38 +2,33 @@ | |||
| 2 | 2 | ||
| 3 | use core::mem::MaybeUninit; | 3 | use core::mem::MaybeUninit; |
| 4 | 4 | ||
| 5 | pub use crate::rcc::bd::RtcClockSource; | ||
| 6 | use crate::time::Hertz; | 5 | use crate::time::Hertz; |
| 7 | 6 | ||
| 8 | pub(crate) mod bd; | 7 | mod bd; |
| 9 | mod bus; | ||
| 10 | #[cfg(any(stm32h5, stm32h7))] | ||
| 11 | mod mco; | 8 | mod mco; |
| 12 | #[cfg(any(stm32h5, stm32h7))] | 9 | pub use bd::*; |
| 13 | pub use mco::*; | 10 | pub use mco::*; |
| 14 | 11 | ||
| 15 | #[cfg_attr(rcc_f0, path = "f0.rs")] | 12 | #[cfg_attr(rcc_f0, path = "f0.rs")] |
| 16 | #[cfg_attr(any(rcc_f1, rcc_f100, rcc_f1cl), path = "f1.rs")] | 13 | #[cfg_attr(any(rcc_f1, rcc_f100, rcc_f1cl), path = "f1.rs")] |
| 17 | #[cfg_attr(rcc_f2, path = "f2.rs")] | 14 | #[cfg_attr(rcc_f2, path = "f2.rs")] |
| 18 | #[cfg_attr(any(rcc_f3, rcc_f3_v2), path = "f3.rs")] | 15 | #[cfg_attr(any(rcc_f3, rcc_f3_v2), path = "f3.rs")] |
| 19 | #[cfg_attr(any(rcc_f4, rcc_f410), path = "f4.rs")] | 16 | #[cfg_attr(any(rcc_f4, rcc_f410, rcc_f7), path = "f4f7.rs")] |
| 20 | #[cfg_attr(rcc_f7, path = "f7.rs")] | ||
| 21 | #[cfg_attr(rcc_c0, path = "c0.rs")] | 17 | #[cfg_attr(rcc_c0, path = "c0.rs")] |
| 22 | #[cfg_attr(rcc_g0, path = "g0.rs")] | 18 | #[cfg_attr(rcc_g0, path = "g0.rs")] |
| 23 | #[cfg_attr(rcc_g4, path = "g4.rs")] | 19 | #[cfg_attr(rcc_g4, path = "g4.rs")] |
| 24 | #[cfg_attr(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7ab), path = "h.rs")] | 20 | #[cfg_attr(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7rm0433, rcc_h7ab), path = "h.rs")] |
| 25 | #[cfg_attr(rcc_l0, path = "l0.rs")] | 21 | #[cfg_attr(any(rcc_l0, rcc_l0_v2, rcc_l1), path = "l0l1.rs")] |
| 26 | #[cfg_attr(rcc_l1, path = "l1.rs")] | 22 | #[cfg_attr(any(rcc_l4, rcc_l4plus, rcc_l5), path = "l4l5.rs")] |
| 27 | #[cfg_attr(rcc_l4, path = "l4.rs")] | ||
| 28 | #[cfg_attr(rcc_l5, path = "l5.rs")] | ||
| 29 | #[cfg_attr(rcc_u5, path = "u5.rs")] | 23 | #[cfg_attr(rcc_u5, path = "u5.rs")] |
| 30 | #[cfg_attr(rcc_wb, path = "wb.rs")] | 24 | #[cfg_attr(rcc_wb, path = "wb.rs")] |
| 31 | #[cfg_attr(rcc_wba, path = "wba.rs")] | 25 | #[cfg_attr(rcc_wba, path = "wba.rs")] |
| 32 | #[cfg_attr(any(rcc_wl5, rcc_wle), path = "wl.rs")] | 26 | #[cfg_attr(any(rcc_wl5, rcc_wle), path = "wl.rs")] |
| 33 | mod _version; | 27 | mod _version; |
| 34 | pub use _version::*; | ||
| 35 | #[cfg(feature = "low-power")] | 28 | #[cfg(feature = "low-power")] |
| 36 | use atomic_polyfill::{AtomicU32, Ordering}; | 29 | use core::sync::atomic::{AtomicU32, Ordering}; |
| 30 | |||
| 31 | pub use _version::*; | ||
| 37 | 32 | ||
| 38 | // Model Clock Configuration | 33 | // Model Clock Configuration |
| 39 | // | 34 | // |
| @@ -51,44 +46,107 @@ pub struct Clocks { | |||
| 51 | pub sys: Hertz, | 46 | pub sys: Hertz, |
| 52 | 47 | ||
| 53 | // APB | 48 | // APB |
| 54 | pub apb1: Hertz, | 49 | pub pclk1: Hertz, |
| 55 | pub apb1_tim: Hertz, | 50 | pub pclk1_tim: Hertz, |
| 56 | #[cfg(not(any(rcc_c0, rcc_g0)))] | 51 | #[cfg(not(any(rcc_c0, rcc_g0)))] |
| 57 | pub apb2: Hertz, | 52 | pub pclk2: Hertz, |
| 58 | #[cfg(not(any(rcc_c0, rcc_g0)))] | 53 | #[cfg(not(any(rcc_c0, rcc_g0)))] |
| 59 | pub apb2_tim: Hertz, | 54 | pub pclk2_tim: Hertz, |
| 60 | #[cfg(any(rcc_wl5, rcc_wle, rcc_h5, rcc_h50, rcc_h7, rcc_h7ab, rcc_u5))] | 55 | #[cfg(any(rcc_wl5, rcc_wle, rcc_h5, rcc_h50, rcc_h7, rcc_h7rm0433, rcc_h7ab, rcc_u5))] |
| 61 | pub apb3: Hertz, | 56 | pub pclk3: Hertz, |
| 62 | #[cfg(any(rcc_h7, rcc_h7ab))] | 57 | #[cfg(any(rcc_h7, rcc_h7rm0433, rcc_h7ab, stm32h5))] |
| 63 | pub apb4: Hertz, | 58 | pub pclk4: Hertz, |
| 64 | #[cfg(any(rcc_wba))] | 59 | #[cfg(any(rcc_wba))] |
| 65 | pub apb7: Hertz, | 60 | pub pclk7: Hertz, |
| 66 | 61 | ||
| 67 | // AHB | 62 | // AHB |
| 68 | pub ahb1: Hertz, | 63 | pub hclk1: Hertz, |
| 69 | #[cfg(any( | 64 | #[cfg(any( |
| 70 | rcc_l4, rcc_l5, rcc_f2, rcc_f4, rcc_f410, rcc_f7, rcc_h5, rcc_h50, rcc_h7, rcc_h7ab, rcc_g4, rcc_u5, rcc_wb, | 65 | rcc_l4, |
| 71 | rcc_wba, rcc_wl5, rcc_wle | 66 | rcc_l4plus, |
| 67 | rcc_l5, | ||
| 68 | rcc_f2, | ||
| 69 | rcc_f4, | ||
| 70 | rcc_f410, | ||
| 71 | rcc_f7, | ||
| 72 | rcc_h5, | ||
| 73 | rcc_h50, | ||
| 74 | rcc_h7, | ||
| 75 | rcc_h7rm0433, | ||
| 76 | rcc_h7ab, | ||
| 77 | rcc_g4, | ||
| 78 | rcc_u5, | ||
| 79 | rcc_wb, | ||
| 80 | rcc_wba, | ||
| 81 | rcc_wl5, | ||
| 82 | rcc_wle | ||
| 72 | ))] | 83 | ))] |
| 73 | pub ahb2: Hertz, | 84 | pub hclk2: Hertz, |
| 74 | #[cfg(any( | 85 | #[cfg(any( |
| 75 | rcc_l4, rcc_l5, rcc_f2, rcc_f4, rcc_f410, rcc_f7, rcc_h5, rcc_h50, rcc_h7, rcc_h7ab, rcc_u5, rcc_wb, rcc_wl5, | 86 | rcc_l4, |
| 87 | rcc_l4plus, | ||
| 88 | rcc_l5, | ||
| 89 | rcc_f2, | ||
| 90 | rcc_f4, | ||
| 91 | rcc_f410, | ||
| 92 | rcc_f7, | ||
| 93 | rcc_h5, | ||
| 94 | rcc_h50, | ||
| 95 | rcc_h7, | ||
| 96 | rcc_h7rm0433, | ||
| 97 | rcc_h7ab, | ||
| 98 | rcc_u5, | ||
| 99 | rcc_wb, | ||
| 100 | rcc_wl5, | ||
| 76 | rcc_wle | 101 | rcc_wle |
| 77 | ))] | 102 | ))] |
| 78 | pub ahb3: Hertz, | 103 | pub hclk3: Hertz, |
| 79 | #[cfg(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7ab, rcc_wba))] | 104 | #[cfg(any(rcc_h5, rcc_h50, rcc_h7, rcc_h7rm0433, rcc_h7ab, rcc_wba))] |
| 80 | pub ahb4: Hertz, | 105 | pub hclk4: Hertz, |
| 81 | |||
| 82 | #[cfg(any(rcc_f2, rcc_f4, rcc_f410, rcc_f7))] | ||
| 83 | pub pll48: Option<Hertz>, | ||
| 84 | 106 | ||
| 85 | #[cfg(all(rcc_f4, not(stm32f410)))] | 107 | #[cfg(all(rcc_f4, not(stm32f410)))] |
| 86 | pub plli2s: Option<Hertz>, | 108 | pub plli2s1_q: Option<Hertz>, |
| 109 | #[cfg(all(rcc_f4, not(stm32f410)))] | ||
| 110 | pub plli2s1_r: Option<Hertz>, | ||
| 87 | 111 | ||
| 112 | #[cfg(rcc_l4)] | ||
| 113 | pub pllsai1_p: Option<Hertz>, | ||
| 114 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | ||
| 115 | pub pllsai1_q: Option<Hertz>, | ||
| 88 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] | 116 | #[cfg(any(stm32f427, stm32f429, stm32f437, stm32f439, stm32f446, stm32f469, stm32f479))] |
| 89 | pub pllsai: Option<Hertz>, | 117 | pub pllsai1_r: Option<Hertz>, |
| 118 | #[cfg(rcc_l4)] | ||
| 119 | pub pllsai2_p: Option<Hertz>, | ||
| 120 | |||
| 121 | #[cfg(any(stm32g4, rcc_l4))] | ||
| 122 | pub pll1_p: Option<Hertz>, | ||
| 123 | #[cfg(any(stm32h5, stm32h7, rcc_f2, rcc_f4, rcc_f410, rcc_f7, rcc_l4))] | ||
| 124 | pub pll1_q: Option<Hertz>, | ||
| 125 | #[cfg(any(stm32h5, stm32h7))] | ||
| 126 | pub pll2_p: Option<Hertz>, | ||
| 127 | #[cfg(any(stm32h5, stm32h7))] | ||
| 128 | pub pll2_q: Option<Hertz>, | ||
| 129 | #[cfg(any(stm32h5, stm32h7))] | ||
| 130 | pub pll2_r: Option<Hertz>, | ||
| 131 | #[cfg(any(stm32h5, stm32h7))] | ||
| 132 | pub pll3_p: Option<Hertz>, | ||
| 133 | #[cfg(any(stm32h5, stm32h7))] | ||
| 134 | pub pll3_q: Option<Hertz>, | ||
| 135 | #[cfg(any(stm32h5, stm32h7))] | ||
| 136 | pub pll3_r: Option<Hertz>, | ||
| 90 | 137 | ||
| 91 | #[cfg(any(rcc_f1, rcc_f100, rcc_f1cl, rcc_h5, rcc_h50, rcc_h7, rcc_h7ab, rcc_f3, rcc_g4))] | 138 | #[cfg(any( |
| 139 | rcc_f1, | ||
| 140 | rcc_f100, | ||
| 141 | rcc_f1cl, | ||
| 142 | rcc_h5, | ||
| 143 | rcc_h50, | ||
| 144 | rcc_h7, | ||
| 145 | rcc_h7rm0433, | ||
| 146 | rcc_h7ab, | ||
| 147 | rcc_f3, | ||
| 148 | rcc_g4 | ||
| 149 | ))] | ||
| 92 | pub adc: Option<Hertz>, | 150 | pub adc: Option<Hertz>, |
| 93 | 151 | ||
| 94 | #[cfg(any(rcc_f3, rcc_g4))] | 152 | #[cfg(any(rcc_f3, rcc_g4))] |
| @@ -97,13 +155,33 @@ pub struct Clocks { | |||
| 97 | #[cfg(stm32f334)] | 155 | #[cfg(stm32f334)] |
| 98 | pub hrtim: Option<Hertz>, | 156 | pub hrtim: Option<Hertz>, |
| 99 | 157 | ||
| 100 | #[cfg(any(rcc_wb, rcc_f4, rcc_f410, rcc_f7))] | ||
| 101 | /// Set only if the lsi or lse is configured, indicates stop is supported | ||
| 102 | pub rtc: Option<Hertz>, | 158 | pub rtc: Option<Hertz>, |
| 103 | 159 | ||
| 104 | #[cfg(any(rcc_wb, rcc_f4, rcc_f410))] | 160 | #[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))] |
| 105 | /// Set if the hse is configured, indicates stop is not supported | 161 | pub hsi: Option<Hertz>, |
| 106 | pub rtc_hse: Option<Hertz>, | 162 | #[cfg(stm32h5)] |
| 163 | pub hsi48: Option<Hertz>, | ||
| 164 | #[cfg(stm32h5)] | ||
| 165 | pub lsi: Option<Hertz>, | ||
| 166 | #[cfg(any(stm32h5, stm32h7))] | ||
| 167 | pub csi: Option<Hertz>, | ||
| 168 | |||
| 169 | #[cfg(any(stm32h5, stm32h7, rcc_l4, rcc_c0))] | ||
| 170 | pub lse: Option<Hertz>, | ||
| 171 | #[cfg(any(stm32h5, stm32h7))] | ||
| 172 | pub hse: Option<Hertz>, | ||
| 173 | |||
| 174 | #[cfg(stm32h5)] | ||
| 175 | pub audioclk: Option<Hertz>, | ||
| 176 | #[cfg(any(stm32h5, stm32h7))] | ||
| 177 | pub per: Option<Hertz>, | ||
| 178 | |||
| 179 | #[cfg(stm32h7)] | ||
| 180 | pub rcc_pclk_d3: Option<Hertz>, | ||
| 181 | #[cfg(rcc_l4)] | ||
| 182 | pub sai1_extclk: Option<Hertz>, | ||
| 183 | #[cfg(rcc_l4)] | ||
| 184 | pub sai2_extclk: Option<Hertz>, | ||
| 107 | } | 185 | } |
| 108 | 186 | ||
| 109 | #[cfg(feature = "low-power")] | 187 | #[cfg(feature = "low-power")] |
| @@ -111,20 +189,22 @@ static CLOCK_REFCOUNT: AtomicU32 = AtomicU32::new(0); | |||
| 111 | 189 | ||
| 112 | #[cfg(feature = "low-power")] | 190 | #[cfg(feature = "low-power")] |
| 113 | pub fn low_power_ready() -> bool { | 191 | pub fn low_power_ready() -> bool { |
| 114 | trace!("clock refcount: {}", CLOCK_REFCOUNT.load(Ordering::SeqCst)); | 192 | // trace!("clock refcount: {}", CLOCK_REFCOUNT.load(Ordering::SeqCst)); |
| 115 | |||
| 116 | CLOCK_REFCOUNT.load(Ordering::SeqCst) == 0 | 193 | CLOCK_REFCOUNT.load(Ordering::SeqCst) == 0 |
| 117 | } | 194 | } |
| 118 | 195 | ||
| 119 | #[cfg(feature = "low-power")] | 196 | #[cfg(feature = "low-power")] |
| 120 | pub(crate) fn clock_refcount_add() { | 197 | pub(crate) fn clock_refcount_add(_cs: critical_section::CriticalSection) { |
| 121 | // We don't check for overflow because constructing more than u32 peripherals is unlikely | 198 | // We don't check for overflow because constructing more than u32 peripherals is unlikely |
| 122 | CLOCK_REFCOUNT.fetch_add(1, Ordering::Relaxed); | 199 | let n = CLOCK_REFCOUNT.load(Ordering::Relaxed); |
| 200 | CLOCK_REFCOUNT.store(n + 1, Ordering::Relaxed); | ||
| 123 | } | 201 | } |
| 124 | 202 | ||
| 125 | #[cfg(feature = "low-power")] | 203 | #[cfg(feature = "low-power")] |
| 126 | pub(crate) fn clock_refcount_sub() { | 204 | pub(crate) fn clock_refcount_sub(_cs: critical_section::CriticalSection) { |
| 127 | assert!(CLOCK_REFCOUNT.fetch_sub(1, Ordering::Relaxed) != 0); | 205 | let n = CLOCK_REFCOUNT.load(Ordering::Relaxed); |
| 206 | assert!(n != 0); | ||
| 207 | CLOCK_REFCOUNT.store(n - 1, Ordering::Relaxed); | ||
| 128 | } | 208 | } |
| 129 | 209 | ||
| 130 | /// Frozen clock frequencies | 210 | /// Frozen clock frequencies |
| @@ -132,14 +212,6 @@ pub(crate) fn clock_refcount_sub() { | |||
| 132 | /// The existence of this value indicates that the clock configuration can no longer be changed | 212 | /// The existence of this value indicates that the clock configuration can no longer be changed |
| 133 | static mut CLOCK_FREQS: MaybeUninit<Clocks> = MaybeUninit::uninit(); | 213 | static mut CLOCK_FREQS: MaybeUninit<Clocks> = MaybeUninit::uninit(); |
| 134 | 214 | ||
| 135 | #[cfg(stm32wb)] | ||
| 136 | /// RCC initialization function | ||
| 137 | pub(crate) unsafe fn init(config: Config) { | ||
| 138 | set_freqs(compute_clocks(&config)); | ||
| 139 | |||
| 140 | configure_clocks(&config); | ||
| 141 | } | ||
| 142 | |||
| 143 | /// Sets the clock frequencies | 215 | /// Sets the clock frequencies |
| 144 | /// | 216 | /// |
| 145 | /// Safety: Sets a mutable global. | 217 | /// Safety: Sets a mutable global. |
| @@ -159,11 +231,19 @@ pub mod low_level { | |||
| 159 | } | 231 | } |
| 160 | 232 | ||
| 161 | pub(crate) mod sealed { | 233 | pub(crate) mod sealed { |
| 234 | use critical_section::CriticalSection; | ||
| 235 | |||
| 162 | pub trait RccPeripheral { | 236 | pub trait RccPeripheral { |
| 163 | fn frequency() -> crate::time::Hertz; | 237 | fn frequency() -> crate::time::Hertz; |
| 164 | fn reset(); | 238 | fn enable_and_reset_with_cs(cs: CriticalSection); |
| 165 | fn enable(); | 239 | fn disable_with_cs(cs: CriticalSection); |
| 166 | fn disable(); | 240 | |
| 241 | fn enable_and_reset() { | ||
| 242 | critical_section::with(|cs| Self::enable_and_reset_with_cs(cs)) | ||
| 243 | } | ||
| 244 | fn disable() { | ||
| 245 | critical_section::with(|cs| Self::disable_with_cs(cs)) | ||
| 246 | } | ||
| 167 | } | 247 | } |
| 168 | } | 248 | } |
| 169 | 249 | ||
diff --git a/embassy-stm32/src/rcc/u5.rs b/embassy-stm32/src/rcc/u5.rs index d9a531285..aba5ca831 100644 --- a/embassy-stm32/src/rcc/u5.rs +++ b/embassy-stm32/src/rcc/u5.rs | |||
| @@ -1,121 +1,99 @@ | |||
| 1 | use stm32_metapac::rcc::vals::{Msirange, Msirgsel, Pllm, Pllsrc, Sw}; | 1 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Msirange, Plldiv, Pllm, Plln, Ppre as APBPrescaler}; |
| 2 | 2 | use crate::pac::rcc::vals::{Msirgsel, Pllmboost, Pllrge, Pllsrc, Sw}; | |
| 3 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | 3 | use crate::pac::{FLASH, PWR, RCC}; |
| 4 | use crate::pac::{FLASH, RCC}; | ||
| 5 | use crate::rcc::{set_freqs, Clocks}; | 4 | use crate::rcc::{set_freqs, Clocks}; |
| 6 | use crate::time::Hertz; | 5 | use crate::time::Hertz; |
| 7 | 6 | ||
| 8 | /// HSI speed | 7 | /// HSI speed |
| 9 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 8 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 10 | 9 | ||
| 11 | /// LSI speed | ||
| 12 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 13 | |||
| 14 | pub use crate::pac::pwr::vals::Vos as VoltageScale; | 10 | pub use crate::pac::pwr::vals::Vos as VoltageScale; |
| 15 | 11 | ||
| 16 | #[derive(Copy, Clone)] | 12 | #[derive(Copy, Clone)] |
| 17 | pub enum ClockSrc { | 13 | pub enum ClockSrc { |
| 18 | MSI(MSIRange), | 14 | /// Use an internal medium speed oscillator (MSIS) as the system clock. |
| 19 | HSE(Hertz), | 15 | MSI(Msirange), |
| 20 | HSI16, | 16 | /// Use the external high speed clock as the system clock. |
| 21 | PLL1R(PllSrc, PllM, PllN, PllClkDiv), | 17 | /// |
| 22 | } | 18 | /// HSE clocks faster than 25 MHz require at least `VoltageScale::RANGE3`, and HSE clocks must |
| 23 | 19 | /// never exceed 50 MHz. | |
| 24 | #[derive(Clone, Copy, Debug)] | ||
| 25 | pub enum PllSrc { | ||
| 26 | MSI(MSIRange), | ||
| 27 | HSE(Hertz), | 20 | HSE(Hertz), |
| 21 | /// Use the 16 MHz internal high speed oscillator as the system clock. | ||
| 28 | HSI16, | 22 | HSI16, |
| 23 | /// Use PLL1 as the system clock. | ||
| 24 | PLL1R(PllConfig), | ||
| 29 | } | 25 | } |
| 30 | 26 | ||
| 31 | impl Into<Pllsrc> for PllSrc { | 27 | impl Default for ClockSrc { |
| 32 | fn into(self) -> Pllsrc { | 28 | fn default() -> Self { |
| 33 | match self { | 29 | // The default system clock source is MSIS @ 4 MHz, per RM0456 § 11.4.9 |
| 34 | PllSrc::MSI(..) => Pllsrc::MSIS, | 30 | ClockSrc::MSI(Msirange::RANGE_4MHZ) |
| 35 | PllSrc::HSE(..) => Pllsrc::HSE, | ||
| 36 | PllSrc::HSI16 => Pllsrc::HSI16, | ||
| 37 | } | ||
| 38 | } | 31 | } |
| 39 | } | 32 | } |
| 40 | 33 | ||
| 41 | seq_macro::seq!(N in 2..=128 { | 34 | #[derive(Clone, Copy)] |
| 42 | #[derive(Copy, Clone, Debug)] | 35 | pub struct PllConfig { |
| 43 | pub enum PllClkDiv { | 36 | /// The clock source for the PLL. |
| 44 | NotDivided, | 37 | pub source: PllSrc, |
| 45 | #( | 38 | /// The PLL prescaler. |
| 46 | Div~N = (N-1), | 39 | /// |
| 47 | )* | 40 | /// The clock speed of the `source` divided by `m` must be between 4 and 16 MHz. |
| 48 | } | 41 | pub m: Pllm, |
| 49 | 42 | /// The PLL multiplier. | |
| 50 | impl PllClkDiv { | 43 | /// |
| 51 | fn to_div(&self) -> u8 { | 44 | /// The multiplied clock – `source` divided by `m` times `n` – must be between 128 and 544 |
| 52 | match self { | 45 | /// MHz. The upper limit may be lower depending on the `Config { voltage_range }`. |
| 53 | PllClkDiv::NotDivided => 1, | 46 | pub n: Plln, |
| 54 | #( | 47 | /// The divider for the R output. |
| 55 | PllClkDiv::Div~N => N + 1, | 48 | /// |
| 56 | )* | 49 | /// When used to drive the system clock, `source` divided by `m` times `n` divided by `r` |
| 57 | } | 50 | /// must not exceed 160 MHz. System clocks above 55 MHz require a non-default |
| 58 | } | 51 | /// `Config { voltage_range }`. |
| 59 | } | 52 | pub r: Plldiv, |
| 60 | }); | ||
| 61 | |||
| 62 | impl Into<u8> for PllClkDiv { | ||
| 63 | fn into(self) -> u8 { | ||
| 64 | (self as u8) + 1 | ||
| 65 | } | ||
| 66 | } | 53 | } |
| 67 | 54 | ||
| 68 | seq_macro::seq!(N in 4..=512 { | 55 | impl PllConfig { |
| 69 | #[derive(Copy, Clone, Debug)] | 56 | /// A configuration for HSI16 / 1 * 10 / 1 = 160 MHz |
| 70 | pub enum PllN { | 57 | pub const fn hsi16_160mhz() -> Self { |
| 71 | NotMultiplied, | 58 | PllConfig { |
| 72 | #( | 59 | source: PllSrc::HSI16, |
| 73 | Mul~N = N-1, | 60 | m: Pllm::DIV1, |
| 74 | )* | 61 | n: Plln::MUL10, |
| 75 | } | 62 | r: Plldiv::DIV1, |
| 76 | |||
| 77 | impl PllN { | ||
| 78 | fn to_mul(&self) -> u16 { | ||
| 79 | match self { | ||
| 80 | PllN::NotMultiplied => 1, | ||
| 81 | #( | ||
| 82 | PllN::Mul~N => N + 1, | ||
| 83 | )* | ||
| 84 | } | ||
| 85 | } | 63 | } |
| 86 | } | 64 | } |
| 87 | }); | ||
| 88 | 65 | ||
| 89 | impl Into<u16> for PllN { | 66 | /// A configuration for MSIS @ 48 MHz / 3 * 10 / 1 = 160 MHz |
| 90 | fn into(self) -> u16 { | 67 | pub const fn msis_160mhz() -> Self { |
| 91 | (self as u16) + 1 | 68 | PllConfig { |
| 69 | source: PllSrc::MSIS(Msirange::RANGE_48MHZ), | ||
| 70 | m: Pllm::DIV3, | ||
| 71 | n: Plln::MUL10, | ||
| 72 | r: Plldiv::DIV1, | ||
| 73 | } | ||
| 92 | } | 74 | } |
| 93 | } | 75 | } |
| 94 | 76 | ||
| 95 | // Pre-division | 77 | #[derive(Clone, Copy)] |
| 96 | #[derive(Copy, Clone, Debug)] | 78 | pub enum PllSrc { |
| 97 | pub enum PllM { | 79 | /// Use an internal medium speed oscillator as the PLL source. |
| 98 | NotDivided = 0b0000, | 80 | MSIS(Msirange), |
| 99 | Div2 = 0b0001, | 81 | /// Use the external high speed clock as the system PLL source. |
| 100 | Div3 = 0b0010, | 82 | /// |
| 101 | Div4 = 0b0011, | 83 | /// HSE clocks faster than 25 MHz require at least `VoltageScale::RANGE3`, and HSE clocks must |
| 102 | Div5 = 0b0100, | 84 | /// never exceed 50 MHz. |
| 103 | Div6 = 0b0101, | 85 | HSE(Hertz), |
| 104 | Div7 = 0b0110, | 86 | /// Use the 16 MHz internal high speed oscillator as the PLL source. |
| 105 | Div8 = 0b0111, | 87 | HSI16, |
| 106 | Div9 = 0b1000, | ||
| 107 | Div10 = 0b1001, | ||
| 108 | Div11 = 0b1010, | ||
| 109 | Div12 = 0b1011, | ||
| 110 | Div13 = 0b1100, | ||
| 111 | Div14 = 0b1101, | ||
| 112 | Div15 = 0b1110, | ||
| 113 | Div16 = 0b1111, | ||
| 114 | } | 88 | } |
| 115 | 89 | ||
| 116 | impl Into<Pllm> for PllM { | 90 | impl Into<Pllsrc> for PllSrc { |
| 117 | fn into(self) -> Pllm { | 91 | fn into(self) -> Pllsrc { |
| 118 | Pllm::from_bits(self as u8) | 92 | match self { |
| 93 | PllSrc::MSIS(..) => Pllsrc::MSIS, | ||
| 94 | PllSrc::HSE(..) => Pllsrc::HSE, | ||
| 95 | PllSrc::HSI16 => Pllsrc::HSI16, | ||
| 96 | } | ||
| 119 | } | 97 | } |
| 120 | } | 98 | } |
| 121 | 99 | ||
| @@ -130,153 +108,216 @@ impl Into<Sw> for ClockSrc { | |||
| 130 | } | 108 | } |
| 131 | } | 109 | } |
| 132 | 110 | ||
| 133 | #[derive(Debug, Copy, Clone)] | 111 | pub struct Config { |
| 134 | pub enum MSIRange { | 112 | pub mux: ClockSrc, |
| 135 | Range48mhz = 48_000_000, | 113 | pub ahb_pre: AHBPrescaler, |
| 136 | Range24mhz = 24_000_000, | 114 | pub apb1_pre: APBPrescaler, |
| 137 | Range16mhz = 16_000_000, | 115 | pub apb2_pre: APBPrescaler, |
| 138 | Range12mhz = 12_000_000, | 116 | pub apb3_pre: APBPrescaler, |
| 139 | Range4mhz = 4_000_000, | 117 | pub hsi48: bool, |
| 140 | Range2mhz = 2_000_000, | 118 | /// The voltage range influences the maximum clock frequencies for different parts of the |
| 141 | Range1_33mhz = 1_330_000, | 119 | /// device. In particular, system clocks exceeding 110 MHz require `RANGE1`, and system clocks |
| 142 | Range1mhz = 1_000_000, | 120 | /// exceeding 55 MHz require at least `RANGE2`. |
| 143 | Range3_072mhz = 3_072_000, | 121 | /// |
| 144 | Range1_536mhz = 1_536_000, | 122 | /// See RM0456 § 10.5.4 for a general overview and § 11.4.10 for clock source frequency limits. |
| 145 | Range1_024mhz = 1_024_000, | 123 | pub voltage_range: VoltageScale, |
| 146 | Range768khz = 768_000, | 124 | pub ls: super::LsConfig, |
| 147 | Range400khz = 400_000, | ||
| 148 | Range200khz = 200_000, | ||
| 149 | Range133khz = 133_000, | ||
| 150 | Range100khz = 100_000, | ||
| 151 | } | 125 | } |
| 152 | 126 | ||
| 153 | impl Into<u32> for MSIRange { | 127 | impl Config { |
| 154 | fn into(self) -> u32 { | 128 | unsafe fn init_hsi16(&self) -> Hertz { |
| 155 | self as u32 | 129 | RCC.cr().write(|w| w.set_hsion(true)); |
| 130 | while !RCC.cr().read().hsirdy() {} | ||
| 131 | |||
| 132 | HSI_FREQ | ||
| 156 | } | 133 | } |
| 157 | } | ||
| 158 | 134 | ||
| 159 | impl Into<Msirange> for MSIRange { | 135 | unsafe fn init_hse(&self, frequency: Hertz) -> Hertz { |
| 160 | fn into(self) -> Msirange { | 136 | // Check frequency limits per RM456 § 11.4.10 |
| 161 | match self { | 137 | match self.voltage_range { |
| 162 | MSIRange::Range48mhz => Msirange::RANGE_48MHZ, | 138 | VoltageScale::RANGE1 | VoltageScale::RANGE2 | VoltageScale::RANGE3 => { |
| 163 | MSIRange::Range24mhz => Msirange::RANGE_24MHZ, | 139 | assert!(frequency.0 <= 50_000_000); |
| 164 | MSIRange::Range16mhz => Msirange::RANGE_16MHZ, | 140 | } |
| 165 | MSIRange::Range12mhz => Msirange::RANGE_12MHZ, | 141 | VoltageScale::RANGE4 => { |
| 166 | MSIRange::Range4mhz => Msirange::RANGE_4MHZ, | 142 | assert!(frequency.0 <= 25_000_000); |
| 167 | MSIRange::Range2mhz => Msirange::RANGE_2MHZ, | 143 | } |
| 168 | MSIRange::Range1_33mhz => Msirange::RANGE_1_33MHZ, | ||
| 169 | MSIRange::Range1mhz => Msirange::RANGE_1MHZ, | ||
| 170 | MSIRange::Range3_072mhz => Msirange::RANGE_3_072MHZ, | ||
| 171 | MSIRange::Range1_536mhz => Msirange::RANGE_1_536MHZ, | ||
| 172 | MSIRange::Range1_024mhz => Msirange::RANGE_1_024MHZ, | ||
| 173 | MSIRange::Range768khz => Msirange::RANGE_768KHZ, | ||
| 174 | MSIRange::Range400khz => Msirange::RANGE_400KHZ, | ||
| 175 | MSIRange::Range200khz => Msirange::RANGE_200KHZ, | ||
| 176 | MSIRange::Range133khz => Msirange::RANGE_133KHZ, | ||
| 177 | MSIRange::Range100khz => Msirange::RANGE_100KHZ, | ||
| 178 | } | 144 | } |
| 179 | } | ||
| 180 | } | ||
| 181 | 145 | ||
| 182 | impl Default for MSIRange { | 146 | // Enable HSE, and wait for it to stabilize |
| 183 | fn default() -> Self { | 147 | RCC.cr().write(|w| w.set_hseon(true)); |
| 184 | MSIRange::Range4mhz | 148 | while !RCC.cr().read().hserdy() {} |
| 149 | |||
| 150 | frequency | ||
| 185 | } | 151 | } |
| 186 | } | ||
| 187 | 152 | ||
| 188 | #[derive(Copy, Clone)] | 153 | unsafe fn init_msis(&self, range: Msirange) -> Hertz { |
| 189 | pub struct Config { | 154 | // Check MSI output per RM0456 § 11.4.10 |
| 190 | pub mux: ClockSrc, | 155 | match self.voltage_range { |
| 191 | pub ahb_pre: AHBPrescaler, | 156 | VoltageScale::RANGE4 => { |
| 192 | pub apb1_pre: APBPrescaler, | 157 | assert!(msirange_to_hertz(range).0 <= 24_000_000); |
| 193 | pub apb2_pre: APBPrescaler, | 158 | } |
| 194 | pub apb3_pre: APBPrescaler, | 159 | _ => {} |
| 195 | pub hsi48: bool, | 160 | } |
| 161 | |||
| 162 | // RM0456 § 11.8.2: spin until MSIS is off or MSIS is ready before setting its range | ||
| 163 | loop { | ||
| 164 | let cr = RCC.cr().read(); | ||
| 165 | if cr.msison() == false || cr.msisrdy() == true { | ||
| 166 | break; | ||
| 167 | } | ||
| 168 | } | ||
| 169 | |||
| 170 | RCC.icscr1().modify(|w| { | ||
| 171 | w.set_msisrange(range); | ||
| 172 | w.set_msirgsel(Msirgsel::RCC_ICSCR1); | ||
| 173 | }); | ||
| 174 | RCC.cr().write(|w| { | ||
| 175 | w.set_msipllen(false); | ||
| 176 | w.set_msison(true); | ||
| 177 | }); | ||
| 178 | while !RCC.cr().read().msisrdy() {} | ||
| 179 | msirange_to_hertz(range) | ||
| 180 | } | ||
| 196 | } | 181 | } |
| 197 | 182 | ||
| 198 | impl Default for Config { | 183 | impl Default for Config { |
| 199 | fn default() -> Self { | 184 | fn default() -> Self { |
| 200 | Self { | 185 | Self { |
| 201 | mux: ClockSrc::MSI(MSIRange::default()), | 186 | mux: ClockSrc::default(), |
| 202 | ahb_pre: AHBPrescaler::DIV1, | 187 | ahb_pre: AHBPrescaler::DIV1, |
| 203 | apb1_pre: APBPrescaler::DIV1, | 188 | apb1_pre: APBPrescaler::DIV1, |
| 204 | apb2_pre: APBPrescaler::DIV1, | 189 | apb2_pre: APBPrescaler::DIV1, |
| 205 | apb3_pre: APBPrescaler::DIV1, | 190 | apb3_pre: APBPrescaler::DIV1, |
| 206 | hsi48: false, | 191 | hsi48: true, |
| 192 | voltage_range: VoltageScale::RANGE3, | ||
| 193 | ls: Default::default(), | ||
| 207 | } | 194 | } |
| 208 | } | 195 | } |
| 209 | } | 196 | } |
| 210 | 197 | ||
| 211 | pub(crate) unsafe fn init(config: Config) { | 198 | pub(crate) unsafe fn init(config: Config) { |
| 199 | // Ensure PWR peripheral clock is enabled | ||
| 200 | RCC.ahb3enr().modify(|w| { | ||
| 201 | w.set_pwren(true); | ||
| 202 | }); | ||
| 203 | RCC.ahb3enr().read(); // synchronize | ||
| 204 | |||
| 205 | // Set the requested power mode | ||
| 206 | PWR.vosr().modify(|w| { | ||
| 207 | w.set_vos(config.voltage_range); | ||
| 208 | }); | ||
| 209 | while !PWR.vosr().read().vosrdy() {} | ||
| 210 | |||
| 212 | let sys_clk = match config.mux { | 211 | let sys_clk = match config.mux { |
| 213 | ClockSrc::MSI(range) => { | 212 | ClockSrc::MSI(range) => config.init_msis(range), |
| 214 | RCC.icscr1().modify(|w| { | 213 | ClockSrc::HSE(freq) => config.init_hse(freq), |
| 215 | let bits: Msirange = range.into(); | 214 | ClockSrc::HSI16 => config.init_hsi16(), |
| 216 | w.set_msisrange(bits); | 215 | ClockSrc::PLL1R(pll) => { |
| 217 | w.set_msirgsel(Msirgsel::RCC_ICSCR1); | 216 | // Configure the PLL source |
| 218 | }); | 217 | let source_clk = match pll.source { |
| 219 | RCC.cr().write(|w| { | 218 | PllSrc::MSIS(range) => config.init_msis(range), |
| 220 | w.set_msipllen(false); | 219 | PllSrc::HSE(hertz) => config.init_hse(hertz), |
| 221 | w.set_msison(true); | 220 | PllSrc::HSI16 => config.init_hsi16(), |
| 222 | }); | 221 | }; |
| 223 | while !RCC.cr().read().msisrdy() {} | ||
| 224 | 222 | ||
| 225 | range.into() | 223 | // Calculate the reference clock, which is the source divided by m |
| 226 | } | 224 | let reference_clk = source_clk / pll.m; |
| 227 | ClockSrc::HSE(freq) => { | ||
| 228 | RCC.cr().write(|w| w.set_hseon(true)); | ||
| 229 | while !RCC.cr().read().hserdy() {} | ||
| 230 | 225 | ||
| 231 | freq.0 | 226 | // Check limits per RM0456 § 11.4.6 |
| 232 | } | 227 | assert!(Hertz::mhz(4) <= reference_clk && reference_clk <= Hertz::mhz(16)); |
| 233 | ClockSrc::HSI16 => { | ||
| 234 | RCC.cr().write(|w| w.set_hsion(true)); | ||
| 235 | while !RCC.cr().read().hsirdy() {} | ||
| 236 | 228 | ||
| 237 | HSI_FREQ.0 | 229 | // Calculate the PLL1 VCO clock and PLL1 R output clock |
| 238 | } | 230 | let pll1_clk = reference_clk * pll.n; |
| 239 | ClockSrc::PLL1R(src, m, n, div) => { | 231 | let pll1r_clk = pll1_clk / pll.r; |
| 240 | let freq = match src { | 232 | |
| 241 | PllSrc::MSI(_) => { | 233 | // Check system clock per RM0456 § 11.4.9 |
| 242 | // TODO: enable MSI | 234 | assert!(pll1r_clk <= Hertz::mhz(160)); |
| 243 | MSIRange::default().into() | 235 | |
| 236 | // Check PLL clocks per RM0456 § 11.4.10 | ||
| 237 | match config.voltage_range { | ||
| 238 | VoltageScale::RANGE1 => { | ||
| 239 | assert!(pll1_clk >= Hertz::mhz(128) && pll1_clk <= Hertz::mhz(544)); | ||
| 240 | assert!(pll1r_clk <= Hertz::mhz(208)); | ||
| 244 | } | 241 | } |
| 245 | PllSrc::HSE(hertz) => { | 242 | VoltageScale::RANGE2 => { |
| 246 | // TODO: enable HSE | 243 | assert!(pll1_clk >= Hertz::mhz(128) && pll1_clk <= Hertz::mhz(544)); |
| 247 | hertz.0 | 244 | assert!(pll1r_clk <= Hertz::mhz(110)); |
| 248 | } | 245 | } |
| 249 | PllSrc::HSI16 => { | 246 | VoltageScale::RANGE3 => { |
| 250 | RCC.cr().write(|w| w.set_hsion(true)); | 247 | assert!(pll1_clk >= Hertz::mhz(128) && pll1_clk <= Hertz::mhz(330)); |
| 251 | while !RCC.cr().read().hsirdy() {} | 248 | assert!(pll1r_clk <= Hertz::mhz(55)); |
| 249 | } | ||
| 250 | VoltageScale::RANGE4 => { | ||
| 251 | panic!("PLL is unavailable in voltage range 4"); | ||
| 252 | } | ||
| 253 | } | ||
| 252 | 254 | ||
| 253 | HSI_FREQ.0 | 255 | // § 10.5.4: if we're targeting >= 55 MHz, we must configure PLL1MBOOST to a prescaler |
| 256 | // value that results in an output between 4 and 16 MHz for the PWR EPOD boost | ||
| 257 | let mboost = if pll1r_clk >= Hertz::mhz(55) { | ||
| 258 | // source_clk can be up to 50 MHz, so there's just a few cases: | ||
| 259 | if source_clk > Hertz::mhz(32) { | ||
| 260 | // Divide by 4, giving EPOD 8-12.5 MHz | ||
| 261 | Pllmboost::DIV4 | ||
| 262 | } else if source_clk > Hertz::mhz(16) { | ||
| 263 | // Divide by 2, giving EPOD 8-16 MHz | ||
| 264 | Pllmboost::DIV2 | ||
| 265 | } else { | ||
| 266 | // Bypass, giving EPOD 4-16 MHz | ||
| 267 | Pllmboost::DIV1 | ||
| 254 | } | 268 | } |
| 269 | } else { | ||
| 270 | // Nothing to do | ||
| 271 | Pllmboost::DIV1 | ||
| 255 | }; | 272 | }; |
| 256 | 273 | ||
| 257 | // disable | 274 | // Disable the PLL, and wait for it to disable |
| 258 | RCC.cr().modify(|w| w.set_pllon(0, false)); | 275 | RCC.cr().modify(|w| w.set_pllon(0, false)); |
| 259 | while RCC.cr().read().pllrdy(0) {} | 276 | while RCC.cr().read().pllrdy(0) {} |
| 260 | 277 | ||
| 261 | let vco = freq * n as u8 as u32; | 278 | // Configure the PLL |
| 262 | let pll_ck = vco / (div as u8 as u32 + 1); | ||
| 263 | |||
| 264 | RCC.pll1cfgr().write(|w| { | 279 | RCC.pll1cfgr().write(|w| { |
| 265 | w.set_pllm(m.into()); | 280 | // Configure PLL1 source and prescaler |
| 266 | w.set_pllsrc(src.into()); | 281 | w.set_pllsrc(pll.source.into()); |
| 282 | w.set_pllm(pll.m); | ||
| 283 | |||
| 284 | // Configure PLL1 input frequncy range | ||
| 285 | let input_range = if reference_clk <= Hertz::mhz(8) { | ||
| 286 | Pllrge::FREQ_4TO8MHZ | ||
| 287 | } else { | ||
| 288 | Pllrge::FREQ_8TO16MHZ | ||
| 289 | }; | ||
| 290 | w.set_pllrge(input_range); | ||
| 291 | |||
| 292 | // Set the prescaler for PWR EPOD | ||
| 293 | w.set_pllmboost(mboost); | ||
| 294 | |||
| 295 | // Enable PLL1R output | ||
| 267 | w.set_pllren(true); | 296 | w.set_pllren(true); |
| 268 | }); | 297 | }); |
| 269 | 298 | ||
| 299 | // Configure the PLL divisors | ||
| 270 | RCC.pll1divr().modify(|w| { | 300 | RCC.pll1divr().modify(|w| { |
| 271 | w.set_pllr(div.to_div()); | 301 | // Set the VCO multiplier |
| 272 | w.set_plln(n.to_mul()); | 302 | w.set_plln(pll.n); |
| 303 | // Set the R output divisor | ||
| 304 | w.set_pllr(pll.r); | ||
| 273 | }); | 305 | }); |
| 274 | 306 | ||
| 275 | // Enable PLL | 307 | // Do we need the EPOD booster to reach the target clock speed per § 10.5.4? |
| 308 | if pll1r_clk >= Hertz::mhz(55) { | ||
| 309 | // Enable the booster | ||
| 310 | PWR.vosr().modify(|w| { | ||
| 311 | w.set_boosten(true); | ||
| 312 | }); | ||
| 313 | while !PWR.vosr().read().boostrdy() {} | ||
| 314 | } | ||
| 315 | |||
| 316 | // Enable the PLL | ||
| 276 | RCC.cr().modify(|w| w.set_pllon(0, true)); | 317 | RCC.cr().modify(|w| w.set_pllon(0, true)); |
| 277 | while !RCC.cr().read().pllrdy(0) {} | 318 | while !RCC.cr().read().pllrdy(0) {} |
| 278 | 319 | ||
| 279 | pll_ck | 320 | pll1r_clk |
| 280 | } | 321 | } |
| 281 | }; | 322 | }; |
| 282 | 323 | ||
| @@ -285,20 +326,18 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 285 | while !RCC.cr().read().hsi48rdy() {} | 326 | while !RCC.cr().read().hsi48rdy() {} |
| 286 | } | 327 | } |
| 287 | 328 | ||
| 288 | // TODO make configurable | 329 | // The clock source is ready |
| 289 | let power_vos = VoltageScale::RANGE3; | 330 | // Calculate and set the flash wait states |
| 290 | 331 | let wait_states = match config.voltage_range { | |
| 291 | // states and programming delay | ||
| 292 | let wait_states = match power_vos { | ||
| 293 | // VOS 1 range VCORE 1.26V - 1.40V | 332 | // VOS 1 range VCORE 1.26V - 1.40V |
| 294 | VoltageScale::RANGE1 => { | 333 | VoltageScale::RANGE1 => { |
| 295 | if sys_clk < 32_000_000 { | 334 | if sys_clk.0 < 32_000_000 { |
| 296 | 0 | 335 | 0 |
| 297 | } else if sys_clk < 64_000_000 { | 336 | } else if sys_clk.0 < 64_000_000 { |
| 298 | 1 | 337 | 1 |
| 299 | } else if sys_clk < 96_000_000 { | 338 | } else if sys_clk.0 < 96_000_000 { |
| 300 | 2 | 339 | 2 |
| 301 | } else if sys_clk < 128_000_000 { | 340 | } else if sys_clk.0 < 128_000_000 { |
| 302 | 3 | 341 | 3 |
| 303 | } else { | 342 | } else { |
| 304 | 4 | 343 | 4 |
| @@ -306,11 +345,11 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 306 | } | 345 | } |
| 307 | // VOS 2 range VCORE 1.15V - 1.26V | 346 | // VOS 2 range VCORE 1.15V - 1.26V |
| 308 | VoltageScale::RANGE2 => { | 347 | VoltageScale::RANGE2 => { |
| 309 | if sys_clk < 30_000_000 { | 348 | if sys_clk.0 < 30_000_000 { |
| 310 | 0 | 349 | 0 |
| 311 | } else if sys_clk < 60_000_000 { | 350 | } else if sys_clk.0 < 60_000_000 { |
| 312 | 1 | 351 | 1 |
| 313 | } else if sys_clk < 90_000_000 { | 352 | } else if sys_clk.0 < 90_000_000 { |
| 314 | 2 | 353 | 2 |
| 315 | } else { | 354 | } else { |
| 316 | 3 | 355 | 3 |
| @@ -318,9 +357,9 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 318 | } | 357 | } |
| 319 | // VOS 3 range VCORE 1.05V - 1.15V | 358 | // VOS 3 range VCORE 1.05V - 1.15V |
| 320 | VoltageScale::RANGE3 => { | 359 | VoltageScale::RANGE3 => { |
| 321 | if sys_clk < 24_000_000 { | 360 | if sys_clk.0 < 24_000_000 { |
| 322 | 0 | 361 | 0 |
| 323 | } else if sys_clk < 48_000_000 { | 362 | } else if sys_clk.0 < 48_000_000 { |
| 324 | 1 | 363 | 1 |
| 325 | } else { | 364 | } else { |
| 326 | 2 | 365 | 2 |
| @@ -328,80 +367,104 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 328 | } | 367 | } |
| 329 | // VOS 4 range VCORE 0.95V - 1.05V | 368 | // VOS 4 range VCORE 0.95V - 1.05V |
| 330 | VoltageScale::RANGE4 => { | 369 | VoltageScale::RANGE4 => { |
| 331 | if sys_clk < 12_000_000 { | 370 | if sys_clk.0 < 12_000_000 { |
| 332 | 0 | 371 | 0 |
| 333 | } else { | 372 | } else { |
| 334 | 1 | 373 | 1 |
| 335 | } | 374 | } |
| 336 | } | 375 | } |
| 337 | }; | 376 | }; |
| 338 | |||
| 339 | FLASH.acr().modify(|w| { | 377 | FLASH.acr().modify(|w| { |
| 340 | w.set_latency(wait_states); | 378 | w.set_latency(wait_states); |
| 341 | }); | 379 | }); |
| 342 | 380 | ||
| 381 | // Switch the system clock source | ||
| 343 | RCC.cfgr1().modify(|w| { | 382 | RCC.cfgr1().modify(|w| { |
| 344 | w.set_sw(config.mux.into()); | 383 | w.set_sw(config.mux.into()); |
| 345 | }); | 384 | }); |
| 346 | 385 | ||
| 386 | // RM0456 § 11.4.9 specifies maximum bus frequencies per voltage range, but the maximum bus | ||
| 387 | // frequency for each voltage range exactly matches the maximum permitted PLL output frequency. | ||
| 388 | // Given that: | ||
| 389 | // | ||
| 390 | // 1. Any bus frequency can never exceed the system clock frequency; | ||
| 391 | // 2. We checked the PLL output frequency if we're using it as a system clock; | ||
| 392 | // 3. The maximum HSE frequencies at each voltage range are lower than the bus limits, and | ||
| 393 | // we checked the HSE frequency if configured as a system clock; and | ||
| 394 | // 4. The maximum frequencies from the other clock sources are lower than the lowest bus | ||
| 395 | // frequency limit | ||
| 396 | // | ||
| 397 | // ...then we do not need to perform additional bus-related frequency checks. | ||
| 398 | |||
| 399 | // Configure the bus prescalers | ||
| 347 | RCC.cfgr2().modify(|w| { | 400 | RCC.cfgr2().modify(|w| { |
| 348 | w.set_hpre(config.ahb_pre.into()); | 401 | w.set_hpre(config.ahb_pre); |
| 349 | w.set_ppre1(config.apb1_pre.into()); | 402 | w.set_ppre1(config.apb1_pre); |
| 350 | w.set_ppre2(config.apb2_pre.into()); | 403 | w.set_ppre2(config.apb2_pre); |
| 351 | }); | 404 | }); |
| 352 | |||
| 353 | RCC.cfgr3().modify(|w| { | 405 | RCC.cfgr3().modify(|w| { |
| 354 | w.set_ppre3(config.apb3_pre.into()); | 406 | w.set_ppre3(config.apb3_pre); |
| 355 | }); | 407 | }); |
| 356 | 408 | ||
| 357 | let ahb_freq: u32 = match config.ahb_pre { | 409 | let ahb_freq = sys_clk / config.ahb_pre; |
| 358 | AHBPrescaler::DIV1 => sys_clk, | ||
| 359 | pre => { | ||
| 360 | let pre: u8 = pre.into(); | ||
| 361 | let pre = 1 << (pre as u32 - 7); | ||
| 362 | sys_clk / pre | ||
| 363 | } | ||
| 364 | }; | ||
| 365 | 410 | ||
| 366 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | 411 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { |
| 367 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 412 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 368 | pre => { | 413 | pre => { |
| 369 | let pre: u8 = pre.into(); | 414 | let freq = ahb_freq / pre; |
| 370 | let pre: u8 = 1 << (pre - 3); | 415 | (freq, freq * 2u32) |
| 371 | let freq = ahb_freq / pre as u32; | ||
| 372 | (freq, freq * 2) | ||
| 373 | } | 416 | } |
| 374 | }; | 417 | }; |
| 375 | 418 | ||
| 376 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | 419 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { |
| 377 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 420 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 378 | pre => { | 421 | pre => { |
| 379 | let pre: u8 = pre.into(); | 422 | let freq = ahb_freq / pre; |
| 380 | let pre: u8 = 1 << (pre - 3); | 423 | (freq, freq * 2u32) |
| 381 | let freq = ahb_freq / pre as u32; | ||
| 382 | (freq, freq * 2) | ||
| 383 | } | 424 | } |
| 384 | }; | 425 | }; |
| 385 | 426 | ||
| 386 | let (apb3_freq, _apb3_tim_freq) = match config.apb3_pre { | 427 | let (apb3_freq, _apb3_tim_freq) = match config.apb3_pre { |
| 387 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 428 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 388 | pre => { | 429 | pre => { |
| 389 | let pre: u8 = pre.into(); | 430 | let freq = ahb_freq / pre; |
| 390 | let pre: u8 = 1 << (pre - 3); | 431 | (freq, freq * 2u32) |
| 391 | let freq = ahb_freq / pre as u32; | ||
| 392 | (freq, freq * 2) | ||
| 393 | } | 432 | } |
| 394 | }; | 433 | }; |
| 395 | 434 | ||
| 435 | let rtc = config.ls.init(); | ||
| 436 | |||
| 396 | set_freqs(Clocks { | 437 | set_freqs(Clocks { |
| 397 | sys: Hertz(sys_clk), | 438 | sys: sys_clk, |
| 398 | ahb1: Hertz(ahb_freq), | 439 | hclk1: ahb_freq, |
| 399 | ahb2: Hertz(ahb_freq), | 440 | hclk2: ahb_freq, |
| 400 | ahb3: Hertz(ahb_freq), | 441 | hclk3: ahb_freq, |
| 401 | apb1: Hertz(apb1_freq), | 442 | pclk1: apb1_freq, |
| 402 | apb2: Hertz(apb2_freq), | 443 | pclk2: apb2_freq, |
| 403 | apb3: Hertz(apb3_freq), | 444 | pclk3: apb3_freq, |
| 404 | apb1_tim: Hertz(apb1_tim_freq), | 445 | pclk1_tim: apb1_tim_freq, |
| 405 | apb2_tim: Hertz(apb2_tim_freq), | 446 | pclk2_tim: apb2_tim_freq, |
| 447 | rtc, | ||
| 406 | }); | 448 | }); |
| 407 | } | 449 | } |
| 450 | |||
| 451 | fn msirange_to_hertz(range: Msirange) -> Hertz { | ||
| 452 | match range { | ||
| 453 | Msirange::RANGE_48MHZ => Hertz(48_000_000), | ||
| 454 | Msirange::RANGE_24MHZ => Hertz(24_000_000), | ||
| 455 | Msirange::RANGE_16MHZ => Hertz(16_000_000), | ||
| 456 | Msirange::RANGE_12MHZ => Hertz(12_000_000), | ||
| 457 | Msirange::RANGE_4MHZ => Hertz(4_000_000), | ||
| 458 | Msirange::RANGE_2MHZ => Hertz(2_000_000), | ||
| 459 | Msirange::RANGE_1_33MHZ => Hertz(1_330_000), | ||
| 460 | Msirange::RANGE_1MHZ => Hertz(1_000_000), | ||
| 461 | Msirange::RANGE_3_072MHZ => Hertz(3_072_000), | ||
| 462 | Msirange::RANGE_1_536MHZ => Hertz(1_536_000), | ||
| 463 | Msirange::RANGE_1_024MHZ => Hertz(1_024_000), | ||
| 464 | Msirange::RANGE_768KHZ => Hertz(768_000), | ||
| 465 | Msirange::RANGE_400KHZ => Hertz(400_000), | ||
| 466 | Msirange::RANGE_200KHZ => Hertz(200_000), | ||
| 467 | Msirange::RANGE_133KHZ => Hertz(133_000), | ||
| 468 | Msirange::RANGE_100KHZ => Hertz(100_000), | ||
| 469 | } | ||
| 470 | } | ||
diff --git a/embassy-stm32/src/rcc/wb.rs b/embassy-stm32/src/rcc/wb.rs index ee45a342b..64173fea8 100644 --- a/embassy-stm32/src/rcc/wb.rs +++ b/embassy-stm32/src/rcc/wb.rs | |||
| @@ -1,118 +1,46 @@ | |||
| 1 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | 1 | pub use crate::pac::rcc::vals::{ |
| 2 | use crate::rcc::bd::{BackupDomain, RtcClockSource}; | 2 | Hpre as AHBPrescaler, Hsepre as HsePrescaler, Pllm, Plln, Pllp, Pllq, Pllr, Pllsrc as PllSource, |
| 3 | use crate::rcc::Clocks; | 3 | Ppre as APBPrescaler, Sw as Sysclk, |
| 4 | use crate::time::{khz, mhz, Hertz}; | 4 | }; |
| 5 | 5 | use crate::rcc::{set_freqs, Clocks}; | |
| 6 | /// Most of clock setup is copied from stm32l0xx-hal, and adopted to the generated PAC, | 6 | use crate::time::{mhz, Hertz}; |
| 7 | /// and with the addition of the init function to configure a system clock. | ||
| 8 | |||
| 9 | /// Only the basic setup using the HSE and HSI clocks are supported as of now. | ||
| 10 | 7 | ||
| 11 | /// HSI speed | 8 | /// HSI speed |
| 12 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 9 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 13 | 10 | ||
| 14 | /// LSI speed | ||
| 15 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 16 | |||
| 17 | #[derive(Clone, Copy)] | ||
| 18 | pub enum HsePrescaler { | ||
| 19 | NotDivided, | ||
| 20 | Div2, | ||
| 21 | } | ||
| 22 | |||
| 23 | impl From<HsePrescaler> for bool { | ||
| 24 | fn from(value: HsePrescaler) -> Self { | ||
| 25 | match value { | ||
| 26 | HsePrescaler::NotDivided => false, | ||
| 27 | HsePrescaler::Div2 => true, | ||
| 28 | } | ||
| 29 | } | ||
| 30 | } | ||
| 31 | |||
| 32 | pub struct Hse { | 11 | pub struct Hse { |
| 33 | pub prediv: HsePrescaler, | 12 | pub prediv: HsePrescaler, |
| 34 | 13 | ||
| 35 | pub frequency: Hertz, | 14 | pub frequency: Hertz, |
| 36 | } | 15 | } |
| 37 | 16 | ||
| 38 | /// System clock mux source | ||
| 39 | #[derive(Clone, Copy, PartialEq)] | ||
| 40 | pub enum Sysclk { | ||
| 41 | /// MSI selected as sysclk | ||
| 42 | MSI, | ||
| 43 | /// HSI selected as sysclk | ||
| 44 | HSI, | ||
| 45 | /// HSE selected as sysclk | ||
| 46 | HSE, | ||
| 47 | /// PLL selected as sysclk | ||
| 48 | Pll, | ||
| 49 | } | ||
| 50 | |||
| 51 | impl From<Sysclk> for u8 { | ||
| 52 | fn from(value: Sysclk) -> Self { | ||
| 53 | match value { | ||
| 54 | Sysclk::MSI => 0b00, | ||
| 55 | Sysclk::HSI => 0b01, | ||
| 56 | Sysclk::HSE => 0b10, | ||
| 57 | Sysclk::Pll => 0b11, | ||
| 58 | } | ||
| 59 | } | ||
| 60 | } | ||
| 61 | |||
| 62 | #[derive(Clone, Copy, PartialEq)] | ||
| 63 | pub enum PllSource { | ||
| 64 | Hsi, | ||
| 65 | Msi, | ||
| 66 | Hse, | ||
| 67 | } | ||
| 68 | |||
| 69 | impl From<PllSource> for u8 { | ||
| 70 | fn from(value: PllSource) -> Self { | ||
| 71 | match value { | ||
| 72 | PllSource::Msi => 0b01, | ||
| 73 | PllSource::Hsi => 0b10, | ||
| 74 | PllSource::Hse => 0b11, | ||
| 75 | } | ||
| 76 | } | ||
| 77 | } | ||
| 78 | |||
| 79 | pub enum Pll48Source { | ||
| 80 | PllSai, | ||
| 81 | Pll, | ||
| 82 | Msi, | ||
| 83 | Hsi48, | ||
| 84 | } | ||
| 85 | |||
| 86 | pub struct PllMux { | 17 | pub struct PllMux { |
| 87 | /// Source clock selection. | 18 | /// Source clock selection. |
| 88 | pub source: PllSource, | 19 | pub source: PllSource, |
| 89 | 20 | ||
| 90 | /// PLL pre-divider (DIVM). Must be between 1 and 63. | 21 | /// PLL pre-divider (DIVM). Must be between 1 and 63. |
| 91 | pub prediv: u8, | 22 | pub prediv: Pllm, |
| 92 | } | 23 | } |
| 93 | 24 | ||
| 94 | pub struct Pll { | 25 | pub struct Pll { |
| 95 | /// PLL multiplication factor. Must be between 4 and 512. | 26 | /// PLL multiplication factor. Must be between 4 and 512. |
| 96 | pub mul: u16, | 27 | pub mul: Plln, |
| 97 | 28 | ||
| 98 | /// PLL P division factor. If None, PLL P output is disabled. Must be between 1 and 128. | 29 | /// PLL P division factor. If None, PLL P output is disabled. Must be between 1 and 128. |
| 99 | /// On PLL1, it must be even (in particular, it cannot be 1.) | 30 | /// On PLL1, it must be even (in particular, it cannot be 1.) |
| 100 | pub divp: Option<u16>, | 31 | pub divp: Option<Pllp>, |
| 101 | /// PLL Q division factor. If None, PLL Q output is disabled. Must be between 1 and 128. | 32 | /// PLL Q division factor. If None, PLL Q output is disabled. Must be between 1 and 128. |
| 102 | pub divq: Option<u16>, | 33 | pub divq: Option<Pllq>, |
| 103 | /// PLL R division factor. If None, PLL R output is disabled. Must be between 1 and 128. | 34 | /// PLL R division factor. If None, PLL R output is disabled. Must be between 1 and 128. |
| 104 | pub divr: Option<u16>, | 35 | pub divr: Option<Pllr>, |
| 105 | } | 36 | } |
| 106 | 37 | ||
| 107 | /// Clocks configutation | 38 | /// Clocks configutation |
| 108 | pub struct Config { | 39 | pub struct Config { |
| 109 | pub hse: Option<Hse>, | 40 | pub hse: Option<Hse>, |
| 110 | pub lse: Option<Hertz>, | ||
| 111 | pub lsi: bool, | ||
| 112 | pub sys: Sysclk, | 41 | pub sys: Sysclk, |
| 113 | pub mux: Option<PllMux>, | 42 | pub mux: Option<PllMux>, |
| 114 | pub pll48: Option<Pll48Source>, | 43 | pub hsi48: bool, |
| 115 | pub rtc: Option<RtcClockSource>, | ||
| 116 | 44 | ||
| 117 | pub pll: Option<Pll>, | 45 | pub pll: Option<Pll>, |
| 118 | pub pllsai: Option<Pll>, | 46 | pub pllsai: Option<Pll>, |
| @@ -122,28 +50,29 @@ pub struct Config { | |||
| 122 | pub ahb3_pre: AHBPrescaler, | 50 | pub ahb3_pre: AHBPrescaler, |
| 123 | pub apb1_pre: APBPrescaler, | 51 | pub apb1_pre: APBPrescaler, |
| 124 | pub apb2_pre: APBPrescaler, | 52 | pub apb2_pre: APBPrescaler, |
| 53 | |||
| 54 | pub ls: super::LsConfig, | ||
| 125 | } | 55 | } |
| 126 | 56 | ||
| 127 | pub const WPAN_DEFAULT: Config = Config { | 57 | pub const WPAN_DEFAULT: Config = Config { |
| 128 | hse: Some(Hse { | 58 | hse: Some(Hse { |
| 129 | frequency: mhz(32), | 59 | frequency: mhz(32), |
| 130 | prediv: HsePrescaler::NotDivided, | 60 | prediv: HsePrescaler::DIV1, |
| 131 | }), | 61 | }), |
| 132 | lse: Some(khz(32)), | 62 | sys: Sysclk::PLL, |
| 133 | sys: Sysclk::Pll, | ||
| 134 | mux: Some(PllMux { | 63 | mux: Some(PllMux { |
| 135 | source: PllSource::Hse, | 64 | source: PllSource::HSE, |
| 136 | prediv: 2, | 65 | prediv: Pllm::DIV2, |
| 137 | }), | 66 | }), |
| 138 | pll48: None, | 67 | hsi48: true, |
| 139 | rtc: Some(RtcClockSource::LSE), | 68 | |
| 140 | lsi: false, | 69 | ls: super::LsConfig::default_lse(), |
| 141 | 70 | ||
| 142 | pll: Some(Pll { | 71 | pll: Some(Pll { |
| 143 | mul: 12, | 72 | mul: Plln::MUL12, |
| 144 | divp: Some(3), | 73 | divp: Some(Pllp::DIV3), |
| 145 | divq: Some(4), | 74 | divq: Some(Pllq::DIV4), |
| 146 | divr: Some(3), | 75 | divr: Some(Pllr::DIV3), |
| 147 | }), | 76 | }), |
| 148 | pllsai: None, | 77 | pllsai: None, |
| 149 | 78 | ||
| @@ -159,14 +88,13 @@ impl Default for Config { | |||
| 159 | fn default() -> Config { | 88 | fn default() -> Config { |
| 160 | Config { | 89 | Config { |
| 161 | hse: None, | 90 | hse: None, |
| 162 | lse: None, | 91 | sys: Sysclk::HSI16, |
| 163 | sys: Sysclk::HSI, | ||
| 164 | mux: None, | 92 | mux: None, |
| 165 | pll48: None, | ||
| 166 | pll: None, | 93 | pll: None, |
| 167 | pllsai: None, | 94 | pllsai: None, |
| 168 | rtc: None, | 95 | hsi48: true, |
| 169 | lsi: false, | 96 | |
| 97 | ls: Default::default(), | ||
| 170 | 98 | ||
| 171 | ahb1_pre: AHBPrescaler::DIV1, | 99 | ahb1_pre: AHBPrescaler::DIV1, |
| 172 | ahb2_pre: AHBPrescaler::DIV1, | 100 | ahb2_pre: AHBPrescaler::DIV1, |
| @@ -177,16 +105,15 @@ impl Default for Config { | |||
| 177 | } | 105 | } |
| 178 | } | 106 | } |
| 179 | 107 | ||
| 180 | pub(crate) fn compute_clocks(config: &Config) -> Clocks { | 108 | #[cfg(stm32wb)] |
| 181 | let hse_clk = config.hse.as_ref().map(|hse| match hse.prediv { | 109 | /// RCC initialization function |
| 182 | HsePrescaler::NotDivided => hse.frequency, | 110 | pub(crate) unsafe fn init(config: Config) { |
| 183 | HsePrescaler::Div2 => hse.frequency / 2u32, | 111 | let hse_clk = config.hse.as_ref().map(|hse| hse.frequency / hse.prediv); |
| 184 | }); | ||
| 185 | 112 | ||
| 186 | let mux_clk = config.mux.as_ref().map(|pll_mux| { | 113 | let mux_clk = config.mux.as_ref().map(|pll_mux| { |
| 187 | (match pll_mux.source { | 114 | (match pll_mux.source { |
| 188 | PllSource::Hse => hse_clk.unwrap(), | 115 | PllSource::HSE => hse_clk.unwrap(), |
| 189 | PllSource::Hsi => HSI_FREQ, | 116 | PllSource::HSI16 => HSI_FREQ, |
| 190 | _ => unreachable!(), | 117 | _ => unreachable!(), |
| 191 | } / pll_mux.prediv) | 118 | } / pll_mux.prediv) |
| 192 | }); | 119 | }); |
| @@ -206,44 +133,19 @@ pub(crate) fn compute_clocks(config: &Config) -> Clocks { | |||
| 206 | 133 | ||
| 207 | let sys_clk = match config.sys { | 134 | let sys_clk = match config.sys { |
| 208 | Sysclk::HSE => hse_clk.unwrap(), | 135 | Sysclk::HSE => hse_clk.unwrap(), |
| 209 | Sysclk::HSI => HSI_FREQ, | 136 | Sysclk::HSI16 => HSI_FREQ, |
| 210 | Sysclk::Pll => pll_r.unwrap(), | 137 | Sysclk::PLL => pll_r.unwrap(), |
| 211 | _ => unreachable!(), | 138 | _ => unreachable!(), |
| 212 | }; | 139 | }; |
| 213 | 140 | ||
| 214 | let ahb1_clk = match config.ahb1_pre { | 141 | let ahb1_clk = sys_clk / config.ahb1_pre; |
| 215 | AHBPrescaler::DIV1 => sys_clk, | 142 | let ahb2_clk = sys_clk / config.ahb2_pre; |
| 216 | pre => { | 143 | let ahb3_clk = sys_clk / config.ahb3_pre; |
| 217 | let pre: u8 = pre.into(); | ||
| 218 | let pre = 1u32 << (pre as u32 - 7); | ||
| 219 | sys_clk / pre | ||
| 220 | } | ||
| 221 | }; | ||
| 222 | |||
| 223 | let ahb2_clk = match config.ahb2_pre { | ||
| 224 | AHBPrescaler::DIV1 => sys_clk, | ||
| 225 | pre => { | ||
| 226 | let pre: u8 = pre.into(); | ||
| 227 | let pre = 1u32 << (pre as u32 - 7); | ||
| 228 | sys_clk / pre | ||
| 229 | } | ||
| 230 | }; | ||
| 231 | |||
| 232 | let ahb3_clk = match config.ahb3_pre { | ||
| 233 | AHBPrescaler::DIV1 => sys_clk, | ||
| 234 | pre => { | ||
| 235 | let pre: u8 = pre.into(); | ||
| 236 | let pre = 1u32 << (pre as u32 - 7); | ||
| 237 | sys_clk / pre | ||
| 238 | } | ||
| 239 | }; | ||
| 240 | 144 | ||
| 241 | let (apb1_clk, apb1_tim_clk) = match config.apb1_pre { | 145 | let (apb1_clk, apb1_tim_clk) = match config.apb1_pre { |
| 242 | APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk), | 146 | APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk), |
| 243 | pre => { | 147 | pre => { |
| 244 | let pre: u8 = pre.into(); | 148 | let freq = ahb1_clk / pre; |
| 245 | let pre: u8 = 1 << (pre - 3); | ||
| 246 | let freq = ahb1_clk / pre as u32; | ||
| 247 | (freq, freq * 2u32) | 149 | (freq, freq * 2u32) |
| 248 | } | 150 | } |
| 249 | }; | 151 | }; |
| @@ -251,43 +153,20 @@ pub(crate) fn compute_clocks(config: &Config) -> Clocks { | |||
| 251 | let (apb2_clk, apb2_tim_clk) = match config.apb2_pre { | 153 | let (apb2_clk, apb2_tim_clk) = match config.apb2_pre { |
| 252 | APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk), | 154 | APBPrescaler::DIV1 => (ahb1_clk, ahb1_clk), |
| 253 | pre => { | 155 | pre => { |
| 254 | let pre: u8 = pre.into(); | 156 | let freq = ahb1_clk / pre; |
| 255 | let pre: u8 = 1 << (pre - 3); | ||
| 256 | let freq = ahb1_clk / pre as u32; | ||
| 257 | (freq, freq * 2u32) | 157 | (freq, freq * 2u32) |
| 258 | } | 158 | } |
| 259 | }; | 159 | }; |
| 260 | 160 | ||
| 261 | let rtc_clk = match config.rtc { | ||
| 262 | Some(RtcClockSource::LSI) => Some(LSI_FREQ), | ||
| 263 | Some(RtcClockSource::LSE) => Some(config.lse.unwrap()), | ||
| 264 | _ => None, | ||
| 265 | }; | ||
| 266 | |||
| 267 | Clocks { | ||
| 268 | sys: sys_clk, | ||
| 269 | ahb1: ahb1_clk, | ||
| 270 | ahb2: ahb2_clk, | ||
| 271 | ahb3: ahb3_clk, | ||
| 272 | apb1: apb1_clk, | ||
| 273 | apb2: apb2_clk, | ||
| 274 | apb1_tim: apb1_tim_clk, | ||
| 275 | apb2_tim: apb2_tim_clk, | ||
| 276 | rtc: rtc_clk, | ||
| 277 | rtc_hse: None, | ||
| 278 | } | ||
| 279 | } | ||
| 280 | |||
| 281 | pub(crate) fn configure_clocks(config: &Config) { | ||
| 282 | let rcc = crate::pac::RCC; | 161 | let rcc = crate::pac::RCC; |
| 283 | 162 | ||
| 284 | let needs_hsi = if let Some(pll_mux) = &config.mux { | 163 | let needs_hsi = if let Some(pll_mux) = &config.mux { |
| 285 | pll_mux.source == PllSource::Hsi | 164 | pll_mux.source == PllSource::HSI16 |
| 286 | } else { | 165 | } else { |
| 287 | false | 166 | false |
| 288 | }; | 167 | }; |
| 289 | 168 | ||
| 290 | if needs_hsi || config.sys == Sysclk::HSI { | 169 | if needs_hsi || config.sys == Sysclk::HSI16 { |
| 291 | rcc.cr().modify(|w| { | 170 | rcc.cr().modify(|w| { |
| 292 | w.set_hsion(true); | 171 | w.set_hsion(true); |
| 293 | }); | 172 | }); |
| @@ -297,16 +176,12 @@ pub(crate) fn configure_clocks(config: &Config) { | |||
| 297 | 176 | ||
| 298 | rcc.cfgr().modify(|w| w.set_stopwuck(true)); | 177 | rcc.cfgr().modify(|w| w.set_stopwuck(true)); |
| 299 | 178 | ||
| 300 | BackupDomain::configure_ls( | 179 | let rtc = config.ls.init(); |
| 301 | config.rtc.unwrap_or(RtcClockSource::NOCLOCK), | ||
| 302 | config.lsi, | ||
| 303 | config.lse.map(|_| Default::default()), | ||
| 304 | ); | ||
| 305 | 180 | ||
| 306 | match &config.hse { | 181 | match &config.hse { |
| 307 | Some(hse) => { | 182 | Some(hse) => { |
| 308 | rcc.cr().modify(|w| { | 183 | rcc.cr().modify(|w| { |
| 309 | w.set_hsepre(hse.prediv.into()); | 184 | w.set_hsepre(hse.prediv); |
| 310 | w.set_hseon(true); | 185 | w.set_hseon(true); |
| 311 | }); | 186 | }); |
| 312 | 187 | ||
| @@ -328,18 +203,18 @@ pub(crate) fn configure_clocks(config: &Config) { | |||
| 328 | match &config.pll { | 203 | match &config.pll { |
| 329 | Some(pll) => { | 204 | Some(pll) => { |
| 330 | rcc.pllcfgr().modify(|w| { | 205 | rcc.pllcfgr().modify(|w| { |
| 331 | w.set_plln(pll.mul as u8); | 206 | w.set_plln(pll.mul); |
| 332 | pll.divp.map(|divp| { | 207 | pll.divp.map(|divp| { |
| 333 | w.set_pllpen(true); | 208 | w.set_pllpen(true); |
| 334 | w.set_pllp((divp - 1) as u8) | 209 | w.set_pllp(divp) |
| 335 | }); | 210 | }); |
| 336 | pll.divq.map(|divq| { | 211 | pll.divq.map(|divq| { |
| 337 | w.set_pllqen(true); | 212 | w.set_pllqen(true); |
| 338 | w.set_pllq((divq - 1) as u8) | 213 | w.set_pllq(divq) |
| 339 | }); | 214 | }); |
| 340 | pll.divr.map(|divr| { | 215 | pll.divr.map(|divr| { |
| 341 | // w.set_pllren(true); | 216 | w.set_pllren(true); |
| 342 | w.set_pllr((divr - 1) as u8); | 217 | w.set_pllr(divr); |
| 343 | }); | 218 | }); |
| 344 | }); | 219 | }); |
| 345 | 220 | ||
| @@ -350,15 +225,34 @@ pub(crate) fn configure_clocks(config: &Config) { | |||
| 350 | _ => {} | 225 | _ => {} |
| 351 | } | 226 | } |
| 352 | 227 | ||
| 228 | let _hsi48 = config.hsi48.then(|| { | ||
| 229 | rcc.crrcr().modify(|w| w.set_hsi48on(true)); | ||
| 230 | while !rcc.crrcr().read().hsi48rdy() {} | ||
| 231 | |||
| 232 | Hertz(48_000_000) | ||
| 233 | }); | ||
| 234 | |||
| 353 | rcc.cfgr().modify(|w| { | 235 | rcc.cfgr().modify(|w| { |
| 354 | w.set_sw(config.sys.into()); | 236 | w.set_sw(config.sys.into()); |
| 355 | w.set_hpre(config.ahb1_pre.into()); | 237 | w.set_hpre(config.ahb1_pre); |
| 356 | w.set_ppre1(config.apb1_pre.into()); | 238 | w.set_ppre1(config.apb1_pre); |
| 357 | w.set_ppre2(config.apb2_pre.into()); | 239 | w.set_ppre2(config.apb2_pre); |
| 358 | }); | 240 | }); |
| 359 | 241 | ||
| 360 | rcc.extcfgr().modify(|w| { | 242 | rcc.extcfgr().modify(|w| { |
| 361 | w.set_c2hpre(config.ahb2_pre.into()); | 243 | w.set_c2hpre(config.ahb2_pre); |
| 362 | w.set_shdhpre(config.ahb3_pre.into()); | 244 | w.set_shdhpre(config.ahb3_pre); |
| 363 | }); | 245 | }); |
| 246 | |||
| 247 | set_freqs(Clocks { | ||
| 248 | sys: sys_clk, | ||
| 249 | hclk1: ahb1_clk, | ||
| 250 | hclk2: ahb2_clk, | ||
| 251 | hclk3: ahb3_clk, | ||
| 252 | pclk1: apb1_clk, | ||
| 253 | pclk2: apb2_clk, | ||
| 254 | pclk1_tim: apb1_tim_clk, | ||
| 255 | pclk2_tim: apb2_tim_clk, | ||
| 256 | rtc, | ||
| 257 | }) | ||
| 364 | } | 258 | } |
diff --git a/embassy-stm32/src/rcc/wba.rs b/embassy-stm32/src/rcc/wba.rs index c5d7ab62f..72f653617 100644 --- a/embassy-stm32/src/rcc/wba.rs +++ b/embassy-stm32/src/rcc/wba.rs | |||
| @@ -7,9 +7,6 @@ use crate::time::Hertz; | |||
| 7 | /// HSI speed | 7 | /// HSI speed |
| 8 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 8 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 9 | 9 | ||
| 10 | /// LSI speed | ||
| 11 | pub const LSI_FREQ: Hertz = Hertz(32_000); | ||
| 12 | |||
| 13 | pub use crate::pac::pwr::vals::Vos as VoltageScale; | 10 | pub use crate::pac::pwr::vals::Vos as VoltageScale; |
| 14 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Ppre as APBPrescaler}; | 11 | pub use crate::pac::rcc::vals::{Hpre as AHBPrescaler, Ppre as APBPrescaler}; |
| 15 | 12 | ||
| @@ -28,7 +25,7 @@ pub enum PllSrc { | |||
| 28 | impl Into<Pllsrc> for PllSrc { | 25 | impl Into<Pllsrc> for PllSrc { |
| 29 | fn into(self) -> Pllsrc { | 26 | fn into(self) -> Pllsrc { |
| 30 | match self { | 27 | match self { |
| 31 | PllSrc::HSE(..) => Pllsrc::HSE32, | 28 | PllSrc::HSE(..) => Pllsrc::HSE, |
| 32 | PllSrc::HSI16 => Pllsrc::HSI16, | 29 | PllSrc::HSI16 => Pllsrc::HSI16, |
| 33 | } | 30 | } |
| 34 | } | 31 | } |
| @@ -37,19 +34,19 @@ impl Into<Pllsrc> for PllSrc { | |||
| 37 | impl Into<Sw> for ClockSrc { | 34 | impl Into<Sw> for ClockSrc { |
| 38 | fn into(self) -> Sw { | 35 | fn into(self) -> Sw { |
| 39 | match self { | 36 | match self { |
| 40 | ClockSrc::HSE(..) => Sw::HSE32, | 37 | ClockSrc::HSE(..) => Sw::HSE, |
| 41 | ClockSrc::HSI16 => Sw::HSI16, | 38 | ClockSrc::HSI16 => Sw::HSI16, |
| 42 | } | 39 | } |
| 43 | } | 40 | } |
| 44 | } | 41 | } |
| 45 | 42 | ||
| 46 | #[derive(Copy, Clone)] | ||
| 47 | pub struct Config { | 43 | pub struct Config { |
| 48 | pub mux: ClockSrc, | 44 | pub mux: ClockSrc, |
| 49 | pub ahb_pre: AHBPrescaler, | 45 | pub ahb_pre: AHBPrescaler, |
| 50 | pub apb1_pre: APBPrescaler, | 46 | pub apb1_pre: APBPrescaler, |
| 51 | pub apb2_pre: APBPrescaler, | 47 | pub apb2_pre: APBPrescaler, |
| 52 | pub apb7_pre: APBPrescaler, | 48 | pub apb7_pre: APBPrescaler, |
| 49 | pub ls: super::LsConfig, | ||
| 53 | } | 50 | } |
| 54 | 51 | ||
| 55 | impl Default for Config { | 52 | impl Default for Config { |
| @@ -60,6 +57,7 @@ impl Default for Config { | |||
| 60 | apb1_pre: APBPrescaler::DIV1, | 57 | apb1_pre: APBPrescaler::DIV1, |
| 61 | apb2_pre: APBPrescaler::DIV1, | 58 | apb2_pre: APBPrescaler::DIV1, |
| 62 | apb7_pre: APBPrescaler::DIV1, | 59 | apb7_pre: APBPrescaler::DIV1, |
| 60 | ls: Default::default(), | ||
| 63 | } | 61 | } |
| 64 | } | 62 | } |
| 65 | } | 63 | } |
| @@ -108,13 +106,13 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 108 | }); | 106 | }); |
| 109 | 107 | ||
| 110 | RCC.cfgr2().modify(|w| { | 108 | RCC.cfgr2().modify(|w| { |
| 111 | w.set_hpre(config.ahb_pre.into()); | 109 | w.set_hpre(config.ahb_pre); |
| 112 | w.set_ppre1(config.apb1_pre.into()); | 110 | w.set_ppre1(config.apb1_pre); |
| 113 | w.set_ppre2(config.apb2_pre.into()); | 111 | w.set_ppre2(config.apb2_pre); |
| 114 | }); | 112 | }); |
| 115 | 113 | ||
| 116 | RCC.cfgr3().modify(|w| { | 114 | RCC.cfgr3().modify(|w| { |
| 117 | w.set_ppre7(config.apb7_pre.into()); | 115 | w.set_ppre7(config.apb7_pre); |
| 118 | }); | 116 | }); |
| 119 | 117 | ||
| 120 | let ahb_freq = sys_clk / config.ahb_pre; | 118 | let ahb_freq = sys_clk / config.ahb_pre; |
| @@ -140,15 +138,18 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 140 | } | 138 | } |
| 141 | }; | 139 | }; |
| 142 | 140 | ||
| 141 | let rtc = config.ls.init(); | ||
| 142 | |||
| 143 | set_freqs(Clocks { | 143 | set_freqs(Clocks { |
| 144 | sys: sys_clk, | 144 | sys: sys_clk, |
| 145 | ahb1: ahb_freq, | 145 | hclk1: ahb_freq, |
| 146 | ahb2: ahb_freq, | 146 | hclk2: ahb_freq, |
| 147 | ahb4: ahb_freq, | 147 | hclk4: ahb_freq, |
| 148 | apb1: apb1_freq, | 148 | pclk1: apb1_freq, |
| 149 | apb2: apb2_freq, | 149 | pclk2: apb2_freq, |
| 150 | apb7: apb7_freq, | 150 | pclk7: apb7_freq, |
| 151 | apb1_tim: apb1_tim_freq, | 151 | pclk1_tim: apb1_tim_freq, |
| 152 | apb2_tim: apb2_tim_freq, | 152 | pclk2_tim: apb2_tim_freq, |
| 153 | rtc, | ||
| 153 | }); | 154 | }); |
| 154 | } | 155 | } |
diff --git a/embassy-stm32/src/rcc/wl.rs b/embassy-stm32/src/rcc/wl.rs index 6643d278a..c1f6a6b1e 100644 --- a/embassy-stm32/src/rcc/wl.rs +++ b/embassy-stm32/src/rcc/wl.rs | |||
| @@ -1,136 +1,27 @@ | |||
| 1 | pub use super::bus::{AHBPrescaler, APBPrescaler}; | ||
| 2 | pub use crate::pac::pwr::vals::Vos as VoltageScale; | 1 | pub use crate::pac::pwr::vals::Vos as VoltageScale; |
| 3 | use crate::pac::rcc::vals::Adcsel; | 2 | use crate::pac::rcc::vals::Sw; |
| 3 | pub use crate::pac::rcc::vals::{ | ||
| 4 | Adcsel as AdcClockSource, Hpre as AHBPrescaler, Msirange as MSIRange, Pllm, Plln, Pllp, Pllq, Pllr, | ||
| 5 | Pllsrc as PllSource, Ppre as APBPrescaler, | ||
| 6 | }; | ||
| 4 | use crate::pac::{FLASH, RCC}; | 7 | use crate::pac::{FLASH, RCC}; |
| 5 | use crate::rcc::bd::{BackupDomain, RtcClockSource}; | ||
| 6 | use crate::rcc::{set_freqs, Clocks}; | 8 | use crate::rcc::{set_freqs, Clocks}; |
| 7 | use crate::time::Hertz; | 9 | use crate::time::Hertz; |
| 8 | 10 | ||
| 9 | /// Most of clock setup is copied from stm32l0xx-hal, and adopted to the generated PAC, | ||
| 10 | /// and with the addition of the init function to configure a system clock. | ||
| 11 | |||
| 12 | /// Only the basic setup using the HSE and HSI clocks are supported as of now. | ||
| 13 | |||
| 14 | /// HSI speed | 11 | /// HSI speed |
| 15 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); | 12 | pub const HSI_FREQ: Hertz = Hertz(16_000_000); |
| 16 | 13 | ||
| 17 | /// LSI speed | 14 | /// HSE speed |
| 18 | pub const LSI_FREQ: Hertz = Hertz(32_000); | 15 | pub const HSE_FREQ: Hertz = Hertz(32_000_000); |
| 19 | |||
| 20 | /// HSE32 speed | ||
| 21 | pub const HSE32_FREQ: Hertz = Hertz(32_000_000); | ||
| 22 | 16 | ||
| 23 | /// System clock mux source | 17 | /// System clock mux source |
| 24 | #[derive(Clone, Copy)] | 18 | #[derive(Clone, Copy)] |
| 25 | pub enum ClockSrc { | 19 | pub enum ClockSrc { |
| 26 | MSI(MSIRange), | 20 | MSI(MSIRange), |
| 27 | HSE32, | 21 | HSE, |
| 28 | HSI16, | 22 | HSI16, |
| 29 | } | 23 | } |
| 30 | 24 | ||
| 31 | #[derive(Clone, Copy, PartialOrd, PartialEq)] | ||
| 32 | pub enum MSIRange { | ||
| 33 | /// Around 100 kHz | ||
| 34 | Range0, | ||
| 35 | /// Around 200 kHz | ||
| 36 | Range1, | ||
| 37 | /// Around 400 kHz | ||
| 38 | Range2, | ||
| 39 | /// Around 800 kHz | ||
| 40 | Range3, | ||
| 41 | /// Around 1 MHz | ||
| 42 | Range4, | ||
| 43 | /// Around 2 MHz | ||
| 44 | Range5, | ||
| 45 | /// Around 4 MHz (reset value) | ||
| 46 | Range6, | ||
| 47 | /// Around 8 MHz | ||
| 48 | Range7, | ||
| 49 | /// Around 16 MHz | ||
| 50 | Range8, | ||
| 51 | /// Around 24 MHz | ||
| 52 | Range9, | ||
| 53 | /// Around 32 MHz | ||
| 54 | Range10, | ||
| 55 | /// Around 48 MHz | ||
| 56 | Range11, | ||
| 57 | } | ||
| 58 | |||
| 59 | impl MSIRange { | ||
| 60 | fn freq(&self) -> u32 { | ||
| 61 | match self { | ||
| 62 | MSIRange::Range0 => 100_000, | ||
| 63 | MSIRange::Range1 => 200_000, | ||
| 64 | MSIRange::Range2 => 400_000, | ||
| 65 | MSIRange::Range3 => 800_000, | ||
| 66 | MSIRange::Range4 => 1_000_000, | ||
| 67 | MSIRange::Range5 => 2_000_000, | ||
| 68 | MSIRange::Range6 => 4_000_000, | ||
| 69 | MSIRange::Range7 => 8_000_000, | ||
| 70 | MSIRange::Range8 => 16_000_000, | ||
| 71 | MSIRange::Range9 => 24_000_000, | ||
| 72 | MSIRange::Range10 => 32_000_000, | ||
| 73 | MSIRange::Range11 => 48_000_000, | ||
| 74 | } | ||
| 75 | } | ||
| 76 | |||
| 77 | fn vos(&self) -> VoltageScale { | ||
| 78 | if self > &MSIRange::Range8 { | ||
| 79 | VoltageScale::RANGE1 | ||
| 80 | } else { | ||
| 81 | VoltageScale::RANGE2 | ||
| 82 | } | ||
| 83 | } | ||
| 84 | } | ||
| 85 | |||
| 86 | impl Default for MSIRange { | ||
| 87 | fn default() -> MSIRange { | ||
| 88 | MSIRange::Range6 | ||
| 89 | } | ||
| 90 | } | ||
| 91 | |||
| 92 | impl Into<u8> for MSIRange { | ||
| 93 | fn into(self) -> u8 { | ||
| 94 | match self { | ||
| 95 | MSIRange::Range0 => 0b0000, | ||
| 96 | MSIRange::Range1 => 0b0001, | ||
| 97 | MSIRange::Range2 => 0b0010, | ||
| 98 | MSIRange::Range3 => 0b0011, | ||
| 99 | MSIRange::Range4 => 0b0100, | ||
| 100 | MSIRange::Range5 => 0b0101, | ||
| 101 | MSIRange::Range6 => 0b0110, | ||
| 102 | MSIRange::Range7 => 0b0111, | ||
| 103 | MSIRange::Range8 => 0b1000, | ||
| 104 | MSIRange::Range9 => 0b1001, | ||
| 105 | MSIRange::Range10 => 0b1010, | ||
| 106 | MSIRange::Range11 => 0b1011, | ||
| 107 | } | ||
| 108 | } | ||
| 109 | } | ||
| 110 | |||
| 111 | #[derive(Clone, Copy)] | ||
| 112 | pub enum AdcClockSource { | ||
| 113 | HSI16, | ||
| 114 | PLLPCLK, | ||
| 115 | SYSCLK, | ||
| 116 | } | ||
| 117 | |||
| 118 | impl AdcClockSource { | ||
| 119 | pub fn adcsel(&self) -> Adcsel { | ||
| 120 | match self { | ||
| 121 | AdcClockSource::HSI16 => Adcsel::HSI16, | ||
| 122 | AdcClockSource::PLLPCLK => Adcsel::PLLPCLK, | ||
| 123 | AdcClockSource::SYSCLK => Adcsel::SYSCLK, | ||
| 124 | } | ||
| 125 | } | ||
| 126 | } | ||
| 127 | |||
| 128 | impl Default for AdcClockSource { | ||
| 129 | fn default() -> Self { | ||
| 130 | Self::HSI16 | ||
| 131 | } | ||
| 132 | } | ||
| 133 | |||
| 134 | /// Clocks configutation | 25 | /// Clocks configutation |
| 135 | pub struct Config { | 26 | pub struct Config { |
| 136 | pub mux: ClockSrc, | 27 | pub mux: ClockSrc, |
| @@ -138,91 +29,60 @@ pub struct Config { | |||
| 138 | pub shd_ahb_pre: AHBPrescaler, | 29 | pub shd_ahb_pre: AHBPrescaler, |
| 139 | pub apb1_pre: APBPrescaler, | 30 | pub apb1_pre: APBPrescaler, |
| 140 | pub apb2_pre: APBPrescaler, | 31 | pub apb2_pre: APBPrescaler, |
| 141 | pub rtc_mux: RtcClockSource, | ||
| 142 | pub lse: Option<Hertz>, | ||
| 143 | pub lsi: bool, | ||
| 144 | pub adc_clock_source: AdcClockSource, | 32 | pub adc_clock_source: AdcClockSource, |
| 33 | pub ls: super::LsConfig, | ||
| 145 | } | 34 | } |
| 146 | 35 | ||
| 147 | impl Default for Config { | 36 | impl Default for Config { |
| 148 | #[inline] | 37 | #[inline] |
| 149 | fn default() -> Config { | 38 | fn default() -> Config { |
| 150 | Config { | 39 | Config { |
| 151 | mux: ClockSrc::MSI(MSIRange::default()), | 40 | mux: ClockSrc::MSI(MSIRange::RANGE4M), |
| 152 | ahb_pre: AHBPrescaler::DIV1, | 41 | ahb_pre: AHBPrescaler::DIV1, |
| 153 | shd_ahb_pre: AHBPrescaler::DIV1, | 42 | shd_ahb_pre: AHBPrescaler::DIV1, |
| 154 | apb1_pre: APBPrescaler::DIV1, | 43 | apb1_pre: APBPrescaler::DIV1, |
| 155 | apb2_pre: APBPrescaler::DIV1, | 44 | apb2_pre: APBPrescaler::DIV1, |
| 156 | rtc_mux: RtcClockSource::LSI, | 45 | adc_clock_source: AdcClockSource::HSI16, |
| 157 | lsi: true, | 46 | ls: Default::default(), |
| 158 | lse: None, | ||
| 159 | adc_clock_source: AdcClockSource::default(), | ||
| 160 | } | 47 | } |
| 161 | } | 48 | } |
| 162 | } | 49 | } |
| 163 | 50 | ||
| 164 | #[repr(u8)] | ||
| 165 | pub enum Lsedrv { | ||
| 166 | Low = 0, | ||
| 167 | MediumLow = 1, | ||
| 168 | MediumHigh = 2, | ||
| 169 | High = 3, | ||
| 170 | } | ||
| 171 | |||
| 172 | pub(crate) unsafe fn init(config: Config) { | 51 | pub(crate) unsafe fn init(config: Config) { |
| 173 | let (sys_clk, sw, vos) = match config.mux { | 52 | let (sys_clk, sw, vos) = match config.mux { |
| 174 | ClockSrc::HSI16 => (HSI_FREQ.0, 0x01, VoltageScale::RANGE2), | 53 | ClockSrc::HSI16 => (HSI_FREQ, Sw::HSI16, VoltageScale::RANGE2), |
| 175 | ClockSrc::HSE32 => (HSE32_FREQ.0, 0x02, VoltageScale::RANGE1), | 54 | ClockSrc::HSE => (HSE_FREQ, Sw::HSE, VoltageScale::RANGE1), |
| 176 | ClockSrc::MSI(range) => (range.freq(), 0x00, range.vos()), | 55 | ClockSrc::MSI(range) => (msirange_to_hertz(range), Sw::MSI, msirange_to_vos(range)), |
| 177 | }; | ||
| 178 | |||
| 179 | let ahb_freq: u32 = match config.ahb_pre { | ||
| 180 | AHBPrescaler::DIV1 => sys_clk, | ||
| 181 | pre => { | ||
| 182 | let pre: u8 = pre.into(); | ||
| 183 | let pre = 1 << (pre as u32 - 7); | ||
| 184 | sys_clk / pre | ||
| 185 | } | ||
| 186 | }; | 56 | }; |
| 187 | 57 | ||
| 188 | let shd_ahb_freq: u32 = match config.shd_ahb_pre { | 58 | let ahb_freq = sys_clk / config.ahb_pre; |
| 189 | AHBPrescaler::DIV1 => sys_clk, | 59 | let shd_ahb_freq = sys_clk / config.shd_ahb_pre; |
| 190 | pre => { | ||
| 191 | let pre: u8 = pre.into(); | ||
| 192 | let pre = 1 << (pre as u32 - 7); | ||
| 193 | sys_clk / pre | ||
| 194 | } | ||
| 195 | }; | ||
| 196 | 60 | ||
| 197 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { | 61 | let (apb1_freq, apb1_tim_freq) = match config.apb1_pre { |
| 198 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 62 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 199 | pre => { | 63 | pre => { |
| 200 | let pre: u8 = pre.into(); | 64 | let freq = ahb_freq / pre; |
| 201 | let pre: u8 = 1 << (pre - 3); | 65 | (freq, freq * 2u32) |
| 202 | let freq = ahb_freq / pre as u32; | ||
| 203 | (freq, freq * 2) | ||
| 204 | } | 66 | } |
| 205 | }; | 67 | }; |
| 206 | 68 | ||
| 207 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { | 69 | let (apb2_freq, apb2_tim_freq) = match config.apb2_pre { |
| 208 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), | 70 | APBPrescaler::DIV1 => (ahb_freq, ahb_freq), |
| 209 | pre => { | 71 | pre => { |
| 210 | let pre: u8 = pre.into(); | 72 | let freq = ahb_freq / pre; |
| 211 | let pre: u8 = 1 << (pre - 3); | 73 | (freq, freq * 2u32) |
| 212 | let freq = ahb_freq / pre as u32; | ||
| 213 | (freq, freq * 2) | ||
| 214 | } | 74 | } |
| 215 | }; | 75 | }; |
| 216 | 76 | ||
| 217 | // Adjust flash latency | 77 | // Adjust flash latency |
| 218 | let flash_clk_src_freq: u32 = shd_ahb_freq; | 78 | let flash_clk_src_freq = shd_ahb_freq; |
| 219 | let ws = match vos { | 79 | let ws = match vos { |
| 220 | VoltageScale::RANGE1 => match flash_clk_src_freq { | 80 | VoltageScale::RANGE1 => match flash_clk_src_freq.0 { |
| 221 | 0..=18_000_000 => 0b000, | 81 | 0..=18_000_000 => 0b000, |
| 222 | 18_000_001..=36_000_000 => 0b001, | 82 | 18_000_001..=36_000_000 => 0b001, |
| 223 | _ => 0b010, | 83 | _ => 0b010, |
| 224 | }, | 84 | }, |
| 225 | VoltageScale::RANGE2 => match flash_clk_src_freq { | 85 | VoltageScale::RANGE2 => match flash_clk_src_freq.0 { |
| 226 | 0..=6_000_000 => 0b000, | 86 | 0..=6_000_000 => 0b000, |
| 227 | 6_000_001..=12_000_000 => 0b001, | 87 | 6_000_001..=12_000_000 => 0b001, |
| 228 | _ => 0b010, | 88 | _ => 0b010, |
| @@ -236,17 +96,14 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 236 | 96 | ||
| 237 | while FLASH.acr().read().latency() != ws {} | 97 | while FLASH.acr().read().latency() != ws {} |
| 238 | 98 | ||
| 239 | // Enables the LSI if configured | ||
| 240 | BackupDomain::configure_ls(config.rtc_mux, config.lsi, config.lse.map(|_| Default::default())); | ||
| 241 | |||
| 242 | match config.mux { | 99 | match config.mux { |
| 243 | ClockSrc::HSI16 => { | 100 | ClockSrc::HSI16 => { |
| 244 | // Enable HSI16 | 101 | // Enable HSI16 |
| 245 | RCC.cr().write(|w| w.set_hsion(true)); | 102 | RCC.cr().write(|w| w.set_hsion(true)); |
| 246 | while !RCC.cr().read().hsirdy() {} | 103 | while !RCC.cr().read().hsirdy() {} |
| 247 | } | 104 | } |
| 248 | ClockSrc::HSE32 => { | 105 | ClockSrc::HSE => { |
| 249 | // Enable HSE32 | 106 | // Enable HSE |
| 250 | RCC.cr().write(|w| { | 107 | RCC.cr().write(|w| { |
| 251 | w.set_hsebyppwr(true); | 108 | w.set_hsebyppwr(true); |
| 252 | w.set_hseon(true); | 109 | w.set_hseon(true); |
| @@ -258,49 +115,70 @@ pub(crate) unsafe fn init(config: Config) { | |||
| 258 | assert!(!cr.msion() || cr.msirdy()); | 115 | assert!(!cr.msion() || cr.msirdy()); |
| 259 | RCC.cr().write(|w| { | 116 | RCC.cr().write(|w| { |
| 260 | w.set_msirgsel(true); | 117 | w.set_msirgsel(true); |
| 261 | w.set_msirange(range.into()); | 118 | w.set_msirange(range); |
| 262 | w.set_msion(true); | 119 | w.set_msion(true); |
| 263 | 120 | ||
| 264 | if let RtcClockSource::LSE = config.rtc_mux { | 121 | // If LSE is enabled, enable calibration of MSI |
| 265 | // If LSE is enabled, enable calibration of MSI | 122 | w.set_msipllen(config.ls.lse.is_some()); |
| 266 | w.set_msipllen(true); | ||
| 267 | } else { | ||
| 268 | w.set_msipllen(false); | ||
| 269 | } | ||
| 270 | }); | 123 | }); |
| 271 | while !RCC.cr().read().msirdy() {} | 124 | while !RCC.cr().read().msirdy() {} |
| 272 | } | 125 | } |
| 273 | } | 126 | } |
| 274 | 127 | ||
| 275 | RCC.extcfgr().modify(|w| { | 128 | RCC.extcfgr().modify(|w| { |
| 276 | if config.shd_ahb_pre == AHBPrescaler::DIV1 { | 129 | w.set_shdhpre(config.shd_ahb_pre); |
| 277 | w.set_shdhpre(0); | ||
| 278 | } else { | ||
| 279 | w.set_shdhpre(config.shd_ahb_pre.into()); | ||
| 280 | } | ||
| 281 | }); | 130 | }); |
| 282 | 131 | ||
| 283 | RCC.cfgr().modify(|w| { | 132 | RCC.cfgr().modify(|w| { |
| 284 | w.set_sw(sw.into()); | 133 | w.set_sw(sw.into()); |
| 285 | w.set_hpre(config.ahb_pre); | 134 | w.set_hpre(config.ahb_pre); |
| 286 | w.set_ppre1(config.apb1_pre.into()); | 135 | w.set_ppre1(config.apb1_pre); |
| 287 | w.set_ppre2(config.apb2_pre.into()); | 136 | w.set_ppre2(config.apb2_pre); |
| 288 | }); | 137 | }); |
| 289 | 138 | ||
| 290 | // ADC clock MUX | 139 | // ADC clock MUX |
| 291 | RCC.ccipr().modify(|w| w.set_adcsel(config.adc_clock_source.adcsel())); | 140 | RCC.ccipr().modify(|w| w.set_adcsel(config.adc_clock_source)); |
| 292 | 141 | ||
| 293 | // TODO: switch voltage range | 142 | // TODO: switch voltage range |
| 294 | 143 | ||
| 144 | let rtc = config.ls.init(); | ||
| 145 | |||
| 295 | set_freqs(Clocks { | 146 | set_freqs(Clocks { |
| 296 | sys: Hertz(sys_clk), | 147 | sys: sys_clk, |
| 297 | ahb1: Hertz(ahb_freq), | 148 | hclk1: ahb_freq, |
| 298 | ahb2: Hertz(ahb_freq), | 149 | hclk2: ahb_freq, |
| 299 | ahb3: Hertz(shd_ahb_freq), | 150 | hclk3: shd_ahb_freq, |
| 300 | apb1: Hertz(apb1_freq), | 151 | pclk1: apb1_freq, |
| 301 | apb2: Hertz(apb2_freq), | 152 | pclk2: apb2_freq, |
| 302 | apb3: Hertz(shd_ahb_freq), | 153 | pclk3: shd_ahb_freq, |
| 303 | apb1_tim: Hertz(apb1_tim_freq), | 154 | pclk1_tim: apb1_tim_freq, |
| 304 | apb2_tim: Hertz(apb2_tim_freq), | 155 | pclk2_tim: apb2_tim_freq, |
| 156 | rtc, | ||
| 305 | }); | 157 | }); |
| 306 | } | 158 | } |
| 159 | |||
| 160 | fn msirange_to_hertz(range: MSIRange) -> Hertz { | ||
| 161 | match range { | ||
| 162 | MSIRange::RANGE100K => Hertz(100_000), | ||
| 163 | MSIRange::RANGE200K => Hertz(200_000), | ||
| 164 | MSIRange::RANGE400K => Hertz(400_000), | ||
| 165 | MSIRange::RANGE800K => Hertz(800_000), | ||
| 166 | MSIRange::RANGE1M => Hertz(1_000_000), | ||
| 167 | MSIRange::RANGE2M => Hertz(2_000_000), | ||
| 168 | MSIRange::RANGE4M => Hertz(4_000_000), | ||
| 169 | MSIRange::RANGE8M => Hertz(8_000_000), | ||
| 170 | MSIRange::RANGE16M => Hertz(16_000_000), | ||
| 171 | MSIRange::RANGE24M => Hertz(24_000_000), | ||
| 172 | MSIRange::RANGE32M => Hertz(32_000_000), | ||
| 173 | MSIRange::RANGE48M => Hertz(48_000_000), | ||
| 174 | _ => unreachable!(), | ||
| 175 | } | ||
| 176 | } | ||
| 177 | |||
| 178 | fn msirange_to_vos(range: MSIRange) -> VoltageScale { | ||
| 179 | if range.to_bits() > MSIRange::RANGE16M.to_bits() { | ||
| 180 | VoltageScale::RANGE1 | ||
| 181 | } else { | ||
| 182 | VoltageScale::RANGE2 | ||
| 183 | } | ||
| 184 | } | ||
diff --git a/embassy-stm32/src/rng.rs b/embassy-stm32/src/rng.rs index 0979dce8c..5e6922e9b 100644 --- a/embassy-stm32/src/rng.rs +++ b/embassy-stm32/src/rng.rs | |||
| @@ -13,6 +13,7 @@ use crate::{interrupt, pac, peripherals, Peripheral}; | |||
| 13 | 13 | ||
| 14 | static RNG_WAKER: AtomicWaker = AtomicWaker::new(); | 14 | static RNG_WAKER: AtomicWaker = AtomicWaker::new(); |
| 15 | 15 | ||
| 16 | #[derive(Debug, PartialEq, Eq)] | ||
| 16 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 17 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 17 | pub enum Error { | 18 | pub enum Error { |
| 18 | SeedError, | 19 | SeedError, |
| @@ -42,8 +43,7 @@ impl<'d, T: Instance> Rng<'d, T> { | |||
| 42 | inner: impl Peripheral<P = T> + 'd, | 43 | inner: impl Peripheral<P = T> + 'd, |
| 43 | _irq: impl interrupt::typelevel::Binding<T::Interrupt, InterruptHandler<T>> + 'd, | 44 | _irq: impl interrupt::typelevel::Binding<T::Interrupt, InterruptHandler<T>> + 'd, |
| 44 | ) -> Self { | 45 | ) -> Self { |
| 45 | T::enable(); | 46 | T::enable_and_reset(); |
| 46 | T::reset(); | ||
| 47 | into_ref!(inner); | 47 | into_ref!(inner); |
| 48 | let mut random = Self { _inner: inner }; | 48 | let mut random = Self { _inner: inner }; |
| 49 | random.reset(); | 49 | random.reset(); |
| @@ -85,7 +85,7 @@ impl<'d, T: Instance> Rng<'d, T> { | |||
| 85 | reg.set_ie(false); | 85 | reg.set_ie(false); |
| 86 | reg.set_rngen(true); | 86 | reg.set_rngen(true); |
| 87 | }); | 87 | }); |
| 88 | T::regs().cr().write(|reg| { | 88 | T::regs().cr().modify(|reg| { |
| 89 | reg.set_ced(false); | 89 | reg.set_ced(false); |
| 90 | }); | 90 | }); |
| 91 | // wait for CONDRST to be set | 91 | // wait for CONDRST to be set |
| @@ -164,7 +164,7 @@ impl<'d, T: Instance> Rng<'d, T> { | |||
| 164 | return Err(Error::SeedError); | 164 | return Err(Error::SeedError); |
| 165 | } | 165 | } |
| 166 | // write bytes to chunk | 166 | // write bytes to chunk |
| 167 | for (dest, src) in chunk.iter_mut().zip(random_word.to_be_bytes().iter()) { | 167 | for (dest, src) in chunk.iter_mut().zip(random_word.to_ne_bytes().iter()) { |
| 168 | *dest = *src | 168 | *dest = *src |
| 169 | } | 169 | } |
| 170 | } | 170 | } |
| @@ -195,7 +195,7 @@ impl<'d, T: Instance> RngCore for Rng<'d, T> { | |||
| 195 | fn fill_bytes(&mut self, dest: &mut [u8]) { | 195 | fn fill_bytes(&mut self, dest: &mut [u8]) { |
| 196 | for chunk in dest.chunks_mut(4) { | 196 | for chunk in dest.chunks_mut(4) { |
| 197 | let rand = self.next_u32(); | 197 | let rand = self.next_u32(); |
| 198 | for (slot, num) in chunk.iter_mut().zip(rand.to_be_bytes().iter()) { | 198 | for (slot, num) in chunk.iter_mut().zip(rand.to_ne_bytes().iter()) { |
| 199 | *slot = *num | 199 | *slot = *num |
| 200 | } | 200 | } |
| 201 | } | 201 | } |
diff --git a/embassy-stm32/src/rtc/mod.rs b/embassy-stm32/src/rtc/mod.rs index 73b78f253..552dcc76f 100644 --- a/embassy-stm32/src/rtc/mod.rs +++ b/embassy-stm32/src/rtc/mod.rs | |||
| @@ -10,7 +10,6 @@ use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | |||
| 10 | use embassy_sync::blocking_mutex::Mutex; | 10 | use embassy_sync::blocking_mutex::Mutex; |
| 11 | 11 | ||
| 12 | pub use self::datetime::{DateTime, DayOfWeek, Error as DateTimeError}; | 12 | pub use self::datetime::{DateTime, DayOfWeek, Error as DateTimeError}; |
| 13 | pub use crate::rcc::RtcClockSource; | ||
| 14 | use crate::time::Hertz; | 13 | use crate::time::Hertz; |
| 15 | 14 | ||
| 16 | /// refer to AN4759 to compare features of RTC2 and RTC3 | 15 | /// refer to AN4759 to compare features of RTC2 and RTC3 |
| @@ -93,21 +92,50 @@ impl RtcTimeProvider { | |||
| 93 | /// | 92 | /// |
| 94 | /// Will return an `RtcError::InvalidDateTime` if the stored value in the system is not a valid [`DayOfWeek`]. | 93 | /// Will return an `RtcError::InvalidDateTime` if the stored value in the system is not a valid [`DayOfWeek`]. |
| 95 | pub fn now(&self) -> Result<DateTime, RtcError> { | 94 | pub fn now(&self) -> Result<DateTime, RtcError> { |
| 96 | let r = RTC::regs(); | 95 | // For RM0433 we use BYPSHAD=1 to work around errata ES0392 2.19.1 |
| 97 | let tr = r.tr().read(); | 96 | #[cfg(rcc_h7rm0433)] |
| 98 | let second = bcd2_to_byte((tr.st(), tr.su())); | 97 | loop { |
| 99 | let minute = bcd2_to_byte((tr.mnt(), tr.mnu())); | 98 | let r = RTC::regs(); |
| 100 | let hour = bcd2_to_byte((tr.ht(), tr.hu())); | 99 | let ss = r.ssr().read().ss(); |
| 101 | // Reading either RTC_SSR or RTC_TR locks the values in the higher-order | 100 | let dr = r.dr().read(); |
| 102 | // calendar shadow registers until RTC_DR is read. | 101 | let tr = r.tr().read(); |
| 103 | let dr = r.dr().read(); | 102 | |
| 104 | 103 | // If an RTCCLK edge occurs during read we may see inconsistent values | |
| 105 | let weekday = dr.wdu(); | 104 | // so read ssr again and see if it has changed. (see RM0433 Rev 7 46.3.9) |
| 106 | let day = bcd2_to_byte((dr.dt(), dr.du())); | 105 | let ss_after = r.ssr().read().ss(); |
| 107 | let month = bcd2_to_byte((dr.mt() as u8, dr.mu())); | 106 | if ss == ss_after { |
| 108 | let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16; | 107 | let second = bcd2_to_byte((tr.st(), tr.su())); |
| 109 | 108 | let minute = bcd2_to_byte((tr.mnt(), tr.mnu())); | |
| 110 | self::datetime::datetime(year, month, day, weekday, hour, minute, second).map_err(RtcError::InvalidDateTime) | 109 | let hour = bcd2_to_byte((tr.ht(), tr.hu())); |
| 110 | |||
| 111 | let weekday = dr.wdu(); | ||
| 112 | let day = bcd2_to_byte((dr.dt(), dr.du())); | ||
| 113 | let month = bcd2_to_byte((dr.mt() as u8, dr.mu())); | ||
| 114 | let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16; | ||
| 115 | |||
| 116 | return self::datetime::datetime(year, month, day, weekday, hour, minute, second) | ||
| 117 | .map_err(RtcError::InvalidDateTime); | ||
| 118 | } | ||
| 119 | } | ||
| 120 | |||
| 121 | #[cfg(not(rcc_h7rm0433))] | ||
| 122 | { | ||
| 123 | let r = RTC::regs(); | ||
| 124 | let tr = r.tr().read(); | ||
| 125 | let second = bcd2_to_byte((tr.st(), tr.su())); | ||
| 126 | let minute = bcd2_to_byte((tr.mnt(), tr.mnu())); | ||
| 127 | let hour = bcd2_to_byte((tr.ht(), tr.hu())); | ||
| 128 | // Reading either RTC_SSR or RTC_TR locks the values in the higher-order | ||
| 129 | // calendar shadow registers until RTC_DR is read. | ||
| 130 | let dr = r.dr().read(); | ||
| 131 | |||
| 132 | let weekday = dr.wdu(); | ||
| 133 | let day = bcd2_to_byte((dr.dt(), dr.du())); | ||
| 134 | let month = bcd2_to_byte((dr.mt() as u8, dr.mu())); | ||
| 135 | let year = bcd2_to_byte((dr.yt(), dr.yu())) as u16 + 1970_u16; | ||
| 136 | |||
| 137 | self::datetime::datetime(year, month, day, weekday, hour, minute, second).map_err(RtcError::InvalidDateTime) | ||
| 138 | } | ||
| 111 | } | 139 | } |
| 112 | } | 140 | } |
| 113 | 141 | ||
| @@ -155,8 +183,8 @@ impl Default for RtcCalibrationCyclePeriod { | |||
| 155 | 183 | ||
| 156 | impl Rtc { | 184 | impl Rtc { |
| 157 | pub fn new(_rtc: impl Peripheral<P = RTC>, rtc_config: RtcConfig) -> Self { | 185 | pub fn new(_rtc: impl Peripheral<P = RTC>, rtc_config: RtcConfig) -> Self { |
| 158 | #[cfg(any(rcc_wle, rcc_wl5, rcc_g4, rcc_g0, rtc_v2l4, rtc_v2wb))] | 186 | #[cfg(not(any(stm32l0, stm32f3, stm32l1, stm32f0, stm32f2)))] |
| 159 | <RTC as crate::rcc::sealed::RccPeripheral>::enable(); | 187 | <RTC as crate::rcc::sealed::RccPeripheral>::enable_and_reset(); |
| 160 | 188 | ||
| 161 | let mut this = Self { | 189 | let mut this = Self { |
| 162 | #[cfg(feature = "low-power")] | 190 | #[cfg(feature = "low-power")] |
| @@ -175,19 +203,8 @@ impl Rtc { | |||
| 175 | } | 203 | } |
| 176 | 204 | ||
| 177 | fn frequency() -> Hertz { | 205 | fn frequency() -> Hertz { |
| 178 | #[cfg(any(rcc_wb, rcc_f4, rcc_f410))] | ||
| 179 | let freqs = unsafe { crate::rcc::get_freqs() }; | 206 | let freqs = unsafe { crate::rcc::get_freqs() }; |
| 180 | 207 | freqs.rtc.unwrap() | |
| 181 | // Load the clock frequency from the rcc mod, if supported | ||
| 182 | #[cfg(any(rcc_wb, rcc_f4, rcc_f410))] | ||
| 183 | match freqs.rtc { | ||
| 184 | Some(hertz) => hertz, | ||
| 185 | None => freqs.rtc_hse.unwrap(), | ||
| 186 | } | ||
| 187 | |||
| 188 | // Assume the default value, if not supported | ||
| 189 | #[cfg(not(any(rcc_wb, rcc_f4, rcc_f410)))] | ||
| 190 | Hertz(32_768) | ||
| 191 | } | 208 | } |
| 192 | 209 | ||
| 193 | /// Acquire a [`RtcTimeProvider`] instance. | 210 | /// Acquire a [`RtcTimeProvider`] instance. |
diff --git a/embassy-stm32/src/rtc/v2.rs b/embassy-stm32/src/rtc/v2.rs index 4608d3114..eeb23e1f1 100644 --- a/embassy-stm32/src/rtc/v2.rs +++ b/embassy-stm32/src/rtc/v2.rs | |||
| @@ -112,25 +112,26 @@ impl super::Rtc { | |||
| 112 | pub(crate) fn stop_wakeup_alarm(&self, cs: critical_section::CriticalSection) -> Option<embassy_time::Duration> { | 112 | pub(crate) fn stop_wakeup_alarm(&self, cs: critical_section::CriticalSection) -> Option<embassy_time::Duration> { |
| 113 | use crate::interrupt::typelevel::Interrupt; | 113 | use crate::interrupt::typelevel::Interrupt; |
| 114 | 114 | ||
| 115 | trace!("rtc: stop wakeup alarm at {}", self.instant()); | 115 | if RTC::regs().cr().read().wute() { |
| 116 | trace!("rtc: stop wakeup alarm at {}", self.instant()); | ||
| 116 | 117 | ||
| 117 | self.write(false, |regs| { | 118 | self.write(false, |regs| { |
| 118 | regs.cr().modify(|w| w.set_wutie(false)); | 119 | regs.cr().modify(|w| w.set_wutie(false)); |
| 119 | regs.cr().modify(|w| w.set_wute(false)); | 120 | regs.cr().modify(|w| w.set_wute(false)); |
| 120 | regs.isr().modify(|w| w.set_wutf(false)); | 121 | regs.isr().modify(|w| w.set_wutf(false)); |
| 121 | 122 | ||
| 122 | crate::pac::EXTI | 123 | crate::pac::EXTI |
| 123 | .pr(0) | 124 | .pr(0) |
| 124 | .modify(|w| w.set_line(RTC::EXTI_WAKEUP_LINE, true)); | 125 | .modify(|w| w.set_line(RTC::EXTI_WAKEUP_LINE, true)); |
| 125 | |||
| 126 | <RTC as crate::rtc::sealed::Instance>::WakeupInterrupt::unpend(); | ||
| 127 | }); | ||
| 128 | 126 | ||
| 129 | if let Some(stop_time) = self.stop_time.borrow(cs).take() { | 127 | <RTC as crate::rtc::sealed::Instance>::WakeupInterrupt::unpend(); |
| 130 | Some(self.instant() - stop_time) | 128 | }); |
| 131 | } else { | ||
| 132 | None | ||
| 133 | } | 129 | } |
| 130 | |||
| 131 | self.stop_time | ||
| 132 | .borrow(cs) | ||
| 133 | .take() | ||
| 134 | .map(|stop_time| self.instant() - stop_time) | ||
| 134 | } | 135 | } |
| 135 | 136 | ||
| 136 | #[cfg(feature = "low-power")] | 137 | #[cfg(feature = "low-power")] |
| @@ -156,6 +157,8 @@ impl super::Rtc { | |||
| 156 | w.set_fmt(stm32_metapac::rtc::vals::Fmt::TWENTY_FOUR_HOUR); | 157 | w.set_fmt(stm32_metapac::rtc::vals::Fmt::TWENTY_FOUR_HOUR); |
| 157 | w.set_osel(Osel::DISABLED); | 158 | w.set_osel(Osel::DISABLED); |
| 158 | w.set_pol(Pol::HIGH); | 159 | w.set_pol(Pol::HIGH); |
| 160 | #[cfg(rcc_h7rm0433)] | ||
| 161 | w.set_bypshad(true); | ||
| 159 | }); | 162 | }); |
| 160 | 163 | ||
| 161 | rtc.prer().modify(|w| { | 164 | rtc.prer().modify(|w| { |
diff --git a/embassy-stm32/src/sai/mod.rs b/embassy-stm32/src/sai/mod.rs index 4ffa6e9ce..a0b4ddac7 100644 --- a/embassy-stm32/src/sai/mod.rs +++ b/embassy-stm32/src/sai/mod.rs | |||
| @@ -4,14 +4,14 @@ use embassy_embedded_hal::SetConfig; | |||
| 4 | use embassy_hal_internal::{into_ref, PeripheralRef}; | 4 | use embassy_hal_internal::{into_ref, PeripheralRef}; |
| 5 | 5 | ||
| 6 | pub use crate::dma::word; | 6 | pub use crate::dma::word; |
| 7 | use crate::dma::{ringbuffer, Channel, ReadableRingBuffer, TransferOptions, WritableRingBuffer}; | 7 | use crate::dma::{ringbuffer, Channel, ReadableRingBuffer, Request, TransferOptions, WritableRingBuffer}; |
| 8 | use crate::gpio::sealed::{AFType, Pin as _}; | 8 | use crate::gpio::sealed::{AFType, Pin as _}; |
| 9 | use crate::gpio::AnyPin; | 9 | use crate::gpio::AnyPin; |
| 10 | use crate::pac::sai::{vals, Sai as Regs}; | 10 | use crate::pac::sai::{vals, Sai as Regs}; |
| 11 | use crate::rcc::RccPeripheral; | 11 | use crate::rcc::RccPeripheral; |
| 12 | use crate::{peripherals, Peripheral}; | 12 | use crate::{peripherals, Peripheral}; |
| 13 | 13 | ||
| 14 | #[derive(Debug)] | 14 | #[derive(Debug, PartialEq, Eq)] |
| 15 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 15 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 16 | pub enum Error { | 16 | pub enum Error { |
| 17 | NotATransmitter, | 17 | NotATransmitter, |
| @@ -48,8 +48,8 @@ pub enum Mode { | |||
| 48 | } | 48 | } |
| 49 | 49 | ||
| 50 | #[derive(Copy, Clone)] | 50 | #[derive(Copy, Clone)] |
| 51 | enum TxRx { | 51 | pub enum TxRx { |
| 52 | Transmiter, | 52 | Transmitter, |
| 53 | Receiver, | 53 | Receiver, |
| 54 | } | 54 | } |
| 55 | 55 | ||
| @@ -57,7 +57,7 @@ impl Mode { | |||
| 57 | #[cfg(any(sai_v1, sai_v2, sai_v3, sai_v4))] | 57 | #[cfg(any(sai_v1, sai_v2, sai_v3, sai_v4))] |
| 58 | const fn mode(&self, tx_rx: TxRx) -> vals::Mode { | 58 | const fn mode(&self, tx_rx: TxRx) -> vals::Mode { |
| 59 | match tx_rx { | 59 | match tx_rx { |
| 60 | TxRx::Transmiter => match self { | 60 | TxRx::Transmitter => match self { |
| 61 | Mode::Master => vals::Mode::MASTERTX, | 61 | Mode::Master => vals::Mode::MASTERTX, |
| 62 | Mode::Slave => vals::Mode::SLAVETX, | 62 | Mode::Slave => vals::Mode::SLAVETX, |
| 63 | }, | 63 | }, |
| @@ -206,12 +206,13 @@ impl Protocol { | |||
| 206 | } | 206 | } |
| 207 | } | 207 | } |
| 208 | 208 | ||
| 209 | #[derive(Copy, Clone)] | 209 | #[derive(Copy, Clone, PartialEq)] |
| 210 | pub enum SyncEnable { | 210 | pub enum SyncEnable { |
| 211 | Asynchronous, | 211 | Asynchronous, |
| 212 | /// Syncs with the other A/B sub-block within the SAI unit | 212 | /// Syncs with the other A/B sub-block within the SAI unit |
| 213 | Internal, | 213 | Internal, |
| 214 | /// Syncs with a sub-block in the other SAI unit - use set_sync_output() and set_sync_input() | 214 | /// Syncs with a sub-block in the other SAI unit - use set_sync_output() and set_sync_input() |
| 215 | #[cfg(any(sai_v4))] | ||
| 215 | External, | 216 | External, |
| 216 | } | 217 | } |
| 217 | 218 | ||
| @@ -221,6 +222,7 @@ impl SyncEnable { | |||
| 221 | match self { | 222 | match self { |
| 222 | SyncEnable::Asynchronous => vals::Syncen::ASYNCHRONOUS, | 223 | SyncEnable::Asynchronous => vals::Syncen::ASYNCHRONOUS, |
| 223 | SyncEnable::Internal => vals::Syncen::INTERNAL, | 224 | SyncEnable::Internal => vals::Syncen::INTERNAL, |
| 225 | #[cfg(any(sai_v4))] | ||
| 224 | SyncEnable::External => vals::Syncen::EXTERNAL, | 226 | SyncEnable::External => vals::Syncen::EXTERNAL, |
| 225 | } | 227 | } |
| 226 | } | 228 | } |
| @@ -425,6 +427,7 @@ impl MasterClockDivider { | |||
| 425 | #[derive(Copy, Clone)] | 427 | #[derive(Copy, Clone)] |
| 426 | pub struct Config { | 428 | pub struct Config { |
| 427 | pub mode: Mode, | 429 | pub mode: Mode, |
| 430 | pub tx_rx: TxRx, | ||
| 428 | pub sync_enable: SyncEnable, | 431 | pub sync_enable: SyncEnable, |
| 429 | pub is_sync_output: bool, | 432 | pub is_sync_output: bool, |
| 430 | pub protocol: Protocol, | 433 | pub protocol: Protocol, |
| @@ -455,6 +458,7 @@ impl Default for Config { | |||
| 455 | fn default() -> Self { | 458 | fn default() -> Self { |
| 456 | Self { | 459 | Self { |
| 457 | mode: Mode::Master, | 460 | mode: Mode::Master, |
| 461 | tx_rx: TxRx::Transmitter, | ||
| 458 | is_sync_output: false, | 462 | is_sync_output: false, |
| 459 | sync_enable: SyncEnable::Asynchronous, | 463 | sync_enable: SyncEnable::Asynchronous, |
| 460 | protocol: Protocol::Free, | 464 | protocol: Protocol::Free, |
| @@ -498,43 +502,130 @@ impl Config { | |||
| 498 | } | 502 | } |
| 499 | 503 | ||
| 500 | #[derive(Copy, Clone)] | 504 | #[derive(Copy, Clone)] |
| 501 | pub enum SubBlock { | 505 | enum WhichSubBlock { |
| 502 | A = 0, | 506 | A = 0, |
| 503 | B = 1, | 507 | B = 1, |
| 504 | } | 508 | } |
| 505 | 509 | ||
| 506 | enum RingBuffer<'d, C: Channel, W: word::Word> { | 510 | enum RingBuffer<'d, C: Channel, W: word::Word> { |
| 507 | Writable(WritableRingBuffer<'d, C, W>), | 511 | Writable(WritableRingBuffer<'d, C, W>), |
| 508 | #[allow(dead_code)] // remove this after implementing new_* functions for receiver | ||
| 509 | Readable(ReadableRingBuffer<'d, C, W>), | 512 | Readable(ReadableRingBuffer<'d, C, W>), |
| 510 | } | 513 | } |
| 511 | 514 | ||
| 512 | #[cfg(any(sai_v1, sai_v2, sai_v3, sai_v4))] | 515 | #[cfg(any(sai_v1, sai_v2, sai_v3, sai_v4))] |
| 513 | fn wdr<W: word::Word>(w: crate::pac::sai::Sai, sub_block: SubBlock) -> *mut W { | 516 | fn dr<W: word::Word>(w: crate::pac::sai::Sai, sub_block: WhichSubBlock) -> *mut W { |
| 514 | let ch = w.ch(sub_block as usize); | 517 | let ch = w.ch(sub_block as usize); |
| 515 | ch.dr().as_ptr() as _ | 518 | ch.dr().as_ptr() as _ |
| 516 | } | 519 | } |
| 517 | 520 | ||
| 518 | pub struct Sai<'d, T: Instance, C: Channel, W: word::Word> { | 521 | pub struct SubBlock<'d, T: Instance, C: Channel, W: word::Word> { |
| 519 | _peri: PeripheralRef<'d, T>, | 522 | _peri: PeripheralRef<'d, T>, |
| 520 | sd: Option<PeripheralRef<'d, AnyPin>>, | 523 | sd: Option<PeripheralRef<'d, AnyPin>>, |
| 521 | fs: Option<PeripheralRef<'d, AnyPin>>, | 524 | fs: Option<PeripheralRef<'d, AnyPin>>, |
| 522 | sck: Option<PeripheralRef<'d, AnyPin>>, | 525 | sck: Option<PeripheralRef<'d, AnyPin>>, |
| 523 | mclk: Option<PeripheralRef<'d, AnyPin>>, | 526 | mclk: Option<PeripheralRef<'d, AnyPin>>, |
| 524 | ring_buffer: RingBuffer<'d, C, W>, | 527 | ring_buffer: RingBuffer<'d, C, W>, |
| 525 | sub_block: SubBlock, | 528 | sub_block: WhichSubBlock, |
| 529 | } | ||
| 530 | |||
| 531 | pub struct SubBlockA {} | ||
| 532 | pub struct SubBlockB {} | ||
| 533 | |||
| 534 | pub struct SubBlockAPeripheral<'d, T>(PeripheralRef<'d, T>); | ||
| 535 | pub struct SubBlockBPeripheral<'d, T>(PeripheralRef<'d, T>); | ||
| 536 | |||
| 537 | pub struct Sai<'d, T: Instance> { | ||
| 538 | _peri: PeripheralRef<'d, T>, | ||
| 539 | sub_block_a_peri: Option<SubBlockAPeripheral<'d, T>>, | ||
| 540 | sub_block_b_peri: Option<SubBlockBPeripheral<'d, T>>, | ||
| 526 | } | 541 | } |
| 527 | 542 | ||
| 528 | impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | 543 | // return the type for (sd, sck) |
| 529 | fn get_transmitter_af_types(mode: Mode) -> (AFType, AFType) { | 544 | fn get_af_types(mode: Mode, tx_rx: TxRx) -> (AFType, AFType) { |
| 545 | ( | ||
| 546 | //sd is defined by tx/rx mode | ||
| 547 | match tx_rx { | ||
| 548 | TxRx::Transmitter => AFType::OutputPushPull, | ||
| 549 | TxRx::Receiver => AFType::Input, | ||
| 550 | }, | ||
| 551 | //clocks (mclk, sck and fs) are defined by master/slave | ||
| 530 | match mode { | 552 | match mode { |
| 531 | Mode::Master => (AFType::OutputPushPull, AFType::OutputPushPull), | 553 | Mode::Master => AFType::OutputPushPull, |
| 532 | Mode::Slave => (AFType::OutputPushPull, AFType::Input), | 554 | Mode::Slave => AFType::Input, |
| 555 | }, | ||
| 556 | ) | ||
| 557 | } | ||
| 558 | |||
| 559 | fn get_ring_buffer<'d, T: Instance, C: Channel, W: word::Word>( | ||
| 560 | dma: impl Peripheral<P = C> + 'd, | ||
| 561 | dma_buf: &'d mut [W], | ||
| 562 | request: Request, | ||
| 563 | sub_block: WhichSubBlock, | ||
| 564 | tx_rx: TxRx, | ||
| 565 | ) -> RingBuffer<'d, C, W> { | ||
| 566 | let opts = TransferOptions { | ||
| 567 | half_transfer_ir: true, | ||
| 568 | //the new_write() and new_read() always use circular mode | ||
| 569 | ..Default::default() | ||
| 570 | }; | ||
| 571 | match tx_rx { | ||
| 572 | TxRx::Transmitter => RingBuffer::Writable(unsafe { | ||
| 573 | WritableRingBuffer::new_write(dma, request, dr(T::REGS, sub_block), dma_buf, opts) | ||
| 574 | }), | ||
| 575 | TxRx::Receiver => RingBuffer::Readable(unsafe { | ||
| 576 | ReadableRingBuffer::new_read(dma, request, dr(T::REGS, sub_block), dma_buf, opts) | ||
| 577 | }), | ||
| 578 | } | ||
| 579 | } | ||
| 580 | |||
| 581 | impl<'d, T: Instance> Sai<'d, T> { | ||
| 582 | pub fn new(peri: impl Peripheral<P = T> + 'd) -> Self { | ||
| 583 | T::enable_and_reset(); | ||
| 584 | |||
| 585 | Self { | ||
| 586 | _peri: unsafe { peri.clone_unchecked().into_ref() }, | ||
| 587 | sub_block_a_peri: Some(SubBlockAPeripheral(unsafe { peri.clone_unchecked().into_ref() })), | ||
| 588 | sub_block_b_peri: Some(SubBlockBPeripheral(peri.into_ref())), | ||
| 533 | } | 589 | } |
| 534 | } | 590 | } |
| 535 | 591 | ||
| 536 | pub fn new_asynchronous_transmitter_with_mclk_a( | 592 | pub fn take_sub_block_a(self: &mut Self) -> Option<SubBlockAPeripheral<'d, T>> { |
| 537 | peri: impl Peripheral<P = T> + 'd, | 593 | if self.sub_block_a_peri.is_some() { |
| 594 | self.sub_block_a_peri.take() | ||
| 595 | } else { | ||
| 596 | None | ||
| 597 | } | ||
| 598 | } | ||
| 599 | |||
| 600 | pub fn take_sub_block_b(self: &mut Self) -> Option<SubBlockBPeripheral<'d, T>> { | ||
| 601 | if self.sub_block_b_peri.is_some() { | ||
| 602 | self.sub_block_b_peri.take() | ||
| 603 | } else { | ||
| 604 | None | ||
| 605 | } | ||
| 606 | } | ||
| 607 | } | ||
| 608 | |||
| 609 | fn update_synchronous_config(config: &mut Config) { | ||
| 610 | config.mode = Mode::Slave; | ||
| 611 | config.is_sync_output = false; | ||
| 612 | |||
| 613 | #[cfg(any(sai_v1, sai_v2, sai_v3))] | ||
| 614 | { | ||
| 615 | config.sync_enable = SyncEnable::Internal; | ||
| 616 | } | ||
| 617 | |||
| 618 | #[cfg(any(sai_v4))] | ||
| 619 | { | ||
| 620 | //this must either be Internal or External | ||
| 621 | //The asynchronous sub-block on the same SAI needs to enable is_sync_output | ||
| 622 | assert!(config.sync_enable != SyncEnable::Asynchronous); | ||
| 623 | } | ||
| 624 | } | ||
| 625 | |||
| 626 | impl SubBlockA { | ||
| 627 | pub fn new_asynchronous_with_mclk<'d, T: Instance, C: Channel, W: word::Word>( | ||
| 628 | peri: SubBlockAPeripheral<'d, T>, | ||
| 538 | sck: impl Peripheral<P = impl SckAPin<T>> + 'd, | 629 | sck: impl Peripheral<P = impl SckAPin<T>> + 'd, |
| 539 | sd: impl Peripheral<P = impl SdAPin<T>> + 'd, | 630 | sd: impl Peripheral<P = impl SdAPin<T>> + 'd, |
| 540 | fs: impl Peripheral<P = impl FsAPin<T>> + 'd, | 631 | fs: impl Peripheral<P = impl FsAPin<T>> + 'd, |
| @@ -542,37 +633,40 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 542 | dma: impl Peripheral<P = C> + 'd, | 633 | dma: impl Peripheral<P = C> + 'd, |
| 543 | dma_buf: &'d mut [W], | 634 | dma_buf: &'d mut [W], |
| 544 | mut config: Config, | 635 | mut config: Config, |
| 545 | ) -> Self | 636 | ) -> SubBlock<'d, T, C, W> |
| 546 | where | 637 | where |
| 547 | C: Channel + DmaA<T>, | 638 | C: Channel + DmaA<T>, |
| 548 | { | 639 | { |
| 549 | into_ref!(mclk); | 640 | into_ref!(mclk); |
| 550 | 641 | ||
| 551 | mclk.set_as_af(mclk.af_num(), AFType::OutputPushPull); | 642 | let (_sd_af_type, ck_af_type) = get_af_types(config.mode, config.tx_rx); |
| 643 | |||
| 644 | mclk.set_as_af(mclk.af_num(), ck_af_type); | ||
| 552 | mclk.set_speed(crate::gpio::Speed::VeryHigh); | 645 | mclk.set_speed(crate::gpio::Speed::VeryHigh); |
| 553 | 646 | ||
| 554 | if config.master_clock_divider == MasterClockDivider::MasterClockDisabled { | 647 | if config.master_clock_divider == MasterClockDivider::MasterClockDisabled { |
| 555 | config.master_clock_divider = MasterClockDivider::Div1; | 648 | config.master_clock_divider = MasterClockDivider::Div1; |
| 556 | } | 649 | } |
| 557 | 650 | ||
| 558 | Self::new_asynchronous_transmitter_a(peri, sck, sd, fs, dma, dma_buf, config) | 651 | Self::new_asynchronous(peri, sck, sd, fs, dma, dma_buf, config) |
| 559 | } | 652 | } |
| 560 | 653 | ||
| 561 | pub fn new_asynchronous_transmitter_a( | 654 | pub fn new_asynchronous<'d, T: Instance, C: Channel, W: word::Word>( |
| 562 | peri: impl Peripheral<P = T> + 'd, | 655 | peri: SubBlockAPeripheral<'d, T>, |
| 563 | sck: impl Peripheral<P = impl SckAPin<T>> + 'd, | 656 | sck: impl Peripheral<P = impl SckAPin<T>> + 'd, |
| 564 | sd: impl Peripheral<P = impl SdAPin<T>> + 'd, | 657 | sd: impl Peripheral<P = impl SdAPin<T>> + 'd, |
| 565 | fs: impl Peripheral<P = impl FsAPin<T>> + 'd, | 658 | fs: impl Peripheral<P = impl FsAPin<T>> + 'd, |
| 566 | dma: impl Peripheral<P = C> + 'd, | 659 | dma: impl Peripheral<P = C> + 'd, |
| 567 | dma_buf: &'d mut [W], | 660 | dma_buf: &'d mut [W], |
| 568 | config: Config, | 661 | config: Config, |
| 569 | ) -> Self | 662 | ) -> SubBlock<'d, T, C, W> |
| 570 | where | 663 | where |
| 571 | C: Channel + DmaA<T>, | 664 | C: Channel + DmaA<T>, |
| 572 | { | 665 | { |
| 666 | let peri = peri.0; | ||
| 573 | into_ref!(peri, dma, sck, sd, fs); | 667 | into_ref!(peri, dma, sck, sd, fs); |
| 574 | 668 | ||
| 575 | let (sd_af_type, ck_af_type) = Self::get_transmitter_af_types(config.mode); | 669 | let (sd_af_type, ck_af_type) = get_af_types(config.mode, config.tx_rx); |
| 576 | sd.set_as_af(sd.af_num(), sd_af_type); | 670 | sd.set_as_af(sd.af_num(), sd_af_type); |
| 577 | sd.set_speed(crate::gpio::Speed::VeryHigh); | 671 | sd.set_speed(crate::gpio::Speed::VeryHigh); |
| 578 | 672 | ||
| @@ -581,31 +675,60 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 581 | fs.set_as_af(fs.af_num(), ck_af_type); | 675 | fs.set_as_af(fs.af_num(), ck_af_type); |
| 582 | fs.set_speed(crate::gpio::Speed::VeryHigh); | 676 | fs.set_speed(crate::gpio::Speed::VeryHigh); |
| 583 | 677 | ||
| 678 | let sub_block = WhichSubBlock::A; | ||
| 584 | let request = dma.request(); | 679 | let request = dma.request(); |
| 585 | let opts = TransferOptions { | ||
| 586 | half_transfer_ir: true, | ||
| 587 | circular: true, | ||
| 588 | ..Default::default() | ||
| 589 | }; | ||
| 590 | |||
| 591 | let sub_block = SubBlock::A; | ||
| 592 | 680 | ||
| 593 | Self::new_inner( | 681 | SubBlock::new_inner( |
| 594 | peri, | 682 | peri, |
| 595 | sub_block, | 683 | sub_block, |
| 596 | Some(sck.map_into()), | 684 | Some(sck.map_into()), |
| 597 | None, | 685 | None, |
| 598 | Some(sd.map_into()), | 686 | Some(sd.map_into()), |
| 599 | Some(fs.map_into()), | 687 | Some(fs.map_into()), |
| 600 | RingBuffer::Writable(unsafe { | 688 | get_ring_buffer::<T, C, W>(dma, dma_buf, request, sub_block, config.tx_rx), |
| 601 | WritableRingBuffer::new_write(dma, request, wdr(T::REGS, sub_block), dma_buf, opts) | ||
| 602 | }), | ||
| 603 | config, | 689 | config, |
| 604 | ) | 690 | ) |
| 605 | } | 691 | } |
| 606 | 692 | ||
| 607 | pub fn new_asynchronous_transmitter_with_mclk_b( | 693 | pub fn new_synchronous<'d, T: Instance, C: Channel, W: word::Word>( |
| 608 | peri: impl Peripheral<P = T> + 'd, | 694 | peri: SubBlockAPeripheral<'d, T>, |
| 695 | sd: impl Peripheral<P = impl SdAPin<T>> + 'd, | ||
| 696 | dma: impl Peripheral<P = C> + 'd, | ||
| 697 | dma_buf: &'d mut [W], | ||
| 698 | mut config: Config, | ||
| 699 | ) -> SubBlock<'d, T, C, W> | ||
| 700 | where | ||
| 701 | C: Channel + DmaA<T>, | ||
| 702 | { | ||
| 703 | update_synchronous_config(&mut config); | ||
| 704 | |||
| 705 | let peri = peri.0; | ||
| 706 | into_ref!(dma, peri, sd); | ||
| 707 | |||
| 708 | let (sd_af_type, _ck_af_type) = get_af_types(config.mode, config.tx_rx); | ||
| 709 | |||
| 710 | sd.set_as_af(sd.af_num(), sd_af_type); | ||
| 711 | sd.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 712 | |||
| 713 | let sub_block = WhichSubBlock::A; | ||
| 714 | let request = dma.request(); | ||
| 715 | |||
| 716 | SubBlock::new_inner( | ||
| 717 | peri, | ||
| 718 | sub_block, | ||
| 719 | None, | ||
| 720 | None, | ||
| 721 | Some(sd.map_into()), | ||
| 722 | None, | ||
| 723 | get_ring_buffer::<T, C, W>(dma, dma_buf, request, sub_block, config.tx_rx), | ||
| 724 | config, | ||
| 725 | ) | ||
| 726 | } | ||
| 727 | } | ||
| 728 | |||
| 729 | impl SubBlockB { | ||
| 730 | pub fn new_asynchronous_with_mclk<'d, T: Instance, C: Channel, W: word::Word>( | ||
| 731 | peri: SubBlockBPeripheral<'d, T>, | ||
| 609 | sck: impl Peripheral<P = impl SckBPin<T>> + 'd, | 732 | sck: impl Peripheral<P = impl SckBPin<T>> + 'd, |
| 610 | sd: impl Peripheral<P = impl SdBPin<T>> + 'd, | 733 | sd: impl Peripheral<P = impl SdBPin<T>> + 'd, |
| 611 | fs: impl Peripheral<P = impl FsBPin<T>> + 'd, | 734 | fs: impl Peripheral<P = impl FsBPin<T>> + 'd, |
| @@ -613,37 +736,40 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 613 | dma: impl Peripheral<P = C> + 'd, | 736 | dma: impl Peripheral<P = C> + 'd, |
| 614 | dma_buf: &'d mut [W], | 737 | dma_buf: &'d mut [W], |
| 615 | mut config: Config, | 738 | mut config: Config, |
| 616 | ) -> Self | 739 | ) -> SubBlock<'d, T, C, W> |
| 617 | where | 740 | where |
| 618 | C: Channel + DmaB<T>, | 741 | C: Channel + DmaB<T>, |
| 619 | { | 742 | { |
| 620 | into_ref!(mclk); | 743 | into_ref!(mclk); |
| 621 | 744 | ||
| 622 | mclk.set_as_af(mclk.af_num(), AFType::OutputPushPull); | 745 | let (_sd_af_type, ck_af_type) = get_af_types(config.mode, config.tx_rx); |
| 746 | |||
| 747 | mclk.set_as_af(mclk.af_num(), ck_af_type); | ||
| 623 | mclk.set_speed(crate::gpio::Speed::VeryHigh); | 748 | mclk.set_speed(crate::gpio::Speed::VeryHigh); |
| 624 | 749 | ||
| 625 | if config.master_clock_divider == MasterClockDivider::MasterClockDisabled { | 750 | if config.master_clock_divider == MasterClockDivider::MasterClockDisabled { |
| 626 | config.master_clock_divider = MasterClockDivider::Div1; | 751 | config.master_clock_divider = MasterClockDivider::Div1; |
| 627 | } | 752 | } |
| 628 | 753 | ||
| 629 | Self::new_asynchronous_transmitter_b(peri, sck, sd, fs, dma, dma_buf, config) | 754 | Self::new_asynchronous(peri, sck, sd, fs, dma, dma_buf, config) |
| 630 | } | 755 | } |
| 631 | 756 | ||
| 632 | pub fn new_asynchronous_transmitter_b( | 757 | pub fn new_asynchronous<'d, T: Instance, C: Channel, W: word::Word>( |
| 633 | peri: impl Peripheral<P = T> + 'd, | 758 | peri: SubBlockBPeripheral<'d, T>, |
| 634 | sck: impl Peripheral<P = impl SckBPin<T>> + 'd, | 759 | sck: impl Peripheral<P = impl SckBPin<T>> + 'd, |
| 635 | sd: impl Peripheral<P = impl SdBPin<T>> + 'd, | 760 | sd: impl Peripheral<P = impl SdBPin<T>> + 'd, |
| 636 | fs: impl Peripheral<P = impl FsBPin<T>> + 'd, | 761 | fs: impl Peripheral<P = impl FsBPin<T>> + 'd, |
| 637 | dma: impl Peripheral<P = C> + 'd, | 762 | dma: impl Peripheral<P = C> + 'd, |
| 638 | dma_buf: &'d mut [W], | 763 | dma_buf: &'d mut [W], |
| 639 | config: Config, | 764 | config: Config, |
| 640 | ) -> Self | 765 | ) -> SubBlock<'d, T, C, W> |
| 641 | where | 766 | where |
| 642 | C: Channel + DmaB<T>, | 767 | C: Channel + DmaB<T>, |
| 643 | { | 768 | { |
| 769 | let peri = peri.0; | ||
| 644 | into_ref!(dma, peri, sck, sd, fs); | 770 | into_ref!(dma, peri, sck, sd, fs); |
| 645 | 771 | ||
| 646 | let (sd_af_type, ck_af_type) = Self::get_transmitter_af_types(config.mode); | 772 | let (sd_af_type, ck_af_type) = get_af_types(config.mode, config.tx_rx); |
| 647 | 773 | ||
| 648 | sd.set_as_af(sd.af_num(), sd_af_type); | 774 | sd.set_as_af(sd.af_num(), sd_af_type); |
| 649 | sd.set_speed(crate::gpio::Speed::VeryHigh); | 775 | sd.set_speed(crate::gpio::Speed::VeryHigh); |
| @@ -653,28 +779,57 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 653 | fs.set_as_af(fs.af_num(), ck_af_type); | 779 | fs.set_as_af(fs.af_num(), ck_af_type); |
| 654 | fs.set_speed(crate::gpio::Speed::VeryHigh); | 780 | fs.set_speed(crate::gpio::Speed::VeryHigh); |
| 655 | 781 | ||
| 782 | let sub_block = WhichSubBlock::B; | ||
| 656 | let request = dma.request(); | 783 | let request = dma.request(); |
| 657 | let opts = TransferOptions { | ||
| 658 | half_transfer_ir: true, | ||
| 659 | ..Default::default() | ||
| 660 | }; | ||
| 661 | |||
| 662 | let sub_block = SubBlock::B; | ||
| 663 | 784 | ||
| 664 | Self::new_inner( | 785 | SubBlock::new_inner( |
| 665 | peri, | 786 | peri, |
| 666 | sub_block, | 787 | sub_block, |
| 667 | Some(sck.map_into()), | 788 | Some(sck.map_into()), |
| 668 | None, | 789 | None, |
| 669 | Some(sd.map_into()), | 790 | Some(sd.map_into()), |
| 670 | Some(fs.map_into()), | 791 | Some(fs.map_into()), |
| 671 | RingBuffer::Writable(unsafe { | 792 | get_ring_buffer::<T, C, W>(dma, dma_buf, request, sub_block, config.tx_rx), |
| 672 | WritableRingBuffer::new_write(dma, request, wdr(T::REGS, sub_block), dma_buf, opts) | 793 | config, |
| 673 | }), | 794 | ) |
| 795 | } | ||
| 796 | |||
| 797 | pub fn new_synchronous<'d, T: Instance, C: Channel, W: word::Word>( | ||
| 798 | peri: SubBlockBPeripheral<'d, T>, | ||
| 799 | sd: impl Peripheral<P = impl SdBPin<T>> + 'd, | ||
| 800 | dma: impl Peripheral<P = C> + 'd, | ||
| 801 | dma_buf: &'d mut [W], | ||
| 802 | mut config: Config, | ||
| 803 | ) -> SubBlock<'d, T, C, W> | ||
| 804 | where | ||
| 805 | C: Channel + DmaB<T>, | ||
| 806 | { | ||
| 807 | update_synchronous_config(&mut config); | ||
| 808 | let peri = peri.0; | ||
| 809 | into_ref!(dma, peri, sd); | ||
| 810 | |||
| 811 | let (sd_af_type, _ck_af_type) = get_af_types(config.mode, config.tx_rx); | ||
| 812 | |||
| 813 | sd.set_as_af(sd.af_num(), sd_af_type); | ||
| 814 | sd.set_speed(crate::gpio::Speed::VeryHigh); | ||
| 815 | |||
| 816 | let sub_block = WhichSubBlock::B; | ||
| 817 | let request = dma.request(); | ||
| 818 | |||
| 819 | SubBlock::new_inner( | ||
| 820 | peri, | ||
| 821 | sub_block, | ||
| 822 | None, | ||
| 823 | None, | ||
| 824 | Some(sd.map_into()), | ||
| 825 | None, | ||
| 826 | get_ring_buffer::<T, C, W>(dma, dma_buf, request, sub_block, config.tx_rx), | ||
| 674 | config, | 827 | config, |
| 675 | ) | 828 | ) |
| 676 | } | 829 | } |
| 830 | } | ||
| 677 | 831 | ||
| 832 | impl<'d, T: Instance, C: Channel, W: word::Word> SubBlock<'d, T, C, W> { | ||
| 678 | pub fn start(self: &mut Self) { | 833 | pub fn start(self: &mut Self) { |
| 679 | match self.ring_buffer { | 834 | match self.ring_buffer { |
| 680 | RingBuffer::Writable(ref mut rb) => { | 835 | RingBuffer::Writable(ref mut rb) => { |
| @@ -695,7 +850,7 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 695 | 850 | ||
| 696 | fn new_inner( | 851 | fn new_inner( |
| 697 | peri: impl Peripheral<P = T> + 'd, | 852 | peri: impl Peripheral<P = T> + 'd, |
| 698 | sub_block: SubBlock, | 853 | sub_block: WhichSubBlock, |
| 699 | sck: Option<PeripheralRef<'d, AnyPin>>, | 854 | sck: Option<PeripheralRef<'d, AnyPin>>, |
| 700 | mclk: Option<PeripheralRef<'d, AnyPin>>, | 855 | mclk: Option<PeripheralRef<'d, AnyPin>>, |
| 701 | sd: Option<PeripheralRef<'d, AnyPin>>, | 856 | sd: Option<PeripheralRef<'d, AnyPin>>, |
| @@ -703,13 +858,18 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 703 | ring_buffer: RingBuffer<'d, C, W>, | 858 | ring_buffer: RingBuffer<'d, C, W>, |
| 704 | config: Config, | 859 | config: Config, |
| 705 | ) -> Self { | 860 | ) -> Self { |
| 706 | T::enable(); | 861 | #[cfg(any(sai_v1, sai_v2, sai_v3, sai_v4))] |
| 707 | T::reset(); | 862 | { |
| 863 | let ch = T::REGS.ch(sub_block as usize); | ||
| 864 | ch.cr1().modify(|w| w.set_saien(false)); | ||
| 865 | } | ||
| 708 | 866 | ||
| 709 | #[cfg(any(sai_v4))] | 867 | #[cfg(any(sai_v4))] |
| 710 | { | 868 | { |
| 711 | // Not totally clear from the datasheet if this is right | 869 | // Not totally clear from the datasheet if this is right |
| 712 | // This is only used if using SyncEnable::External | 870 | // This is only used if using SyncEnable::External on the other SAI unit |
| 871 | // Syncing from SAIX subblock A to subblock B does not require this | ||
| 872 | // Only syncing from SAI1 subblock A/B to SAI2 subblock A/B | ||
| 713 | let value: u8 = if T::REGS.as_ptr() == stm32_metapac::SAI1.as_ptr() { | 873 | let value: u8 = if T::REGS.as_ptr() == stm32_metapac::SAI1.as_ptr() { |
| 714 | 1 //this is SAI1, so sync with SAI2 | 874 | 1 //this is SAI1, so sync with SAI2 |
| 715 | } else { | 875 | } else { |
| @@ -721,8 +881,8 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 721 | 881 | ||
| 722 | if config.is_sync_output { | 882 | if config.is_sync_output { |
| 723 | let syncout: u8 = match sub_block { | 883 | let syncout: u8 = match sub_block { |
| 724 | SubBlock::A => 0b01, | 884 | WhichSubBlock::A => 0b01, |
| 725 | SubBlock::B => 0b10, | 885 | WhichSubBlock::B => 0b10, |
| 726 | }; | 886 | }; |
| 727 | T::REGS.gcr().modify(|w| { | 887 | T::REGS.gcr().modify(|w| { |
| 728 | w.set_syncout(syncout); | 888 | w.set_syncout(syncout); |
| @@ -735,7 +895,7 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 735 | let ch = T::REGS.ch(sub_block as usize); | 895 | let ch = T::REGS.ch(sub_block as usize); |
| 736 | ch.cr1().modify(|w| { | 896 | ch.cr1().modify(|w| { |
| 737 | w.set_mode(config.mode.mode(if Self::is_transmitter(&ring_buffer) { | 897 | w.set_mode(config.mode.mode(if Self::is_transmitter(&ring_buffer) { |
| 738 | TxRx::Transmiter | 898 | TxRx::Transmitter |
| 739 | } else { | 899 | } else { |
| 740 | TxRx::Receiver | 900 | TxRx::Receiver |
| 741 | })); | 901 | })); |
| @@ -770,7 +930,7 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 770 | w.set_fsoff(config.frame_sync_offset.fsoff()); | 930 | w.set_fsoff(config.frame_sync_offset.fsoff()); |
| 771 | w.set_fspol(config.frame_sync_polarity.fspol()); | 931 | w.set_fspol(config.frame_sync_polarity.fspol()); |
| 772 | w.set_fsdef(config.frame_sync_definition.fsdef()); | 932 | w.set_fsdef(config.frame_sync_definition.fsdef()); |
| 773 | w.set_fsall(config.frame_sync_active_level_length.0 as u8); | 933 | w.set_fsall(config.frame_sync_active_level_length.0 as u8 - 1); |
| 774 | w.set_frl(config.frame_length - 1); | 934 | w.set_frl(config.frame_length - 1); |
| 775 | }); | 935 | }); |
| 776 | 936 | ||
| @@ -782,6 +942,10 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 782 | }); | 942 | }); |
| 783 | 943 | ||
| 784 | ch.cr1().modify(|w| w.set_saien(true)); | 944 | ch.cr1().modify(|w| w.set_saien(true)); |
| 945 | |||
| 946 | if ch.cr1().read().saien() == false { | ||
| 947 | panic!("SAI failed to enable. Check that config is valid (frame length, slot count, etc)"); | ||
| 948 | } | ||
| 785 | } | 949 | } |
| 786 | 950 | ||
| 787 | Self { | 951 | Self { |
| @@ -795,6 +959,10 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 795 | } | 959 | } |
| 796 | } | 960 | } |
| 797 | 961 | ||
| 962 | pub fn reset() { | ||
| 963 | T::enable_and_reset(); | ||
| 964 | } | ||
| 965 | |||
| 798 | pub fn flush(&mut self) { | 966 | pub fn flush(&mut self) { |
| 799 | let ch = T::REGS.ch(self.sub_block as usize); | 967 | let ch = T::REGS.ch(self.sub_block as usize); |
| 800 | ch.cr1().modify(|w| w.set_saien(false)); | 968 | ch.cr1().modify(|w| w.set_saien(false)); |
| @@ -814,8 +982,9 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 814 | ch.cr2().modify(|w| w.set_mute(value)); | 982 | ch.cr2().modify(|w| w.set_mute(value)); |
| 815 | } | 983 | } |
| 816 | 984 | ||
| 985 | #[allow(dead_code)] | ||
| 817 | /// Reconfigures it with the supplied config. | 986 | /// Reconfigures it with the supplied config. |
| 818 | pub fn reconfigure(&mut self, _config: Config) {} | 987 | fn reconfigure(&mut self, _config: Config) {} |
| 819 | 988 | ||
| 820 | pub fn get_current_config(&self) -> Config { | 989 | pub fn get_current_config(&self) -> Config { |
| 821 | Config::default() | 990 | Config::default() |
| @@ -842,7 +1011,7 @@ impl<'d, T: Instance, C: Channel, W: word::Word> Sai<'d, T, C, W> { | |||
| 842 | } | 1011 | } |
| 843 | } | 1012 | } |
| 844 | 1013 | ||
| 845 | impl<'d, T: Instance, C: Channel, W: word::Word> Drop for Sai<'d, T, C, W> { | 1014 | impl<'d, T: Instance, C: Channel, W: word::Word> Drop for SubBlock<'d, T, C, W> { |
| 846 | fn drop(&mut self) { | 1015 | fn drop(&mut self) { |
| 847 | let ch = T::REGS.ch(self.sub_block as usize); | 1016 | let ch = T::REGS.ch(self.sub_block as usize); |
| 848 | ch.cr1().modify(|w| w.set_saien(false)); | 1017 | ch.cr1().modify(|w| w.set_saien(false)); |
| @@ -886,9 +1055,12 @@ foreach_peripheral!( | |||
| 886 | }; | 1055 | }; |
| 887 | ); | 1056 | ); |
| 888 | 1057 | ||
| 889 | impl<'d, T: Instance, C: Channel, W: word::Word> SetConfig for Sai<'d, T, C, W> { | 1058 | impl<'d, T: Instance> SetConfig for Sai<'d, T> { |
| 890 | type Config = Config; | 1059 | type Config = Config; |
| 891 | fn set_config(&mut self, config: &Self::Config) { | 1060 | type ConfigError = (); |
| 892 | self.reconfigure(*config); | 1061 | fn set_config(&mut self, _config: &Self::Config) -> Result<(), ()> { |
| 1062 | // self.reconfigure(*config); | ||
| 1063 | |||
| 1064 | Ok(()) | ||
| 893 | } | 1065 | } |
| 894 | } | 1066 | } |
diff --git a/embassy-stm32/src/sdmmc/mod.rs b/embassy-stm32/src/sdmmc/mod.rs index 9fb380fd6..11ff24645 100644 --- a/embassy-stm32/src/sdmmc/mod.rs +++ b/embassy-stm32/src/sdmmc/mod.rs | |||
| @@ -452,8 +452,7 @@ impl<'d, T: Instance, Dma: SdmmcDma<T> + 'd> Sdmmc<'d, T, Dma> { | |||
| 452 | ) -> Self { | 452 | ) -> Self { |
| 453 | into_ref!(sdmmc, dma); | 453 | into_ref!(sdmmc, dma); |
| 454 | 454 | ||
| 455 | T::enable(); | 455 | T::enable_and_reset(); |
| 456 | T::reset(); | ||
| 457 | 456 | ||
| 458 | T::Interrupt::unpend(); | 457 | T::Interrupt::unpend(); |
| 459 | unsafe { T::Interrupt::enable() }; | 458 | unsafe { T::Interrupt::enable() }; |
| @@ -1458,7 +1457,7 @@ cfg_if::cfg_if! { | |||
| 1458 | macro_rules! kernel_clk { | 1457 | macro_rules! kernel_clk { |
| 1459 | ($inst:ident) => { | 1458 | ($inst:ident) => { |
| 1460 | critical_section::with(|_| unsafe { | 1459 | critical_section::with(|_| unsafe { |
| 1461 | crate::rcc::get_freqs().pll48 | 1460 | crate::rcc::get_freqs().pll1_q |
| 1462 | }).expect("PLL48 is required for SDIO") | 1461 | }).expect("PLL48 is required for SDIO") |
| 1463 | } | 1462 | } |
| 1464 | } | 1463 | } |
| @@ -1470,7 +1469,7 @@ cfg_if::cfg_if! { | |||
| 1470 | if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { | 1469 | if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { |
| 1471 | crate::rcc::get_freqs().sys | 1470 | crate::rcc::get_freqs().sys |
| 1472 | } else { | 1471 | } else { |
| 1473 | crate::rcc::get_freqs().pll48.expect("PLL48 is required for SDMMC") | 1472 | crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC") |
| 1474 | } | 1473 | } |
| 1475 | }) | 1474 | }) |
| 1476 | }; | 1475 | }; |
| @@ -1480,7 +1479,7 @@ cfg_if::cfg_if! { | |||
| 1480 | if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { | 1479 | if sdmmcsel == crate::pac::rcc::vals::Sdmmcsel::SYSCLK { |
| 1481 | crate::rcc::get_freqs().sys | 1480 | crate::rcc::get_freqs().sys |
| 1482 | } else { | 1481 | } else { |
| 1483 | crate::rcc::get_freqs().pll48.expect("PLL48 is required for SDMMC") | 1482 | crate::rcc::get_freqs().pll1_q.expect("PLL48 is required for SDMMC") |
| 1484 | } | 1483 | } |
| 1485 | }) | 1484 | }) |
| 1486 | }; | 1485 | }; |
diff --git a/embassy-stm32/src/spi/mod.rs b/embassy-stm32/src/spi/mod.rs index f40bce784..c391e0a5a 100644 --- a/embassy-stm32/src/spi/mod.rs +++ b/embassy-stm32/src/spi/mod.rs | |||
| @@ -15,7 +15,7 @@ use crate::rcc::RccPeripheral; | |||
| 15 | use crate::time::Hertz; | 15 | use crate::time::Hertz; |
| 16 | use crate::{peripherals, Peripheral}; | 16 | use crate::{peripherals, Peripheral}; |
| 17 | 17 | ||
| 18 | #[derive(Debug)] | 18 | #[derive(Debug, PartialEq, Eq)] |
| 19 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 19 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 20 | pub enum Error { | 20 | pub enum Error { |
| 21 | Framing, | 21 | Framing, |
| @@ -230,8 +230,7 @@ impl<'d, T: Instance, Tx, Rx> Spi<'d, T, Tx, Rx> { | |||
| 230 | 230 | ||
| 231 | let lsbfirst = config.raw_byte_order(); | 231 | let lsbfirst = config.raw_byte_order(); |
| 232 | 232 | ||
| 233 | T::enable(); | 233 | T::enable_and_reset(); |
| 234 | T::reset(); | ||
| 235 | 234 | ||
| 236 | #[cfg(any(spi_v1, spi_f1))] | 235 | #[cfg(any(spi_v1, spi_f1))] |
| 237 | { | 236 | { |
| @@ -323,7 +322,7 @@ impl<'d, T: Instance, Tx, Rx> Spi<'d, T, Tx, Rx> { | |||
| 323 | } | 322 | } |
| 324 | 323 | ||
| 325 | /// Reconfigures it with the supplied config. | 324 | /// Reconfigures it with the supplied config. |
| 326 | pub fn set_config(&mut self, config: Config) { | 325 | pub fn set_config(&mut self, config: &Config) -> Result<(), ()> { |
| 327 | let cpha = config.raw_phase(); | 326 | let cpha = config.raw_phase(); |
| 328 | let cpol = config.raw_polarity(); | 327 | let cpol = config.raw_polarity(); |
| 329 | 328 | ||
| @@ -352,6 +351,7 @@ impl<'d, T: Instance, Tx, Rx> Spi<'d, T, Tx, Rx> { | |||
| 352 | w.set_mbr(br); | 351 | w.set_mbr(br); |
| 353 | }); | 352 | }); |
| 354 | } | 353 | } |
| 354 | Ok(()) | ||
| 355 | } | 355 | } |
| 356 | 356 | ||
| 357 | pub fn get_current_config(&self) -> Config { | 357 | pub fn get_current_config(&self) -> Config { |
| @@ -1061,7 +1061,8 @@ foreach_peripheral!( | |||
| 1061 | 1061 | ||
| 1062 | impl<'d, T: Instance, Tx, Rx> SetConfig for Spi<'d, T, Tx, Rx> { | 1062 | impl<'d, T: Instance, Tx, Rx> SetConfig for Spi<'d, T, Tx, Rx> { |
| 1063 | type Config = Config; | 1063 | type Config = Config; |
| 1064 | fn set_config(&mut self, config: &Self::Config) { | 1064 | type ConfigError = (); |
| 1065 | self.set_config(*config); | 1065 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 1066 | self.set_config(config) | ||
| 1066 | } | 1067 | } |
| 1067 | } | 1068 | } |
diff --git a/embassy-stm32/src/time.rs b/embassy-stm32/src/time.rs index 604503e61..a0bc33944 100644 --- a/embassy-stm32/src/time.rs +++ b/embassy-stm32/src/time.rs | |||
| @@ -77,3 +77,10 @@ impl Div<u8> for Hertz { | |||
| 77 | self / (rhs as u32) | 77 | self / (rhs as u32) |
| 78 | } | 78 | } |
| 79 | } | 79 | } |
| 80 | |||
| 81 | impl Div<Hertz> for Hertz { | ||
| 82 | type Output = u32; | ||
| 83 | fn div(self, rhs: Hertz) -> Self::Output { | ||
| 84 | self.0 / rhs.0 | ||
| 85 | } | ||
| 86 | } | ||
diff --git a/embassy-stm32/src/time_driver.rs b/embassy-stm32/src/time_driver.rs index 5b01937f5..add8be831 100644 --- a/embassy-stm32/src/time_driver.rs +++ b/embassy-stm32/src/time_driver.rs | |||
| @@ -1,9 +1,8 @@ | |||
| 1 | use core::cell::Cell; | 1 | use core::cell::Cell; |
| 2 | use core::convert::TryInto; | 2 | use core::convert::TryInto; |
| 3 | use core::sync::atomic::{compiler_fence, Ordering}; | 3 | use core::sync::atomic::{compiler_fence, AtomicU32, AtomicU8, Ordering}; |
| 4 | use core::{mem, ptr}; | 4 | use core::{mem, ptr}; |
| 5 | 5 | ||
| 6 | use atomic_polyfill::{AtomicU32, AtomicU8}; | ||
| 7 | use critical_section::CriticalSection; | 6 | use critical_section::CriticalSection; |
| 8 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | 7 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; |
| 9 | use embassy_sync::blocking_mutex::Mutex; | 8 | use embassy_sync::blocking_mutex::Mutex; |
| @@ -153,46 +152,43 @@ embassy_time::time_driver_impl!(static DRIVER: RtcDriver = RtcDriver { | |||
| 153 | }); | 152 | }); |
| 154 | 153 | ||
| 155 | impl RtcDriver { | 154 | impl RtcDriver { |
| 156 | fn init(&'static self) { | 155 | fn init(&'static self, cs: critical_section::CriticalSection) { |
| 157 | let r = T::regs_gp16(); | 156 | let r = T::regs_gp16(); |
| 158 | 157 | ||
| 159 | <T as RccPeripheral>::enable(); | 158 | <T as RccPeripheral>::enable_and_reset_with_cs(cs); |
| 160 | <T as RccPeripheral>::reset(); | ||
| 161 | 159 | ||
| 162 | let timer_freq = T::frequency(); | 160 | let timer_freq = T::frequency(); |
| 163 | 161 | ||
| 164 | critical_section::with(|_| { | 162 | r.cr1().modify(|w| w.set_cen(false)); |
| 165 | r.cr1().modify(|w| w.set_cen(false)); | 163 | r.cnt().write(|w| w.set_cnt(0)); |
| 166 | r.cnt().write(|w| w.set_cnt(0)); | ||
| 167 | 164 | ||
| 168 | let psc = timer_freq.0 / TICK_HZ as u32 - 1; | 165 | let psc = timer_freq.0 / TICK_HZ as u32 - 1; |
| 169 | let psc: u16 = match psc.try_into() { | 166 | let psc: u16 = match psc.try_into() { |
| 170 | Err(_) => panic!("psc division overflow: {}", psc), | 167 | Err(_) => panic!("psc division overflow: {}", psc), |
| 171 | Ok(n) => n, | 168 | Ok(n) => n, |
| 172 | }; | 169 | }; |
| 173 | 170 | ||
| 174 | r.psc().write(|w| w.set_psc(psc)); | 171 | r.psc().write(|w| w.set_psc(psc)); |
| 175 | r.arr().write(|w| w.set_arr(u16::MAX)); | 172 | r.arr().write(|w| w.set_arr(u16::MAX)); |
| 176 | 173 | ||
| 177 | // Set URS, generate update and clear URS | 174 | // Set URS, generate update and clear URS |
| 178 | r.cr1().modify(|w| w.set_urs(vals::Urs::COUNTERONLY)); | 175 | r.cr1().modify(|w| w.set_urs(vals::Urs::COUNTERONLY)); |
| 179 | r.egr().write(|w| w.set_ug(true)); | 176 | r.egr().write(|w| w.set_ug(true)); |
| 180 | r.cr1().modify(|w| w.set_urs(vals::Urs::ANYEVENT)); | 177 | r.cr1().modify(|w| w.set_urs(vals::Urs::ANYEVENT)); |
| 181 | 178 | ||
| 182 | // Mid-way point | 179 | // Mid-way point |
| 183 | r.ccr(0).write(|w| w.set_ccr(0x8000)); | 180 | r.ccr(0).write(|w| w.set_ccr(0x8000)); |
| 184 | 181 | ||
| 185 | // Enable overflow and half-overflow interrupts | 182 | // Enable overflow and half-overflow interrupts |
| 186 | r.dier().write(|w| { | 183 | r.dier().write(|w| { |
| 187 | w.set_uie(true); | 184 | w.set_uie(true); |
| 188 | w.set_ccie(0, true); | 185 | w.set_ccie(0, true); |
| 189 | }); | 186 | }); |
| 190 | 187 | ||
| 191 | <T as BasicInstance>::Interrupt::unpend(); | 188 | <T as BasicInstance>::Interrupt::unpend(); |
| 192 | unsafe { <T as BasicInstance>::Interrupt::enable() }; | 189 | unsafe { <T as BasicInstance>::Interrupt::enable() }; |
| 193 | 190 | ||
| 194 | r.cr1().modify(|w| w.set_cen(true)); | 191 | r.cr1().modify(|w| w.set_cen(true)); |
| 195 | }) | ||
| 196 | } | 192 | } |
| 197 | 193 | ||
| 198 | fn on_interrupt(&self) { | 194 | fn on_interrupt(&self) { |
| @@ -229,7 +225,9 @@ impl RtcDriver { | |||
| 229 | fn next_period(&self) { | 225 | fn next_period(&self) { |
| 230 | let r = T::regs_gp16(); | 226 | let r = T::regs_gp16(); |
| 231 | 227 | ||
| 232 | let period = self.period.fetch_add(1, Ordering::Relaxed) + 1; | 228 | // We only modify the period from the timer interrupt, so we know this can't race. |
| 229 | let period = self.period.load(Ordering::Relaxed) + 1; | ||
| 230 | self.period.store(period, Ordering::Relaxed); | ||
| 233 | let t = (period as u64) << 15; | 231 | let t = (period as u64) << 15; |
| 234 | 232 | ||
| 235 | critical_section::with(move |cs| { | 233 | critical_section::with(move |cs| { |
| @@ -340,7 +338,11 @@ impl RtcDriver { | |||
| 340 | #[cfg(feature = "low-power")] | 338 | #[cfg(feature = "low-power")] |
| 341 | /// Set the rtc but panic if it's already been set | 339 | /// Set the rtc but panic if it's already been set |
| 342 | pub(crate) fn set_rtc(&self, rtc: &'static Rtc) { | 340 | pub(crate) fn set_rtc(&self, rtc: &'static Rtc) { |
| 343 | critical_section::with(|cs| assert!(self.rtc.borrow(cs).replace(Some(rtc)).is_none())); | 341 | critical_section::with(|cs| { |
| 342 | rtc.stop_wakeup_alarm(cs); | ||
| 343 | |||
| 344 | assert!(self.rtc.borrow(cs).replace(Some(rtc)).is_none()) | ||
| 345 | }); | ||
| 344 | } | 346 | } |
| 345 | 347 | ||
| 346 | #[cfg(feature = "low-power")] | 348 | #[cfg(feature = "low-power")] |
| @@ -399,18 +401,15 @@ impl Driver for RtcDriver { | |||
| 399 | } | 401 | } |
| 400 | 402 | ||
| 401 | unsafe fn allocate_alarm(&self) -> Option<AlarmHandle> { | 403 | unsafe fn allocate_alarm(&self) -> Option<AlarmHandle> { |
| 402 | let id = self.alarm_count.fetch_update(Ordering::AcqRel, Ordering::Acquire, |x| { | 404 | critical_section::with(|_| { |
| 403 | if x < ALARM_COUNT as u8 { | 405 | let id = self.alarm_count.load(Ordering::Relaxed); |
| 404 | Some(x + 1) | 406 | if id < ALARM_COUNT as u8 { |
| 407 | self.alarm_count.store(id + 1, Ordering::Relaxed); | ||
| 408 | Some(AlarmHandle::new(id)) | ||
| 405 | } else { | 409 | } else { |
| 406 | None | 410 | None |
| 407 | } | 411 | } |
| 408 | }); | 412 | }) |
| 409 | |||
| 410 | match id { | ||
| 411 | Ok(id) => Some(AlarmHandle::new(id)), | ||
| 412 | Err(_) => None, | ||
| 413 | } | ||
| 414 | } | 413 | } |
| 415 | 414 | ||
| 416 | fn set_alarm_callback(&self, alarm: AlarmHandle, callback: fn(*mut ()), ctx: *mut ()) { | 415 | fn set_alarm_callback(&self, alarm: AlarmHandle, callback: fn(*mut ()), ctx: *mut ()) { |
| @@ -461,6 +460,6 @@ pub(crate) fn get_driver() -> &'static RtcDriver { | |||
| 461 | &DRIVER | 460 | &DRIVER |
| 462 | } | 461 | } |
| 463 | 462 | ||
| 464 | pub(crate) fn init() { | 463 | pub(crate) fn init(cs: CriticalSection) { |
| 465 | DRIVER.init() | 464 | DRIVER.init(cs) |
| 466 | } | 465 | } |
diff --git a/embassy-stm32/src/timer/complementary_pwm.rs b/embassy-stm32/src/timer/complementary_pwm.rs index 72ff84b63..6654366cd 100644 --- a/embassy-stm32/src/timer/complementary_pwm.rs +++ b/embassy-stm32/src/timer/complementary_pwm.rs | |||
| @@ -65,8 +65,7 @@ impl<'d, T: ComplementaryCaptureCompare16bitInstance> ComplementaryPwm<'d, T> { | |||
| 65 | fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self { | 65 | fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self { |
| 66 | into_ref!(tim); | 66 | into_ref!(tim); |
| 67 | 67 | ||
| 68 | T::enable(); | 68 | T::enable_and_reset(); |
| 69 | <T as crate::rcc::sealed::RccPeripheral>::reset(); | ||
| 70 | 69 | ||
| 71 | let mut this = Self { inner: tim }; | 70 | let mut this = Self { inner: tim }; |
| 72 | 71 | ||
| @@ -74,7 +73,7 @@ impl<'d, T: ComplementaryCaptureCompare16bitInstance> ComplementaryPwm<'d, T> { | |||
| 74 | this.set_freq(freq); | 73 | this.set_freq(freq); |
| 75 | this.inner.start(); | 74 | this.inner.start(); |
| 76 | 75 | ||
| 77 | this.inner.enable_outputs(true); | 76 | this.inner.enable_outputs(); |
| 78 | 77 | ||
| 79 | this.inner | 78 | this.inner |
| 80 | .set_output_compare_mode(Channel::Ch1, OutputCompareMode::PwmMode1); | 79 | .set_output_compare_mode(Channel::Ch1, OutputCompareMode::PwmMode1); |
| @@ -129,6 +128,46 @@ impl<'d, T: ComplementaryCaptureCompare16bitInstance> ComplementaryPwm<'d, T> { | |||
| 129 | } | 128 | } |
| 130 | } | 129 | } |
| 131 | 130 | ||
| 131 | impl<'d, T: ComplementaryCaptureCompare16bitInstance> embedded_hal_02::Pwm for ComplementaryPwm<'d, T> { | ||
| 132 | type Channel = Channel; | ||
| 133 | type Time = Hertz; | ||
| 134 | type Duty = u16; | ||
| 135 | |||
| 136 | fn disable(&mut self, channel: Self::Channel) { | ||
| 137 | self.inner.enable_complementary_channel(channel, false); | ||
| 138 | self.inner.enable_channel(channel, false); | ||
| 139 | } | ||
| 140 | |||
| 141 | fn enable(&mut self, channel: Self::Channel) { | ||
| 142 | self.inner.enable_channel(channel, true); | ||
| 143 | self.inner.enable_complementary_channel(channel, true); | ||
| 144 | } | ||
| 145 | |||
| 146 | fn get_period(&self) -> Self::Time { | ||
| 147 | self.inner.get_frequency().into() | ||
| 148 | } | ||
| 149 | |||
| 150 | fn get_duty(&self, channel: Self::Channel) -> Self::Duty { | ||
| 151 | self.inner.get_compare_value(channel) | ||
| 152 | } | ||
| 153 | |||
| 154 | fn get_max_duty(&self) -> Self::Duty { | ||
| 155 | self.inner.get_max_compare_value() + 1 | ||
| 156 | } | ||
| 157 | |||
| 158 | fn set_duty(&mut self, channel: Self::Channel, duty: Self::Duty) { | ||
| 159 | assert!(duty <= self.get_max_duty()); | ||
| 160 | self.inner.set_compare_value(channel, duty) | ||
| 161 | } | ||
| 162 | |||
| 163 | fn set_period<P>(&mut self, period: P) | ||
| 164 | where | ||
| 165 | P: Into<Self::Time>, | ||
| 166 | { | ||
| 167 | self.inner.set_frequency(period.into()); | ||
| 168 | } | ||
| 169 | } | ||
| 170 | |||
| 132 | fn compute_dead_time_value(value: u16) -> (Ckd, u8) { | 171 | fn compute_dead_time_value(value: u16) -> (Ckd, u8) { |
| 133 | /* | 172 | /* |
| 134 | Dead-time = T_clk * T_dts * T_dtg | 173 | Dead-time = T_clk * T_dts * T_dtg |
diff --git a/embassy-stm32/src/timer/mod.rs b/embassy-stm32/src/timer/mod.rs index 15eaf3536..913bfed2b 100644 --- a/embassy-stm32/src/timer/mod.rs +++ b/embassy-stm32/src/timer/mod.rs | |||
| @@ -77,6 +77,16 @@ pub(crate) mod sealed { | |||
| 77 | fn set_autoreload_preload(&mut self, enable: vals::Arpe) { | 77 | fn set_autoreload_preload(&mut self, enable: vals::Arpe) { |
| 78 | Self::regs().cr1().modify(|r| r.set_arpe(enable)); | 78 | Self::regs().cr1().modify(|r| r.set_arpe(enable)); |
| 79 | } | 79 | } |
| 80 | |||
| 81 | fn get_frequency(&self) -> Hertz { | ||
| 82 | let timer_f = Self::frequency(); | ||
| 83 | |||
| 84 | let regs = Self::regs(); | ||
| 85 | let arr = regs.arr().read().arr(); | ||
| 86 | let psc = regs.psc().read().psc(); | ||
| 87 | |||
| 88 | timer_f / arr / (psc + 1) | ||
| 89 | } | ||
| 80 | } | 90 | } |
| 81 | 91 | ||
| 82 | pub trait GeneralPurpose16bitInstance: Basic16bitInstance { | 92 | pub trait GeneralPurpose16bitInstance: Basic16bitInstance { |
| @@ -123,6 +133,16 @@ pub(crate) mod sealed { | |||
| 123 | regs.egr().write(|r| r.set_ug(true)); | 133 | regs.egr().write(|r| r.set_ug(true)); |
| 124 | regs.cr1().modify(|r| r.set_urs(vals::Urs::ANYEVENT)); | 134 | regs.cr1().modify(|r| r.set_urs(vals::Urs::ANYEVENT)); |
| 125 | } | 135 | } |
| 136 | |||
| 137 | fn get_frequency(&self) -> Hertz { | ||
| 138 | let timer_f = Self::frequency(); | ||
| 139 | |||
| 140 | let regs = Self::regs_gp32(); | ||
| 141 | let arr = regs.arr().read().arr(); | ||
| 142 | let psc = regs.psc().read().psc(); | ||
| 143 | |||
| 144 | timer_f / arr / (psc + 1) | ||
| 145 | } | ||
| 126 | } | 146 | } |
| 127 | 147 | ||
| 128 | pub trait AdvancedControlInstance: GeneralPurpose16bitInstance { | 148 | pub trait AdvancedControlInstance: GeneralPurpose16bitInstance { |
| @@ -173,7 +193,7 @@ pub(crate) mod sealed { | |||
| 173 | } | 193 | } |
| 174 | }); | 194 | }); |
| 175 | } | 195 | } |
| 176 | fn enable_outputs(&mut self, _enable: bool) {} | 196 | fn enable_outputs(&mut self); |
| 177 | 197 | ||
| 178 | fn set_output_compare_mode(&mut self, channel: Channel, mode: OutputCompareMode) { | 198 | fn set_output_compare_mode(&mut self, channel: Channel, mode: OutputCompareMode) { |
| 179 | let r = Self::regs_gp16(); | 199 | let r = Self::regs_gp16(); |
| @@ -203,6 +223,10 @@ pub(crate) mod sealed { | |||
| 203 | fn get_max_compare_value(&self) -> u16 { | 223 | fn get_max_compare_value(&self) -> u16 { |
| 204 | Self::regs_gp16().arr().read().arr() | 224 | Self::regs_gp16().arr().read().arr() |
| 205 | } | 225 | } |
| 226 | |||
| 227 | fn get_compare_value(&self, channel: Channel) -> u16 { | ||
| 228 | Self::regs_gp16().ccr(channel.raw()).read().ccr() | ||
| 229 | } | ||
| 206 | } | 230 | } |
| 207 | 231 | ||
| 208 | pub trait ComplementaryCaptureCompare16bitInstance: CaptureCompare16bitInstance + AdvancedControlInstance { | 232 | pub trait ComplementaryCaptureCompare16bitInstance: CaptureCompare16bitInstance + AdvancedControlInstance { |
| @@ -239,6 +263,10 @@ pub(crate) mod sealed { | |||
| 239 | fn get_max_compare_value(&self) -> u32 { | 263 | fn get_max_compare_value(&self) -> u32 { |
| 240 | Self::regs_gp32().arr().read().arr() | 264 | Self::regs_gp32().arr().read().arr() |
| 241 | } | 265 | } |
| 266 | |||
| 267 | fn get_compare_value(&self, channel: Channel) -> u32 { | ||
| 268 | Self::regs_gp32().ccr(channel.raw()).read().ccr() | ||
| 269 | } | ||
| 242 | } | 270 | } |
| 243 | } | 271 | } |
| 244 | 272 | ||
| @@ -460,7 +488,9 @@ macro_rules! impl_32bit_timer { | |||
| 460 | #[allow(unused)] | 488 | #[allow(unused)] |
| 461 | macro_rules! impl_compare_capable_16bit { | 489 | macro_rules! impl_compare_capable_16bit { |
| 462 | ($inst:ident) => { | 490 | ($inst:ident) => { |
| 463 | impl sealed::CaptureCompare16bitInstance for crate::peripherals::$inst {} | 491 | impl sealed::CaptureCompare16bitInstance for crate::peripherals::$inst { |
| 492 | fn enable_outputs(&mut self) {} | ||
| 493 | } | ||
| 464 | }; | 494 | }; |
| 465 | } | 495 | } |
| 466 | 496 | ||
| @@ -509,7 +539,13 @@ foreach_interrupt! { | |||
| 509 | impl CaptureCompare16bitInstance for crate::peripherals::$inst {} | 539 | impl CaptureCompare16bitInstance for crate::peripherals::$inst {} |
| 510 | impl ComplementaryCaptureCompare16bitInstance for crate::peripherals::$inst {} | 540 | impl ComplementaryCaptureCompare16bitInstance for crate::peripherals::$inst {} |
| 511 | impl AdvancedControlInstance for crate::peripherals::$inst {} | 541 | impl AdvancedControlInstance for crate::peripherals::$inst {} |
| 512 | impl sealed::CaptureCompare16bitInstance for crate::peripherals::$inst {} | 542 | impl sealed::CaptureCompare16bitInstance for crate::peripherals::$inst { |
| 543 | fn enable_outputs(&mut self) { | ||
| 544 | use crate::timer::sealed::AdvancedControlInstance; | ||
| 545 | let r = Self::regs_advanced(); | ||
| 546 | r.bdtr().modify(|w| w.set_moe(true)); | ||
| 547 | } | ||
| 548 | } | ||
| 513 | impl sealed::ComplementaryCaptureCompare16bitInstance for crate::peripherals::$inst {} | 549 | impl sealed::ComplementaryCaptureCompare16bitInstance for crate::peripherals::$inst {} |
| 514 | impl sealed::GeneralPurpose16bitInstance for crate::peripherals::$inst { | 550 | impl sealed::GeneralPurpose16bitInstance for crate::peripherals::$inst { |
| 515 | fn regs_gp16() -> crate::pac::timer::TimGp16 { | 551 | fn regs_gp16() -> crate::pac::timer::TimGp16 { |
diff --git a/embassy-stm32/src/timer/qei.rs b/embassy-stm32/src/timer/qei.rs index 15f2c3a79..01d028bf9 100644 --- a/embassy-stm32/src/timer/qei.rs +++ b/embassy-stm32/src/timer/qei.rs | |||
| @@ -55,8 +55,7 @@ impl<'d, T: CaptureCompare16bitInstance> Qei<'d, T> { | |||
| 55 | fn new_inner(tim: impl Peripheral<P = T> + 'd) -> Self { | 55 | fn new_inner(tim: impl Peripheral<P = T> + 'd) -> Self { |
| 56 | into_ref!(tim); | 56 | into_ref!(tim); |
| 57 | 57 | ||
| 58 | T::enable(); | 58 | T::enable_and_reset(); |
| 59 | <T as crate::rcc::sealed::RccPeripheral>::reset(); | ||
| 60 | 59 | ||
| 61 | // Configure TxC1 and TxC2 as captures | 60 | // Configure TxC1 and TxC2 as captures |
| 62 | T::regs_gp16().ccmr_input(0).modify(|w| { | 61 | T::regs_gp16().ccmr_input(0).modify(|w| { |
diff --git a/embassy-stm32/src/timer/simple_pwm.rs b/embassy-stm32/src/timer/simple_pwm.rs index b54f8cb07..1cf0ad728 100644 --- a/embassy-stm32/src/timer/simple_pwm.rs +++ b/embassy-stm32/src/timer/simple_pwm.rs | |||
| @@ -64,8 +64,7 @@ impl<'d, T: CaptureCompare16bitInstance> SimplePwm<'d, T> { | |||
| 64 | fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self { | 64 | fn new_inner(tim: impl Peripheral<P = T> + 'd, freq: Hertz, counting_mode: CountingMode) -> Self { |
| 65 | into_ref!(tim); | 65 | into_ref!(tim); |
| 66 | 66 | ||
| 67 | T::enable(); | 67 | T::enable_and_reset(); |
| 68 | <T as crate::rcc::sealed::RccPeripheral>::reset(); | ||
| 69 | 68 | ||
| 70 | let mut this = Self { inner: tim }; | 69 | let mut this = Self { inner: tim }; |
| 71 | 70 | ||
| @@ -73,7 +72,7 @@ impl<'d, T: CaptureCompare16bitInstance> SimplePwm<'d, T> { | |||
| 73 | this.set_freq(freq); | 72 | this.set_freq(freq); |
| 74 | this.inner.start(); | 73 | this.inner.start(); |
| 75 | 74 | ||
| 76 | this.inner.enable_outputs(true); | 75 | this.inner.enable_outputs(); |
| 77 | 76 | ||
| 78 | this.inner | 77 | this.inner |
| 79 | .set_output_compare_mode(Channel::Ch1, OutputCompareMode::PwmMode1); | 78 | .set_output_compare_mode(Channel::Ch1, OutputCompareMode::PwmMode1); |
| @@ -116,3 +115,41 @@ impl<'d, T: CaptureCompare16bitInstance> SimplePwm<'d, T> { | |||
| 116 | self.inner.set_output_polarity(channel, polarity); | 115 | self.inner.set_output_polarity(channel, polarity); |
| 117 | } | 116 | } |
| 118 | } | 117 | } |
| 118 | |||
| 119 | impl<'d, T: CaptureCompare16bitInstance> embedded_hal_02::Pwm for SimplePwm<'d, T> { | ||
| 120 | type Channel = Channel; | ||
| 121 | type Time = Hertz; | ||
| 122 | type Duty = u16; | ||
| 123 | |||
| 124 | fn disable(&mut self, channel: Self::Channel) { | ||
| 125 | self.inner.enable_channel(channel, false); | ||
| 126 | } | ||
| 127 | |||
| 128 | fn enable(&mut self, channel: Self::Channel) { | ||
| 129 | self.inner.enable_channel(channel, true); | ||
| 130 | } | ||
| 131 | |||
| 132 | fn get_period(&self) -> Self::Time { | ||
| 133 | self.inner.get_frequency().into() | ||
| 134 | } | ||
| 135 | |||
| 136 | fn get_duty(&self, channel: Self::Channel) -> Self::Duty { | ||
| 137 | self.inner.get_compare_value(channel) | ||
| 138 | } | ||
| 139 | |||
| 140 | fn get_max_duty(&self) -> Self::Duty { | ||
| 141 | self.inner.get_max_compare_value() + 1 | ||
| 142 | } | ||
| 143 | |||
| 144 | fn set_duty(&mut self, channel: Self::Channel, duty: Self::Duty) { | ||
| 145 | assert!(duty <= self.get_max_duty()); | ||
| 146 | self.inner.set_compare_value(channel, duty) | ||
| 147 | } | ||
| 148 | |||
| 149 | fn set_period<P>(&mut self, period: P) | ||
| 150 | where | ||
| 151 | P: Into<Self::Time>, | ||
| 152 | { | ||
| 153 | self.inner.set_frequency(period.into()); | ||
| 154 | } | ||
| 155 | } | ||
diff --git a/embassy-stm32/src/usart/buffered.rs b/embassy-stm32/src/usart/buffered.rs index e2d6e42af..cbc13a342 100644 --- a/embassy-stm32/src/usart/buffered.rs +++ b/embassy-stm32/src/usart/buffered.rs | |||
| @@ -116,25 +116,28 @@ pub struct BufferedUartRx<'d, T: BasicInstance> { | |||
| 116 | 116 | ||
| 117 | impl<'d, T: BasicInstance> SetConfig for BufferedUart<'d, T> { | 117 | impl<'d, T: BasicInstance> SetConfig for BufferedUart<'d, T> { |
| 118 | type Config = Config; | 118 | type Config = Config; |
| 119 | type ConfigError = (); | ||
| 119 | 120 | ||
| 120 | fn set_config(&mut self, config: &Self::Config) { | 121 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 121 | unwrap!(self.set_config(config)) | 122 | self.set_config(config).map_err(|_| ()) |
| 122 | } | 123 | } |
| 123 | } | 124 | } |
| 124 | 125 | ||
| 125 | impl<'d, T: BasicInstance> SetConfig for BufferedUartRx<'d, T> { | 126 | impl<'d, T: BasicInstance> SetConfig for BufferedUartRx<'d, T> { |
| 126 | type Config = Config; | 127 | type Config = Config; |
| 128 | type ConfigError = (); | ||
| 127 | 129 | ||
| 128 | fn set_config(&mut self, config: &Self::Config) { | 130 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 129 | unwrap!(self.set_config(config)) | 131 | self.set_config(config).map_err(|_| ()) |
| 130 | } | 132 | } |
| 131 | } | 133 | } |
| 132 | 134 | ||
| 133 | impl<'d, T: BasicInstance> SetConfig for BufferedUartTx<'d, T> { | 135 | impl<'d, T: BasicInstance> SetConfig for BufferedUartTx<'d, T> { |
| 134 | type Config = Config; | 136 | type Config = Config; |
| 137 | type ConfigError = (); | ||
| 135 | 138 | ||
| 136 | fn set_config(&mut self, config: &Self::Config) { | 139 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 137 | unwrap!(self.set_config(config)) | 140 | self.set_config(config).map_err(|_| ()) |
| 138 | } | 141 | } |
| 139 | } | 142 | } |
| 140 | 143 | ||
| @@ -149,9 +152,8 @@ impl<'d, T: BasicInstance> BufferedUart<'d, T> { | |||
| 149 | config: Config, | 152 | config: Config, |
| 150 | ) -> Result<Self, ConfigError> { | 153 | ) -> Result<Self, ConfigError> { |
| 151 | // UartRx and UartTx have one refcount ea. | 154 | // UartRx and UartTx have one refcount ea. |
| 152 | T::enable(); | 155 | T::enable_and_reset(); |
| 153 | T::enable(); | 156 | T::enable_and_reset(); |
| 154 | T::reset(); | ||
| 155 | 157 | ||
| 156 | Self::new_inner(peri, rx, tx, tx_buffer, rx_buffer, config) | 158 | Self::new_inner(peri, rx, tx, tx_buffer, rx_buffer, config) |
| 157 | } | 159 | } |
| @@ -170,9 +172,8 @@ impl<'d, T: BasicInstance> BufferedUart<'d, T> { | |||
| 170 | into_ref!(cts, rts); | 172 | into_ref!(cts, rts); |
| 171 | 173 | ||
| 172 | // UartRx and UartTx have one refcount ea. | 174 | // UartRx and UartTx have one refcount ea. |
| 173 | T::enable(); | 175 | T::enable_and_reset(); |
| 174 | T::enable(); | 176 | T::enable_and_reset(); |
| 175 | T::reset(); | ||
| 176 | 177 | ||
| 177 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); | 178 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); |
| 178 | cts.set_as_af(cts.af_num(), AFType::Input); | 179 | cts.set_as_af(cts.af_num(), AFType::Input); |
| @@ -198,9 +199,8 @@ impl<'d, T: BasicInstance> BufferedUart<'d, T> { | |||
| 198 | into_ref!(de); | 199 | into_ref!(de); |
| 199 | 200 | ||
| 200 | // UartRx and UartTx have one refcount ea. | 201 | // UartRx and UartTx have one refcount ea. |
| 201 | T::enable(); | 202 | T::enable_and_reset(); |
| 202 | T::enable(); | 203 | T::enable_and_reset(); |
| 203 | T::reset(); | ||
| 204 | 204 | ||
| 205 | de.set_as_af(de.af_num(), AFType::OutputPushPull); | 205 | de.set_as_af(de.af_num(), AFType::OutputPushPull); |
| 206 | T::regs().cr3().write(|w| { | 206 | T::regs().cr3().write(|w| { |
diff --git a/embassy-stm32/src/usart/mod.rs b/embassy-stm32/src/usart/mod.rs index 9835f1ace..880ca4162 100644 --- a/embassy-stm32/src/usart/mod.rs +++ b/embassy-stm32/src/usart/mod.rs | |||
| @@ -181,10 +181,11 @@ pub struct Uart<'d, T: BasicInstance, TxDma = NoDma, RxDma = NoDma> { | |||
| 181 | 181 | ||
| 182 | impl<'d, T: BasicInstance, TxDma, RxDma> SetConfig for Uart<'d, T, TxDma, RxDma> { | 182 | impl<'d, T: BasicInstance, TxDma, RxDma> SetConfig for Uart<'d, T, TxDma, RxDma> { |
| 183 | type Config = Config; | 183 | type Config = Config; |
| 184 | type ConfigError = (); | ||
| 184 | 185 | ||
| 185 | fn set_config(&mut self, config: &Self::Config) { | 186 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 186 | unwrap!(self.tx.set_config(config)); | 187 | self.tx.set_config(config).map_err(|_| ())?; |
| 187 | unwrap!(self.rx.set_config(config)); | 188 | self.rx.set_config(config).map_err(|_| ()) |
| 188 | } | 189 | } |
| 189 | } | 190 | } |
| 190 | 191 | ||
| @@ -195,9 +196,10 @@ pub struct UartTx<'d, T: BasicInstance, TxDma = NoDma> { | |||
| 195 | 196 | ||
| 196 | impl<'d, T: BasicInstance, TxDma> SetConfig for UartTx<'d, T, TxDma> { | 197 | impl<'d, T: BasicInstance, TxDma> SetConfig for UartTx<'d, T, TxDma> { |
| 197 | type Config = Config; | 198 | type Config = Config; |
| 199 | type ConfigError = (); | ||
| 198 | 200 | ||
| 199 | fn set_config(&mut self, config: &Self::Config) { | 201 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 200 | unwrap!(self.set_config(config)); | 202 | self.set_config(config).map_err(|_| ()) |
| 201 | } | 203 | } |
| 202 | } | 204 | } |
| 203 | 205 | ||
| @@ -211,9 +213,10 @@ pub struct UartRx<'d, T: BasicInstance, RxDma = NoDma> { | |||
| 211 | 213 | ||
| 212 | impl<'d, T: BasicInstance, RxDma> SetConfig for UartRx<'d, T, RxDma> { | 214 | impl<'d, T: BasicInstance, RxDma> SetConfig for UartRx<'d, T, RxDma> { |
| 213 | type Config = Config; | 215 | type Config = Config; |
| 216 | type ConfigError = (); | ||
| 214 | 217 | ||
| 215 | fn set_config(&mut self, config: &Self::Config) { | 218 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 216 | unwrap!(self.set_config(config)); | 219 | self.set_config(config).map_err(|_| ()) |
| 217 | } | 220 | } |
| 218 | } | 221 | } |
| 219 | 222 | ||
| @@ -225,8 +228,7 @@ impl<'d, T: BasicInstance, TxDma> UartTx<'d, T, TxDma> { | |||
| 225 | tx_dma: impl Peripheral<P = TxDma> + 'd, | 228 | tx_dma: impl Peripheral<P = TxDma> + 'd, |
| 226 | config: Config, | 229 | config: Config, |
| 227 | ) -> Result<Self, ConfigError> { | 230 | ) -> Result<Self, ConfigError> { |
| 228 | T::enable(); | 231 | T::enable_and_reset(); |
| 229 | T::reset(); | ||
| 230 | 232 | ||
| 231 | Self::new_inner(peri, tx, tx_dma, config) | 233 | Self::new_inner(peri, tx, tx_dma, config) |
| 232 | } | 234 | } |
| @@ -240,8 +242,7 @@ impl<'d, T: BasicInstance, TxDma> UartTx<'d, T, TxDma> { | |||
| 240 | ) -> Result<Self, ConfigError> { | 242 | ) -> Result<Self, ConfigError> { |
| 241 | into_ref!(cts); | 243 | into_ref!(cts); |
| 242 | 244 | ||
| 243 | T::enable(); | 245 | T::enable_and_reset(); |
| 244 | T::reset(); | ||
| 245 | 246 | ||
| 246 | cts.set_as_af(cts.af_num(), AFType::Input); | 247 | cts.set_as_af(cts.af_num(), AFType::Input); |
| 247 | T::regs().cr3().write(|w| { | 248 | T::regs().cr3().write(|w| { |
| @@ -318,8 +319,7 @@ impl<'d, T: BasicInstance, RxDma> UartRx<'d, T, RxDma> { | |||
| 318 | rx_dma: impl Peripheral<P = RxDma> + 'd, | 319 | rx_dma: impl Peripheral<P = RxDma> + 'd, |
| 319 | config: Config, | 320 | config: Config, |
| 320 | ) -> Result<Self, ConfigError> { | 321 | ) -> Result<Self, ConfigError> { |
| 321 | T::enable(); | 322 | T::enable_and_reset(); |
| 322 | T::reset(); | ||
| 323 | 323 | ||
| 324 | Self::new_inner(peri, rx, rx_dma, config) | 324 | Self::new_inner(peri, rx, rx_dma, config) |
| 325 | } | 325 | } |
| @@ -334,8 +334,7 @@ impl<'d, T: BasicInstance, RxDma> UartRx<'d, T, RxDma> { | |||
| 334 | ) -> Result<Self, ConfigError> { | 334 | ) -> Result<Self, ConfigError> { |
| 335 | into_ref!(rts); | 335 | into_ref!(rts); |
| 336 | 336 | ||
| 337 | T::enable(); | 337 | T::enable_and_reset(); |
| 338 | T::reset(); | ||
| 339 | 338 | ||
| 340 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); | 339 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); |
| 341 | T::regs().cr3().write(|w| { | 340 | T::regs().cr3().write(|w| { |
| @@ -692,9 +691,8 @@ impl<'d, T: BasicInstance, TxDma, RxDma> Uart<'d, T, TxDma, RxDma> { | |||
| 692 | config: Config, | 691 | config: Config, |
| 693 | ) -> Result<Self, ConfigError> { | 692 | ) -> Result<Self, ConfigError> { |
| 694 | // UartRx and UartTx have one refcount ea. | 693 | // UartRx and UartTx have one refcount ea. |
| 695 | T::enable(); | 694 | T::enable_and_reset(); |
| 696 | T::enable(); | 695 | T::enable_and_reset(); |
| 697 | T::reset(); | ||
| 698 | 696 | ||
| 699 | Self::new_inner(peri, rx, tx, tx_dma, rx_dma, config) | 697 | Self::new_inner(peri, rx, tx, tx_dma, rx_dma, config) |
| 700 | } | 698 | } |
| @@ -713,9 +711,8 @@ impl<'d, T: BasicInstance, TxDma, RxDma> Uart<'d, T, TxDma, RxDma> { | |||
| 713 | into_ref!(cts, rts); | 711 | into_ref!(cts, rts); |
| 714 | 712 | ||
| 715 | // UartRx and UartTx have one refcount ea. | 713 | // UartRx and UartTx have one refcount ea. |
| 716 | T::enable(); | 714 | T::enable_and_reset(); |
| 717 | T::enable(); | 715 | T::enable_and_reset(); |
| 718 | T::reset(); | ||
| 719 | 716 | ||
| 720 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); | 717 | rts.set_as_af(rts.af_num(), AFType::OutputPushPull); |
| 721 | cts.set_as_af(cts.af_num(), AFType::Input); | 718 | cts.set_as_af(cts.af_num(), AFType::Input); |
| @@ -740,9 +737,8 @@ impl<'d, T: BasicInstance, TxDma, RxDma> Uart<'d, T, TxDma, RxDma> { | |||
| 740 | into_ref!(de); | 737 | into_ref!(de); |
| 741 | 738 | ||
| 742 | // UartRx and UartTx have one refcount ea. | 739 | // UartRx and UartTx have one refcount ea. |
| 743 | T::enable(); | 740 | T::enable_and_reset(); |
| 744 | T::enable(); | 741 | T::enable_and_reset(); |
| 745 | T::reset(); | ||
| 746 | 742 | ||
| 747 | de.set_as_af(de.af_num(), AFType::OutputPushPull); | 743 | de.set_as_af(de.af_num(), AFType::OutputPushPull); |
| 748 | T::regs().cr3().write(|w| { | 744 | T::regs().cr3().write(|w| { |
| @@ -803,10 +799,6 @@ impl<'d, T: BasicInstance, TxDma, RxDma> Uart<'d, T, TxDma, RxDma> { | |||
| 803 | }) | 799 | }) |
| 804 | } | 800 | } |
| 805 | 801 | ||
| 806 | pub fn set_config(&mut self, config: &Config) -> Result<(), ConfigError> { | ||
| 807 | reconfigure::<T>(config) | ||
| 808 | } | ||
| 809 | |||
| 810 | pub async fn write(&mut self, buffer: &[u8]) -> Result<(), Error> | 802 | pub async fn write(&mut self, buffer: &[u8]) -> Result<(), Error> |
| 811 | where | 803 | where |
| 812 | TxDma: crate::usart::TxDma<T>, | 804 | TxDma: crate::usart::TxDma<T>, |
diff --git a/embassy-stm32/src/usart/ringbuffered.rs b/embassy-stm32/src/usart/ringbuffered.rs index 347aae7c9..55489f2e0 100644 --- a/embassy-stm32/src/usart/ringbuffered.rs +++ b/embassy-stm32/src/usart/ringbuffered.rs | |||
| @@ -18,9 +18,10 @@ pub struct RingBufferedUartRx<'d, T: BasicInstance, RxDma: super::RxDma<T>> { | |||
| 18 | 18 | ||
| 19 | impl<'d, T: BasicInstance, RxDma: super::RxDma<T>> SetConfig for RingBufferedUartRx<'d, T, RxDma> { | 19 | impl<'d, T: BasicInstance, RxDma: super::RxDma<T>> SetConfig for RingBufferedUartRx<'d, T, RxDma> { |
| 20 | type Config = Config; | 20 | type Config = Config; |
| 21 | type ConfigError = (); | ||
| 21 | 22 | ||
| 22 | fn set_config(&mut self, config: &Self::Config) { | 23 | fn set_config(&mut self, config: &Self::Config) -> Result<(), ()> { |
| 23 | unwrap!(self.set_config(config)); | 24 | self.set_config(config).map_err(|_| ()) |
| 24 | } | 25 | } |
| 25 | } | 26 | } |
| 26 | 27 | ||
diff --git a/embassy-stm32/src/usb/usb.rs b/embassy-stm32/src/usb/usb.rs index b24fc74eb..9269ddd88 100644 --- a/embassy-stm32/src/usb/usb.rs +++ b/embassy-stm32/src/usb/usb.rs | |||
| @@ -269,8 +269,7 @@ impl<'d, T: Instance> Driver<'d, T> { | |||
| 269 | #[cfg(pwr_h5)] | 269 | #[cfg(pwr_h5)] |
| 270 | crate::pac::PWR.usbscr().modify(|w| w.set_usb33sv(true)); | 270 | crate::pac::PWR.usbscr().modify(|w| w.set_usb33sv(true)); |
| 271 | 271 | ||
| 272 | <T as RccPeripheral>::enable(); | 272 | <T as RccPeripheral>::enable_and_reset(); |
| 273 | <T as RccPeripheral>::reset(); | ||
| 274 | 273 | ||
| 275 | regs.cntr().write(|w| { | 274 | regs.cntr().write(|w| { |
| 276 | w.set_pdwn(false); | 275 | w.set_pdwn(false); |
diff --git a/embassy-stm32/src/usb_otg/usb.rs b/embassy-stm32/src/usb_otg/usb.rs index 1fe010bbb..e45e4ac43 100644 --- a/embassy-stm32/src/usb_otg/usb.rs +++ b/embassy-stm32/src/usb_otg/usb.rs | |||
| @@ -632,8 +632,7 @@ impl<'d, T: Instance> Bus<'d, T> { | |||
| 632 | }); | 632 | }); |
| 633 | } | 633 | } |
| 634 | 634 | ||
| 635 | <T as RccPeripheral>::enable(); | 635 | <T as RccPeripheral>::enable_and_reset(); |
| 636 | <T as RccPeripheral>::reset(); | ||
| 637 | 636 | ||
| 638 | T::Interrupt::unpend(); | 637 | T::Interrupt::unpend(); |
| 639 | unsafe { T::Interrupt::enable() }; | 638 | unsafe { T::Interrupt::enable() }; |
diff --git a/embassy-sync/Cargo.toml b/embassy-sync/Cargo.toml index f7739f305..7d3d2c589 100644 --- a/embassy-sync/Cargo.toml +++ b/embassy-sync/Cargo.toml | |||
| @@ -35,7 +35,7 @@ futures-util = { version = "0.3.17", default-features = false } | |||
| 35 | critical-section = "1.1" | 35 | critical-section = "1.1" |
| 36 | heapless = "0.7.5" | 36 | heapless = "0.7.5" |
| 37 | cfg-if = "1.0.0" | 37 | cfg-if = "1.0.0" |
| 38 | embedded-io-async = { version = "0.5.0", optional = true } | 38 | embedded-io-async = { version = "0.6.0", optional = true } |
| 39 | 39 | ||
| 40 | [dev-dependencies] | 40 | [dev-dependencies] |
| 41 | futures-executor = { version = "0.3.17", features = [ "thread-pool" ] } | 41 | futures-executor = { version = "0.3.17", features = [ "thread-pool" ] } |
diff --git a/embassy-sync/src/lib.rs b/embassy-sync/src/lib.rs index 8a9f841ee..aca6ff38f 100644 --- a/embassy-sync/src/lib.rs +++ b/embassy-sync/src/lib.rs | |||
| @@ -1,5 +1,5 @@ | |||
| 1 | #![cfg_attr(not(any(feature = "std", feature = "wasm")), no_std)] | 1 | #![cfg_attr(not(any(feature = "std", feature = "wasm")), no_std)] |
| 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait, impl_trait_projections))] | 2 | #![cfg_attr(feature = "nightly", feature(async_fn_in_trait))] |
| 3 | #![allow(clippy::new_without_default)] | 3 | #![allow(clippy::new_without_default)] |
| 4 | #![doc = include_str!("../README.md")] | 4 | #![doc = include_str!("../README.md")] |
| 5 | #![warn(missing_docs)] | 5 | #![warn(missing_docs)] |
diff --git a/embassy-time/CHANGELOG.md b/embassy-time/CHANGELOG.md index e3b38455c..6e79addf6 100644 --- a/embassy-time/CHANGELOG.md +++ b/embassy-time/CHANGELOG.md | |||
| @@ -5,7 +5,14 @@ All notable changes to this project will be documented in this file. | |||
| 5 | The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), | 5 | The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), |
| 6 | and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). | 6 | and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). |
| 7 | 7 | ||
| 8 | ## 0.1.4 - ??? | 8 | ## 0.1.5 - 2023-10-16 |
| 9 | |||
| 10 | - Added `links` key to Cargo.toml, to prevent multiple copies of this crate in the same binary. | ||
| 11 | Needed because different copies might get different tick rates, causing | ||
| 12 | wrong delays if the time driver is using one copy and user code is using another. | ||
| 13 | This is especially common when mixing crates from crates.io and git. | ||
| 14 | |||
| 15 | ## 0.1.4 - 2023-10-12 | ||
| 9 | 16 | ||
| 10 | - Added more tick rates | 17 | - Added more tick rates |
| 11 | 18 | ||
diff --git a/embassy-time/Cargo.toml b/embassy-time/Cargo.toml index 8f034a9de..87b57d1e1 100644 --- a/embassy-time/Cargo.toml +++ b/embassy-time/Cargo.toml | |||
| @@ -1,6 +1,6 @@ | |||
| 1 | [package] | 1 | [package] |
| 2 | name = "embassy-time" | 2 | name = "embassy-time" |
| 3 | version = "0.1.4" | 3 | version = "0.1.5" |
| 4 | edition = "2021" | 4 | edition = "2021" |
| 5 | description = "Instant and Duration for embedded no-std systems, with async timer support" | 5 | description = "Instant and Duration for embedded no-std systems, with async timer support" |
| 6 | repository = "https://github.com/embassy-rs/embassy" | 6 | repository = "https://github.com/embassy-rs/embassy" |
| @@ -13,6 +13,12 @@ categories = [ | |||
| 13 | "asynchronous", | 13 | "asynchronous", |
| 14 | ] | 14 | ] |
| 15 | 15 | ||
| 16 | # Prevent multiple copies of this crate in the same binary. | ||
| 17 | # Needed because different copies might get different tick rates, causing | ||
| 18 | # wrong delays if the time driver is using one copy and user code is using another. | ||
| 19 | # This is especially common when mixing crates from crates.io and git. | ||
| 20 | links = "embassy-time" | ||
| 21 | |||
| 16 | [package.metadata.embassy_docs] | 22 | [package.metadata.embassy_docs] |
| 17 | src_base = "https://github.com/embassy-rs/embassy/blob/embassy-time-v$VERSION/embassy-time/src/" | 23 | src_base = "https://github.com/embassy-rs/embassy/blob/embassy-time-v$VERSION/embassy-time/src/" |
| 18 | src_base_git = "https://github.com/embassy-rs/embassy/blob/$COMMIT/embassy-time/src/" | 24 | src_base_git = "https://github.com/embassy-rs/embassy/blob/$COMMIT/embassy-time/src/" |
| @@ -218,7 +224,6 @@ embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1", optional = | |||
| 218 | embedded-hal-async = { version = "=1.0.0-rc.1", optional = true} | 224 | embedded-hal-async = { version = "=1.0.0-rc.1", optional = true} |
| 219 | 225 | ||
| 220 | futures-util = { version = "0.3.17", default-features = false } | 226 | futures-util = { version = "0.3.17", default-features = false } |
| 221 | atomic-polyfill = "1.0.1" | ||
| 222 | critical-section = "1.1" | 227 | critical-section = "1.1" |
| 223 | cfg-if = "1.0.0" | 228 | cfg-if = "1.0.0" |
| 224 | heapless = "0.7" | 229 | heapless = "0.7" |
diff --git a/embassy-time/build.rs b/embassy-time/build.rs new file mode 100644 index 000000000..5b0095661 --- /dev/null +++ b/embassy-time/build.rs | |||
| @@ -0,0 +1,3 @@ | |||
| 1 | // empty, needed to be able to use `links` in Cargo.toml. | ||
| 2 | |||
| 3 | fn main() {} | ||
diff --git a/embassy-time/src/delay.rs b/embassy-time/src/delay.rs index cf1918724..be962747c 100644 --- a/embassy-time/src/delay.rs +++ b/embassy-time/src/delay.rs | |||
| @@ -36,11 +36,11 @@ mod eha { | |||
| 36 | 36 | ||
| 37 | impl embedded_hal_async::delay::DelayUs for Delay { | 37 | impl embedded_hal_async::delay::DelayUs for Delay { |
| 38 | async fn delay_us(&mut self, micros: u32) { | 38 | async fn delay_us(&mut self, micros: u32) { |
| 39 | Timer::after(Duration::from_micros(micros as _)).await | 39 | Timer::after_micros(micros as _).await |
| 40 | } | 40 | } |
| 41 | 41 | ||
| 42 | async fn delay_ms(&mut self, millis: u32) { | 42 | async fn delay_ms(&mut self, millis: u32) { |
| 43 | Timer::after(Duration::from_millis(millis as _)).await | 43 | Timer::after_millis(millis as _).await |
| 44 | } | 44 | } |
| 45 | } | 45 | } |
| 46 | } | 46 | } |
diff --git a/embassy-time/src/timer.rs b/embassy-time/src/timer.rs index 07ddf473f..ee2423daf 100644 --- a/embassy-time/src/timer.rs +++ b/embassy-time/src/timer.rs | |||
| @@ -64,6 +64,42 @@ impl Timer { | |||
| 64 | yielded_once: false, | 64 | yielded_once: false, |
| 65 | } | 65 | } |
| 66 | } | 66 | } |
| 67 | |||
| 68 | /// Expire after the specified number of ticks. | ||
| 69 | /// | ||
| 70 | /// This method is a convenience wrapper for calling `Timer::after(Duration::from_ticks())`. | ||
| 71 | /// For more details, refer to [`Timer::after()`] and [`Duration::from_ticks()`]. | ||
| 72 | #[inline] | ||
| 73 | pub fn after_ticks(ticks: u64) -> Self { | ||
| 74 | Self::after(Duration::from_ticks(ticks)) | ||
| 75 | } | ||
| 76 | |||
| 77 | /// Expire after the specified number of microseconds. | ||
| 78 | /// | ||
| 79 | /// This method is a convenience wrapper for calling `Timer::after(Duration::from_micros())`. | ||
| 80 | /// For more details, refer to [`Timer::after()`] and [`Duration::from_micros()`]. | ||
| 81 | #[inline] | ||
| 82 | pub fn after_micros(micros: u64) -> Self { | ||
| 83 | Self::after(Duration::from_micros(micros)) | ||
| 84 | } | ||
| 85 | |||
| 86 | /// Expire after the specified number of milliseconds. | ||
| 87 | /// | ||
| 88 | /// This method is a convenience wrapper for calling `Timer::after(Duration::from_millis())`. | ||
| 89 | /// For more details, refer to [`Timer::after`] and [`Duration::from_millis()`]. | ||
| 90 | #[inline] | ||
| 91 | pub fn after_millis(millis: u64) -> Self { | ||
| 92 | Self::after(Duration::from_millis(millis)) | ||
| 93 | } | ||
| 94 | |||
| 95 | /// Expire after the specified number of seconds. | ||
| 96 | /// | ||
| 97 | /// This method is a convenience wrapper for calling `Timer::after(Duration::from_secs())`. | ||
| 98 | /// For more details, refer to [`Timer::after`] and [`Duration::from_secs()`]. | ||
| 99 | #[inline] | ||
| 100 | pub fn after_secs(secs: u64) -> Self { | ||
| 101 | Self::after(Duration::from_secs(secs)) | ||
| 102 | } | ||
| 67 | } | 103 | } |
| 68 | 104 | ||
| 69 | impl Unpin for Timer {} | 105 | impl Unpin for Timer {} |
diff --git a/embassy-usb/Cargo.toml b/embassy-usb/Cargo.toml index 0e7e0e708..9ae144992 100644 --- a/embassy-usb/Cargo.toml +++ b/embassy-usb/Cargo.toml | |||
| @@ -42,7 +42,7 @@ max-handler-count-8 = [] | |||
| 42 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } | 42 | embassy-futures = { version = "0.1.0", path = "../embassy-futures" } |
| 43 | embassy-usb-driver = { version = "0.1.0", path = "../embassy-usb-driver" } | 43 | embassy-usb-driver = { version = "0.1.0", path = "../embassy-usb-driver" } |
| 44 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } | 44 | embassy-sync = { version = "0.3.0", path = "../embassy-sync" } |
| 45 | embassy-net-driver-channel = { version = "0.1.0", path = "../embassy-net-driver-channel" } | 45 | embassy-net-driver-channel = { version = "0.2.0", path = "../embassy-net-driver-channel" } |
| 46 | 46 | ||
| 47 | defmt = { version = "0.3", optional = true } | 47 | defmt = { version = "0.3", optional = true } |
| 48 | log = { version = "0.4.14", optional = true } | 48 | log = { version = "0.4.14", optional = true } |
diff --git a/embassy-usb/build.rs b/embassy-usb/build.rs index 33d32f7d3..5e3bec485 100644 --- a/embassy-usb/build.rs +++ b/embassy-usb/build.rs | |||
| @@ -70,9 +70,11 @@ fn main() { | |||
| 70 | 70 | ||
| 71 | // envvars take priority. | 71 | // envvars take priority. |
| 72 | if !cfg.seen_env { | 72 | if !cfg.seen_env { |
| 73 | if cfg.seen_feature { | 73 | assert!( |
| 74 | panic!("multiple values set for feature {}: {} and {}", name, cfg.value, value); | 74 | !cfg.seen_feature, |
| 75 | } | 75 | "multiple values set for feature {}: {} and {}", |
| 76 | name, cfg.value, value | ||
| 77 | ); | ||
| 76 | 78 | ||
| 77 | cfg.value = value; | 79 | cfg.value = value; |
| 78 | cfg.seen_feature = true; | 80 | cfg.seen_feature = true; |
diff --git a/embassy-usb/src/builder.rs b/embassy-usb/src/builder.rs index 6b68bcd7b..b4ddccd71 100644 --- a/embassy-usb/src/builder.rs +++ b/embassy-usb/src/builder.rs | |||
| @@ -1,17 +1,17 @@ | |||
| 1 | use heapless::Vec; | 1 | use heapless::Vec; |
| 2 | 2 | ||
| 3 | use crate::config::*; | 3 | use crate::config::MAX_HANDLER_COUNT; |
| 4 | use crate::descriptor::{BosWriter, DescriptorWriter}; | 4 | use crate::descriptor::{BosWriter, DescriptorWriter}; |
| 5 | use crate::driver::{Driver, Endpoint, EndpointType}; | 5 | use crate::driver::{Driver, Endpoint, EndpointType}; |
| 6 | #[cfg(feature = "msos-descriptor")] | 6 | #[cfg(feature = "msos-descriptor")] |
| 7 | use crate::msos::{DeviceLevelDescriptor, FunctionLevelDescriptor, MsOsDescriptorWriter}; | 7 | use crate::msos::{DeviceLevelDescriptor, FunctionLevelDescriptor, MsOsDescriptorWriter}; |
| 8 | use crate::types::*; | 8 | use crate::types::{InterfaceNumber, StringIndex}; |
| 9 | use crate::{Handler, Interface, UsbDevice, MAX_INTERFACE_COUNT, STRING_INDEX_CUSTOM_START}; | 9 | use crate::{Handler, Interface, UsbDevice, MAX_INTERFACE_COUNT, STRING_INDEX_CUSTOM_START}; |
| 10 | 10 | ||
| 11 | #[derive(Debug, Copy, Clone)] | 11 | #[derive(Debug, Copy, Clone)] |
| 12 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] | 12 | #[cfg_attr(feature = "defmt", derive(defmt::Format))] |
| 13 | #[non_exhaustive] | 13 | #[non_exhaustive] |
| 14 | /// Configuration used when creating [UsbDevice]. | 14 | /// Configuration used when creating [`UsbDevice`]. |
| 15 | pub struct Config<'a> { | 15 | pub struct Config<'a> { |
| 16 | pub(crate) vendor_id: u16, | 16 | pub(crate) vendor_id: u16, |
| 17 | pub(crate) product_id: u16, | 17 | pub(crate) product_id: u16, |
| @@ -99,7 +99,7 @@ pub struct Config<'a> { | |||
| 99 | 99 | ||
| 100 | impl<'a> Config<'a> { | 100 | impl<'a> Config<'a> { |
| 101 | /// Create default configuration with the provided vid and pid values. | 101 | /// Create default configuration with the provided vid and pid values. |
| 102 | pub fn new(vid: u16, pid: u16) -> Self { | 102 | pub const fn new(vid: u16, pid: u16) -> Self { |
| 103 | Self { | 103 | Self { |
| 104 | device_class: 0x00, | 104 | device_class: 0x00, |
| 105 | device_sub_class: 0x00, | 105 | device_sub_class: 0x00, |
| @@ -159,9 +159,10 @@ impl<'d, D: Driver<'d>> Builder<'d, D> { | |||
| 159 | panic!("if composite_with_iads is set, you must set device_class = 0xEF, device_sub_class = 0x02, device_protocol = 0x01"); | 159 | panic!("if composite_with_iads is set, you must set device_class = 0xEF, device_sub_class = 0x02, device_protocol = 0x01"); |
| 160 | } | 160 | } |
| 161 | 161 | ||
| 162 | if config.max_power > 500 { | 162 | assert!( |
| 163 | panic!("The maximum allowed value for `max_power` is 500mA"); | 163 | config.max_power <= 500, |
| 164 | } | 164 | "The maximum allowed value for `max_power` is 500mA" |
| 165 | ); | ||
| 165 | 166 | ||
| 166 | match config.max_packet_size_0 { | 167 | match config.max_packet_size_0 { |
| 167 | 8 | 16 | 32 | 64 => {} | 168 | 8 | 16 | 32 | 64 => {} |
| @@ -260,12 +261,11 @@ impl<'d, D: Driver<'d>> Builder<'d, D> { | |||
| 260 | /// The Handler is called on some USB bus events, and to handle all control requests not already | 261 | /// The Handler is called on some USB bus events, and to handle all control requests not already |
| 261 | /// handled by the USB stack. | 262 | /// handled by the USB stack. |
| 262 | pub fn handler(&mut self, handler: &'d mut dyn Handler) { | 263 | pub fn handler(&mut self, handler: &'d mut dyn Handler) { |
| 263 | if self.handlers.push(handler).is_err() { | 264 | assert!( |
| 264 | panic!( | 265 | self.handlers.push(handler).is_ok(), |
| 265 | "embassy-usb: handler list full. Increase the `max_handler_count` compile-time setting. Current value: {}", | 266 | "embassy-usb: handler list full. Increase the `max_handler_count` compile-time setting. Current value: {}", |
| 266 | MAX_HANDLER_COUNT | 267 | MAX_HANDLER_COUNT |
| 267 | ) | 268 | ); |
| 268 | } | ||
| 269 | } | 269 | } |
| 270 | 270 | ||
| 271 | /// Allocates a new string index. | 271 | /// Allocates a new string index. |
| @@ -332,12 +332,10 @@ impl<'a, 'd, D: Driver<'d>> FunctionBuilder<'a, 'd, D> { | |||
| 332 | num_alt_settings: 0, | 332 | num_alt_settings: 0, |
| 333 | }; | 333 | }; |
| 334 | 334 | ||
| 335 | if self.builder.interfaces.push(iface).is_err() { | 335 | assert!(self.builder.interfaces.push(iface).is_ok(), |
| 336 | panic!( | 336 | "embassy-usb: interface list full. Increase the `max_interface_count` compile-time setting. Current value: {}", |
| 337 | "embassy-usb: interface list full. Increase the `max_interface_count` compile-time setting. Current value: {}", | 337 | MAX_INTERFACE_COUNT |
| 338 | MAX_INTERFACE_COUNT | 338 | ); |
| 339 | ) | ||
| 340 | } | ||
| 341 | 339 | ||
| 342 | InterfaceBuilder { | 340 | InterfaceBuilder { |
| 343 | builder: self.builder, | 341 | builder: self.builder, |
| @@ -371,7 +369,7 @@ pub struct InterfaceBuilder<'a, 'd, D: Driver<'d>> { | |||
| 371 | 369 | ||
| 372 | impl<'a, 'd, D: Driver<'d>> InterfaceBuilder<'a, 'd, D> { | 370 | impl<'a, 'd, D: Driver<'d>> InterfaceBuilder<'a, 'd, D> { |
| 373 | /// Get the interface number. | 371 | /// Get the interface number. |
| 374 | pub fn interface_number(&self) -> InterfaceNumber { | 372 | pub const fn interface_number(&self) -> InterfaceNumber { |
| 375 | self.interface_number | 373 | self.interface_number |
| 376 | } | 374 | } |
| 377 | 375 | ||
| @@ -422,12 +420,12 @@ pub struct InterfaceAltBuilder<'a, 'd, D: Driver<'d>> { | |||
| 422 | 420 | ||
| 423 | impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> { | 421 | impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> { |
| 424 | /// Get the interface number. | 422 | /// Get the interface number. |
| 425 | pub fn interface_number(&self) -> InterfaceNumber { | 423 | pub const fn interface_number(&self) -> InterfaceNumber { |
| 426 | self.interface_number | 424 | self.interface_number |
| 427 | } | 425 | } |
| 428 | 426 | ||
| 429 | /// Get the alternate setting number. | 427 | /// Get the alternate setting number. |
| 430 | pub fn alt_setting_number(&self) -> u8 { | 428 | pub const fn alt_setting_number(&self) -> u8 { |
| 431 | self.alt_setting_number | 429 | self.alt_setting_number |
| 432 | } | 430 | } |
| 433 | 431 | ||
| @@ -436,7 +434,7 @@ impl<'a, 'd, D: Driver<'d>> InterfaceAltBuilder<'a, 'd, D> { | |||
| 436 | /// Descriptors are written in the order builder functions are called. Note that some | 434 | /// Descriptors are written in the order builder functions are called. Note that some |
| 437 | /// classes care about the order. | 435 | /// classes care about the order. |
| 438 | pub fn descriptor(&mut self, descriptor_type: u8, descriptor: &[u8]) { | 436 | pub fn descriptor(&mut self, descriptor_type: u8, descriptor: &[u8]) { |
| 439 | self.builder.config_descriptor.write(descriptor_type, descriptor) | 437 | self.builder.config_descriptor.write(descriptor_type, descriptor); |
| 440 | } | 438 | } |
| 441 | 439 | ||
| 442 | fn endpoint_in(&mut self, ep_type: EndpointType, max_packet_size: u16, interval_ms: u8) -> D::EndpointIn { | 440 | fn endpoint_in(&mut self, ep_type: EndpointType, max_packet_size: u16, interval_ms: u8) -> D::EndpointIn { |
diff --git a/embassy-usb/src/class/cdc_acm.rs b/embassy-usb/src/class/cdc_acm.rs index a341e10da..f1066d2f2 100644 --- a/embassy-usb/src/class/cdc_acm.rs +++ b/embassy-usb/src/class/cdc_acm.rs | |||
| @@ -1,14 +1,17 @@ | |||
| 1 | //! CDC-ACM class implementation, aka Serial over USB. | 1 | //! CDC-ACM class implementation, aka Serial over USB. |
| 2 | 2 | ||
| 3 | use core::cell::Cell; | 3 | use core::cell::{Cell, RefCell}; |
| 4 | use core::future::poll_fn; | ||
| 4 | use core::mem::{self, MaybeUninit}; | 5 | use core::mem::{self, MaybeUninit}; |
| 5 | use core::sync::atomic::{AtomicBool, Ordering}; | 6 | use core::sync::atomic::{AtomicBool, Ordering}; |
| 7 | use core::task::Poll; | ||
| 6 | 8 | ||
| 7 | use embassy_sync::blocking_mutex::CriticalSectionMutex; | 9 | use embassy_sync::blocking_mutex::CriticalSectionMutex; |
| 10 | use embassy_sync::waitqueue::WakerRegistration; | ||
| 8 | 11 | ||
| 9 | use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; | 12 | use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; |
| 10 | use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; | 13 | use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; |
| 11 | use crate::types::*; | 14 | use crate::types::InterfaceNumber; |
| 12 | use crate::{Builder, Handler}; | 15 | use crate::{Builder, Handler}; |
| 13 | 16 | ||
| 14 | /// This should be used as `device_class` when building the `UsbDevice`. | 17 | /// This should be used as `device_class` when building the `UsbDevice`. |
| @@ -36,12 +39,18 @@ pub struct State<'a> { | |||
| 36 | shared: ControlShared, | 39 | shared: ControlShared, |
| 37 | } | 40 | } |
| 38 | 41 | ||
| 42 | impl<'a> Default for State<'a> { | ||
| 43 | fn default() -> Self { | ||
| 44 | Self::new() | ||
| 45 | } | ||
| 46 | } | ||
| 47 | |||
| 39 | impl<'a> State<'a> { | 48 | impl<'a> State<'a> { |
| 40 | /// Create a new `State`. | 49 | /// Create a new `State`. |
| 41 | pub fn new() -> Self { | 50 | pub fn new() -> Self { |
| 42 | Self { | 51 | Self { |
| 43 | control: MaybeUninit::uninit(), | 52 | control: MaybeUninit::uninit(), |
| 44 | shared: Default::default(), | 53 | shared: ControlShared::default(), |
| 45 | } | 54 | } |
| 46 | } | 55 | } |
| 47 | } | 56 | } |
| @@ -52,9 +61,9 @@ impl<'a> State<'a> { | |||
| 52 | /// writing USB packets with no intermediate buffers, but it will not act like a stream-like serial | 61 | /// writing USB packets with no intermediate buffers, but it will not act like a stream-like serial |
| 53 | /// port. The following constraints must be followed if you use this class directly: | 62 | /// port. The following constraints must be followed if you use this class directly: |
| 54 | /// | 63 | /// |
| 55 | /// - `read_packet` must be called with a buffer large enough to hold max_packet_size bytes. | 64 | /// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes. |
| 56 | /// - `write_packet` must not be called with a buffer larger than max_packet_size bytes. | 65 | /// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes. |
| 57 | /// - If you write a packet that is exactly max_packet_size bytes long, it won't be processed by the | 66 | /// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the |
| 58 | /// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP) | 67 | /// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP) |
| 59 | /// can be sent if there is no other data to send. This is because USB bulk transactions must be | 68 | /// can be sent if there is no other data to send. This is because USB bulk transactions must be |
| 60 | /// terminated with a short packet, even if the bulk endpoint is used for stream-like data. | 69 | /// terminated with a short packet, even if the bulk endpoint is used for stream-like data. |
| @@ -76,6 +85,9 @@ struct ControlShared { | |||
| 76 | line_coding: CriticalSectionMutex<Cell<LineCoding>>, | 85 | line_coding: CriticalSectionMutex<Cell<LineCoding>>, |
| 77 | dtr: AtomicBool, | 86 | dtr: AtomicBool, |
| 78 | rts: AtomicBool, | 87 | rts: AtomicBool, |
| 88 | |||
| 89 | waker: RefCell<WakerRegistration>, | ||
| 90 | changed: AtomicBool, | ||
| 79 | } | 91 | } |
| 80 | 92 | ||
| 81 | impl Default for ControlShared { | 93 | impl Default for ControlShared { |
| @@ -89,10 +101,27 @@ impl Default for ControlShared { | |||
| 89 | parity_type: ParityType::None, | 101 | parity_type: ParityType::None, |
| 90 | data_rate: 8_000, | 102 | data_rate: 8_000, |
| 91 | })), | 103 | })), |
| 104 | waker: RefCell::new(WakerRegistration::new()), | ||
| 105 | changed: AtomicBool::new(false), | ||
| 92 | } | 106 | } |
| 93 | } | 107 | } |
| 94 | } | 108 | } |
| 95 | 109 | ||
| 110 | impl ControlShared { | ||
| 111 | async fn changed(&self) { | ||
| 112 | poll_fn(|cx| { | ||
| 113 | if self.changed.load(Ordering::Relaxed) { | ||
| 114 | self.changed.store(false, Ordering::Relaxed); | ||
| 115 | Poll::Ready(()) | ||
| 116 | } else { | ||
| 117 | self.waker.borrow_mut().register(cx.waker()); | ||
| 118 | Poll::Pending | ||
| 119 | } | ||
| 120 | }) | ||
| 121 | .await; | ||
| 122 | } | ||
| 123 | } | ||
| 124 | |||
| 96 | impl<'a> Control<'a> { | 125 | impl<'a> Control<'a> { |
| 97 | fn shared(&mut self) -> &'a ControlShared { | 126 | fn shared(&mut self) -> &'a ControlShared { |
| 98 | self.shared | 127 | self.shared |
| @@ -105,6 +134,9 @@ impl<'d> Handler for Control<'d> { | |||
| 105 | shared.line_coding.lock(|x| x.set(LineCoding::default())); | 134 | shared.line_coding.lock(|x| x.set(LineCoding::default())); |
| 106 | shared.dtr.store(false, Ordering::Relaxed); | 135 | shared.dtr.store(false, Ordering::Relaxed); |
| 107 | shared.rts.store(false, Ordering::Relaxed); | 136 | shared.rts.store(false, Ordering::Relaxed); |
| 137 | |||
| 138 | shared.changed.store(true, Ordering::Relaxed); | ||
| 139 | shared.waker.borrow_mut().wake(); | ||
| 108 | } | 140 | } |
| 109 | 141 | ||
| 110 | fn control_out(&mut self, req: control::Request, data: &[u8]) -> Option<OutResponse> { | 142 | fn control_out(&mut self, req: control::Request, data: &[u8]) -> Option<OutResponse> { |
| @@ -127,9 +159,13 @@ impl<'d> Handler for Control<'d> { | |||
| 127 | parity_type: data[5].into(), | 159 | parity_type: data[5].into(), |
| 128 | data_bits: data[6], | 160 | data_bits: data[6], |
| 129 | }; | 161 | }; |
| 130 | self.shared().line_coding.lock(|x| x.set(coding)); | 162 | let shared = self.shared(); |
| 163 | shared.line_coding.lock(|x| x.set(coding)); | ||
| 131 | debug!("Set line coding to: {:?}", coding); | 164 | debug!("Set line coding to: {:?}", coding); |
| 132 | 165 | ||
| 166 | shared.changed.store(true, Ordering::Relaxed); | ||
| 167 | shared.waker.borrow_mut().wake(); | ||
| 168 | |||
| 133 | Some(OutResponse::Accepted) | 169 | Some(OutResponse::Accepted) |
| 134 | } | 170 | } |
| 135 | REQ_SET_CONTROL_LINE_STATE => { | 171 | REQ_SET_CONTROL_LINE_STATE => { |
| @@ -141,6 +177,9 @@ impl<'d> Handler for Control<'d> { | |||
| 141 | shared.rts.store(rts, Ordering::Relaxed); | 177 | shared.rts.store(rts, Ordering::Relaxed); |
| 142 | debug!("Set dtr {}, rts {}", dtr, rts); | 178 | debug!("Set dtr {}, rts {}", dtr, rts); |
| 143 | 179 | ||
| 180 | shared.changed.store(true, Ordering::Relaxed); | ||
| 181 | shared.waker.borrow_mut().wake(); | ||
| 182 | |||
| 144 | Some(OutResponse::Accepted) | 183 | Some(OutResponse::Accepted) |
| 145 | } | 184 | } |
| 146 | _ => Some(OutResponse::Rejected), | 185 | _ => Some(OutResponse::Rejected), |
| @@ -158,7 +197,7 @@ impl<'d> Handler for Control<'d> { | |||
| 158 | // REQ_GET_ENCAPSULATED_COMMAND is not really supported - it will be rejected below. | 197 | // REQ_GET_ENCAPSULATED_COMMAND is not really supported - it will be rejected below. |
| 159 | REQ_GET_LINE_CODING if req.length == 7 => { | 198 | REQ_GET_LINE_CODING if req.length == 7 => { |
| 160 | debug!("Sending line coding"); | 199 | debug!("Sending line coding"); |
| 161 | let coding = self.shared().line_coding.lock(|x| x.get()); | 200 | let coding = self.shared().line_coding.lock(Cell::get); |
| 162 | assert!(buf.len() >= 7); | 201 | assert!(buf.len() >= 7); |
| 163 | buf[0..4].copy_from_slice(&coding.data_rate.to_le_bytes()); | 202 | buf[0..4].copy_from_slice(&coding.data_rate.to_le_bytes()); |
| 164 | buf[4] = coding.stop_bits as u8; | 203 | buf[4] = coding.stop_bits as u8; |
| @@ -172,8 +211,8 @@ impl<'d> Handler for Control<'d> { | |||
| 172 | } | 211 | } |
| 173 | 212 | ||
| 174 | impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { | 213 | impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { |
| 175 | /// Creates a new CdcAcmClass with the provided UsbBus and max_packet_size in bytes. For | 214 | /// Creates a new CdcAcmClass with the provided UsbBus and `max_packet_size` in bytes. For |
| 176 | /// full-speed devices, max_packet_size has to be one of 8, 16, 32 or 64. | 215 | /// full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64. |
| 177 | pub fn new(builder: &mut Builder<'d, D>, state: &'d mut State<'d>, max_packet_size: u16) -> Self { | 216 | pub fn new(builder: &mut Builder<'d, D>, state: &'d mut State<'d>, max_packet_size: u16) -> Self { |
| 178 | assert!(builder.control_buf_len() >= 7); | 217 | assert!(builder.control_buf_len() >= 7); |
| 179 | 218 | ||
| @@ -208,7 +247,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { | |||
| 208 | &[ | 247 | &[ |
| 209 | CDC_TYPE_UNION, // bDescriptorSubtype | 248 | CDC_TYPE_UNION, // bDescriptorSubtype |
| 210 | comm_if.into(), // bControlInterface | 249 | comm_if.into(), // bControlInterface |
| 211 | data_if.into(), // bSubordinateInterface | 250 | data_if, // bSubordinateInterface |
| 212 | ], | 251 | ], |
| 213 | ); | 252 | ); |
| 214 | 253 | ||
| @@ -249,7 +288,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { | |||
| 249 | /// Gets the current line coding. The line coding contains information that's mainly relevant | 288 | /// Gets the current line coding. The line coding contains information that's mainly relevant |
| 250 | /// for USB to UART serial port emulators, and can be ignored if not relevant. | 289 | /// for USB to UART serial port emulators, and can be ignored if not relevant. |
| 251 | pub fn line_coding(&self) -> LineCoding { | 290 | pub fn line_coding(&self) -> LineCoding { |
| 252 | self.control.line_coding.lock(|x| x.get()) | 291 | self.control.line_coding.lock(Cell::get) |
| 253 | } | 292 | } |
| 254 | 293 | ||
| 255 | /// Gets the DTR (data terminal ready) state | 294 | /// Gets the DTR (data terminal ready) state |
| @@ -274,7 +313,7 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { | |||
| 274 | 313 | ||
| 275 | /// Waits for the USB host to enable this interface | 314 | /// Waits for the USB host to enable this interface |
| 276 | pub async fn wait_connection(&mut self) { | 315 | pub async fn wait_connection(&mut self) { |
| 277 | self.read_ep.wait_enabled().await | 316 | self.read_ep.wait_enabled().await; |
| 278 | } | 317 | } |
| 279 | 318 | ||
| 280 | /// Split the class into a sender and receiver. | 319 | /// Split the class into a sender and receiver. |
| @@ -292,6 +331,38 @@ impl<'d, D: Driver<'d>> CdcAcmClass<'d, D> { | |||
| 292 | }, | 331 | }, |
| 293 | ) | 332 | ) |
| 294 | } | 333 | } |
| 334 | |||
| 335 | /// Split the class into sender, receiver and control | ||
| 336 | /// | ||
| 337 | /// Allows concurrently sending and receiving packets whilst monitoring for | ||
| 338 | /// control changes (dtr, rts) | ||
| 339 | pub fn split_with_control(self) -> (Sender<'d, D>, Receiver<'d, D>, ControlChanged<'d>) { | ||
| 340 | ( | ||
| 341 | Sender { | ||
| 342 | write_ep: self.write_ep, | ||
| 343 | control: self.control, | ||
| 344 | }, | ||
| 345 | Receiver { | ||
| 346 | read_ep: self.read_ep, | ||
| 347 | control: self.control, | ||
| 348 | }, | ||
| 349 | ControlChanged { control: self.control }, | ||
| 350 | ) | ||
| 351 | } | ||
| 352 | } | ||
| 353 | |||
| 354 | /// CDC ACM Control status change monitor | ||
| 355 | /// | ||
| 356 | /// You can obtain a `ControlChanged` with [`CdcAcmClass::split_with_control`] | ||
| 357 | pub struct ControlChanged<'d> { | ||
| 358 | control: &'d ControlShared, | ||
| 359 | } | ||
| 360 | |||
| 361 | impl<'d> ControlChanged<'d> { | ||
| 362 | /// Return a future for when the control settings change | ||
| 363 | pub async fn control_changed(&self) { | ||
| 364 | self.control.changed().await; | ||
| 365 | } | ||
| 295 | } | 366 | } |
| 296 | 367 | ||
| 297 | /// CDC ACM class packet sender. | 368 | /// CDC ACM class packet sender. |
| @@ -312,7 +383,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> { | |||
| 312 | /// Gets the current line coding. The line coding contains information that's mainly relevant | 383 | /// Gets the current line coding. The line coding contains information that's mainly relevant |
| 313 | /// for USB to UART serial port emulators, and can be ignored if not relevant. | 384 | /// for USB to UART serial port emulators, and can be ignored if not relevant. |
| 314 | pub fn line_coding(&self) -> LineCoding { | 385 | pub fn line_coding(&self) -> LineCoding { |
| 315 | self.control.line_coding.lock(|x| x.get()) | 386 | self.control.line_coding.lock(Cell::get) |
| 316 | } | 387 | } |
| 317 | 388 | ||
| 318 | /// Gets the DTR (data terminal ready) state | 389 | /// Gets the DTR (data terminal ready) state |
| @@ -332,7 +403,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> { | |||
| 332 | 403 | ||
| 333 | /// Waits for the USB host to enable this interface | 404 | /// Waits for the USB host to enable this interface |
| 334 | pub async fn wait_connection(&mut self) { | 405 | pub async fn wait_connection(&mut self) { |
| 335 | self.write_ep.wait_enabled().await | 406 | self.write_ep.wait_enabled().await; |
| 336 | } | 407 | } |
| 337 | } | 408 | } |
| 338 | 409 | ||
| @@ -354,7 +425,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> { | |||
| 354 | /// Gets the current line coding. The line coding contains information that's mainly relevant | 425 | /// Gets the current line coding. The line coding contains information that's mainly relevant |
| 355 | /// for USB to UART serial port emulators, and can be ignored if not relevant. | 426 | /// for USB to UART serial port emulators, and can be ignored if not relevant. |
| 356 | pub fn line_coding(&self) -> LineCoding { | 427 | pub fn line_coding(&self) -> LineCoding { |
| 357 | self.control.line_coding.lock(|x| x.get()) | 428 | self.control.line_coding.lock(Cell::get) |
| 358 | } | 429 | } |
| 359 | 430 | ||
| 360 | /// Gets the DTR (data terminal ready) state | 431 | /// Gets the DTR (data terminal ready) state |
| @@ -374,7 +445,7 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> { | |||
| 374 | 445 | ||
| 375 | /// Waits for the USB host to enable this interface | 446 | /// Waits for the USB host to enable this interface |
| 376 | pub async fn wait_connection(&mut self) { | 447 | pub async fn wait_connection(&mut self) { |
| 377 | self.read_ep.wait_enabled().await | 448 | self.read_ep.wait_enabled().await; |
| 378 | } | 449 | } |
| 379 | } | 450 | } |
| 380 | 451 | ||
| @@ -448,17 +519,17 @@ impl LineCoding { | |||
| 448 | } | 519 | } |
| 449 | 520 | ||
| 450 | /// Gets the number of data bits for UART communication. | 521 | /// Gets the number of data bits for UART communication. |
| 451 | pub fn data_bits(&self) -> u8 { | 522 | pub const fn data_bits(&self) -> u8 { |
| 452 | self.data_bits | 523 | self.data_bits |
| 453 | } | 524 | } |
| 454 | 525 | ||
| 455 | /// Gets the parity type for UART communication. | 526 | /// Gets the parity type for UART communication. |
| 456 | pub fn parity_type(&self) -> ParityType { | 527 | pub const fn parity_type(&self) -> ParityType { |
| 457 | self.parity_type | 528 | self.parity_type |
| 458 | } | 529 | } |
| 459 | 530 | ||
| 460 | /// Gets the data rate in bits per second for UART communication. | 531 | /// Gets the data rate in bits per second for UART communication. |
| 461 | pub fn data_rate(&self) -> u32 { | 532 | pub const fn data_rate(&self) -> u32 { |
| 462 | self.data_rate | 533 | self.data_rate |
| 463 | } | 534 | } |
| 464 | } | 535 | } |
diff --git a/embassy-usb/src/class/cdc_ncm/mod.rs b/embassy-usb/src/class/cdc_ncm/mod.rs index 830e9b768..bea9dac27 100644 --- a/embassy-usb/src/class/cdc_ncm/mod.rs +++ b/embassy-usb/src/class/cdc_ncm/mod.rs | |||
| @@ -16,10 +16,11 @@ | |||
| 16 | 16 | ||
| 17 | use core::intrinsics::copy_nonoverlapping; | 17 | use core::intrinsics::copy_nonoverlapping; |
| 18 | use core::mem::{size_of, MaybeUninit}; | 18 | use core::mem::{size_of, MaybeUninit}; |
| 19 | use core::ptr::addr_of; | ||
| 19 | 20 | ||
| 20 | use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; | 21 | use crate::control::{self, InResponse, OutResponse, Recipient, Request, RequestType}; |
| 21 | use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; | 22 | use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; |
| 22 | use crate::types::*; | 23 | use crate::types::{InterfaceNumber, StringIndex}; |
| 23 | use crate::{Builder, Handler}; | 24 | use crate::{Builder, Handler}; |
| 24 | 25 | ||
| 25 | pub mod embassy_net; | 26 | pub mod embassy_net; |
| @@ -62,9 +63,9 @@ const REQ_SET_NTB_INPUT_SIZE: u8 = 0x86; | |||
| 62 | //const NOTIF_POLL_INTERVAL: u8 = 20; | 63 | //const NOTIF_POLL_INTERVAL: u8 = 20; |
| 63 | 64 | ||
| 64 | const NTB_MAX_SIZE: usize = 2048; | 65 | const NTB_MAX_SIZE: usize = 2048; |
| 65 | const SIG_NTH: u32 = 0x484d434e; | 66 | const SIG_NTH: u32 = 0x484d_434e; |
| 66 | const SIG_NDP_NO_FCS: u32 = 0x304d434e; | 67 | const SIG_NDP_NO_FCS: u32 = 0x304d_434e; |
| 67 | const SIG_NDP_WITH_FCS: u32 = 0x314d434e; | 68 | const SIG_NDP_WITH_FCS: u32 = 0x314d_434e; |
| 68 | 69 | ||
| 69 | const ALTERNATE_SETTING_DISABLED: u8 = 0x00; | 70 | const ALTERNATE_SETTING_DISABLED: u8 = 0x00; |
| 70 | const ALTERNATE_SETTING_ENABLED: u8 = 0x01; | 71 | const ALTERNATE_SETTING_ENABLED: u8 = 0x01; |
| @@ -111,7 +112,7 @@ struct NtbParametersDir { | |||
| 111 | 112 | ||
| 112 | fn byteify<T>(buf: &mut [u8], data: T) -> &[u8] { | 113 | fn byteify<T>(buf: &mut [u8], data: T) -> &[u8] { |
| 113 | let len = size_of::<T>(); | 114 | let len = size_of::<T>(); |
| 114 | unsafe { copy_nonoverlapping(&data as *const _ as *const u8, buf.as_mut_ptr(), len) } | 115 | unsafe { copy_nonoverlapping(addr_of!(data).cast(), buf.as_mut_ptr(), len) } |
| 115 | &buf[..len] | 116 | &buf[..len] |
| 116 | } | 117 | } |
| 117 | 118 | ||
| @@ -121,27 +122,28 @@ pub struct State<'a> { | |||
| 121 | shared: ControlShared, | 122 | shared: ControlShared, |
| 122 | } | 123 | } |
| 123 | 124 | ||
| 125 | impl<'a> Default for State<'a> { | ||
| 126 | fn default() -> Self { | ||
| 127 | Self::new() | ||
| 128 | } | ||
| 129 | } | ||
| 130 | |||
| 124 | impl<'a> State<'a> { | 131 | impl<'a> State<'a> { |
| 125 | /// Create a new `State`. | 132 | /// Create a new `State`. |
| 126 | pub fn new() -> Self { | 133 | pub fn new() -> Self { |
| 127 | Self { | 134 | Self { |
| 128 | control: MaybeUninit::uninit(), | 135 | control: MaybeUninit::uninit(), |
| 129 | shared: Default::default(), | 136 | shared: ControlShared::default(), |
| 130 | } | 137 | } |
| 131 | } | 138 | } |
| 132 | } | 139 | } |
| 133 | 140 | ||
| 134 | /// Shared data between Control and CdcAcmClass | 141 | /// Shared data between Control and `CdcAcmClass` |
| 142 | #[derive(Default)] | ||
| 135 | struct ControlShared { | 143 | struct ControlShared { |
| 136 | mac_addr: [u8; 6], | 144 | mac_addr: [u8; 6], |
| 137 | } | 145 | } |
| 138 | 146 | ||
| 139 | impl Default for ControlShared { | ||
| 140 | fn default() -> Self { | ||
| 141 | ControlShared { mac_addr: [0; 6] } | ||
| 142 | } | ||
| 143 | } | ||
| 144 | |||
| 145 | struct Control<'a> { | 147 | struct Control<'a> { |
| 146 | mac_addr_string: StringIndex, | 148 | mac_addr_string: StringIndex, |
| 147 | shared: &'a ControlShared, | 149 | shared: &'a ControlShared, |
| @@ -377,12 +379,12 @@ impl<'d, D: Driver<'d>> Sender<'d, D> { | |||
| 377 | /// | 379 | /// |
| 378 | /// This waits until the packet is successfully stored in the CDC-NCM endpoint buffers. | 380 | /// This waits until the packet is successfully stored in the CDC-NCM endpoint buffers. |
| 379 | pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> { | 381 | pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> { |
| 380 | let seq = self.seq; | ||
| 381 | self.seq = self.seq.wrapping_add(1); | ||
| 382 | |||
| 383 | const OUT_HEADER_LEN: usize = 28; | 382 | const OUT_HEADER_LEN: usize = 28; |
| 384 | const ABS_MAX_PACKET_SIZE: usize = 512; | 383 | const ABS_MAX_PACKET_SIZE: usize = 512; |
| 385 | 384 | ||
| 385 | let seq = self.seq; | ||
| 386 | self.seq = self.seq.wrapping_add(1); | ||
| 387 | |||
| 386 | let header = NtbOutHeader { | 388 | let header = NtbOutHeader { |
| 387 | nth_sig: SIG_NTH, | 389 | nth_sig: SIG_NTH, |
| 388 | nth_len: 0x0c, | 390 | nth_len: 0x0c, |
| @@ -416,7 +418,7 @@ impl<'d, D: Driver<'d>> Sender<'d, D> { | |||
| 416 | self.write_ep.write(&buf[..self.max_packet_size]).await?; | 418 | self.write_ep.write(&buf[..self.max_packet_size]).await?; |
| 417 | 419 | ||
| 418 | for chunk in d2.chunks(self.max_packet_size) { | 420 | for chunk in d2.chunks(self.max_packet_size) { |
| 419 | self.write_ep.write(&chunk).await?; | 421 | self.write_ep.write(chunk).await?; |
| 420 | } | 422 | } |
| 421 | 423 | ||
| 422 | // Send ZLP if needed. | 424 | // Send ZLP if needed. |
| @@ -459,12 +461,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> { | |||
| 459 | let ntb = &ntb[..pos]; | 461 | let ntb = &ntb[..pos]; |
| 460 | 462 | ||
| 461 | // Process NTB header (NTH) | 463 | // Process NTB header (NTH) |
| 462 | let nth = match ntb.get(..12) { | 464 | let Some(nth) = ntb.get(..12) else { |
| 463 | Some(x) => x, | 465 | warn!("Received too short NTB"); |
| 464 | None => { | 466 | continue; |
| 465 | warn!("Received too short NTB"); | ||
| 466 | continue; | ||
| 467 | } | ||
| 468 | }; | 467 | }; |
| 469 | let sig = u32::from_le_bytes(nth[0..4].try_into().unwrap()); | 468 | let sig = u32::from_le_bytes(nth[0..4].try_into().unwrap()); |
| 470 | if sig != SIG_NTH { | 469 | if sig != SIG_NTH { |
| @@ -474,12 +473,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> { | |||
| 474 | let ndp_idx = u16::from_le_bytes(nth[10..12].try_into().unwrap()) as usize; | 473 | let ndp_idx = u16::from_le_bytes(nth[10..12].try_into().unwrap()) as usize; |
| 475 | 474 | ||
| 476 | // Process NTB Datagram Pointer (NDP) | 475 | // Process NTB Datagram Pointer (NDP) |
| 477 | let ndp = match ntb.get(ndp_idx..ndp_idx + 12) { | 476 | let Some(ndp) = ntb.get(ndp_idx..ndp_idx + 12) else { |
| 478 | Some(x) => x, | 477 | warn!("NTH has an NDP pointer out of range."); |
| 479 | None => { | 478 | continue; |
| 480 | warn!("NTH has an NDP pointer out of range."); | ||
| 481 | continue; | ||
| 482 | } | ||
| 483 | }; | 479 | }; |
| 484 | let sig = u32::from_le_bytes(ndp[0..4].try_into().unwrap()); | 480 | let sig = u32::from_le_bytes(ndp[0..4].try_into().unwrap()); |
| 485 | if sig != SIG_NDP_NO_FCS && sig != SIG_NDP_WITH_FCS { | 481 | if sig != SIG_NDP_NO_FCS && sig != SIG_NDP_WITH_FCS { |
| @@ -495,12 +491,9 @@ impl<'d, D: Driver<'d>> Receiver<'d, D> { | |||
| 495 | } | 491 | } |
| 496 | 492 | ||
| 497 | // Process actual datagram, finally. | 493 | // Process actual datagram, finally. |
| 498 | let datagram = match ntb.get(datagram_index..datagram_index + datagram_len) { | 494 | let Some(datagram) = ntb.get(datagram_index..datagram_index + datagram_len) else { |
| 499 | Some(x) => x, | 495 | warn!("NDP has a datagram pointer out of range."); |
| 500 | None => { | 496 | continue; |
| 501 | warn!("NDP has a datagram pointer out of range."); | ||
| 502 | continue; | ||
| 503 | } | ||
| 504 | }; | 497 | }; |
| 505 | buf[..datagram_len].copy_from_slice(datagram); | 498 | buf[..datagram_len].copy_from_slice(datagram); |
| 506 | 499 | ||
diff --git a/embassy-usb/src/class/hid.rs b/embassy-usb/src/class/hid.rs index 889d66ec5..0000b5b2b 100644 --- a/embassy-usb/src/class/hid.rs +++ b/embassy-usb/src/class/hid.rs | |||
| @@ -63,7 +63,7 @@ pub enum ReportId { | |||
| 63 | } | 63 | } |
| 64 | 64 | ||
| 65 | impl ReportId { | 65 | impl ReportId { |
| 66 | fn try_from(value: u16) -> Result<Self, ()> { | 66 | const fn try_from(value: u16) -> Result<Self, ()> { |
| 67 | match value >> 8 { | 67 | match value >> 8 { |
| 68 | 1 => Ok(ReportId::In(value as u8)), | 68 | 1 => Ok(ReportId::In(value as u8)), |
| 69 | 2 => Ok(ReportId::Out(value as u8)), | 69 | 2 => Ok(ReportId::Out(value as u8)), |
| @@ -79,9 +79,15 @@ pub struct State<'d> { | |||
| 79 | out_report_offset: AtomicUsize, | 79 | out_report_offset: AtomicUsize, |
| 80 | } | 80 | } |
| 81 | 81 | ||
| 82 | impl<'d> Default for State<'d> { | ||
| 83 | fn default() -> Self { | ||
| 84 | Self::new() | ||
| 85 | } | ||
| 86 | } | ||
| 87 | |||
| 82 | impl<'d> State<'d> { | 88 | impl<'d> State<'d> { |
| 83 | /// Create a new `State`. | 89 | /// Create a new `State`. |
| 84 | pub fn new() -> Self { | 90 | pub const fn new() -> Self { |
| 85 | State { | 91 | State { |
| 86 | control: MaybeUninit::uninit(), | 92 | control: MaybeUninit::uninit(), |
| 87 | out_report_offset: AtomicUsize::new(0), | 93 | out_report_offset: AtomicUsize::new(0), |
| @@ -148,7 +154,7 @@ fn build<'d, D: Driver<'d>>( | |||
| 148 | } | 154 | } |
| 149 | 155 | ||
| 150 | impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWriter<'d, D, READ_N, WRITE_N> { | 156 | impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWriter<'d, D, READ_N, WRITE_N> { |
| 151 | /// Creates a new HidReaderWriter. | 157 | /// Creates a new `HidReaderWriter`. |
| 152 | /// | 158 | /// |
| 153 | /// This will allocate one IN and one OUT endpoints. If you only need writing (sending) | 159 | /// This will allocate one IN and one OUT endpoints. If you only need writing (sending) |
| 154 | /// HID reports, consider using [`HidWriter::new`] instead, which allocates an IN endpoint only. | 160 | /// HID reports, consider using [`HidWriter::new`] instead, which allocates an IN endpoint only. |
| @@ -171,7 +177,7 @@ impl<'d, D: Driver<'d>, const READ_N: usize, const WRITE_N: usize> HidReaderWrit | |||
| 171 | } | 177 | } |
| 172 | 178 | ||
| 173 | /// Waits for both IN and OUT endpoints to be enabled. | 179 | /// Waits for both IN and OUT endpoints to be enabled. |
| 174 | pub async fn ready(&mut self) -> () { | 180 | pub async fn ready(&mut self) { |
| 175 | self.reader.ready().await; | 181 | self.reader.ready().await; |
| 176 | self.writer.ready().await; | 182 | self.writer.ready().await; |
| 177 | } | 183 | } |
| @@ -224,7 +230,7 @@ pub enum ReadError { | |||
| 224 | 230 | ||
| 225 | impl From<EndpointError> for ReadError { | 231 | impl From<EndpointError> for ReadError { |
| 226 | fn from(val: EndpointError) -> Self { | 232 | fn from(val: EndpointError) -> Self { |
| 227 | use EndpointError::*; | 233 | use EndpointError::{BufferOverflow, Disabled}; |
| 228 | match val { | 234 | match val { |
| 229 | BufferOverflow => ReadError::BufferOverflow, | 235 | BufferOverflow => ReadError::BufferOverflow, |
| 230 | Disabled => ReadError::Disabled, | 236 | Disabled => ReadError::Disabled, |
| @@ -251,17 +257,16 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> { | |||
| 251 | } | 257 | } |
| 252 | 258 | ||
| 253 | /// Waits for the interrupt in endpoint to be enabled. | 259 | /// Waits for the interrupt in endpoint to be enabled. |
| 254 | pub async fn ready(&mut self) -> () { | 260 | pub async fn ready(&mut self) { |
| 255 | self.ep_in.wait_enabled().await | 261 | self.ep_in.wait_enabled().await; |
| 256 | } | 262 | } |
| 257 | 263 | ||
| 258 | /// Writes an input report by serializing the given report structure. | 264 | /// Writes an input report by serializing the given report structure. |
| 259 | #[cfg(feature = "usbd-hid")] | 265 | #[cfg(feature = "usbd-hid")] |
| 260 | pub async fn write_serialize<IR: AsInputReport>(&mut self, r: &IR) -> Result<(), EndpointError> { | 266 | pub async fn write_serialize<IR: AsInputReport>(&mut self, r: &IR) -> Result<(), EndpointError> { |
| 261 | let mut buf: [u8; N] = [0; N]; | 267 | let mut buf: [u8; N] = [0; N]; |
| 262 | let size = match serialize(&mut buf, r) { | 268 | let Ok(size) = serialize(&mut buf, r) else { |
| 263 | Ok(size) => size, | 269 | return Err(EndpointError::BufferOverflow); |
| 264 | Err(_) => return Err(EndpointError::BufferOverflow), | ||
| 265 | }; | 270 | }; |
| 266 | self.write(&buf[0..size]).await | 271 | self.write(&buf[0..size]).await |
| 267 | } | 272 | } |
| @@ -286,8 +291,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidWriter<'d, D, N> { | |||
| 286 | 291 | ||
| 287 | impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> { | 292 | impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> { |
| 288 | /// Waits for the interrupt out endpoint to be enabled. | 293 | /// Waits for the interrupt out endpoint to be enabled. |
| 289 | pub async fn ready(&mut self) -> () { | 294 | pub async fn ready(&mut self) { |
| 290 | self.ep_out.wait_enabled().await | 295 | self.ep_out.wait_enabled().await; |
| 291 | } | 296 | } |
| 292 | 297 | ||
| 293 | /// Delivers output reports from the Interrupt Out pipe to `handler`. | 298 | /// Delivers output reports from the Interrupt Out pipe to `handler`. |
| @@ -344,9 +349,8 @@ impl<'d, D: Driver<'d>, const N: usize> HidReader<'d, D, N> { | |||
| 344 | if size < max_packet_size || total == N { | 349 | if size < max_packet_size || total == N { |
| 345 | self.offset.store(0, Ordering::Release); | 350 | self.offset.store(0, Ordering::Release); |
| 346 | break; | 351 | break; |
| 347 | } else { | ||
| 348 | self.offset.store(total, Ordering::Release); | ||
| 349 | } | 352 | } |
| 353 | self.offset.store(total, Ordering::Release); | ||
| 350 | } | 354 | } |
| 351 | Err(err) => { | 355 | Err(err) => { |
| 352 | self.offset.store(0, Ordering::Release); | 356 | self.offset.store(0, Ordering::Release); |
| @@ -466,7 +470,7 @@ impl<'d> Handler for Control<'d> { | |||
| 466 | HID_REQ_SET_IDLE => { | 470 | HID_REQ_SET_IDLE => { |
| 467 | if let Some(handler) = self.request_handler { | 471 | if let Some(handler) = self.request_handler { |
| 468 | let id = req.value as u8; | 472 | let id = req.value as u8; |
| 469 | let id = (id != 0).then(|| ReportId::In(id)); | 473 | let id = (id != 0).then_some(ReportId::In(id)); |
| 470 | let dur = u32::from(req.value >> 8); | 474 | let dur = u32::from(req.value >> 8); |
| 471 | let dur = if dur == 0 { u32::MAX } else { 4 * dur }; | 475 | let dur = if dur == 0 { u32::MAX } else { 4 * dur }; |
| 472 | handler.set_idle_ms(id, dur); | 476 | handler.set_idle_ms(id, dur); |
| @@ -522,7 +526,7 @@ impl<'d> Handler for Control<'d> { | |||
| 522 | HID_REQ_GET_IDLE => { | 526 | HID_REQ_GET_IDLE => { |
| 523 | if let Some(handler) = self.request_handler { | 527 | if let Some(handler) = self.request_handler { |
| 524 | let id = req.value as u8; | 528 | let id = req.value as u8; |
| 525 | let id = (id != 0).then(|| ReportId::In(id)); | 529 | let id = (id != 0).then_some(ReportId::In(id)); |
| 526 | if let Some(dur) = handler.get_idle_ms(id) { | 530 | if let Some(dur) = handler.get_idle_ms(id) { |
| 527 | let dur = u8::try_from(dur / 4).unwrap_or(0); | 531 | let dur = u8::try_from(dur / 4).unwrap_or(0); |
| 528 | buf[0] = dur; | 532 | buf[0] = dur; |
diff --git a/embassy-usb/src/class/midi.rs b/embassy-usb/src/class/midi.rs new file mode 100644 index 000000000..52a96f278 --- /dev/null +++ b/embassy-usb/src/class/midi.rs | |||
| @@ -0,0 +1,227 @@ | |||
| 1 | //! MIDI class implementation. | ||
| 2 | |||
| 3 | use crate::driver::{Driver, Endpoint, EndpointError, EndpointIn, EndpointOut}; | ||
| 4 | use crate::Builder; | ||
| 5 | |||
| 6 | /// This should be used as `device_class` when building the `UsbDevice`. | ||
| 7 | pub const USB_AUDIO_CLASS: u8 = 0x01; | ||
| 8 | |||
| 9 | const USB_AUDIOCONTROL_SUBCLASS: u8 = 0x01; | ||
| 10 | const USB_MIDISTREAMING_SUBCLASS: u8 = 0x03; | ||
| 11 | const MIDI_IN_JACK_SUBTYPE: u8 = 0x02; | ||
| 12 | const MIDI_OUT_JACK_SUBTYPE: u8 = 0x03; | ||
| 13 | const EMBEDDED: u8 = 0x01; | ||
| 14 | const EXTERNAL: u8 = 0x02; | ||
| 15 | const CS_INTERFACE: u8 = 0x24; | ||
| 16 | const CS_ENDPOINT: u8 = 0x25; | ||
| 17 | const HEADER_SUBTYPE: u8 = 0x01; | ||
| 18 | const MS_HEADER_SUBTYPE: u8 = 0x01; | ||
| 19 | const MS_GENERAL: u8 = 0x01; | ||
| 20 | const PROTOCOL_NONE: u8 = 0x00; | ||
| 21 | const MIDI_IN_SIZE: u8 = 0x06; | ||
| 22 | const MIDI_OUT_SIZE: u8 = 0x09; | ||
| 23 | |||
| 24 | /// Packet level implementation of a USB MIDI device. | ||
| 25 | /// | ||
| 26 | /// This class can be used directly and it has the least overhead due to directly reading and | ||
| 27 | /// writing USB packets with no intermediate buffers, but it will not act like a stream-like port. | ||
| 28 | /// The following constraints must be followed if you use this class directly: | ||
| 29 | /// | ||
| 30 | /// - `read_packet` must be called with a buffer large enough to hold `max_packet_size` bytes. | ||
| 31 | /// - `write_packet` must not be called with a buffer larger than `max_packet_size` bytes. | ||
| 32 | /// - If you write a packet that is exactly `max_packet_size` bytes long, it won't be processed by the | ||
| 33 | /// host operating system until a subsequent shorter packet is sent. A zero-length packet (ZLP) | ||
| 34 | /// can be sent if there is no other data to send. This is because USB bulk transactions must be | ||
| 35 | /// terminated with a short packet, even if the bulk endpoint is used for stream-like data. | ||
| 36 | pub struct MidiClass<'d, D: Driver<'d>> { | ||
| 37 | read_ep: D::EndpointOut, | ||
| 38 | write_ep: D::EndpointIn, | ||
| 39 | } | ||
| 40 | |||
| 41 | impl<'d, D: Driver<'d>> MidiClass<'d, D> { | ||
| 42 | /// Creates a new `MidiClass` with the provided UsbBus, number of input and output jacks and `max_packet_size` in bytes. | ||
| 43 | /// For full-speed devices, `max_packet_size` has to be one of 8, 16, 32 or 64. | ||
| 44 | pub fn new(builder: &mut Builder<'d, D>, n_in_jacks: u8, n_out_jacks: u8, max_packet_size: u16) -> Self { | ||
| 45 | let mut func = builder.function(USB_AUDIO_CLASS, USB_AUDIOCONTROL_SUBCLASS, PROTOCOL_NONE); | ||
| 46 | |||
| 47 | // Audio control interface | ||
| 48 | let mut iface = func.interface(); | ||
| 49 | let audio_if = iface.interface_number(); | ||
| 50 | let midi_if = u8::from(audio_if) + 1; | ||
| 51 | let mut alt = iface.alt_setting(USB_AUDIO_CLASS, USB_AUDIOCONTROL_SUBCLASS, PROTOCOL_NONE, None); | ||
| 52 | alt.descriptor(CS_INTERFACE, &[HEADER_SUBTYPE, 0x00, 0x01, 0x09, 0x00, 0x01, midi_if]); | ||
| 53 | |||
| 54 | // MIDIStreaming interface | ||
| 55 | let mut iface = func.interface(); | ||
| 56 | let _midi_if = iface.interface_number(); | ||
| 57 | let mut alt = iface.alt_setting(USB_AUDIO_CLASS, USB_MIDISTREAMING_SUBCLASS, PROTOCOL_NONE, None); | ||
| 58 | |||
| 59 | let midi_streaming_total_length = 7 | ||
| 60 | + (n_in_jacks + n_out_jacks) as usize * (MIDI_IN_SIZE + MIDI_OUT_SIZE) as usize | ||
| 61 | + 7 | ||
| 62 | + (4 + n_out_jacks as usize) | ||
| 63 | + 7 | ||
| 64 | + (4 + n_in_jacks as usize); | ||
| 65 | |||
| 66 | alt.descriptor( | ||
| 67 | CS_INTERFACE, | ||
| 68 | &[ | ||
| 69 | MS_HEADER_SUBTYPE, | ||
| 70 | 0x00, | ||
| 71 | 0x01, | ||
| 72 | (midi_streaming_total_length & 0xFF) as u8, | ||
| 73 | ((midi_streaming_total_length >> 8) & 0xFF) as u8, | ||
| 74 | ], | ||
| 75 | ); | ||
| 76 | |||
| 77 | // Calculates the index'th external midi in jack id | ||
| 78 | let in_jack_id_ext = |index| 2 * index + 1; | ||
| 79 | // Calculates the index'th embedded midi out jack id | ||
| 80 | let out_jack_id_emb = |index| 2 * index + 2; | ||
| 81 | // Calculates the index'th external midi out jack id | ||
| 82 | let out_jack_id_ext = |index| 2 * n_in_jacks + 2 * index + 1; | ||
| 83 | // Calculates the index'th embedded midi in jack id | ||
| 84 | let in_jack_id_emb = |index| 2 * n_in_jacks + 2 * index + 2; | ||
| 85 | |||
| 86 | for i in 0..n_in_jacks { | ||
| 87 | alt.descriptor(CS_INTERFACE, &[MIDI_IN_JACK_SUBTYPE, EXTERNAL, in_jack_id_ext(i), 0x00]); | ||
| 88 | } | ||
| 89 | |||
| 90 | for i in 0..n_out_jacks { | ||
| 91 | alt.descriptor(CS_INTERFACE, &[MIDI_IN_JACK_SUBTYPE, EMBEDDED, in_jack_id_emb(i), 0x00]); | ||
| 92 | } | ||
| 93 | |||
| 94 | for i in 0..n_out_jacks { | ||
| 95 | alt.descriptor( | ||
| 96 | CS_INTERFACE, | ||
| 97 | &[ | ||
| 98 | MIDI_OUT_JACK_SUBTYPE, | ||
| 99 | EXTERNAL, | ||
| 100 | out_jack_id_ext(i), | ||
| 101 | 0x01, | ||
| 102 | in_jack_id_emb(i), | ||
| 103 | 0x01, | ||
| 104 | 0x00, | ||
| 105 | ], | ||
| 106 | ); | ||
| 107 | } | ||
| 108 | |||
| 109 | for i in 0..n_in_jacks { | ||
| 110 | alt.descriptor( | ||
| 111 | CS_INTERFACE, | ||
| 112 | &[ | ||
| 113 | MIDI_OUT_JACK_SUBTYPE, | ||
| 114 | EMBEDDED, | ||
| 115 | out_jack_id_emb(i), | ||
| 116 | 0x01, | ||
| 117 | in_jack_id_ext(i), | ||
| 118 | 0x01, | ||
| 119 | 0x00, | ||
| 120 | ], | ||
| 121 | ); | ||
| 122 | } | ||
| 123 | |||
| 124 | let mut endpoint_data = [ | ||
| 125 | MS_GENERAL, 0, // Number of jacks | ||
| 126 | 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, // Jack mappings | ||
| 127 | ]; | ||
| 128 | endpoint_data[1] = n_out_jacks; | ||
| 129 | for i in 0..n_out_jacks { | ||
| 130 | endpoint_data[2 + i as usize] = in_jack_id_emb(i); | ||
| 131 | } | ||
| 132 | let read_ep = alt.endpoint_bulk_out(max_packet_size); | ||
| 133 | alt.descriptor(CS_ENDPOINT, &endpoint_data[0..2 + n_out_jacks as usize]); | ||
| 134 | |||
| 135 | endpoint_data[1] = n_in_jacks; | ||
| 136 | for i in 0..n_in_jacks { | ||
| 137 | endpoint_data[2 + i as usize] = out_jack_id_emb(i); | ||
| 138 | } | ||
| 139 | let write_ep = alt.endpoint_bulk_in(max_packet_size); | ||
| 140 | alt.descriptor(CS_ENDPOINT, &endpoint_data[0..2 + n_in_jacks as usize]); | ||
| 141 | |||
| 142 | MidiClass { read_ep, write_ep } | ||
| 143 | } | ||
| 144 | |||
| 145 | /// Gets the maximum packet size in bytes. | ||
| 146 | pub fn max_packet_size(&self) -> u16 { | ||
| 147 | // The size is the same for both endpoints. | ||
| 148 | self.read_ep.info().max_packet_size | ||
| 149 | } | ||
| 150 | |||
| 151 | /// Writes a single packet into the IN endpoint. | ||
| 152 | pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> { | ||
| 153 | self.write_ep.write(data).await | ||
| 154 | } | ||
| 155 | |||
| 156 | /// Reads a single packet from the OUT endpoint. | ||
| 157 | pub async fn read_packet(&mut self, data: &mut [u8]) -> Result<usize, EndpointError> { | ||
| 158 | self.read_ep.read(data).await | ||
| 159 | } | ||
| 160 | |||
| 161 | /// Waits for the USB host to enable this interface | ||
| 162 | pub async fn wait_connection(&mut self) { | ||
| 163 | self.read_ep.wait_enabled().await; | ||
| 164 | } | ||
| 165 | |||
| 166 | /// Split the class into a sender and receiver. | ||
| 167 | /// | ||
| 168 | /// This allows concurrently sending and receiving packets from separate tasks. | ||
| 169 | pub fn split(self) -> (Sender<'d, D>, Receiver<'d, D>) { | ||
| 170 | ( | ||
| 171 | Sender { | ||
| 172 | write_ep: self.write_ep, | ||
| 173 | }, | ||
| 174 | Receiver { read_ep: self.read_ep }, | ||
| 175 | ) | ||
| 176 | } | ||
| 177 | } | ||
| 178 | |||
| 179 | /// Midi class packet sender. | ||
| 180 | /// | ||
| 181 | /// You can obtain a `Sender` with [`MidiClass::split`] | ||
| 182 | pub struct Sender<'d, D: Driver<'d>> { | ||
| 183 | write_ep: D::EndpointIn, | ||
| 184 | } | ||
| 185 | |||
| 186 | impl<'d, D: Driver<'d>> Sender<'d, D> { | ||
| 187 | /// Gets the maximum packet size in bytes. | ||
| 188 | pub fn max_packet_size(&self) -> u16 { | ||
| 189 | // The size is the same for both endpoints. | ||
| 190 | self.write_ep.info().max_packet_size | ||
| 191 | } | ||
| 192 | |||
| 193 | /// Writes a single packet. | ||
| 194 | pub async fn write_packet(&mut self, data: &[u8]) -> Result<(), EndpointError> { | ||
| 195 | self.write_ep.write(data).await | ||
| 196 | } | ||
| 197 | |||
| 198 | /// Waits for the USB host to enable this interface | ||
| 199 | pub async fn wait_connection(&mut self) { | ||
| 200 | self.write_ep.wait_enabled().await; | ||
| 201 | } | ||
| 202 | } | ||
| 203 | |||
| 204 | /// Midi class packet receiver. | ||
| 205 | /// | ||
| 206 | /// You can obtain a `Receiver` with [`MidiClass::split`] | ||
| 207 | pub struct Receiver<'d, D: Driver<'d>> { | ||
| 208 | read_ep: D::EndpointOut, | ||
| 209 | } | ||
| 210 | |||
| 211 | impl<'d, D: Driver<'d>> Receiver<'d, D> { | ||
| 212 | /// Gets the maximum packet size in bytes. | ||
| 213 | pub fn max_packet_size(&self) -> u16 { | ||
| 214 | // The size is the same for both endpoints. | ||
| 215 | self.read_ep.info().max_packet_size | ||
| 216 | } | ||
| 217 | |||
| 218 | /// Reads a single packet. | ||
| 219 | pub async fn read_packet(&mut self, data: &mut [u8]) -> Result<usize, EndpointError> { | ||
| 220 | self.read_ep.read(data).await | ||
| 221 | } | ||
| 222 | |||
| 223 | /// Waits for the USB host to enable this interface | ||
| 224 | pub async fn wait_connection(&mut self) { | ||
| 225 | self.read_ep.wait_enabled().await; | ||
| 226 | } | ||
| 227 | } | ||
diff --git a/embassy-usb/src/class/mod.rs b/embassy-usb/src/class/mod.rs index b23e03d40..452eedf17 100644 --- a/embassy-usb/src/class/mod.rs +++ b/embassy-usb/src/class/mod.rs | |||
| @@ -2,3 +2,4 @@ | |||
| 2 | pub mod cdc_acm; | 2 | pub mod cdc_acm; |
| 3 | pub mod cdc_ncm; | 3 | pub mod cdc_ncm; |
| 4 | pub mod hid; | 4 | pub mod hid; |
| 5 | pub mod midi; | ||
diff --git a/embassy-usb/src/control.rs b/embassy-usb/src/control.rs index ceccfd85b..79f736309 100644 --- a/embassy-usb/src/control.rs +++ b/embassy-usb/src/control.rs | |||
| @@ -120,7 +120,7 @@ impl Request { | |||
| 120 | } | 120 | } |
| 121 | 121 | ||
| 122 | /// Gets the descriptor type and index from the value field of a GET_DESCRIPTOR request. | 122 | /// Gets the descriptor type and index from the value field of a GET_DESCRIPTOR request. |
| 123 | pub fn descriptor_type_index(&self) -> (u8, u8) { | 123 | pub const fn descriptor_type_index(&self) -> (u8, u8) { |
| 124 | ((self.value >> 8) as u8, self.value as u8) | 124 | ((self.value >> 8) as u8, self.value as u8) |
| 125 | } | 125 | } |
| 126 | } | 126 | } |
diff --git a/embassy-usb/src/descriptor.rs b/embassy-usb/src/descriptor.rs index ae38e26ca..fa83ef583 100644 --- a/embassy-usb/src/descriptor.rs +++ b/embassy-usb/src/descriptor.rs | |||
| @@ -2,7 +2,7 @@ | |||
| 2 | 2 | ||
| 3 | use crate::builder::Config; | 3 | use crate::builder::Config; |
| 4 | use crate::driver::EndpointInfo; | 4 | use crate::driver::EndpointInfo; |
| 5 | use crate::types::*; | 5 | use crate::types::{InterfaceNumber, StringIndex}; |
| 6 | use crate::CONFIGURATION_VALUE; | 6 | use crate::CONFIGURATION_VALUE; |
| 7 | 7 | ||
| 8 | /// Standard descriptor types | 8 | /// Standard descriptor types |
| @@ -59,7 +59,7 @@ impl<'a> DescriptorWriter<'a> { | |||
| 59 | } | 59 | } |
| 60 | 60 | ||
| 61 | /// Gets the current position in the buffer, i.e. the number of bytes written so far. | 61 | /// Gets the current position in the buffer, i.e. the number of bytes written so far. |
| 62 | pub fn position(&self) -> usize { | 62 | pub const fn position(&self) -> usize { |
| 63 | self.position | 63 | self.position |
| 64 | } | 64 | } |
| 65 | 65 | ||
| @@ -67,9 +67,10 @@ impl<'a> DescriptorWriter<'a> { | |||
| 67 | pub fn write(&mut self, descriptor_type: u8, descriptor: &[u8]) { | 67 | pub fn write(&mut self, descriptor_type: u8, descriptor: &[u8]) { |
| 68 | let length = descriptor.len(); | 68 | let length = descriptor.len(); |
| 69 | 69 | ||
| 70 | if (self.position + 2 + length) > self.buf.len() || (length + 2) > 255 { | 70 | assert!( |
| 71 | panic!("Descriptor buffer full"); | 71 | (self.position + 2 + length) <= self.buf.len() && (length + 2) <= 255, |
| 72 | } | 72 | "Descriptor buffer full" |
| 73 | ); | ||
| 73 | 74 | ||
| 74 | self.buf[self.position] = (length + 2) as u8; | 75 | self.buf[self.position] = (length + 2) as u8; |
| 75 | self.buf[self.position + 1] = descriptor_type; | 76 | self.buf[self.position + 1] = descriptor_type; |
| @@ -102,7 +103,7 @@ impl<'a> DescriptorWriter<'a> { | |||
| 102 | config.serial_number.map_or(0, |_| 3), // iSerialNumber | 103 | config.serial_number.map_or(0, |_| 3), // iSerialNumber |
| 103 | 1, // bNumConfigurations | 104 | 1, // bNumConfigurations |
| 104 | ], | 105 | ], |
| 105 | ) | 106 | ); |
| 106 | } | 107 | } |
| 107 | 108 | ||
| 108 | pub(crate) fn configuration(&mut self, config: &Config) { | 109 | pub(crate) fn configuration(&mut self, config: &Config) { |
| @@ -120,7 +121,7 @@ impl<'a> DescriptorWriter<'a> { | |||
| 120 | | if config.supports_remote_wakeup { 0x20 } else { 0x00 }, // bmAttributes | 121 | | if config.supports_remote_wakeup { 0x20 } else { 0x00 }, // bmAttributes |
| 121 | (config.max_power / 2) as u8, // bMaxPower | 122 | (config.max_power / 2) as u8, // bMaxPower |
| 122 | ], | 123 | ], |
| 123 | ) | 124 | ); |
| 124 | } | 125 | } |
| 125 | 126 | ||
| 126 | #[allow(unused)] | 127 | #[allow(unused)] |
| @@ -248,9 +249,7 @@ impl<'a> DescriptorWriter<'a> { | |||
| 248 | pub(crate) fn string(&mut self, string: &str) { | 249 | pub(crate) fn string(&mut self, string: &str) { |
| 249 | let mut pos = self.position; | 250 | let mut pos = self.position; |
| 250 | 251 | ||
| 251 | if pos + 2 > self.buf.len() { | 252 | assert!(pos + 2 <= self.buf.len(), "Descriptor buffer full"); |
| 252 | panic!("Descriptor buffer full"); | ||
| 253 | } | ||
| 254 | 253 | ||
| 255 | self.buf[pos] = 0; // length placeholder | 254 | self.buf[pos] = 0; // length placeholder |
| 256 | self.buf[pos + 1] = descriptor_type::STRING; | 255 | self.buf[pos + 1] = descriptor_type::STRING; |
| @@ -258,9 +257,7 @@ impl<'a> DescriptorWriter<'a> { | |||
| 258 | pos += 2; | 257 | pos += 2; |
| 259 | 258 | ||
| 260 | for c in string.encode_utf16() { | 259 | for c in string.encode_utf16() { |
| 261 | if pos >= self.buf.len() { | 260 | assert!(pos < self.buf.len(), "Descriptor buffer full"); |
| 262 | panic!("Descriptor buffer full"); | ||
| 263 | } | ||
| 264 | 261 | ||
| 265 | self.buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); | 262 | self.buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); |
| 266 | pos += 2; | 263 | pos += 2; |
| @@ -279,9 +276,9 @@ pub struct BosWriter<'a> { | |||
| 279 | } | 276 | } |
| 280 | 277 | ||
| 281 | impl<'a> BosWriter<'a> { | 278 | impl<'a> BosWriter<'a> { |
| 282 | pub(crate) fn new(writer: DescriptorWriter<'a>) -> Self { | 279 | pub(crate) const fn new(writer: DescriptorWriter<'a>) -> Self { |
| 283 | Self { | 280 | Self { |
| 284 | writer: writer, | 281 | writer, |
| 285 | num_caps_mark: None, | 282 | num_caps_mark: None, |
| 286 | } | 283 | } |
| 287 | } | 284 | } |
| @@ -314,9 +311,10 @@ impl<'a> BosWriter<'a> { | |||
| 314 | let mut start = self.writer.position; | 311 | let mut start = self.writer.position; |
| 315 | let blen = data.len(); | 312 | let blen = data.len(); |
| 316 | 313 | ||
| 317 | if (start + blen + 3) > self.writer.buf.len() || (blen + 3) > 255 { | 314 | assert!( |
| 318 | panic!("Descriptor buffer full"); | 315 | (start + blen + 3) <= self.writer.buf.len() && (blen + 3) <= 255, |
| 319 | } | 316 | "Descriptor buffer full" |
| 317 | ); | ||
| 320 | 318 | ||
| 321 | self.writer.buf[start] = (blen + 3) as u8; | 319 | self.writer.buf[start] = (blen + 3) as u8; |
| 322 | self.writer.buf[start + 1] = descriptor_type::CAPABILITY; | 320 | self.writer.buf[start + 1] = descriptor_type::CAPABILITY; |
diff --git a/embassy-usb/src/descriptor_reader.rs b/embassy-usb/src/descriptor_reader.rs index 05adcce60..abb4b379e 100644 --- a/embassy-usb/src/descriptor_reader.rs +++ b/embassy-usb/src/descriptor_reader.rs | |||
| @@ -11,11 +11,11 @@ pub struct Reader<'a> { | |||
| 11 | } | 11 | } |
| 12 | 12 | ||
| 13 | impl<'a> Reader<'a> { | 13 | impl<'a> Reader<'a> { |
| 14 | pub fn new(data: &'a [u8]) -> Self { | 14 | pub const fn new(data: &'a [u8]) -> Self { |
| 15 | Self { data } | 15 | Self { data } |
| 16 | } | 16 | } |
| 17 | 17 | ||
| 18 | pub fn eof(&self) -> bool { | 18 | pub const fn eof(&self) -> bool { |
| 19 | self.data.is_empty() | 19 | self.data.is_empty() |
| 20 | } | 20 | } |
| 21 | 21 | ||
| @@ -102,7 +102,7 @@ pub fn foreach_endpoint(data: &[u8], mut f: impl FnMut(EndpointInfo)) -> Result< | |||
| 102 | } | 102 | } |
| 103 | descriptor_type::ENDPOINT => { | 103 | descriptor_type::ENDPOINT => { |
| 104 | ep.ep_address = EndpointAddress::from(r.read_u8()?); | 104 | ep.ep_address = EndpointAddress::from(r.read_u8()?); |
| 105 | f(ep) | 105 | f(ep); |
| 106 | } | 106 | } |
| 107 | _ => {} | 107 | _ => {} |
| 108 | } | 108 | } |
diff --git a/embassy-usb/src/lib.rs b/embassy-usb/src/lib.rs index 1180b9b66..88d88cad7 100644 --- a/embassy-usb/src/lib.rs +++ b/embassy-usb/src/lib.rs | |||
| @@ -24,12 +24,12 @@ use embassy_futures::select::{select, Either}; | |||
| 24 | use heapless::Vec; | 24 | use heapless::Vec; |
| 25 | 25 | ||
| 26 | pub use crate::builder::{Builder, Config, FunctionBuilder, InterfaceAltBuilder, InterfaceBuilder}; | 26 | pub use crate::builder::{Builder, Config, FunctionBuilder, InterfaceAltBuilder, InterfaceBuilder}; |
| 27 | use crate::config::*; | 27 | use crate::config::{MAX_HANDLER_COUNT, MAX_INTERFACE_COUNT}; |
| 28 | use crate::control::*; | 28 | use crate::control::{InResponse, OutResponse, Recipient, Request, RequestType}; |
| 29 | use crate::descriptor::*; | 29 | use crate::descriptor::{descriptor_type, lang_id}; |
| 30 | use crate::descriptor_reader::foreach_endpoint; | 30 | use crate::descriptor_reader::foreach_endpoint; |
| 31 | use crate::driver::{Bus, ControlPipe, Direction, Driver, EndpointAddress, Event}; | 31 | use crate::driver::{Bus, ControlPipe, Direction, Driver, EndpointAddress, Event}; |
| 32 | use crate::types::*; | 32 | use crate::types::{InterfaceNumber, StringIndex}; |
| 33 | 33 | ||
| 34 | /// The global state of the USB device. | 34 | /// The global state of the USB device. |
| 35 | /// | 35 | /// |
| @@ -294,7 +294,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> { | |||
| 294 | /// After dropping the future, [`UsbDevice::disable()`] should be called | 294 | /// After dropping the future, [`UsbDevice::disable()`] should be called |
| 295 | /// before calling any other `UsbDevice` methods to fully reset the | 295 | /// before calling any other `UsbDevice` methods to fully reset the |
| 296 | /// peripheral. | 296 | /// peripheral. |
| 297 | pub async fn run_until_suspend(&mut self) -> () { | 297 | pub async fn run_until_suspend(&mut self) { |
| 298 | while !self.inner.suspended { | 298 | while !self.inner.suspended { |
| 299 | let control_fut = self.control.setup(); | 299 | let control_fut = self.control.setup(); |
| 300 | let bus_fut = self.inner.bus.poll(); | 300 | let bus_fut = self.inner.bus.poll(); |
| @@ -364,6 +364,8 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> { | |||
| 364 | } | 364 | } |
| 365 | 365 | ||
| 366 | async fn handle_control_in(&mut self, req: Request) { | 366 | async fn handle_control_in(&mut self, req: Request) { |
| 367 | const DEVICE_DESCRIPTOR_LEN: usize = 18; | ||
| 368 | |||
| 367 | let mut resp_length = req.length as usize; | 369 | let mut resp_length = req.length as usize; |
| 368 | let max_packet_size = self.control.max_packet_size(); | 370 | let max_packet_size = self.control.max_packet_size(); |
| 369 | 371 | ||
| @@ -371,19 +373,15 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> { | |||
| 371 | // The host doesn't know our EP0 max packet size yet, and might assume | 373 | // The host doesn't know our EP0 max packet size yet, and might assume |
| 372 | // a full-length packet is a short packet, thinking we're done sending data. | 374 | // a full-length packet is a short packet, thinking we're done sending data. |
| 373 | // See https://github.com/hathach/tinyusb/issues/184 | 375 | // See https://github.com/hathach/tinyusb/issues/184 |
| 374 | const DEVICE_DESCRIPTOR_LEN: usize = 18; | 376 | if self.inner.address == 0 && max_packet_size < DEVICE_DESCRIPTOR_LEN && max_packet_size < resp_length { |
| 375 | if self.inner.address == 0 | ||
| 376 | && max_packet_size < DEVICE_DESCRIPTOR_LEN | ||
| 377 | && (max_packet_size as usize) < resp_length | ||
| 378 | { | ||
| 379 | trace!("received control req while not addressed: capping response to 1 packet."); | 377 | trace!("received control req while not addressed: capping response to 1 packet."); |
| 380 | resp_length = max_packet_size; | 378 | resp_length = max_packet_size; |
| 381 | } | 379 | } |
| 382 | 380 | ||
| 383 | match self.inner.handle_control_in(req, &mut self.control_buf) { | 381 | match self.inner.handle_control_in(req, self.control_buf) { |
| 384 | InResponse::Accepted(data) => { | 382 | InResponse::Accepted(data) => { |
| 385 | let len = data.len().min(resp_length); | 383 | let len = data.len().min(resp_length); |
| 386 | let need_zlp = len != resp_length && (len % usize::from(max_packet_size)) == 0; | 384 | let need_zlp = len != resp_length && (len % max_packet_size) == 0; |
| 387 | 385 | ||
| 388 | let chunks = data[0..len] | 386 | let chunks = data[0..len] |
| 389 | .chunks(max_packet_size) | 387 | .chunks(max_packet_size) |
| @@ -435,7 +433,7 @@ impl<'d, D: Driver<'d>> UsbDevice<'d, D> { | |||
| 435 | self.control.accept_set_address(self.inner.address).await; | 433 | self.control.accept_set_address(self.inner.address).await; |
| 436 | self.inner.set_address_pending = false; | 434 | self.inner.set_address_pending = false; |
| 437 | } else { | 435 | } else { |
| 438 | self.control.accept().await | 436 | self.control.accept().await; |
| 439 | } | 437 | } |
| 440 | } | 438 | } |
| 441 | OutResponse::Rejected => self.control.reject().await, | 439 | OutResponse::Rejected => self.control.reject().await, |
| @@ -548,9 +546,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> { | |||
| 548 | 546 | ||
| 549 | OutResponse::Accepted | 547 | OutResponse::Accepted |
| 550 | } | 548 | } |
| 551 | (Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => match self.device_state { | 549 | (Request::SET_CONFIGURATION, CONFIGURATION_NONE_U16) => { |
| 552 | UsbDeviceState::Default => OutResponse::Accepted, | 550 | if self.device_state != UsbDeviceState::Default { |
| 553 | _ => { | ||
| 554 | debug!("SET_CONFIGURATION: unconfigured"); | 551 | debug!("SET_CONFIGURATION: unconfigured"); |
| 555 | self.device_state = UsbDeviceState::Addressed; | 552 | self.device_state = UsbDeviceState::Addressed; |
| 556 | 553 | ||
| @@ -564,17 +561,15 @@ impl<'d, D: Driver<'d>> Inner<'d, D> { | |||
| 564 | for h in &mut self.handlers { | 561 | for h in &mut self.handlers { |
| 565 | h.configured(false); | 562 | h.configured(false); |
| 566 | } | 563 | } |
| 567 | |||
| 568 | OutResponse::Accepted | ||
| 569 | } | 564 | } |
| 570 | }, | 565 | OutResponse::Accepted |
| 566 | } | ||
| 571 | _ => OutResponse::Rejected, | 567 | _ => OutResponse::Rejected, |
| 572 | }, | 568 | }, |
| 573 | (RequestType::Standard, Recipient::Interface) => { | 569 | (RequestType::Standard, Recipient::Interface) => { |
| 574 | let iface_num = InterfaceNumber::new(req.index as _); | 570 | let iface_num = InterfaceNumber::new(req.index as _); |
| 575 | let iface = match self.interfaces.get_mut(iface_num.0 as usize) { | 571 | let Some(iface) = self.interfaces.get_mut(iface_num.0 as usize) else { |
| 576 | Some(iface) => iface, | 572 | return OutResponse::Rejected; |
| 577 | None => return OutResponse::Rejected, | ||
| 578 | }; | 573 | }; |
| 579 | 574 | ||
| 580 | match req.request { | 575 | match req.request { |
| @@ -650,9 +645,8 @@ impl<'d, D: Driver<'d>> Inner<'d, D> { | |||
| 650 | _ => InResponse::Rejected, | 645 | _ => InResponse::Rejected, |
| 651 | }, | 646 | }, |
| 652 | (RequestType::Standard, Recipient::Interface) => { | 647 | (RequestType::Standard, Recipient::Interface) => { |
| 653 | let iface = match self.interfaces.get_mut(req.index as usize) { | 648 | let Some(iface) = self.interfaces.get_mut(req.index as usize) else { |
| 654 | Some(iface) => iface, | 649 | return InResponse::Rejected; |
| 655 | None => return InResponse::Rejected, | ||
| 656 | }; | 650 | }; |
| 657 | 651 | ||
| 658 | match req.request { | 652 | match req.request { |
| @@ -706,7 +700,7 @@ impl<'d, D: Driver<'d>> Inner<'d, D> { | |||
| 706 | } | 700 | } |
| 707 | 701 | ||
| 708 | fn handle_control_in_delegated<'a>(&'a mut self, req: Request, buf: &'a mut [u8]) -> InResponse<'a> { | 702 | fn handle_control_in_delegated<'a>(&'a mut self, req: Request, buf: &'a mut [u8]) -> InResponse<'a> { |
| 709 | unsafe fn extend_lifetime<'x, 'y>(r: InResponse<'x>) -> InResponse<'y> { | 703 | unsafe fn extend_lifetime<'y>(r: InResponse<'_>) -> InResponse<'y> { |
| 710 | core::mem::transmute(r) | 704 | core::mem::transmute(r) |
| 711 | } | 705 | } |
| 712 | 706 | ||
| @@ -756,16 +750,12 @@ impl<'d, D: Driver<'d>> Inner<'d, D> { | |||
| 756 | }; | 750 | }; |
| 757 | 751 | ||
| 758 | if let Some(s) = s { | 752 | if let Some(s) = s { |
| 759 | if buf.len() < 2 { | 753 | assert!(buf.len() >= 2, "control buffer too small"); |
| 760 | panic!("control buffer too small"); | ||
| 761 | } | ||
| 762 | 754 | ||
| 763 | buf[1] = descriptor_type::STRING; | 755 | buf[1] = descriptor_type::STRING; |
| 764 | let mut pos = 2; | 756 | let mut pos = 2; |
| 765 | for c in s.encode_utf16() { | 757 | for c in s.encode_utf16() { |
| 766 | if pos + 2 >= buf.len() { | 758 | assert!(pos + 2 < buf.len(), "control buffer too small"); |
| 767 | panic!("control buffer too small"); | ||
| 768 | } | ||
| 769 | 759 | ||
| 770 | buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); | 760 | buf[pos..pos + 2].copy_from_slice(&c.to_le_bytes()); |
| 771 | pos += 2; | 761 | pos += 2; |
diff --git a/embassy-usb/src/msos.rs b/embassy-usb/src/msos.rs index 847338e5f..13d5d7c4b 100644 --- a/embassy-usb/src/msos.rs +++ b/embassy-usb/src/msos.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | 6 | ||
| 7 | use core::mem::size_of; | 7 | use core::mem::size_of; |
| 8 | 8 | ||
| 9 | use super::{capability_type, BosWriter}; | 9 | use crate::descriptor::{capability_type, BosWriter}; |
| 10 | use crate::types::InterfaceNumber; | 10 | use crate::types::InterfaceNumber; |
| 11 | 11 | ||
| 12 | /// A serialized Microsoft OS 2.0 Descriptor set. | 12 | /// A serialized Microsoft OS 2.0 Descriptor set. |
diff --git a/embassy-usb/src/types.rs b/embassy-usb/src/types.rs index c7a47f7e4..cb9fe2576 100644 --- a/embassy-usb/src/types.rs +++ b/embassy-usb/src/types.rs | |||
| @@ -7,7 +7,7 @@ | |||
| 7 | pub struct InterfaceNumber(pub u8); | 7 | pub struct InterfaceNumber(pub u8); |
| 8 | 8 | ||
| 9 | impl InterfaceNumber { | 9 | impl InterfaceNumber { |
| 10 | pub(crate) fn new(index: u8) -> InterfaceNumber { | 10 | pub(crate) const fn new(index: u8) -> InterfaceNumber { |
| 11 | InterfaceNumber(index) | 11 | InterfaceNumber(index) |
| 12 | } | 12 | } |
| 13 | } | 13 | } |
| @@ -25,7 +25,7 @@ impl From<InterfaceNumber> for u8 { | |||
| 25 | pub struct StringIndex(pub u8); | 25 | pub struct StringIndex(pub u8); |
| 26 | 26 | ||
| 27 | impl StringIndex { | 27 | impl StringIndex { |
| 28 | pub(crate) fn new(index: u8) -> StringIndex { | 28 | pub(crate) const fn new(index: u8) -> StringIndex { |
| 29 | StringIndex(index) | 29 | StringIndex(index) |
| 30 | } | 30 | } |
| 31 | } | 31 | } |
diff --git a/examples/boot/application/nrf/Cargo.toml b/examples/boot/application/nrf/Cargo.toml index 435a33919..275367ff7 100644 --- a/examples/boot/application/nrf/Cargo.toml +++ b/examples/boot/application/nrf/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly"] } |
| 11 | embassy-nrf = { version = "0.1.0", path = "../../../../embassy-nrf", features = ["time-driver-rtc1", "gpiote", "nightly"] } | 11 | embassy-nrf = { version = "0.1.0", path = "../../../../embassy-nrf", features = ["time-driver-rtc1", "gpiote", "nightly"] } |
| 12 | embassy-boot = { version = "0.1.0", path = "../../../../embassy-boot/boot", features = ["nightly"] } | 12 | embassy-boot = { version = "0.1.0", path = "../../../../embassy-boot/boot", features = ["nightly"] } |
| 13 | embassy-boot-nrf = { version = "0.1.0", path = "../../../../embassy-boot/nrf", features = ["nightly"] } | 13 | embassy-boot-nrf = { version = "0.1.0", path = "../../../../embassy-boot/nrf", features = ["nightly"] } |
diff --git a/examples/boot/application/nrf/src/bin/b.rs b/examples/boot/application/nrf/src/bin/b.rs index 15ebce5fa..a88c3c56c 100644 --- a/examples/boot/application/nrf/src/bin/b.rs +++ b/examples/boot/application/nrf/src/bin/b.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | 5 | ||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; | 7 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use panic_reset as _; | 9 | use panic_reset as _; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -19,8 +19,8 @@ async fn main(_spawner: Spawner) { | |||
| 19 | 19 | ||
| 20 | loop { | 20 | loop { |
| 21 | led.set_high(); | 21 | led.set_high(); |
| 22 | Timer::after(Duration::from_millis(300)).await; | 22 | Timer::after_millis(300).await; |
| 23 | led.set_low(); | 23 | led.set_low(); |
| 24 | Timer::after(Duration::from_millis(300)).await; | 24 | Timer::after_millis(300).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
diff --git a/examples/boot/application/rp/Cargo.toml b/examples/boot/application/rp/Cargo.toml index 01cfc5994..da89f15da 100644 --- a/examples/boot/application/rp/Cargo.toml +++ b/examples/boot/application/rp/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers", "arch-cortex-m", "executor-thread"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly"] } |
| 11 | embassy-rp = { version = "0.1.0", path = "../../../../embassy-rp", features = ["time-driver", "unstable-traits", "nightly"] } | 11 | embassy-rp = { version = "0.1.0", path = "../../../../embassy-rp", features = ["time-driver", "unstable-traits", "nightly"] } |
| 12 | embassy-boot-rp = { version = "0.1.0", path = "../../../../embassy-boot/rp", features = ["nightly"] } | 12 | embassy-boot-rp = { version = "0.1.0", path = "../../../../embassy-boot/rp", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/rp/src/bin/a.rs b/examples/boot/application/rp/src/bin/a.rs index a4602a7ed..6fd5d7f60 100644 --- a/examples/boot/application/rp/src/bin/a.rs +++ b/examples/boot/application/rp/src/bin/a.rs | |||
| @@ -41,7 +41,7 @@ async fn main(_s: Spawner) { | |||
| 41 | let mut aligned = AlignedBuffer([0; 1]); | 41 | let mut aligned = AlignedBuffer([0; 1]); |
| 42 | let mut updater = BlockingFirmwareUpdater::new(config, &mut aligned.0); | 42 | let mut updater = BlockingFirmwareUpdater::new(config, &mut aligned.0); |
| 43 | 43 | ||
| 44 | Timer::after(Duration::from_secs(5)).await; | 44 | Timer::after_secs(5).await; |
| 45 | watchdog.feed(); | 45 | watchdog.feed(); |
| 46 | led.set_high(); | 46 | led.set_high(); |
| 47 | let mut offset = 0; | 47 | let mut offset = 0; |
| @@ -61,7 +61,7 @@ async fn main(_s: Spawner) { | |||
| 61 | watchdog.feed(); | 61 | watchdog.feed(); |
| 62 | defmt::info!("firmware written, marking update"); | 62 | defmt::info!("firmware written, marking update"); |
| 63 | updater.mark_updated().unwrap(); | 63 | updater.mark_updated().unwrap(); |
| 64 | Timer::after(Duration::from_secs(2)).await; | 64 | Timer::after_secs(2).await; |
| 65 | led.set_low(); | 65 | led.set_low(); |
| 66 | defmt::info!("update marked, resetting"); | 66 | defmt::info!("update marked, resetting"); |
| 67 | cortex_m::peripheral::SCB::sys_reset(); | 67 | cortex_m::peripheral::SCB::sys_reset(); |
diff --git a/examples/boot/application/rp/src/bin/b.rs b/examples/boot/application/rp/src/bin/b.rs index 47dec329c..1eca5b4a2 100644 --- a/examples/boot/application/rp/src/bin/b.rs +++ b/examples/boot/application/rp/src/bin/b.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use embassy_executor::Spawner; | 5 | use embassy_executor::Spawner; |
| 6 | use embassy_rp::gpio; | 6 | use embassy_rp::gpio; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use gpio::{Level, Output}; | 8 | use gpio::{Level, Output}; |
| 9 | use {defmt_rtt as _, panic_reset as _}; | 9 | use {defmt_rtt as _, panic_reset as _}; |
| 10 | 10 | ||
| @@ -15,9 +15,9 @@ async fn main(_s: Spawner) { | |||
| 15 | 15 | ||
| 16 | loop { | 16 | loop { |
| 17 | led.set_high(); | 17 | led.set_high(); |
| 18 | Timer::after(Duration::from_millis(100)).await; | 18 | Timer::after_millis(100).await; |
| 19 | 19 | ||
| 20 | led.set_low(); | 20 | led.set_low(); |
| 21 | Timer::after(Duration::from_millis(100)).await; | 21 | Timer::after_millis(100).await; |
| 22 | } | 22 | } |
| 23 | } | 23 | } |
diff --git a/examples/boot/application/stm32f3/Cargo.toml b/examples/boot/application/stm32f3/Cargo.toml index a0649cf83..147a5bcf5 100644 --- a/examples/boot/application/stm32f3/Cargo.toml +++ b/examples/boot/application/stm32f3/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32f303re", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32f303re", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32f3/src/bin/b.rs b/examples/boot/application/stm32f3/src/bin/b.rs index a5862b1b0..8411f384c 100644 --- a/examples/boot/application/stm32f3/src/bin/b.rs +++ b/examples/boot/application/stm32f3/src/bin/b.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,9 +16,9 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | loop { | 17 | loop { |
| 18 | led.set_high(); | 18 | led.set_high(); |
| 19 | Timer::after(Duration::from_millis(500)).await; | 19 | Timer::after_millis(500).await; |
| 20 | 20 | ||
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(500)).await; | 22 | Timer::after_millis(500).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/boot/application/stm32f7/Cargo.toml b/examples/boot/application/stm32f7/Cargo.toml index ca1c0c424..3fa136aea 100644 --- a/examples/boot/application/stm32f7/Cargo.toml +++ b/examples/boot/application/stm32f7/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32f767zi", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32f767zi", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32f7/src/bin/b.rs b/examples/boot/application/stm32f7/src/bin/b.rs index 16c94d845..4c2ad06a2 100644 --- a/examples/boot/application/stm32f7/src/bin/b.rs +++ b/examples/boot/application/stm32f7/src/bin/b.rs | |||
| @@ -6,21 +6,21 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| 13 | async fn main(_spawner: Spawner) { | 13 | async fn main(_spawner: Spawner) { |
| 14 | let p = embassy_stm32::init(Default::default()); | 14 | let p = embassy_stm32::init(Default::default()); |
| 15 | Timer::after(Duration::from_millis(300)).await; | 15 | Timer::after_millis(300).await; |
| 16 | let mut led = Output::new(p.PB7, Level::High, Speed::Low); | 16 | let mut led = Output::new(p.PB7, Level::High, Speed::Low); |
| 17 | led.set_high(); | 17 | led.set_high(); |
| 18 | 18 | ||
| 19 | loop { | 19 | loop { |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | led.set_low(); | 23 | led.set_low(); |
| 24 | Timer::after(Duration::from_millis(500)).await; | 24 | Timer::after_millis(500).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
diff --git a/examples/boot/application/stm32h7/Cargo.toml b/examples/boot/application/stm32h7/Cargo.toml index e50c8c415..7ca767bde 100644 --- a/examples/boot/application/stm32h7/Cargo.toml +++ b/examples/boot/application/stm32h7/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32h743zi", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32h743zi", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32h7/src/bin/b.rs b/examples/boot/application/stm32h7/src/bin/b.rs index 34799279c..5c03e2d0c 100644 --- a/examples/boot/application/stm32h7/src/bin/b.rs +++ b/examples/boot/application/stm32h7/src/bin/b.rs | |||
| @@ -6,21 +6,21 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| 13 | async fn main(_spawner: Spawner) { | 13 | async fn main(_spawner: Spawner) { |
| 14 | let p = embassy_stm32::init(Default::default()); | 14 | let p = embassy_stm32::init(Default::default()); |
| 15 | Timer::after(Duration::from_millis(300)).await; | 15 | Timer::after_millis(300).await; |
| 16 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); | 16 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); |
| 17 | led.set_high(); | 17 | led.set_high(); |
| 18 | 18 | ||
| 19 | loop { | 19 | loop { |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | led.set_low(); | 23 | led.set_low(); |
| 24 | Timer::after(Duration::from_millis(500)).await; | 24 | Timer::after_millis(500).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
diff --git a/examples/boot/application/stm32l0/Cargo.toml b/examples/boot/application/stm32l0/Cargo.toml index 1f1a0f3cf..3e3cbbd82 100644 --- a/examples/boot/application/stm32l0/Cargo.toml +++ b/examples/boot/application/stm32l0/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l072cz", "time-driver-any", "exti", "memory-x"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l072cz", "time-driver-any", "exti", "memory-x"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32l0/src/bin/a.rs b/examples/boot/application/stm32l0/src/bin/a.rs index b4cdcd44d..42e1a71eb 100644 --- a/examples/boot/application/stm32l0/src/bin/a.rs +++ b/examples/boot/application/stm32l0/src/bin/a.rs | |||
| @@ -11,7 +11,7 @@ use embassy_stm32::exti::ExtiInput; | |||
| 11 | use embassy_stm32::flash::{Flash, WRITE_SIZE}; | 11 | use embassy_stm32::flash::{Flash, WRITE_SIZE}; |
| 12 | use embassy_stm32::gpio::{Input, Level, Output, Pull, Speed}; | 12 | use embassy_stm32::gpio::{Input, Level, Output, Pull, Speed}; |
| 13 | use embassy_sync::mutex::Mutex; | 13 | use embassy_sync::mutex::Mutex; |
| 14 | use embassy_time::{Duration, Timer}; | 14 | use embassy_time::Timer; |
| 15 | use panic_reset as _; | 15 | use panic_reset as _; |
| 16 | 16 | ||
| 17 | #[cfg(feature = "skip-include")] | 17 | #[cfg(feature = "skip-include")] |
| @@ -46,6 +46,6 @@ async fn main(_spawner: Spawner) { | |||
| 46 | 46 | ||
| 47 | updater.mark_updated().await.unwrap(); | 47 | updater.mark_updated().await.unwrap(); |
| 48 | led.set_low(); | 48 | led.set_low(); |
| 49 | Timer::after(Duration::from_secs(1)).await; | 49 | Timer::after_secs(1).await; |
| 50 | cortex_m::peripheral::SCB::sys_reset(); | 50 | cortex_m::peripheral::SCB::sys_reset(); |
| 51 | } | 51 | } |
diff --git a/examples/boot/application/stm32l0/src/bin/b.rs b/examples/boot/application/stm32l0/src/bin/b.rs index ee40274ff..52d42395f 100644 --- a/examples/boot/application/stm32l0/src/bin/b.rs +++ b/examples/boot/application/stm32l0/src/bin/b.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,9 +16,9 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | loop { | 17 | loop { |
| 18 | led.set_high(); | 18 | led.set_high(); |
| 19 | Timer::after(Duration::from_millis(500)).await; | 19 | Timer::after_millis(500).await; |
| 20 | 20 | ||
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(500)).await; | 22 | Timer::after_millis(500).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/boot/application/stm32l1/Cargo.toml b/examples/boot/application/stm32l1/Cargo.toml index 45b12813e..5e77b7d53 100644 --- a/examples/boot/application/stm32l1/Cargo.toml +++ b/examples/boot/application/stm32l1/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l151cb-a", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l151cb-a", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32l1/src/bin/a.rs b/examples/boot/application/stm32l1/src/bin/a.rs index b4cdcd44d..42e1a71eb 100644 --- a/examples/boot/application/stm32l1/src/bin/a.rs +++ b/examples/boot/application/stm32l1/src/bin/a.rs | |||
| @@ -11,7 +11,7 @@ use embassy_stm32::exti::ExtiInput; | |||
| 11 | use embassy_stm32::flash::{Flash, WRITE_SIZE}; | 11 | use embassy_stm32::flash::{Flash, WRITE_SIZE}; |
| 12 | use embassy_stm32::gpio::{Input, Level, Output, Pull, Speed}; | 12 | use embassy_stm32::gpio::{Input, Level, Output, Pull, Speed}; |
| 13 | use embassy_sync::mutex::Mutex; | 13 | use embassy_sync::mutex::Mutex; |
| 14 | use embassy_time::{Duration, Timer}; | 14 | use embassy_time::Timer; |
| 15 | use panic_reset as _; | 15 | use panic_reset as _; |
| 16 | 16 | ||
| 17 | #[cfg(feature = "skip-include")] | 17 | #[cfg(feature = "skip-include")] |
| @@ -46,6 +46,6 @@ async fn main(_spawner: Spawner) { | |||
| 46 | 46 | ||
| 47 | updater.mark_updated().await.unwrap(); | 47 | updater.mark_updated().await.unwrap(); |
| 48 | led.set_low(); | 48 | led.set_low(); |
| 49 | Timer::after(Duration::from_secs(1)).await; | 49 | Timer::after_secs(1).await; |
| 50 | cortex_m::peripheral::SCB::sys_reset(); | 50 | cortex_m::peripheral::SCB::sys_reset(); |
| 51 | } | 51 | } |
diff --git a/examples/boot/application/stm32l1/src/bin/b.rs b/examples/boot/application/stm32l1/src/bin/b.rs index ee40274ff..52d42395f 100644 --- a/examples/boot/application/stm32l1/src/bin/b.rs +++ b/examples/boot/application/stm32l1/src/bin/b.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,9 +16,9 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | loop { | 17 | loop { |
| 18 | led.set_high(); | 18 | led.set_high(); |
| 19 | Timer::after(Duration::from_millis(500)).await; | 19 | Timer::after_millis(500).await; |
| 20 | 20 | ||
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(500)).await; | 22 | Timer::after_millis(500).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/boot/application/stm32l4/Cargo.toml b/examples/boot/application/stm32l4/Cargo.toml index d0d0d0fbe..aa5c5cf9f 100644 --- a/examples/boot/application/stm32l4/Cargo.toml +++ b/examples/boot/application/stm32l4/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l475vg", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32l475vg", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32l4/src/bin/b.rs b/examples/boot/application/stm32l4/src/bin/b.rs index a5862b1b0..8411f384c 100644 --- a/examples/boot/application/stm32l4/src/bin/b.rs +++ b/examples/boot/application/stm32l4/src/bin/b.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,9 +16,9 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | loop { | 17 | loop { |
| 18 | led.set_high(); | 18 | led.set_high(); |
| 19 | Timer::after(Duration::from_millis(500)).await; | 19 | Timer::after_millis(500).await; |
| 20 | 20 | ||
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(500)).await; | 22 | Timer::after_millis(500).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/boot/application/stm32wl/Cargo.toml b/examples/boot/application/stm32wl/Cargo.toml index 3265b9f1a..87b8a1161 100644 --- a/examples/boot/application/stm32wl/Cargo.toml +++ b/examples/boot/application/stm32wl/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } | 8 | embassy-sync = { version = "0.3.0", path = "../../../../embassy-sync" } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../../../embassy-time", features = ["nightly", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32wl55jc-cm4", "time-driver-any", "exti"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../../../embassy-stm32", features = ["unstable-traits", "nightly", "stm32wl55jc-cm4", "time-driver-any", "exti"] } |
| 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } | 12 | embassy-boot-stm32 = { version = "0.1.0", path = "../../../../embassy-boot/stm32", features = ["nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../../../embassy-embedded-hal" } |
diff --git a/examples/boot/application/stm32wl/src/bin/b.rs b/examples/boot/application/stm32wl/src/bin/b.rs index f9f0ffc60..1ca3c6ea8 100644 --- a/examples/boot/application/stm32wl/src/bin/b.rs +++ b/examples/boot/application/stm32wl/src/bin/b.rs | |||
| @@ -6,7 +6,7 @@ | |||
| 6 | use defmt_rtt::*; | 6 | use defmt_rtt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::gpio::{Level, Output, Speed}; | 8 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use panic_reset as _; | 10 | use panic_reset as _; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,9 +16,9 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | loop { | 17 | loop { |
| 18 | led.set_high(); | 18 | led.set_high(); |
| 19 | Timer::after(Duration::from_millis(500)).await; | 19 | Timer::after_millis(500).await; |
| 20 | 20 | ||
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(500)).await; | 22 | Timer::after_millis(500).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/nrf-rtos-trace/Cargo.toml b/examples/nrf-rtos-trace/Cargo.toml index e402e49f4..e5820f26d 100644 --- a/examples/nrf-rtos-trace/Cargo.toml +++ b/examples/nrf-rtos-trace/Cargo.toml | |||
| @@ -18,7 +18,7 @@ log = [ | |||
| 18 | [dependencies] | 18 | [dependencies] |
| 19 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync" } | 19 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync" } |
| 20 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "rtos-trace", "rtos-trace-interrupt", "integrated-timers"] } | 20 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "rtos-trace", "rtos-trace-interrupt", "integrated-timers"] } |
| 21 | embassy-time = { version = "0.1.3", path = "../../embassy-time" } | 21 | embassy-time = { version = "0.1.5", path = "../../embassy-time" } |
| 22 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac"] } | 22 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac"] } |
| 23 | 23 | ||
| 24 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } | 24 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } |
diff --git a/examples/nrf-rtos-trace/src/bin/rtos_trace.rs b/examples/nrf-rtos-trace/src/bin/rtos_trace.rs index cf8b2f808..888375693 100644 --- a/examples/nrf-rtos-trace/src/bin/rtos_trace.rs +++ b/examples/nrf-rtos-trace/src/bin/rtos_trace.rs | |||
| @@ -6,7 +6,7 @@ use core::future::poll_fn; | |||
| 6 | use core::task::Poll; | 6 | use core::task::Poll; |
| 7 | 7 | ||
| 8 | use embassy_executor::Spawner; | 8 | use embassy_executor::Spawner; |
| 9 | use embassy_time::{Duration, Instant, Timer}; | 9 | use embassy_time::{Instant, Timer}; |
| 10 | #[cfg(feature = "log")] | 10 | #[cfg(feature = "log")] |
| 11 | use log::*; | 11 | use log::*; |
| 12 | use panic_probe as _; | 12 | use panic_probe as _; |
| @@ -34,7 +34,7 @@ async fn run1() { | |||
| 34 | info!("DING DONG"); | 34 | info!("DING DONG"); |
| 35 | #[cfg(not(feature = "log"))] | 35 | #[cfg(not(feature = "log"))] |
| 36 | rtos_trace::trace::marker(13); | 36 | rtos_trace::trace::marker(13); |
| 37 | Timer::after(Duration::from_ticks(16000)).await; | 37 | Timer::after_ticks(16000).await; |
| 38 | } | 38 | } |
| 39 | } | 39 | } |
| 40 | 40 | ||
diff --git a/examples/nrf52840-rtic/Cargo.toml b/examples/nrf52840-rtic/Cargo.toml index c588b807e..a81d43a26 100644 --- a/examples/nrf52840-rtic/Cargo.toml +++ b/examples/nrf52840-rtic/Cargo.toml | |||
| @@ -9,7 +9,7 @@ rtic = { version = "2", features = ["thumbv7-backend"] } | |||
| 9 | 9 | ||
| 10 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 10 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime", "generic-queue"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime", "generic-queue"] } |
| 13 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["nightly", "unstable-traits", "defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] } | 13 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["nightly", "unstable-traits", "defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] } |
| 14 | 14 | ||
| 15 | defmt = "0.3" | 15 | defmt = "0.3" |
diff --git a/examples/nrf52840-rtic/memory.x b/examples/nrf52840-rtic/memory.x index 9b04edec0..15b492bce 100644 --- a/examples/nrf52840-rtic/memory.x +++ b/examples/nrf52840-rtic/memory.x | |||
| @@ -1,7 +1,12 @@ | |||
| 1 | MEMORY | 1 | MEMORY |
| 2 | { | 2 | { |
| 3 | /* NOTE 1 K = 1 KiBi = 1024 bytes */ | 3 | /* NOTE 1 K = 1 KiBi = 1024 bytes */ |
| 4 | /* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */ | ||
| 5 | FLASH : ORIGIN = 0x00000000, LENGTH = 1024K | 4 | FLASH : ORIGIN = 0x00000000, LENGTH = 1024K |
| 6 | RAM : ORIGIN = 0x20000000, LENGTH = 256K | 5 | RAM : ORIGIN = 0x20000000, LENGTH = 256K |
| 6 | |||
| 7 | /* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */ | ||
| 8 | /* | ||
| 9 | FLASH : ORIGIN = 0x00027000, LENGTH = 868K | ||
| 10 | RAM : ORIGIN = 0x20020000, LENGTH = 128K | ||
| 11 | */ | ||
| 7 | } | 12 | } |
diff --git a/examples/nrf52840-rtic/src/bin/blinky.rs b/examples/nrf52840-rtic/src/bin/blinky.rs index a682c1932..060bb9ebc 100644 --- a/examples/nrf52840-rtic/src/bin/blinky.rs +++ b/examples/nrf52840-rtic/src/bin/blinky.rs | |||
| @@ -9,7 +9,7 @@ mod app { | |||
| 9 | use defmt::info; | 9 | use defmt::info; |
| 10 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; | 10 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; |
| 11 | use embassy_nrf::peripherals; | 11 | use embassy_nrf::peripherals; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | 13 | ||
| 14 | #[shared] | 14 | #[shared] |
| 15 | struct Shared {} | 15 | struct Shared {} |
| @@ -34,10 +34,10 @@ mod app { | |||
| 34 | loop { | 34 | loop { |
| 35 | info!("off!"); | 35 | info!("off!"); |
| 36 | led.set_high(); | 36 | led.set_high(); |
| 37 | Timer::after(Duration::from_millis(300)).await; | 37 | Timer::after_millis(300).await; |
| 38 | info!("on!"); | 38 | info!("on!"); |
| 39 | led.set_low(); | 39 | led.set_low(); |
| 40 | Timer::after(Duration::from_millis(300)).await; | 40 | Timer::after_millis(300).await; |
| 41 | } | 41 | } |
| 42 | } | 42 | } |
| 43 | } | 43 | } |
diff --git a/examples/nrf52840/Cargo.toml b/examples/nrf52840/Cargo.toml index d45e006c7..753733509 100644 --- a/examples/nrf52840/Cargo.toml +++ b/examples/nrf52840/Cargo.toml | |||
| @@ -31,12 +31,12 @@ nightly = [ | |||
| 31 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 31 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 32 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 32 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 33 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } | 33 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } |
| 34 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime"] } | 34 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime"] } |
| 35 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] } | 35 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac", "time"] } |
| 36 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true } | 36 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet"], optional = true } |
| 37 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt", "msos-descriptor",], optional = true } | 37 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt", "msos-descriptor",], optional = true } |
| 38 | embedded-io = { version = "0.5.0", features = ["defmt-03"] } | 38 | embedded-io = { version = "0.6.0", features = ["defmt-03"] } |
| 39 | embedded-io-async = { version = "0.5.0", optional = true, features = ["defmt-03"] } | 39 | embedded-io-async = { version = "0.6.0", optional = true, features = ["defmt-03"] } |
| 40 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["time", "defmt"], optional = true } | 40 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["time", "defmt"], optional = true } |
| 41 | lora-phy = { version = "2", optional = true } | 41 | lora-phy = { version = "2", optional = true } |
| 42 | lorawan-device = { version = "0.11.0", default-features = false, features = ["async", "external-lora-phy"], optional = true } | 42 | lorawan-device = { version = "0.11.0", default-features = false, features = ["async", "external-lora-phy"], optional = true } |
diff --git a/examples/nrf52840/memory.x b/examples/nrf52840/memory.x index 9b04edec0..15b492bce 100644 --- a/examples/nrf52840/memory.x +++ b/examples/nrf52840/memory.x | |||
| @@ -1,7 +1,12 @@ | |||
| 1 | MEMORY | 1 | MEMORY |
| 2 | { | 2 | { |
| 3 | /* NOTE 1 K = 1 KiBi = 1024 bytes */ | 3 | /* NOTE 1 K = 1 KiBi = 1024 bytes */ |
| 4 | /* These values correspond to the NRF52840 with Softdevices S140 7.0.1 */ | ||
| 5 | FLASH : ORIGIN = 0x00000000, LENGTH = 1024K | 4 | FLASH : ORIGIN = 0x00000000, LENGTH = 1024K |
| 6 | RAM : ORIGIN = 0x20000000, LENGTH = 256K | 5 | RAM : ORIGIN = 0x20000000, LENGTH = 256K |
| 6 | |||
| 7 | /* These values correspond to the NRF52840 with Softdevices S140 7.3.0 */ | ||
| 8 | /* | ||
| 9 | FLASH : ORIGIN = 0x00027000, LENGTH = 868K | ||
| 10 | RAM : ORIGIN = 0x20020000, LENGTH = 128K | ||
| 11 | */ | ||
| 7 | } | 12 | } |
diff --git a/examples/nrf52840/src/bin/blinky.rs b/examples/nrf52840/src/bin/blinky.rs index 513f6cd82..d3d1a7122 100644 --- a/examples/nrf52840/src/bin/blinky.rs +++ b/examples/nrf52840/src/bin/blinky.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use embassy_executor::Spawner; | 5 | use embassy_executor::Spawner; |
| 6 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; | 6 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | #[embassy_executor::main] | 10 | #[embassy_executor::main] |
| @@ -14,8 +14,8 @@ async fn main(_spawner: Spawner) { | |||
| 14 | 14 | ||
| 15 | loop { | 15 | loop { |
| 16 | led.set_high(); | 16 | led.set_high(); |
| 17 | Timer::after(Duration::from_millis(300)).await; | 17 | Timer::after_millis(300).await; |
| 18 | led.set_low(); | 18 | led.set_low(); |
| 19 | Timer::after(Duration::from_millis(300)).await; | 19 | Timer::after_millis(300).await; |
| 20 | } | 20 | } |
| 21 | } | 21 | } |
diff --git a/examples/nrf52840/src/bin/channel.rs b/examples/nrf52840/src/bin/channel.rs index bd9c909da..d3c7b47d2 100644 --- a/examples/nrf52840/src/bin/channel.rs +++ b/examples/nrf52840/src/bin/channel.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; | 7 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; |
| 8 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; | 8 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; |
| 9 | use embassy_sync::channel::Channel; | 9 | use embassy_sync::channel::Channel; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | enum LedState { | 13 | enum LedState { |
| @@ -21,9 +21,9 @@ static CHANNEL: Channel<ThreadModeRawMutex, LedState, 1> = Channel::new(); | |||
| 21 | async fn my_task() { | 21 | async fn my_task() { |
| 22 | loop { | 22 | loop { |
| 23 | CHANNEL.send(LedState::On).await; | 23 | CHANNEL.send(LedState::On).await; |
| 24 | Timer::after(Duration::from_secs(1)).await; | 24 | Timer::after_secs(1).await; |
| 25 | CHANNEL.send(LedState::Off).await; | 25 | CHANNEL.send(LedState::Off).await; |
| 26 | Timer::after(Duration::from_secs(1)).await; | 26 | Timer::after_secs(1).await; |
| 27 | } | 27 | } |
| 28 | } | 28 | } |
| 29 | 29 | ||
diff --git a/examples/nrf52840/src/bin/channel_sender_receiver.rs b/examples/nrf52840/src/bin/channel_sender_receiver.rs index ec4f1d800..79d2c4048 100644 --- a/examples/nrf52840/src/bin/channel_sender_receiver.rs +++ b/examples/nrf52840/src/bin/channel_sender_receiver.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_nrf::gpio::{AnyPin, Level, Output, OutputDrive, Pin}; | 7 | use embassy_nrf::gpio::{AnyPin, Level, Output, OutputDrive, Pin}; |
| 8 | use embassy_sync::blocking_mutex::raw::NoopRawMutex; | 8 | use embassy_sync::blocking_mutex::raw::NoopRawMutex; |
| 9 | use embassy_sync::channel::{Channel, Receiver, Sender}; | 9 | use embassy_sync::channel::{Channel, Receiver, Sender}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use static_cell::StaticCell; | 11 | use static_cell::StaticCell; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| @@ -22,9 +22,9 @@ static CHANNEL: StaticCell<Channel<NoopRawMutex, LedState, 1>> = StaticCell::new | |||
| 22 | async fn send_task(sender: Sender<'static, NoopRawMutex, LedState, 1>) { | 22 | async fn send_task(sender: Sender<'static, NoopRawMutex, LedState, 1>) { |
| 23 | loop { | 23 | loop { |
| 24 | sender.send(LedState::On).await; | 24 | sender.send(LedState::On).await; |
| 25 | Timer::after(Duration::from_secs(1)).await; | 25 | Timer::after_secs(1).await; |
| 26 | sender.send(LedState::Off).await; | 26 | sender.send(LedState::Off).await; |
| 27 | Timer::after(Duration::from_secs(1)).await; | 27 | Timer::after_secs(1).await; |
| 28 | } | 28 | } |
| 29 | } | 29 | } |
| 30 | 30 | ||
diff --git a/examples/nrf52840/src/bin/executor_fairness_test.rs b/examples/nrf52840/src/bin/executor_fairness_test.rs index 2a28f2763..f111b272e 100644 --- a/examples/nrf52840/src/bin/executor_fairness_test.rs +++ b/examples/nrf52840/src/bin/executor_fairness_test.rs | |||
| @@ -7,14 +7,14 @@ use core::task::Poll; | |||
| 7 | 7 | ||
| 8 | use defmt::{info, unwrap}; | 8 | use defmt::{info, unwrap}; |
| 9 | use embassy_executor::Spawner; | 9 | use embassy_executor::Spawner; |
| 10 | use embassy_time::{Duration, Instant, Timer}; | 10 | use embassy_time::{Instant, Timer}; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::task] | 13 | #[embassy_executor::task] |
| 14 | async fn run1() { | 14 | async fn run1() { |
| 15 | loop { | 15 | loop { |
| 16 | info!("DING DONG"); | 16 | info!("DING DONG"); |
| 17 | Timer::after(Duration::from_ticks(16000)).await; | 17 | Timer::after_ticks(16000).await; |
| 18 | } | 18 | } |
| 19 | } | 19 | } |
| 20 | 20 | ||
diff --git a/examples/nrf52840/src/bin/lora_cad.rs b/examples/nrf52840/src/bin/lora_cad.rs index 3a98133c9..38e6d6197 100644 --- a/examples/nrf52840/src/bin/lora_cad.rs +++ b/examples/nrf52840/src/bin/lora_cad.rs | |||
| @@ -11,7 +11,7 @@ use embassy_executor::Spawner; | |||
| 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; | 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; |
| 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; | 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; |
| 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; | 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; |
| 14 | use embassy_time::{Delay, Duration, Timer}; | 14 | use embassy_time::{Delay, Timer}; |
| 15 | use lora_phy::mod_params::*; | 15 | use lora_phy::mod_params::*; |
| 16 | use lora_phy::sx1261_2::SX1261_2; | 16 | use lora_phy::sx1261_2::SX1261_2; |
| 17 | use lora_phy::LoRa; | 17 | use lora_phy::LoRa; |
| @@ -55,7 +55,7 @@ async fn main(_spawner: Spawner) { | |||
| 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); | 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); |
| 56 | 56 | ||
| 57 | start_indicator.set_high(); | 57 | start_indicator.set_high(); |
| 58 | Timer::after(Duration::from_secs(5)).await; | 58 | Timer::after_secs(5).await; |
| 59 | start_indicator.set_low(); | 59 | start_indicator.set_low(); |
| 60 | 60 | ||
| 61 | let mdltn_params = { | 61 | let mdltn_params = { |
| @@ -89,7 +89,7 @@ async fn main(_spawner: Spawner) { | |||
| 89 | info!("cad successful without activity detected") | 89 | info!("cad successful without activity detected") |
| 90 | } | 90 | } |
| 91 | debug_indicator.set_high(); | 91 | debug_indicator.set_high(); |
| 92 | Timer::after(Duration::from_secs(5)).await; | 92 | Timer::after_secs(5).await; |
| 93 | debug_indicator.set_low(); | 93 | debug_indicator.set_low(); |
| 94 | } | 94 | } |
| 95 | Err(err) => info!("cad unsuccessful = {}", err), | 95 | Err(err) => info!("cad unsuccessful = {}", err), |
diff --git a/examples/nrf52840/src/bin/lora_p2p_receive.rs b/examples/nrf52840/src/bin/lora_p2p_receive.rs index 1d293c6bf..4f41e1245 100644 --- a/examples/nrf52840/src/bin/lora_p2p_receive.rs +++ b/examples/nrf52840/src/bin/lora_p2p_receive.rs | |||
| @@ -11,7 +11,7 @@ use embassy_executor::Spawner; | |||
| 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; | 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; |
| 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; | 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; |
| 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; | 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; |
| 14 | use embassy_time::{Delay, Duration, Timer}; | 14 | use embassy_time::{Delay, Timer}; |
| 15 | use lora_phy::mod_params::*; | 15 | use lora_phy::mod_params::*; |
| 16 | use lora_phy::sx1261_2::SX1261_2; | 16 | use lora_phy::sx1261_2::SX1261_2; |
| 17 | use lora_phy::LoRa; | 17 | use lora_phy::LoRa; |
| @@ -55,7 +55,7 @@ async fn main(_spawner: Spawner) { | |||
| 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); | 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); |
| 56 | 56 | ||
| 57 | start_indicator.set_high(); | 57 | start_indicator.set_high(); |
| 58 | Timer::after(Duration::from_secs(5)).await; | 58 | Timer::after_secs(5).await; |
| 59 | start_indicator.set_low(); | 59 | start_indicator.set_low(); |
| 60 | 60 | ||
| 61 | let mut receiving_buffer = [00u8; 100]; | 61 | let mut receiving_buffer = [00u8; 100]; |
| @@ -107,7 +107,7 @@ async fn main(_spawner: Spawner) { | |||
| 107 | { | 107 | { |
| 108 | info!("rx successful"); | 108 | info!("rx successful"); |
| 109 | debug_indicator.set_high(); | 109 | debug_indicator.set_high(); |
| 110 | Timer::after(Duration::from_secs(5)).await; | 110 | Timer::after_secs(5).await; |
| 111 | debug_indicator.set_low(); | 111 | debug_indicator.set_low(); |
| 112 | } else { | 112 | } else { |
| 113 | info!("rx unknown packet"); | 113 | info!("rx unknown packet"); |
diff --git a/examples/nrf52840/src/bin/lora_p2p_receive_duty_cycle.rs b/examples/nrf52840/src/bin/lora_p2p_receive_duty_cycle.rs index eee4d20e7..3d34f6aef 100644 --- a/examples/nrf52840/src/bin/lora_p2p_receive_duty_cycle.rs +++ b/examples/nrf52840/src/bin/lora_p2p_receive_duty_cycle.rs | |||
| @@ -11,7 +11,7 @@ use embassy_executor::Spawner; | |||
| 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; | 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; |
| 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; | 12 | use embassy_nrf::gpio::{Input, Level, Output, OutputDrive, Pin as _, Pull}; |
| 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; | 13 | use embassy_nrf::{bind_interrupts, peripherals, spim}; |
| 14 | use embassy_time::{Delay, Duration, Timer}; | 14 | use embassy_time::{Delay, Timer}; |
| 15 | use lora_phy::mod_params::*; | 15 | use lora_phy::mod_params::*; |
| 16 | use lora_phy::sx1261_2::SX1261_2; | 16 | use lora_phy::sx1261_2::SX1261_2; |
| 17 | use lora_phy::LoRa; | 17 | use lora_phy::LoRa; |
| @@ -55,7 +55,7 @@ async fn main(_spawner: Spawner) { | |||
| 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); | 55 | let mut start_indicator = Output::new(p.P1_04, Level::Low, OutputDrive::Standard); |
| 56 | 56 | ||
| 57 | start_indicator.set_high(); | 57 | start_indicator.set_high(); |
| 58 | Timer::after(Duration::from_secs(5)).await; | 58 | Timer::after_secs(5).await; |
| 59 | start_indicator.set_low(); | 59 | start_indicator.set_low(); |
| 60 | 60 | ||
| 61 | let mut receiving_buffer = [00u8; 100]; | 61 | let mut receiving_buffer = [00u8; 100]; |
| @@ -116,7 +116,7 @@ async fn main(_spawner: Spawner) { | |||
| 116 | { | 116 | { |
| 117 | info!("rx successful"); | 117 | info!("rx successful"); |
| 118 | debug_indicator.set_high(); | 118 | debug_indicator.set_high(); |
| 119 | Timer::after(Duration::from_secs(5)).await; | 119 | Timer::after_secs(5).await; |
| 120 | debug_indicator.set_low(); | 120 | debug_indicator.set_low(); |
| 121 | } else { | 121 | } else { |
| 122 | info!("rx unknown packet") | 122 | info!("rx unknown packet") |
diff --git a/examples/nrf52840/src/bin/manually_create_executor.rs b/examples/nrf52840/src/bin/manually_create_executor.rs index 12ce660f9..80364d34a 100644 --- a/examples/nrf52840/src/bin/manually_create_executor.rs +++ b/examples/nrf52840/src/bin/manually_create_executor.rs | |||
| @@ -8,7 +8,7 @@ | |||
| 8 | use cortex_m_rt::entry; | 8 | use cortex_m_rt::entry; |
| 9 | use defmt::{info, unwrap}; | 9 | use defmt::{info, unwrap}; |
| 10 | use embassy_executor::Executor; | 10 | use embassy_executor::Executor; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use static_cell::StaticCell; | 12 | use static_cell::StaticCell; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| @@ -16,7 +16,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 16 | async fn run1() { | 16 | async fn run1() { |
| 17 | loop { | 17 | loop { |
| 18 | info!("BIG INFREQUENT TICK"); | 18 | info!("BIG INFREQUENT TICK"); |
| 19 | Timer::after(Duration::from_ticks(64000)).await; | 19 | Timer::after_ticks(64000).await; |
| 20 | } | 20 | } |
| 21 | } | 21 | } |
| 22 | 22 | ||
| @@ -24,7 +24,7 @@ async fn run1() { | |||
| 24 | async fn run2() { | 24 | async fn run2() { |
| 25 | loop { | 25 | loop { |
| 26 | info!("tick"); | 26 | info!("tick"); |
| 27 | Timer::after(Duration::from_ticks(13000)).await; | 27 | Timer::after_ticks(13000).await; |
| 28 | } | 28 | } |
| 29 | } | 29 | } |
| 30 | 30 | ||
diff --git a/examples/nrf52840/src/bin/multiprio.rs b/examples/nrf52840/src/bin/multiprio.rs index aab819117..352f62bf2 100644 --- a/examples/nrf52840/src/bin/multiprio.rs +++ b/examples/nrf52840/src/bin/multiprio.rs | |||
| @@ -62,7 +62,7 @@ use defmt::{info, unwrap}; | |||
| 62 | use embassy_executor::{Executor, InterruptExecutor}; | 62 | use embassy_executor::{Executor, InterruptExecutor}; |
| 63 | use embassy_nrf::interrupt; | 63 | use embassy_nrf::interrupt; |
| 64 | use embassy_nrf::interrupt::{InterruptExt, Priority}; | 64 | use embassy_nrf::interrupt::{InterruptExt, Priority}; |
| 65 | use embassy_time::{Duration, Instant, Timer}; | 65 | use embassy_time::{Instant, Timer}; |
| 66 | use static_cell::StaticCell; | 66 | use static_cell::StaticCell; |
| 67 | use {defmt_rtt as _, panic_probe as _}; | 67 | use {defmt_rtt as _, panic_probe as _}; |
| 68 | 68 | ||
| @@ -70,7 +70,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 70 | async fn run_high() { | 70 | async fn run_high() { |
| 71 | loop { | 71 | loop { |
| 72 | info!(" [high] tick!"); | 72 | info!(" [high] tick!"); |
| 73 | Timer::after(Duration::from_ticks(27374)).await; | 73 | Timer::after_ticks(27374).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -87,7 +87,7 @@ async fn run_med() { | |||
| 87 | let ms = end.duration_since(start).as_ticks() / 33; | 87 | let ms = end.duration_since(start).as_ticks() / 33; |
| 88 | info!(" [med] done in {} ms", ms); | 88 | info!(" [med] done in {} ms", ms); |
| 89 | 89 | ||
| 90 | Timer::after(Duration::from_ticks(23421)).await; | 90 | Timer::after_ticks(23421).await; |
| 91 | } | 91 | } |
| 92 | } | 92 | } |
| 93 | 93 | ||
| @@ -104,7 +104,7 @@ async fn run_low() { | |||
| 104 | let ms = end.duration_since(start).as_ticks() / 33; | 104 | let ms = end.duration_since(start).as_ticks() / 33; |
| 105 | info!("[low] done in {} ms", ms); | 105 | info!("[low] done in {} ms", ms); |
| 106 | 106 | ||
| 107 | Timer::after(Duration::from_ticks(32983)).await; | 107 | Timer::after_ticks(32983).await; |
| 108 | } | 108 | } |
| 109 | } | 109 | } |
| 110 | 110 | ||
diff --git a/examples/nrf52840/src/bin/mutex.rs b/examples/nrf52840/src/bin/mutex.rs index c402c6ba1..11b47d991 100644 --- a/examples/nrf52840/src/bin/mutex.rs +++ b/examples/nrf52840/src/bin/mutex.rs | |||
| @@ -6,7 +6,7 @@ use defmt::{info, unwrap}; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; | 7 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; |
| 8 | use embassy_sync::mutex::Mutex; | 8 | use embassy_sync::mutex::Mutex; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | static MUTEX: Mutex<ThreadModeRawMutex, u32> = Mutex::new(0); | 12 | static MUTEX: Mutex<ThreadModeRawMutex, u32> = Mutex::new(0); |
| @@ -20,11 +20,11 @@ async fn my_task() { | |||
| 20 | *m += 1000; | 20 | *m += 1000; |
| 21 | 21 | ||
| 22 | // Hold the mutex for a long time. | 22 | // Hold the mutex for a long time. |
| 23 | Timer::after(Duration::from_secs(1)).await; | 23 | Timer::after_secs(1).await; |
| 24 | info!("end long operation: count = {}", *m); | 24 | info!("end long operation: count = {}", *m); |
| 25 | } | 25 | } |
| 26 | 26 | ||
| 27 | Timer::after(Duration::from_secs(1)).await; | 27 | Timer::after_secs(1).await; |
| 28 | } | 28 | } |
| 29 | } | 29 | } |
| 30 | 30 | ||
| @@ -34,7 +34,7 @@ async fn main(spawner: Spawner) { | |||
| 34 | unwrap!(spawner.spawn(my_task())); | 34 | unwrap!(spawner.spawn(my_task())); |
| 35 | 35 | ||
| 36 | loop { | 36 | loop { |
| 37 | Timer::after(Duration::from_millis(300)).await; | 37 | Timer::after_millis(300).await; |
| 38 | let mut m = MUTEX.lock().await; | 38 | let mut m = MUTEX.lock().await; |
| 39 | *m += 1; | 39 | *m += 1; |
| 40 | info!("short operation: count = {}", *m); | 40 | info!("short operation: count = {}", *m); |
diff --git a/examples/nrf52840/src/bin/nvmc.rs b/examples/nrf52840/src/bin/nvmc.rs index 31c6fe4b6..624829863 100644 --- a/examples/nrf52840/src/bin/nvmc.rs +++ b/examples/nrf52840/src/bin/nvmc.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::nvmc::Nvmc; | 7 | use embassy_nrf::nvmc::Nvmc; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use embedded_storage::nor_flash::{NorFlash, ReadNorFlash}; | 9 | use embedded_storage::nor_flash::{NorFlash, ReadNorFlash}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| @@ -15,7 +15,7 @@ async fn main(_spawner: Spawner) { | |||
| 15 | info!("Hello NVMC!"); | 15 | info!("Hello NVMC!"); |
| 16 | 16 | ||
| 17 | // probe-rs run breaks without this, I'm not sure why. | 17 | // probe-rs run breaks without this, I'm not sure why. |
| 18 | Timer::after(Duration::from_secs(1)).await; | 18 | Timer::after_secs(1).await; |
| 19 | 19 | ||
| 20 | let mut f = Nvmc::new(p.NVMC); | 20 | let mut f = Nvmc::new(p.NVMC); |
| 21 | const ADDR: u32 = 0x80000; | 21 | const ADDR: u32 = 0x80000; |
diff --git a/examples/nrf52840/src/bin/pdm.rs b/examples/nrf52840/src/bin/pdm.rs index 444b9137f..bff323974 100644 --- a/examples/nrf52840/src/bin/pdm.rs +++ b/examples/nrf52840/src/bin/pdm.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::pdm::{self, Config, Pdm}; | 7 | use embassy_nrf::pdm::{self, Config, Pdm}; |
| 8 | use embassy_nrf::{bind_interrupts, peripherals}; | 8 | use embassy_nrf::{bind_interrupts, peripherals}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use fixed::types::I7F1; | 10 | use fixed::types::I7F1; |
| 11 | use num_integer::Roots; | 11 | use num_integer::Roots; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -28,7 +28,7 @@ async fn main(_p: Spawner) { | |||
| 28 | pdm.start().await; | 28 | pdm.start().await; |
| 29 | 29 | ||
| 30 | // wait some time till the microphon settled | 30 | // wait some time till the microphon settled |
| 31 | Timer::after(Duration::from_millis(1000)).await; | 31 | Timer::after_millis(1000).await; |
| 32 | 32 | ||
| 33 | const SAMPLES: usize = 2048; | 33 | const SAMPLES: usize = 2048; |
| 34 | let mut buf = [0i16; SAMPLES]; | 34 | let mut buf = [0i16; SAMPLES]; |
| @@ -51,7 +51,7 @@ async fn main(_p: Spawner) { | |||
| 51 | info!("samples: {:?}", &buf); | 51 | info!("samples: {:?}", &buf); |
| 52 | 52 | ||
| 53 | pdm.stop().await; | 53 | pdm.stop().await; |
| 54 | Timer::after(Duration::from_millis(100)).await; | 54 | Timer::after_millis(100).await; |
| 55 | } | 55 | } |
| 56 | } | 56 | } |
| 57 | } | 57 | } |
diff --git a/examples/nrf52840/src/bin/pubsub.rs b/examples/nrf52840/src/bin/pubsub.rs index cca60ebc9..17d902227 100644 --- a/examples/nrf52840/src/bin/pubsub.rs +++ b/examples/nrf52840/src/bin/pubsub.rs | |||
| @@ -6,7 +6,7 @@ use defmt::unwrap; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; | 7 | use embassy_sync::blocking_mutex::raw::ThreadModeRawMutex; |
| 8 | use embassy_sync::pubsub::{DynSubscriber, PubSubChannel, Subscriber}; | 8 | use embassy_sync::pubsub::{DynSubscriber, PubSubChannel, Subscriber}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | /// Create the message bus. It has a queue of 4, supports 3 subscribers and 1 publisher | 12 | /// Create the message bus. It has a queue of 4, supports 3 subscribers and 1 publisher |
| @@ -39,7 +39,7 @@ async fn main(spawner: Spawner) { | |||
| 39 | 39 | ||
| 40 | let mut index = 0; | 40 | let mut index = 0; |
| 41 | loop { | 41 | loop { |
| 42 | Timer::after(Duration::from_millis(500)).await; | 42 | Timer::after_millis(500).await; |
| 43 | 43 | ||
| 44 | let message = match index % 3 { | 44 | let message = match index % 3 { |
| 45 | 0 => Message::A, | 45 | 0 => Message::A, |
| @@ -81,7 +81,7 @@ async fn fast_logger(mut messages: Subscriber<'static, ThreadModeRawMutex, Messa | |||
| 81 | async fn slow_logger(mut messages: DynSubscriber<'static, Message>) { | 81 | async fn slow_logger(mut messages: DynSubscriber<'static, Message>) { |
| 82 | loop { | 82 | loop { |
| 83 | // Do some work | 83 | // Do some work |
| 84 | Timer::after(Duration::from_millis(2000)).await; | 84 | Timer::after_millis(2000).await; |
| 85 | 85 | ||
| 86 | // If the publisher has used the `publish_immediate` function, then we may receive a lag message here | 86 | // If the publisher has used the `publish_immediate` function, then we may receive a lag message here |
| 87 | let message = messages.next_message().await; | 87 | let message = messages.next_message().await; |
| @@ -98,7 +98,7 @@ async fn slow_logger(mut messages: DynSubscriber<'static, Message>) { | |||
| 98 | async fn slow_logger_pure(mut messages: DynSubscriber<'static, Message>) { | 98 | async fn slow_logger_pure(mut messages: DynSubscriber<'static, Message>) { |
| 99 | loop { | 99 | loop { |
| 100 | // Do some work | 100 | // Do some work |
| 101 | Timer::after(Duration::from_millis(2000)).await; | 101 | Timer::after_millis(2000).await; |
| 102 | 102 | ||
| 103 | // Instead of receiving lags here, we just ignore that and read the next message | 103 | // Instead of receiving lags here, we just ignore that and read the next message |
| 104 | let message = messages.next_message_pure().await; | 104 | let message = messages.next_message_pure().await; |
diff --git a/examples/nrf52840/src/bin/pwm.rs b/examples/nrf52840/src/bin/pwm.rs index 1698c0bc8..9750935c8 100644 --- a/examples/nrf52840/src/bin/pwm.rs +++ b/examples/nrf52840/src/bin/pwm.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::pwm::{Prescaler, SimplePwm}; | 7 | use embassy_nrf::pwm::{Prescaler, SimplePwm}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | // for i in range(1024): print(int((math.sin(i/512*math.pi)*0.4+0.5)**2*32767), ', ', end='') | 11 | // for i in range(1024): print(int((math.sin(i/512*math.pi)*0.4+0.5)**2*32767), ', ', end='') |
| @@ -84,6 +84,6 @@ async fn main(_spawner: Spawner) { | |||
| 84 | pwm.set_duty(1, DUTY[(i + 256) % 1024]); | 84 | pwm.set_duty(1, DUTY[(i + 256) % 1024]); |
| 85 | pwm.set_duty(2, DUTY[(i + 512) % 1024]); | 85 | pwm.set_duty(2, DUTY[(i + 512) % 1024]); |
| 86 | pwm.set_duty(3, DUTY[(i + 768) % 1024]); | 86 | pwm.set_duty(3, DUTY[(i + 768) % 1024]); |
| 87 | Timer::after(Duration::from_millis(3)).await; | 87 | Timer::after_millis(3).await; |
| 88 | } | 88 | } |
| 89 | } | 89 | } |
diff --git a/examples/nrf52840/src/bin/pwm_double_sequence.rs b/examples/nrf52840/src/bin/pwm_double_sequence.rs index 16e50e909..1bfe6e15a 100644 --- a/examples/nrf52840/src/bin/pwm_double_sequence.rs +++ b/examples/nrf52840/src/bin/pwm_double_sequence.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_nrf::pwm::{ | 7 | use embassy_nrf::pwm::{ |
| 8 | Config, Prescaler, Sequence, SequenceConfig, SequenceMode, SequencePwm, Sequencer, StartSequence, | 8 | Config, Prescaler, Sequence, SequenceConfig, SequenceMode, SequencePwm, Sequencer, StartSequence, |
| 9 | }; | 9 | }; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::main] | 13 | #[embassy_executor::main] |
| @@ -36,6 +36,6 @@ async fn main(_spawner: Spawner) { | |||
| 36 | // we can abort a sequence if we need to before its complete with pwm.stop() | 36 | // we can abort a sequence if we need to before its complete with pwm.stop() |
| 37 | // or stop is also implicitly called when the pwm peripheral is dropped | 37 | // or stop is also implicitly called when the pwm peripheral is dropped |
| 38 | // when it goes out of scope | 38 | // when it goes out of scope |
| 39 | Timer::after(Duration::from_millis(40000)).await; | 39 | Timer::after_millis(40000).await; |
| 40 | info!("pwm stopped early!"); | 40 | info!("pwm stopped early!"); |
| 41 | } | 41 | } |
diff --git a/examples/nrf52840/src/bin/pwm_sequence.rs b/examples/nrf52840/src/bin/pwm_sequence.rs index b9aca9aaa..f282cf910 100644 --- a/examples/nrf52840/src/bin/pwm_sequence.rs +++ b/examples/nrf52840/src/bin/pwm_sequence.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::pwm::{Config, Prescaler, SequenceConfig, SequencePwm, SingleSequenceMode, SingleSequencer}; | 7 | use embassy_nrf::pwm::{Config, Prescaler, SequenceConfig, SequencePwm, SingleSequenceMode, SingleSequencer}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -31,6 +31,6 @@ async fn main(_spawner: Spawner) { | |||
| 31 | // we can abort a sequence if we need to before its complete with pwm.stop() | 31 | // we can abort a sequence if we need to before its complete with pwm.stop() |
| 32 | // or stop is also implicitly called when the pwm peripheral is dropped | 32 | // or stop is also implicitly called when the pwm peripheral is dropped |
| 33 | // when it goes out of scope | 33 | // when it goes out of scope |
| 34 | Timer::after(Duration::from_millis(20000)).await; | 34 | Timer::after_millis(20000).await; |
| 35 | info!("pwm stopped early!"); | 35 | info!("pwm stopped early!"); |
| 36 | } | 36 | } |
diff --git a/examples/nrf52840/src/bin/pwm_sequence_ws2812b.rs b/examples/nrf52840/src/bin/pwm_sequence_ws2812b.rs index 711c8a17b..8596e6545 100644 --- a/examples/nrf52840/src/bin/pwm_sequence_ws2812b.rs +++ b/examples/nrf52840/src/bin/pwm_sequence_ws2812b.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_nrf::pwm::{ | 7 | use embassy_nrf::pwm::{ |
| 8 | Config, Prescaler, SequenceConfig, SequenceLoad, SequencePwm, SingleSequenceMode, SingleSequencer, | 8 | Config, Prescaler, SequenceConfig, SequenceLoad, SequencePwm, SingleSequenceMode, SingleSequencer, |
| 9 | }; | 9 | }; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | // WS2812B LED light demonstration. Drives just one light. | 13 | // WS2812B LED light demonstration. Drives just one light. |
| @@ -52,7 +52,7 @@ async fn main(_spawner: Spawner) { | |||
| 52 | let sequences = SingleSequencer::new(&mut pwm, &seq_words, seq_config.clone()); | 52 | let sequences = SingleSequencer::new(&mut pwm, &seq_words, seq_config.clone()); |
| 53 | unwrap!(sequences.start(SingleSequenceMode::Times(1))); | 53 | unwrap!(sequences.start(SingleSequenceMode::Times(1))); |
| 54 | 54 | ||
| 55 | Timer::after(Duration::from_millis(50)).await; | 55 | Timer::after_millis(50).await; |
| 56 | 56 | ||
| 57 | if bit_value == T0H { | 57 | if bit_value == T0H { |
| 58 | if color_bit == 20 { | 58 | if color_bit == 20 { |
diff --git a/examples/nrf52840/src/bin/pwm_servo.rs b/examples/nrf52840/src/bin/pwm_servo.rs index 19228f433..92ded1f88 100644 --- a/examples/nrf52840/src/bin/pwm_servo.rs +++ b/examples/nrf52840/src/bin/pwm_servo.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::pwm::{Prescaler, SimplePwm}; | 7 | use embassy_nrf::pwm::{Prescaler, SimplePwm}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -19,29 +19,29 @@ async fn main(_spawner: Spawner) { | |||
| 19 | pwm.set_max_duty(2500); | 19 | pwm.set_max_duty(2500); |
| 20 | info!("pwm initialized!"); | 20 | info!("pwm initialized!"); |
| 21 | 21 | ||
| 22 | Timer::after(Duration::from_millis(5000)).await; | 22 | Timer::after_millis(5000).await; |
| 23 | 23 | ||
| 24 | // 1ms 0deg (1/.008=125), 1.5ms 90deg (1.5/.008=187.5), 2ms 180deg (2/.008=250), | 24 | // 1ms 0deg (1/.008=125), 1.5ms 90deg (1.5/.008=187.5), 2ms 180deg (2/.008=250), |
| 25 | loop { | 25 | loop { |
| 26 | info!("45 deg"); | 26 | info!("45 deg"); |
| 27 | // poor mans inverting, subtract our value from max_duty | 27 | // poor mans inverting, subtract our value from max_duty |
| 28 | pwm.set_duty(0, 2500 - 156); | 28 | pwm.set_duty(0, 2500 - 156); |
| 29 | Timer::after(Duration::from_millis(5000)).await; | 29 | Timer::after_millis(5000).await; |
| 30 | 30 | ||
| 31 | info!("90 deg"); | 31 | info!("90 deg"); |
| 32 | pwm.set_duty(0, 2500 - 187); | 32 | pwm.set_duty(0, 2500 - 187); |
| 33 | Timer::after(Duration::from_millis(5000)).await; | 33 | Timer::after_millis(5000).await; |
| 34 | 34 | ||
| 35 | info!("135 deg"); | 35 | info!("135 deg"); |
| 36 | pwm.set_duty(0, 2500 - 218); | 36 | pwm.set_duty(0, 2500 - 218); |
| 37 | Timer::after(Duration::from_millis(5000)).await; | 37 | Timer::after_millis(5000).await; |
| 38 | 38 | ||
| 39 | info!("180 deg"); | 39 | info!("180 deg"); |
| 40 | pwm.set_duty(0, 2500 - 250); | 40 | pwm.set_duty(0, 2500 - 250); |
| 41 | Timer::after(Duration::from_millis(5000)).await; | 41 | Timer::after_millis(5000).await; |
| 42 | 42 | ||
| 43 | info!("0 deg"); | 43 | info!("0 deg"); |
| 44 | pwm.set_duty(0, 2500 - 125); | 44 | pwm.set_duty(0, 2500 - 125); |
| 45 | Timer::after(Duration::from_millis(5000)).await; | 45 | Timer::after_millis(5000).await; |
| 46 | } | 46 | } |
| 47 | } | 47 | } |
diff --git a/examples/nrf52840/src/bin/qspi_lowpower.rs b/examples/nrf52840/src/bin/qspi_lowpower.rs index 22a5c0c6d..42b5454e0 100644 --- a/examples/nrf52840/src/bin/qspi_lowpower.rs +++ b/examples/nrf52840/src/bin/qspi_lowpower.rs | |||
| @@ -8,7 +8,7 @@ use defmt::{info, unwrap}; | |||
| 8 | use embassy_executor::Spawner; | 8 | use embassy_executor::Spawner; |
| 9 | use embassy_nrf::qspi::Frequency; | 9 | use embassy_nrf::qspi::Frequency; |
| 10 | use embassy_nrf::{bind_interrupts, peripherals, qspi}; | 10 | use embassy_nrf::{bind_interrupts, peripherals, qspi}; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | // Workaround for alignment requirements. | 14 | // Workaround for alignment requirements. |
| @@ -79,6 +79,6 @@ async fn main(_p: Spawner) { | |||
| 79 | 79 | ||
| 80 | // Sleep for 1 second. The executor ensures the core sleeps with a WFE when it has nothing to do. | 80 | // Sleep for 1 second. The executor ensures the core sleeps with a WFE when it has nothing to do. |
| 81 | // During this sleep, the nRF chip should only use ~3uA | 81 | // During this sleep, the nRF chip should only use ~3uA |
| 82 | Timer::after(Duration::from_secs(1)).await; | 82 | Timer::after_secs(1).await; |
| 83 | } | 83 | } |
| 84 | } | 84 | } |
diff --git a/examples/nrf52840/src/bin/raw_spawn.rs b/examples/nrf52840/src/bin/raw_spawn.rs index 1b067f5e4..717b0faa6 100644 --- a/examples/nrf52840/src/bin/raw_spawn.rs +++ b/examples/nrf52840/src/bin/raw_spawn.rs | |||
| @@ -7,21 +7,21 @@ use cortex_m_rt::entry; | |||
| 7 | use defmt::{info, unwrap}; | 7 | use defmt::{info, unwrap}; |
| 8 | use embassy_executor::raw::TaskStorage; | 8 | use embassy_executor::raw::TaskStorage; |
| 9 | use embassy_executor::Executor; | 9 | use embassy_executor::Executor; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use static_cell::StaticCell; | 11 | use static_cell::StaticCell; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | async fn run1() { | 14 | async fn run1() { |
| 15 | loop { | 15 | loop { |
| 16 | info!("BIG INFREQUENT TICK"); | 16 | info!("BIG INFREQUENT TICK"); |
| 17 | Timer::after(Duration::from_ticks(64000)).await; | 17 | Timer::after_ticks(64000).await; |
| 18 | } | 18 | } |
| 19 | } | 19 | } |
| 20 | 20 | ||
| 21 | async fn run2() { | 21 | async fn run2() { |
| 22 | loop { | 22 | loop { |
| 23 | info!("tick"); | 23 | info!("tick"); |
| 24 | Timer::after(Duration::from_ticks(13000)).await; | 24 | Timer::after_ticks(13000).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
| 27 | 27 | ||
diff --git a/examples/nrf52840/src/bin/saadc.rs b/examples/nrf52840/src/bin/saadc.rs index ffd9a7f4b..d651834f5 100644 --- a/examples/nrf52840/src/bin/saadc.rs +++ b/examples/nrf52840/src/bin/saadc.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::saadc::{ChannelConfig, Config, Saadc}; | 7 | use embassy_nrf::saadc::{ChannelConfig, Config, Saadc}; |
| 8 | use embassy_nrf::{bind_interrupts, saadc}; | 8 | use embassy_nrf::{bind_interrupts, saadc}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | bind_interrupts!(struct Irqs { | 12 | bind_interrupts!(struct Irqs { |
| @@ -24,6 +24,6 @@ async fn main(_p: Spawner) { | |||
| 24 | let mut buf = [0; 1]; | 24 | let mut buf = [0; 1]; |
| 25 | saadc.sample(&mut buf).await; | 25 | saadc.sample(&mut buf).await; |
| 26 | info!("sample: {=i16}", &buf[0]); | 26 | info!("sample: {=i16}", &buf[0]); |
| 27 | Timer::after(Duration::from_millis(100)).await; | 27 | Timer::after_millis(100).await; |
| 28 | } | 28 | } |
| 29 | } | 29 | } |
diff --git a/examples/nrf52840/src/bin/saadc_continuous.rs b/examples/nrf52840/src/bin/saadc_continuous.rs index a25e17465..a5f8a4dd7 100644 --- a/examples/nrf52840/src/bin/saadc_continuous.rs +++ b/examples/nrf52840/src/bin/saadc_continuous.rs | |||
| @@ -7,7 +7,6 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_nrf::saadc::{CallbackResult, ChannelConfig, Config, Saadc}; | 7 | use embassy_nrf::saadc::{CallbackResult, ChannelConfig, Config, Saadc}; |
| 8 | use embassy_nrf::timer::Frequency; | 8 | use embassy_nrf::timer::Frequency; |
| 9 | use embassy_nrf::{bind_interrupts, saadc}; | 9 | use embassy_nrf::{bind_interrupts, saadc}; |
| 10 | use embassy_time::Duration; | ||
| 11 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 11 | ||
| 13 | // Demonstrates both continuous sampling and scanning multiple channels driven by a PPI linked timer | 12 | // Demonstrates both continuous sampling and scanning multiple channels driven by a PPI linked timer |
| @@ -32,7 +31,7 @@ async fn main(_p: Spawner) { | |||
| 32 | 31 | ||
| 33 | // This delay demonstrates that starting the timer prior to running | 32 | // This delay demonstrates that starting the timer prior to running |
| 34 | // the task sampler is benign given the calibration that follows. | 33 | // the task sampler is benign given the calibration that follows. |
| 35 | embassy_time::Timer::after(Duration::from_millis(500)).await; | 34 | embassy_time::Timer::after_millis(500).await; |
| 36 | saadc.calibrate().await; | 35 | saadc.calibrate().await; |
| 37 | 36 | ||
| 38 | let mut bufs = [[[0; 3]; 500]; 2]; | 37 | let mut bufs = [[[0; 3]; 500]; 2]; |
diff --git a/examples/nrf52840/src/bin/self_spawn.rs b/examples/nrf52840/src/bin/self_spawn.rs index 31ea6c81e..8a58396a4 100644 --- a/examples/nrf52840/src/bin/self_spawn.rs +++ b/examples/nrf52840/src/bin/self_spawn.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | mod config { | 10 | mod config { |
| @@ -13,7 +13,7 @@ mod config { | |||
| 13 | 13 | ||
| 14 | #[embassy_executor::task(pool_size = config::MY_TASK_POOL_SIZE)] | 14 | #[embassy_executor::task(pool_size = config::MY_TASK_POOL_SIZE)] |
| 15 | async fn my_task(spawner: Spawner, n: u32) { | 15 | async fn my_task(spawner: Spawner, n: u32) { |
| 16 | Timer::after(Duration::from_secs(1)).await; | 16 | Timer::after_secs(1).await; |
| 17 | info!("Spawning self! {}", n); | 17 | info!("Spawning self! {}", n); |
| 18 | unwrap!(spawner.spawn(my_task(spawner, n + 1))); | 18 | unwrap!(spawner.spawn(my_task(spawner, n + 1))); |
| 19 | } | 19 | } |
diff --git a/examples/nrf52840/src/bin/self_spawn_current_executor.rs b/examples/nrf52840/src/bin/self_spawn_current_executor.rs index 8a179886c..65d50f8c3 100644 --- a/examples/nrf52840/src/bin/self_spawn_current_executor.rs +++ b/examples/nrf52840/src/bin/self_spawn_current_executor.rs | |||
| @@ -4,12 +4,12 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | #[embassy_executor::task(pool_size = 2)] | 10 | #[embassy_executor::task(pool_size = 2)] |
| 11 | async fn my_task(n: u32) { | 11 | async fn my_task(n: u32) { |
| 12 | Timer::after(Duration::from_secs(1)).await; | 12 | Timer::after_secs(1).await; |
| 13 | info!("Spawning self! {}", n); | 13 | info!("Spawning self! {}", n); |
| 14 | unwrap!(Spawner::for_current_executor().await.spawn(my_task(n + 1))); | 14 | unwrap!(Spawner::for_current_executor().await.spawn(my_task(n + 1))); |
| 15 | } | 15 | } |
diff --git a/examples/nrf52840/src/bin/temp.rs b/examples/nrf52840/src/bin/temp.rs index 70957548f..d94dea38d 100644 --- a/examples/nrf52840/src/bin/temp.rs +++ b/examples/nrf52840/src/bin/temp.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_nrf::temp::Temp; | 7 | use embassy_nrf::temp::Temp; |
| 8 | use embassy_nrf::{bind_interrupts, temp}; | 8 | use embassy_nrf::{bind_interrupts, temp}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | bind_interrupts!(struct Irqs { | 12 | bind_interrupts!(struct Irqs { |
| @@ -21,6 +21,6 @@ async fn main(_spawner: Spawner) { | |||
| 21 | loop { | 21 | loop { |
| 22 | let value = temp.read().await; | 22 | let value = temp.read().await; |
| 23 | info!("temperature: {}℃", value.to_num::<u16>()); | 23 | info!("temperature: {}℃", value.to_num::<u16>()); |
| 24 | Timer::after(Duration::from_secs(1)).await; | 24 | Timer::after_secs(1).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
diff --git a/examples/nrf52840/src/bin/timer.rs b/examples/nrf52840/src/bin/timer.rs index c22b5acd5..9b9bb3eb4 100644 --- a/examples/nrf52840/src/bin/timer.rs +++ b/examples/nrf52840/src/bin/timer.rs | |||
| @@ -4,14 +4,14 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | #[embassy_executor::task] | 10 | #[embassy_executor::task] |
| 11 | async fn run1() { | 11 | async fn run1() { |
| 12 | loop { | 12 | loop { |
| 13 | info!("BIG INFREQUENT TICK"); | 13 | info!("BIG INFREQUENT TICK"); |
| 14 | Timer::after(Duration::from_ticks(64000)).await; | 14 | Timer::after_ticks(64000).await; |
| 15 | } | 15 | } |
| 16 | } | 16 | } |
| 17 | 17 | ||
| @@ -19,7 +19,7 @@ async fn run1() { | |||
| 19 | async fn run2() { | 19 | async fn run2() { |
| 20 | loop { | 20 | loop { |
| 21 | info!("tick"); | 21 | info!("tick"); |
| 22 | Timer::after(Duration::from_ticks(13000)).await; | 22 | Timer::after_ticks(13000).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
| 25 | 25 | ||
diff --git a/examples/nrf52840/src/bin/twim_lowpower.rs b/examples/nrf52840/src/bin/twim_lowpower.rs index 0970d3c3c..bf9f966ef 100644 --- a/examples/nrf52840/src/bin/twim_lowpower.rs +++ b/examples/nrf52840/src/bin/twim_lowpower.rs | |||
| @@ -14,7 +14,7 @@ use defmt::*; | |||
| 14 | use embassy_executor::Spawner; | 14 | use embassy_executor::Spawner; |
| 15 | use embassy_nrf::twim::{self, Twim}; | 15 | use embassy_nrf::twim::{self, Twim}; |
| 16 | use embassy_nrf::{bind_interrupts, peripherals}; | 16 | use embassy_nrf::{bind_interrupts, peripherals}; |
| 17 | use embassy_time::{Duration, Timer}; | 17 | use embassy_time::Timer; |
| 18 | use {defmt_rtt as _, panic_probe as _}; | 18 | use {defmt_rtt as _, panic_probe as _}; |
| 19 | 19 | ||
| 20 | const ADDRESS: u8 = 0x50; | 20 | const ADDRESS: u8 = 0x50; |
| @@ -48,6 +48,6 @@ async fn main(_p: Spawner) { | |||
| 48 | 48 | ||
| 49 | // Sleep for 1 second. The executor ensures the core sleeps with a WFE when it has nothing to do. | 49 | // Sleep for 1 second. The executor ensures the core sleeps with a WFE when it has nothing to do. |
| 50 | // During this sleep, the nRF chip should only use ~3uA | 50 | // During this sleep, the nRF chip should only use ~3uA |
| 51 | Timer::after(Duration::from_secs(1)).await; | 51 | Timer::after_secs(1).await; |
| 52 | } | 52 | } |
| 53 | } | 53 | } |
diff --git a/examples/nrf52840/src/bin/usb_hid_mouse.rs b/examples/nrf52840/src/bin/usb_hid_mouse.rs index edf634a5e..96fcf8a66 100644 --- a/examples/nrf52840/src/bin/usb_hid_mouse.rs +++ b/examples/nrf52840/src/bin/usb_hid_mouse.rs | |||
| @@ -10,7 +10,7 @@ use embassy_futures::join::join; | |||
| 10 | use embassy_nrf::usb::vbus_detect::HardwareVbusDetect; | 10 | use embassy_nrf::usb::vbus_detect::HardwareVbusDetect; |
| 11 | use embassy_nrf::usb::Driver; | 11 | use embassy_nrf::usb::Driver; |
| 12 | use embassy_nrf::{bind_interrupts, pac, peripherals, usb}; | 12 | use embassy_nrf::{bind_interrupts, pac, peripherals, usb}; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use embassy_usb::class::hid::{HidWriter, ReportId, RequestHandler, State}; | 14 | use embassy_usb::class::hid::{HidWriter, ReportId, RequestHandler, State}; |
| 15 | use embassy_usb::control::OutResponse; | 15 | use embassy_usb::control::OutResponse; |
| 16 | use embassy_usb::{Builder, Config}; | 16 | use embassy_usb::{Builder, Config}; |
| @@ -83,7 +83,7 @@ async fn main(_spawner: Spawner) { | |||
| 83 | let hid_fut = async { | 83 | let hid_fut = async { |
| 84 | let mut y: i8 = 5; | 84 | let mut y: i8 = 5; |
| 85 | loop { | 85 | loop { |
| 86 | Timer::after(Duration::from_millis(500)).await; | 86 | Timer::after_millis(500).await; |
| 87 | 87 | ||
| 88 | y = -y; | 88 | y = -y; |
| 89 | let report = MouseReport { | 89 | let report = MouseReport { |
diff --git a/examples/nrf5340/Cargo.toml b/examples/nrf5340/Cargo.toml index 86d969ed5..24972a4fb 100644 --- a/examples/nrf5340/Cargo.toml +++ b/examples/nrf5340/Cargo.toml | |||
| @@ -14,7 +14,7 @@ embassy-executor = { version = "0.3.0", path = "../../embassy-executor", feature | |||
| 14 | "defmt", | 14 | "defmt", |
| 15 | "integrated-timers", | 15 | "integrated-timers", |
| 16 | ] } | 16 | ] } |
| 17 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = [ | 17 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = [ |
| 18 | "defmt", | 18 | "defmt", |
| 19 | "defmt-timestamp-uptime", | 19 | "defmt-timestamp-uptime", |
| 20 | ] } | 20 | ] } |
| @@ -27,7 +27,7 @@ embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = [ | |||
| 27 | "gpiote", | 27 | "gpiote", |
| 28 | "unstable-pac", | 28 | "unstable-pac", |
| 29 | ] } | 29 | ] } |
| 30 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = [ | 30 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = [ |
| 31 | "nightly", | 31 | "nightly", |
| 32 | "defmt", | 32 | "defmt", |
| 33 | "tcp", | 33 | "tcp", |
| @@ -37,7 +37,7 @@ embassy-net = { version = "0.1.0", path = "../../embassy-net", features = [ | |||
| 37 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = [ | 37 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = [ |
| 38 | "defmt", | 38 | "defmt", |
| 39 | ] } | 39 | ] } |
| 40 | embedded-io-async = { version = "0.5.0" } | 40 | embedded-io-async = { version = "0.6.0" } |
| 41 | 41 | ||
| 42 | defmt = "0.3" | 42 | defmt = "0.3" |
| 43 | defmt-rtt = "0.4" | 43 | defmt-rtt = "0.4" |
diff --git a/examples/nrf5340/src/bin/blinky.rs b/examples/nrf5340/src/bin/blinky.rs index 3422cedf0..b784564a5 100644 --- a/examples/nrf5340/src/bin/blinky.rs +++ b/examples/nrf5340/src/bin/blinky.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use embassy_executor::Spawner; | 5 | use embassy_executor::Spawner; |
| 6 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; | 6 | use embassy_nrf::gpio::{Level, Output, OutputDrive}; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | #[embassy_executor::main] | 10 | #[embassy_executor::main] |
| @@ -14,8 +14,8 @@ async fn main(_spawner: Spawner) { | |||
| 14 | 14 | ||
| 15 | loop { | 15 | loop { |
| 16 | led.set_high(); | 16 | led.set_high(); |
| 17 | Timer::after(Duration::from_millis(300)).await; | 17 | Timer::after_millis(300).await; |
| 18 | led.set_low(); | 18 | led.set_low(); |
| 19 | Timer::after(Duration::from_millis(300)).await; | 19 | Timer::after_millis(300).await; |
| 20 | } | 20 | } |
| 21 | } | 21 | } |
diff --git a/examples/rp/Cargo.toml b/examples/rp/Cargo.toml index 2677e0402..7386eeea7 100644 --- a/examples/rp/Cargo.toml +++ b/examples/rp/Cargo.toml | |||
| @@ -9,10 +9,10 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal", features = ["defmt"] } | 9 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal", features = ["defmt"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime"] } |
| 13 | embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["defmt", "unstable-traits", "nightly", "unstable-pac", "time-driver", "critical-section-impl"] } | 13 | embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["defmt", "unstable-traits", "nightly", "unstable-pac", "time-driver", "critical-section-impl"] } |
| 14 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 14 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 15 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } | 15 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } |
| 16 | embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] } | 16 | embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] } |
| 17 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 17 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 18 | embassy-usb-logger = { version = "0.1.0", path = "../../embassy-usb-logger" } | 18 | embassy-usb-logger = { version = "0.1.0", path = "../../embassy-usb-logger" } |
| @@ -45,7 +45,7 @@ usbd-hid = "0.6.1" | |||
| 45 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } | 45 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } |
| 46 | embedded-hal-async = "1.0.0-rc.1" | 46 | embedded-hal-async = "1.0.0-rc.1" |
| 47 | embedded-hal-bus = { version = "0.1.0-rc.1", features = ["async"] } | 47 | embedded-hal-bus = { version = "0.1.0-rc.1", features = ["async"] } |
| 48 | embedded-io-async = { version = "0.5.0", features = ["defmt-03"] } | 48 | embedded-io-async = { version = "0.6.0", features = ["defmt-03"] } |
| 49 | embedded-storage = { version = "0.3" } | 49 | embedded-storage = { version = "0.3" } |
| 50 | static_cell = { version = "1.1", features = ["nightly"]} | 50 | static_cell = { version = "1.1", features = ["nightly"]} |
| 51 | log = "0.4" | 51 | log = "0.4" |
diff --git a/examples/rp/src/bin/adc.rs b/examples/rp/src/bin/adc.rs index 02bc493b6..a579be139 100644 --- a/examples/rp/src/bin/adc.rs +++ b/examples/rp/src/bin/adc.rs | |||
| @@ -10,7 +10,7 @@ use embassy_executor::Spawner; | |||
| 10 | use embassy_rp::adc::{Adc, Channel, Config, InterruptHandler}; | 10 | use embassy_rp::adc::{Adc, Channel, Config, InterruptHandler}; |
| 11 | use embassy_rp::bind_interrupts; | 11 | use embassy_rp::bind_interrupts; |
| 12 | use embassy_rp::gpio::Pull; | 12 | use embassy_rp::gpio::Pull; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| 16 | bind_interrupts!(struct Irqs { | 16 | bind_interrupts!(struct Irqs { |
| @@ -36,7 +36,7 @@ async fn main(_spawner: Spawner) { | |||
| 36 | info!("Pin 28 ADC: {}", level); | 36 | info!("Pin 28 ADC: {}", level); |
| 37 | let temp = adc.read(&mut ts).await.unwrap(); | 37 | let temp = adc.read(&mut ts).await.unwrap(); |
| 38 | info!("Temp: {} degrees", convert_to_celsius(temp)); | 38 | info!("Temp: {} degrees", convert_to_celsius(temp)); |
| 39 | Timer::after(Duration::from_secs(1)).await; | 39 | Timer::after_secs(1).await; |
| 40 | } | 40 | } |
| 41 | } | 41 | } |
| 42 | 42 | ||
diff --git a/examples/rp/src/bin/blinky.rs b/examples/rp/src/bin/blinky.rs index 295b000f3..66c8773fa 100644 --- a/examples/rp/src/bin/blinky.rs +++ b/examples/rp/src/bin/blinky.rs | |||
| @@ -9,7 +9,7 @@ | |||
| 9 | use defmt::*; | 9 | use defmt::*; |
| 10 | use embassy_executor::Spawner; | 10 | use embassy_executor::Spawner; |
| 11 | use embassy_rp::gpio; | 11 | use embassy_rp::gpio; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use gpio::{Level, Output}; | 13 | use gpio::{Level, Output}; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| @@ -21,10 +21,10 @@ async fn main(_spawner: Spawner) { | |||
| 21 | loop { | 21 | loop { |
| 22 | info!("led on!"); | 22 | info!("led on!"); |
| 23 | led.set_high(); | 23 | led.set_high(); |
| 24 | Timer::after(Duration::from_secs(1)).await; | 24 | Timer::after_secs(1).await; |
| 25 | 25 | ||
| 26 | info!("led off!"); | 26 | info!("led off!"); |
| 27 | led.set_low(); | 27 | led.set_low(); |
| 28 | Timer::after(Duration::from_secs(1)).await; | 28 | Timer::after_secs(1).await; |
| 29 | } | 29 | } |
| 30 | } | 30 | } |
diff --git a/examples/rp/src/bin/ethernet_w5500_tcp_client.rs b/examples/rp/src/bin/ethernet_w5500_tcp_client.rs index e593acae4..b19362fc1 100644 --- a/examples/rp/src/bin/ethernet_w5500_tcp_client.rs +++ b/examples/rp/src/bin/ethernet_w5500_tcp_client.rs | |||
| @@ -111,7 +111,7 @@ async fn main(spawner: Spawner) { | |||
| 111 | break; | 111 | break; |
| 112 | } | 112 | } |
| 113 | info!("txd: {}", core::str::from_utf8(msg).unwrap()); | 113 | info!("txd: {}", core::str::from_utf8(msg).unwrap()); |
| 114 | Timer::after(Duration::from_secs(1)).await; | 114 | Timer::after_secs(1).await; |
| 115 | } | 115 | } |
| 116 | } | 116 | } |
| 117 | } | 117 | } |
diff --git a/examples/rp/src/bin/flash.rs b/examples/rp/src/bin/flash.rs index 911a657eb..129a8497f 100644 --- a/examples/rp/src/bin/flash.rs +++ b/examples/rp/src/bin/flash.rs | |||
| @@ -8,7 +8,7 @@ use defmt::*; | |||
| 8 | use embassy_executor::Spawner; | 8 | use embassy_executor::Spawner; |
| 9 | use embassy_rp::flash::{Async, ERASE_SIZE, FLASH_BASE}; | 9 | use embassy_rp::flash::{Async, ERASE_SIZE, FLASH_BASE}; |
| 10 | use embassy_rp::peripherals::FLASH; | 10 | use embassy_rp::peripherals::FLASH; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | const ADDR_OFFSET: u32 = 0x100000; | 14 | const ADDR_OFFSET: u32 = 0x100000; |
| @@ -23,7 +23,7 @@ async fn main(_spawner: Spawner) { | |||
| 23 | // defmt RTT header. Reading that header might touch flash memory, which | 23 | // defmt RTT header. Reading that header might touch flash memory, which |
| 24 | // interferes with flash write operations. | 24 | // interferes with flash write operations. |
| 25 | // https://github.com/knurling-rs/defmt/pull/683 | 25 | // https://github.com/knurling-rs/defmt/pull/683 |
| 26 | Timer::after(Duration::from_millis(10)).await; | 26 | Timer::after_millis(10).await; |
| 27 | 27 | ||
| 28 | let mut flash = embassy_rp::flash::Flash::<_, Async, FLASH_SIZE>::new(p.FLASH, p.DMA_CH0); | 28 | let mut flash = embassy_rp::flash::Flash::<_, Async, FLASH_SIZE>::new(p.FLASH, p.DMA_CH0); |
| 29 | 29 | ||
diff --git a/examples/rp/src/bin/gpio_async.rs b/examples/rp/src/bin/gpio_async.rs index bf58044d5..98209fe41 100644 --- a/examples/rp/src/bin/gpio_async.rs +++ b/examples/rp/src/bin/gpio_async.rs | |||
| @@ -9,7 +9,7 @@ | |||
| 9 | use defmt::*; | 9 | use defmt::*; |
| 10 | use embassy_executor::Spawner; | 10 | use embassy_executor::Spawner; |
| 11 | use embassy_rp::gpio; | 11 | use embassy_rp::gpio; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use gpio::{Input, Level, Output, Pull}; | 13 | use gpio::{Input, Level, Output, Pull}; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| @@ -36,6 +36,6 @@ async fn main(_spawner: Spawner) { | |||
| 36 | info!("done wait_for_high. Turn off LED"); | 36 | info!("done wait_for_high. Turn off LED"); |
| 37 | led.set_low(); | 37 | led.set_low(); |
| 38 | 38 | ||
| 39 | Timer::after(Duration::from_secs(2)).await; | 39 | Timer::after_secs(2).await; |
| 40 | } | 40 | } |
| 41 | } | 41 | } |
diff --git a/examples/rp/src/bin/gpout.rs b/examples/rp/src/bin/gpout.rs index 0a3b5fa98..896cc15ee 100644 --- a/examples/rp/src/bin/gpout.rs +++ b/examples/rp/src/bin/gpout.rs | |||
| @@ -9,7 +9,7 @@ | |||
| 9 | use defmt::*; | 9 | use defmt::*; |
| 10 | use embassy_executor::Spawner; | 10 | use embassy_executor::Spawner; |
| 11 | use embassy_rp::clocks; | 11 | use embassy_rp::clocks; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| @@ -26,13 +26,13 @@ async fn main(_spawner: Spawner) { | |||
| 26 | "Pin 25 is now outputing CLK_SYS/1000, should be toggling at {}", | 26 | "Pin 25 is now outputing CLK_SYS/1000, should be toggling at {}", |
| 27 | gpout3.get_freq() | 27 | gpout3.get_freq() |
| 28 | ); | 28 | ); |
| 29 | Timer::after(Duration::from_secs(2)).await; | 29 | Timer::after_secs(2).await; |
| 30 | 30 | ||
| 31 | gpout3.set_src(clocks::GpoutSrc::Ref); | 31 | gpout3.set_src(clocks::GpoutSrc::Ref); |
| 32 | info!( | 32 | info!( |
| 33 | "Pin 25 is now outputing CLK_REF/1000, should be toggling at {}", | 33 | "Pin 25 is now outputing CLK_REF/1000, should be toggling at {}", |
| 34 | gpout3.get_freq() | 34 | gpout3.get_freq() |
| 35 | ); | 35 | ); |
| 36 | Timer::after(Duration::from_secs(2)).await; | 36 | Timer::after_secs(2).await; |
| 37 | } | 37 | } |
| 38 | } | 38 | } |
diff --git a/examples/rp/src/bin/i2c_async.rs b/examples/rp/src/bin/i2c_async.rs index 93224bc43..7b53aae72 100644 --- a/examples/rp/src/bin/i2c_async.rs +++ b/examples/rp/src/bin/i2c_async.rs | |||
| @@ -12,7 +12,7 @@ use embassy_executor::Spawner; | |||
| 12 | use embassy_rp::bind_interrupts; | 12 | use embassy_rp::bind_interrupts; |
| 13 | use embassy_rp::i2c::{self, Config, InterruptHandler}; | 13 | use embassy_rp::i2c::{self, Config, InterruptHandler}; |
| 14 | use embassy_rp::peripherals::I2C1; | 14 | use embassy_rp::peripherals::I2C1; |
| 15 | use embassy_time::{Duration, Timer}; | 15 | use embassy_time::Timer; |
| 16 | use embedded_hal_async::i2c::I2c; | 16 | use embedded_hal_async::i2c::I2c; |
| 17 | use {defmt_rtt as _, panic_probe as _}; | 17 | use {defmt_rtt as _, panic_probe as _}; |
| 18 | 18 | ||
| @@ -106,6 +106,6 @@ async fn main(_spawner: Spawner) { | |||
| 106 | } | 106 | } |
| 107 | } | 107 | } |
| 108 | 108 | ||
| 109 | Timer::after(Duration::from_millis(100)).await; | 109 | Timer::after_millis(100).await; |
| 110 | } | 110 | } |
| 111 | } | 111 | } |
diff --git a/examples/rp/src/bin/i2c_blocking.rs b/examples/rp/src/bin/i2c_blocking.rs index 1c8c2039d..9ddb48d69 100644 --- a/examples/rp/src/bin/i2c_blocking.rs +++ b/examples/rp/src/bin/i2c_blocking.rs | |||
| @@ -10,7 +10,7 @@ | |||
| 10 | use defmt::*; | 10 | use defmt::*; |
| 11 | use embassy_executor::Spawner; | 11 | use embassy_executor::Spawner; |
| 12 | use embassy_rp::i2c::{self, Config}; | 12 | use embassy_rp::i2c::{self, Config}; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use embedded_hal_1::i2c::I2c; | 14 | use embedded_hal_1::i2c::I2c; |
| 15 | use {defmt_rtt as _, panic_probe as _}; | 15 | use {defmt_rtt as _, panic_probe as _}; |
| 16 | 16 | ||
| @@ -70,6 +70,6 @@ async fn main(_spawner: Spawner) { | |||
| 70 | info!("portb = {:02x}", portb[0]); | 70 | info!("portb = {:02x}", portb[0]); |
| 71 | val = !val; | 71 | val = !val; |
| 72 | 72 | ||
| 73 | Timer::after(Duration::from_secs(1)).await; | 73 | Timer::after_secs(1).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
diff --git a/examples/rp/src/bin/i2c_slave.rs b/examples/rp/src/bin/i2c_slave.rs index 7de300fb8..151b083a4 100644 --- a/examples/rp/src/bin/i2c_slave.rs +++ b/examples/rp/src/bin/i2c_slave.rs | |||
| @@ -7,7 +7,7 @@ use defmt::*; | |||
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_rp::peripherals::{I2C0, I2C1}; | 8 | use embassy_rp::peripherals::{I2C0, I2C1}; |
| 9 | use embassy_rp::{bind_interrupts, i2c, i2c_slave}; | 9 | use embassy_rp::{bind_interrupts, i2c, i2c_slave}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use embedded_hal_async::i2c::I2c; | 11 | use embedded_hal_async::i2c::I2c; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| @@ -81,7 +81,7 @@ async fn controller_task(mut con: i2c::I2c<'static, I2C0, i2c::Async>) { | |||
| 81 | Err(e) => error!("Error writing {}", e), | 81 | Err(e) => error!("Error writing {}", e), |
| 82 | } | 82 | } |
| 83 | 83 | ||
| 84 | Timer::after(Duration::from_millis(100)).await; | 84 | Timer::after_millis(100).await; |
| 85 | } | 85 | } |
| 86 | match con.read(DEV_ADDR, &mut resp_buff).await { | 86 | match con.read(DEV_ADDR, &mut resp_buff).await { |
| 87 | Ok(_) => info!("read response: {}", resp_buff), | 87 | Ok(_) => info!("read response: {}", resp_buff), |
| @@ -91,7 +91,7 @@ async fn controller_task(mut con: i2c::I2c<'static, I2C0, i2c::Async>) { | |||
| 91 | Ok(_) => info!("write_read response: {}", resp_buff), | 91 | Ok(_) => info!("write_read response: {}", resp_buff), |
| 92 | Err(e) => error!("Error writing {}", e), | 92 | Err(e) => error!("Error writing {}", e), |
| 93 | } | 93 | } |
| 94 | Timer::after(Duration::from_millis(100)).await; | 94 | Timer::after_millis(100).await; |
| 95 | } | 95 | } |
| 96 | } | 96 | } |
| 97 | 97 | ||
diff --git a/examples/rp/src/bin/lora_p2p_receive.rs b/examples/rp/src/bin/lora_p2p_receive.rs index 5891826fd..d5843fdcd 100644 --- a/examples/rp/src/bin/lora_p2p_receive.rs +++ b/examples/rp/src/bin/lora_p2p_receive.rs | |||
| @@ -11,7 +11,7 @@ use embassy_executor::Spawner; | |||
| 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; | 11 | use embassy_lora::iv::GenericSx126xInterfaceVariant; |
| 12 | use embassy_rp::gpio::{Input, Level, Output, Pin, Pull}; | 12 | use embassy_rp::gpio::{Input, Level, Output, Pin, Pull}; |
| 13 | use embassy_rp::spi::{Config, Spi}; | 13 | use embassy_rp::spi::{Config, Spi}; |
| 14 | use embassy_time::{Delay, Duration, Timer}; | 14 | use embassy_time::{Delay, Timer}; |
| 15 | use lora_phy::mod_params::*; | 15 | use lora_phy::mod_params::*; |
| 16 | use lora_phy::sx1261_2::SX1261_2; | 16 | use lora_phy::sx1261_2::SX1261_2; |
| 17 | use lora_phy::LoRa; | 17 | use lora_phy::LoRa; |
| @@ -96,7 +96,7 @@ async fn main(_spawner: Spawner) { | |||
| 96 | { | 96 | { |
| 97 | info!("rx successful"); | 97 | info!("rx successful"); |
| 98 | debug_indicator.set_high(); | 98 | debug_indicator.set_high(); |
| 99 | Timer::after(Duration::from_secs(5)).await; | 99 | Timer::after_secs(5).await; |
| 100 | debug_indicator.set_low(); | 100 | debug_indicator.set_low(); |
| 101 | } else { | 101 | } else { |
| 102 | info!("rx unknown packet"); | 102 | info!("rx unknown packet"); |
diff --git a/examples/rp/src/bin/lora_p2p_send_multicore.rs b/examples/rp/src/bin/lora_p2p_send_multicore.rs index e31aa62a2..ccf44987c 100644 --- a/examples/rp/src/bin/lora_p2p_send_multicore.rs +++ b/examples/rp/src/bin/lora_p2p_send_multicore.rs | |||
| @@ -15,7 +15,7 @@ use embassy_rp::peripherals::SPI1; | |||
| 15 | use embassy_rp::spi::{Async, Config, Spi}; | 15 | use embassy_rp::spi::{Async, Config, Spi}; |
| 16 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | 16 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; |
| 17 | use embassy_sync::channel::Channel; | 17 | use embassy_sync::channel::Channel; |
| 18 | use embassy_time::{Delay, Duration, Timer}; | 18 | use embassy_time::{Delay, Timer}; |
| 19 | use lora_phy::mod_params::*; | 19 | use lora_phy::mod_params::*; |
| 20 | use lora_phy::sx1261_2::SX1261_2; | 20 | use lora_phy::sx1261_2::SX1261_2; |
| 21 | use lora_phy::LoRa; | 21 | use lora_phy::LoRa; |
| @@ -59,7 +59,7 @@ async fn core0_task() { | |||
| 59 | info!("Hello from core 0"); | 59 | info!("Hello from core 0"); |
| 60 | loop { | 60 | loop { |
| 61 | CHANNEL.send([0x01u8, 0x02u8, 0x03u8]).await; | 61 | CHANNEL.send([0x01u8, 0x02u8, 0x03u8]).await; |
| 62 | Timer::after(Duration::from_millis(60 * 1000)).await; | 62 | Timer::after_millis(60 * 1000).await; |
| 63 | } | 63 | } |
| 64 | } | 64 | } |
| 65 | 65 | ||
diff --git a/examples/rp/src/bin/multicore.rs b/examples/rp/src/bin/multicore.rs index bf017f6a7..43eaf8b0a 100644 --- a/examples/rp/src/bin/multicore.rs +++ b/examples/rp/src/bin/multicore.rs | |||
| @@ -13,7 +13,7 @@ use embassy_rp::multicore::{spawn_core1, Stack}; | |||
| 13 | use embassy_rp::peripherals::PIN_25; | 13 | use embassy_rp::peripherals::PIN_25; |
| 14 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | 14 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; |
| 15 | use embassy_sync::channel::Channel; | 15 | use embassy_sync::channel::Channel; |
| 16 | use embassy_time::{Duration, Timer}; | 16 | use embassy_time::Timer; |
| 17 | use static_cell::StaticCell; | 17 | use static_cell::StaticCell; |
| 18 | use {defmt_rtt as _, panic_probe as _}; | 18 | use {defmt_rtt as _, panic_probe as _}; |
| 19 | 19 | ||
| @@ -46,9 +46,9 @@ async fn core0_task() { | |||
| 46 | info!("Hello from core 0"); | 46 | info!("Hello from core 0"); |
| 47 | loop { | 47 | loop { |
| 48 | CHANNEL.send(LedState::On).await; | 48 | CHANNEL.send(LedState::On).await; |
| 49 | Timer::after(Duration::from_millis(100)).await; | 49 | Timer::after_millis(100).await; |
| 50 | CHANNEL.send(LedState::Off).await; | 50 | CHANNEL.send(LedState::Off).await; |
| 51 | Timer::after(Duration::from_millis(400)).await; | 51 | Timer::after_millis(400).await; |
| 52 | } | 52 | } |
| 53 | } | 53 | } |
| 54 | 54 | ||
diff --git a/examples/rp/src/bin/multiprio.rs b/examples/rp/src/bin/multiprio.rs index 9ace4cd68..28f621437 100644 --- a/examples/rp/src/bin/multiprio.rs +++ b/examples/rp/src/bin/multiprio.rs | |||
| @@ -62,7 +62,7 @@ use defmt::{info, unwrap}; | |||
| 62 | use embassy_executor::{Executor, InterruptExecutor}; | 62 | use embassy_executor::{Executor, InterruptExecutor}; |
| 63 | use embassy_rp::interrupt; | 63 | use embassy_rp::interrupt; |
| 64 | use embassy_rp::interrupt::{InterruptExt, Priority}; | 64 | use embassy_rp::interrupt::{InterruptExt, Priority}; |
| 65 | use embassy_time::{Duration, Instant, Timer, TICK_HZ}; | 65 | use embassy_time::{Instant, Timer, TICK_HZ}; |
| 66 | use static_cell::StaticCell; | 66 | use static_cell::StaticCell; |
| 67 | use {defmt_rtt as _, panic_probe as _}; | 67 | use {defmt_rtt as _, panic_probe as _}; |
| 68 | 68 | ||
| @@ -70,7 +70,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 70 | async fn run_high() { | 70 | async fn run_high() { |
| 71 | loop { | 71 | loop { |
| 72 | info!(" [high] tick!"); | 72 | info!(" [high] tick!"); |
| 73 | Timer::after(Duration::from_ticks(673740)).await; | 73 | Timer::after_ticks(673740).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -87,7 +87,7 @@ async fn run_med() { | |||
| 87 | let ms = end.duration_since(start).as_ticks() * 1000 / TICK_HZ; | 87 | let ms = end.duration_since(start).as_ticks() * 1000 / TICK_HZ; |
| 88 | info!(" [med] done in {} ms", ms); | 88 | info!(" [med] done in {} ms", ms); |
| 89 | 89 | ||
| 90 | Timer::after(Duration::from_ticks(53421)).await; | 90 | Timer::after_ticks(53421).await; |
| 91 | } | 91 | } |
| 92 | } | 92 | } |
| 93 | 93 | ||
| @@ -104,7 +104,7 @@ async fn run_low() { | |||
| 104 | let ms = end.duration_since(start).as_ticks() * 1000 / TICK_HZ; | 104 | let ms = end.duration_since(start).as_ticks() * 1000 / TICK_HZ; |
| 105 | info!("[low] done in {} ms", ms); | 105 | info!("[low] done in {} ms", ms); |
| 106 | 106 | ||
| 107 | Timer::after(Duration::from_ticks(82983)).await; | 107 | Timer::after_ticks(82983).await; |
| 108 | } | 108 | } |
| 109 | } | 109 | } |
| 110 | 110 | ||
diff --git a/examples/rp/src/bin/pio_hd44780.rs b/examples/rp/src/bin/pio_hd44780.rs index d80c5c24b..5e5a6f9a3 100644 --- a/examples/rp/src/bin/pio_hd44780.rs +++ b/examples/rp/src/bin/pio_hd44780.rs | |||
| @@ -15,7 +15,7 @@ use embassy_rp::pio::{ | |||
| 15 | }; | 15 | }; |
| 16 | use embassy_rp::pwm::{self, Pwm}; | 16 | use embassy_rp::pwm::{self, Pwm}; |
| 17 | use embassy_rp::{bind_interrupts, into_ref, Peripheral, PeripheralRef}; | 17 | use embassy_rp::{bind_interrupts, into_ref, Peripheral, PeripheralRef}; |
| 18 | use embassy_time::{Duration, Instant, Timer}; | 18 | use embassy_time::{Instant, Timer}; |
| 19 | use {defmt_rtt as _, panic_probe as _}; | 19 | use {defmt_rtt as _, panic_probe as _}; |
| 20 | 20 | ||
| 21 | bind_interrupts!(pub struct Irqs { | 21 | bind_interrupts!(pub struct Irqs { |
| @@ -66,7 +66,7 @@ async fn main(_spawner: Spawner) { | |||
| 66 | let mut buf = Buf([0; 16], 0); | 66 | let mut buf = Buf([0; 16], 0); |
| 67 | write!(buf, "up {}s", Instant::now().as_micros() as f32 / 1e6).unwrap(); | 67 | write!(buf, "up {}s", Instant::now().as_micros() as f32 / 1e6).unwrap(); |
| 68 | hd.add_line(&buf.0[0..buf.1]).await; | 68 | hd.add_line(&buf.0[0..buf.1]).await; |
| 69 | Timer::after(Duration::from_secs(1)).await; | 69 | Timer::after_secs(1).await; |
| 70 | } | 70 | } |
| 71 | } | 71 | } |
| 72 | 72 | ||
diff --git a/examples/rp/src/bin/pio_ws2812.rs b/examples/rp/src/bin/pio_ws2812.rs index 5c0c60246..7b3259538 100644 --- a/examples/rp/src/bin/pio_ws2812.rs +++ b/examples/rp/src/bin/pio_ws2812.rs | |||
| @@ -13,7 +13,7 @@ use embassy_rp::pio::{ | |||
| 13 | Common, Config, FifoJoin, Instance, InterruptHandler, Pio, PioPin, ShiftConfig, ShiftDirection, StateMachine, | 13 | Common, Config, FifoJoin, Instance, InterruptHandler, Pio, PioPin, ShiftConfig, ShiftDirection, StateMachine, |
| 14 | }; | 14 | }; |
| 15 | use embassy_rp::{bind_interrupts, clocks, into_ref, Peripheral, PeripheralRef}; | 15 | use embassy_rp::{bind_interrupts, clocks, into_ref, Peripheral, PeripheralRef}; |
| 16 | use embassy_time::{Duration, Timer}; | 16 | use embassy_time::Timer; |
| 17 | use fixed::types::U24F8; | 17 | use fixed::types::U24F8; |
| 18 | use fixed_macro::fixed; | 18 | use fixed_macro::fixed; |
| 19 | use smart_leds::RGB8; | 19 | use smart_leds::RGB8; |
| @@ -153,7 +153,7 @@ async fn main(_spawner: Spawner) { | |||
| 153 | } | 153 | } |
| 154 | ws2812.write(&data).await; | 154 | ws2812.write(&data).await; |
| 155 | 155 | ||
| 156 | Timer::after(Duration::from_millis(10)).await; | 156 | Timer::after_millis(10).await; |
| 157 | } | 157 | } |
| 158 | } | 158 | } |
| 159 | } | 159 | } |
diff --git a/examples/rp/src/bin/pwm.rs b/examples/rp/src/bin/pwm.rs index 9d919287c..a99e88003 100644 --- a/examples/rp/src/bin/pwm.rs +++ b/examples/rp/src/bin/pwm.rs | |||
| @@ -9,7 +9,7 @@ | |||
| 9 | use defmt::*; | 9 | use defmt::*; |
| 10 | use embassy_executor::Spawner; | 10 | use embassy_executor::Spawner; |
| 11 | use embassy_rp::pwm::{Config, Pwm}; | 11 | use embassy_rp::pwm::{Config, Pwm}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| @@ -23,7 +23,7 @@ async fn main(_spawner: Spawner) { | |||
| 23 | 23 | ||
| 24 | loop { | 24 | loop { |
| 25 | info!("current LED duty cycle: {}/32768", c.compare_b); | 25 | info!("current LED duty cycle: {}/32768", c.compare_b); |
| 26 | Timer::after(Duration::from_secs(1)).await; | 26 | Timer::after_secs(1).await; |
| 27 | c.compare_b = c.compare_b.rotate_left(4); | 27 | c.compare_b = c.compare_b.rotate_left(4); |
| 28 | pwm.set_config(&c); | 28 | pwm.set_config(&c); |
| 29 | } | 29 | } |
diff --git a/examples/rp/src/bin/rosc.rs b/examples/rp/src/bin/rosc.rs new file mode 100644 index 000000000..f841043b6 --- /dev/null +++ b/examples/rp/src/bin/rosc.rs | |||
| @@ -0,0 +1,32 @@ | |||
| 1 | //! This example test the RP Pico on board LED. | ||
| 2 | //! | ||
| 3 | //! It does not work with the RP Pico W board. See wifi_blinky.rs. | ||
| 4 | |||
| 5 | #![no_std] | ||
| 6 | #![no_main] | ||
| 7 | #![feature(type_alias_impl_trait)] | ||
| 8 | |||
| 9 | use defmt::*; | ||
| 10 | use embassy_executor::Spawner; | ||
| 11 | use embassy_rp::{clocks, gpio}; | ||
| 12 | use embassy_time::Timer; | ||
| 13 | use gpio::{Level, Output}; | ||
| 14 | use {defmt_rtt as _, panic_probe as _}; | ||
| 15 | |||
| 16 | #[embassy_executor::main] | ||
| 17 | async fn main(_spawner: Spawner) { | ||
| 18 | let mut config = embassy_rp::config::Config::default(); | ||
| 19 | config.clocks = clocks::ClockConfig::rosc(); | ||
| 20 | let p = embassy_rp::init(config); | ||
| 21 | let mut led = Output::new(p.PIN_25, Level::Low); | ||
| 22 | |||
| 23 | loop { | ||
| 24 | info!("led on!"); | ||
| 25 | led.set_high(); | ||
| 26 | Timer::after_secs(1).await; | ||
| 27 | |||
| 28 | info!("led off!"); | ||
| 29 | led.set_low(); | ||
| 30 | Timer::after_secs(1).await; | ||
| 31 | } | ||
| 32 | } | ||
diff --git a/examples/rp/src/bin/rtc.rs b/examples/rp/src/bin/rtc.rs index 15aa8243f..667876db5 100644 --- a/examples/rp/src/bin/rtc.rs +++ b/examples/rp/src/bin/rtc.rs | |||
| @@ -7,7 +7,7 @@ | |||
| 7 | use defmt::*; | 7 | use defmt::*; |
| 8 | use embassy_executor::Spawner; | 8 | use embassy_executor::Spawner; |
| 9 | use embassy_rp::rtc::{DateTime, DayOfWeek, Rtc}; | 9 | use embassy_rp::rtc::{DateTime, DayOfWeek, Rtc}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::main] | 13 | #[embassy_executor::main] |
| @@ -31,7 +31,7 @@ async fn main(_spawner: Spawner) { | |||
| 31 | rtc.set_datetime(now).unwrap(); | 31 | rtc.set_datetime(now).unwrap(); |
| 32 | } | 32 | } |
| 33 | 33 | ||
| 34 | Timer::after(Duration::from_millis(20000)).await; | 34 | Timer::after_millis(20000).await; |
| 35 | 35 | ||
| 36 | if let Ok(dt) = rtc.now() { | 36 | if let Ok(dt) = rtc.now() { |
| 37 | info!( | 37 | info!( |
| @@ -41,6 +41,6 @@ async fn main(_spawner: Spawner) { | |||
| 41 | } | 41 | } |
| 42 | 42 | ||
| 43 | info!("Reboot."); | 43 | info!("Reboot."); |
| 44 | Timer::after(Duration::from_millis(200)).await; | 44 | Timer::after_millis(200).await; |
| 45 | cortex_m::peripheral::SCB::sys_reset(); | 45 | cortex_m::peripheral::SCB::sys_reset(); |
| 46 | } | 46 | } |
diff --git a/examples/rp/src/bin/spi_async.rs b/examples/rp/src/bin/spi_async.rs index 328074e8b..f5a2d334e 100644 --- a/examples/rp/src/bin/spi_async.rs +++ b/examples/rp/src/bin/spi_async.rs | |||
| @@ -8,7 +8,7 @@ | |||
| 8 | use defmt::*; | 8 | use defmt::*; |
| 9 | use embassy_executor::Spawner; | 9 | use embassy_executor::Spawner; |
| 10 | use embassy_rp::spi::{Config, Spi}; | 10 | use embassy_rp::spi::{Config, Spi}; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | #[embassy_executor::main] | 14 | #[embassy_executor::main] |
| @@ -27,6 +27,6 @@ async fn main(_spawner: Spawner) { | |||
| 27 | let mut rx_buf = [0_u8; 6]; | 27 | let mut rx_buf = [0_u8; 6]; |
| 28 | spi.transfer(&mut rx_buf, &tx_buf).await.unwrap(); | 28 | spi.transfer(&mut rx_buf, &tx_buf).await.unwrap(); |
| 29 | info!("{:?}", rx_buf); | 29 | info!("{:?}", rx_buf); |
| 30 | Timer::after(Duration::from_secs(1)).await; | 30 | Timer::after_secs(1).await; |
| 31 | } | 31 | } |
| 32 | } | 32 | } |
diff --git a/examples/rp/src/bin/uart_buffered_split.rs b/examples/rp/src/bin/uart_buffered_split.rs index d3e67c8ed..14e8810a4 100644 --- a/examples/rp/src/bin/uart_buffered_split.rs +++ b/examples/rp/src/bin/uart_buffered_split.rs | |||
| @@ -13,7 +13,7 @@ use embassy_executor::Spawner; | |||
| 13 | use embassy_rp::bind_interrupts; | 13 | use embassy_rp::bind_interrupts; |
| 14 | use embassy_rp::peripherals::UART0; | 14 | use embassy_rp::peripherals::UART0; |
| 15 | use embassy_rp::uart::{BufferedInterruptHandler, BufferedUart, BufferedUartRx, Config}; | 15 | use embassy_rp::uart::{BufferedInterruptHandler, BufferedUart, BufferedUartRx, Config}; |
| 16 | use embassy_time::{Duration, Timer}; | 16 | use embassy_time::Timer; |
| 17 | use embedded_io_async::{Read, Write}; | 17 | use embedded_io_async::{Read, Write}; |
| 18 | use static_cell::make_static; | 18 | use static_cell::make_static; |
| 19 | use {defmt_rtt as _, panic_probe as _}; | 19 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -42,7 +42,7 @@ async fn main(spawner: Spawner) { | |||
| 42 | ]; | 42 | ]; |
| 43 | info!("TX {:?}", data); | 43 | info!("TX {:?}", data); |
| 44 | tx.write_all(&data).await.unwrap(); | 44 | tx.write_all(&data).await.unwrap(); |
| 45 | Timer::after(Duration::from_secs(1)).await; | 45 | Timer::after_secs(1).await; |
| 46 | } | 46 | } |
| 47 | } | 47 | } |
| 48 | 48 | ||
diff --git a/examples/rp/src/bin/uart_unidir.rs b/examples/rp/src/bin/uart_unidir.rs index c1515a911..42c8b432e 100644 --- a/examples/rp/src/bin/uart_unidir.rs +++ b/examples/rp/src/bin/uart_unidir.rs | |||
| @@ -14,7 +14,7 @@ use embassy_executor::Spawner; | |||
| 14 | use embassy_rp::bind_interrupts; | 14 | use embassy_rp::bind_interrupts; |
| 15 | use embassy_rp::peripherals::UART1; | 15 | use embassy_rp::peripherals::UART1; |
| 16 | use embassy_rp::uart::{Async, Config, InterruptHandler, UartRx, UartTx}; | 16 | use embassy_rp::uart::{Async, Config, InterruptHandler, UartRx, UartTx}; |
| 17 | use embassy_time::{Duration, Timer}; | 17 | use embassy_time::Timer; |
| 18 | use {defmt_rtt as _, panic_probe as _}; | 18 | use {defmt_rtt as _, panic_probe as _}; |
| 19 | 19 | ||
| 20 | bind_interrupts!(struct Irqs { | 20 | bind_interrupts!(struct Irqs { |
| @@ -35,7 +35,7 @@ async fn main(spawner: Spawner) { | |||
| 35 | let data = [1u8, 2, 3, 4, 5, 6, 7, 8]; | 35 | let data = [1u8, 2, 3, 4, 5, 6, 7, 8]; |
| 36 | info!("TX {:?}", data); | 36 | info!("TX {:?}", data); |
| 37 | uart_tx.write(&data).await.unwrap(); | 37 | uart_tx.write(&data).await.unwrap(); |
| 38 | Timer::after(Duration::from_secs(1)).await; | 38 | Timer::after_secs(1).await; |
| 39 | } | 39 | } |
| 40 | } | 40 | } |
| 41 | 41 | ||
diff --git a/examples/rp/src/bin/usb_hid_keyboard.rs b/examples/rp/src/bin/usb_hid_keyboard.rs index 99af1f02f..cc2090d22 100644 --- a/examples/rp/src/bin/usb_hid_keyboard.rs +++ b/examples/rp/src/bin/usb_hid_keyboard.rs | |||
| @@ -78,6 +78,9 @@ async fn main(_spawner: Spawner) { | |||
| 78 | // Set up the signal pin that will be used to trigger the keyboard. | 78 | // Set up the signal pin that will be used to trigger the keyboard. |
| 79 | let mut signal_pin = Input::new(p.PIN_16, Pull::None); | 79 | let mut signal_pin = Input::new(p.PIN_16, Pull::None); |
| 80 | 80 | ||
| 81 | // Enable the schmitt trigger to slightly debounce. | ||
| 82 | signal_pin.set_schmitt(true); | ||
| 83 | |||
| 81 | let (reader, mut writer) = hid.split(); | 84 | let (reader, mut writer) = hid.split(); |
| 82 | 85 | ||
| 83 | // Do stuff with the class! | 86 | // Do stuff with the class! |
diff --git a/examples/rp/src/bin/usb_logger.rs b/examples/rp/src/bin/usb_logger.rs index 9c5e6897d..791f15e56 100644 --- a/examples/rp/src/bin/usb_logger.rs +++ b/examples/rp/src/bin/usb_logger.rs | |||
| @@ -10,7 +10,7 @@ use embassy_executor::Spawner; | |||
| 10 | use embassy_rp::bind_interrupts; | 10 | use embassy_rp::bind_interrupts; |
| 11 | use embassy_rp::peripherals::USB; | 11 | use embassy_rp::peripherals::USB; |
| 12 | use embassy_rp::usb::{Driver, InterruptHandler}; | 12 | use embassy_rp::usb::{Driver, InterruptHandler}; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| 16 | bind_interrupts!(struct Irqs { | 16 | bind_interrupts!(struct Irqs { |
| @@ -32,6 +32,6 @@ async fn main(spawner: Spawner) { | |||
| 32 | loop { | 32 | loop { |
| 33 | counter += 1; | 33 | counter += 1; |
| 34 | log::info!("Tick {}", counter); | 34 | log::info!("Tick {}", counter); |
| 35 | Timer::after(Duration::from_secs(1)).await; | 35 | Timer::after_secs(1).await; |
| 36 | } | 36 | } |
| 37 | } | 37 | } |
diff --git a/examples/rp/src/bin/usb_midi.rs b/examples/rp/src/bin/usb_midi.rs new file mode 100644 index 000000000..f0b03c81b --- /dev/null +++ b/examples/rp/src/bin/usb_midi.rs | |||
| @@ -0,0 +1,110 @@ | |||
| 1 | //! This example shows how to use USB (Universal Serial Bus) in the RP2040 chip. | ||
| 2 | //! | ||
| 3 | //! This creates a USB MIDI device that echoes MIDI messages back to the host. | ||
| 4 | |||
| 5 | #![no_std] | ||
| 6 | #![no_main] | ||
| 7 | #![feature(type_alias_impl_trait)] | ||
| 8 | |||
| 9 | use defmt::{info, panic}; | ||
| 10 | use embassy_executor::Spawner; | ||
| 11 | use embassy_futures::join::join; | ||
| 12 | use embassy_rp::bind_interrupts; | ||
| 13 | use embassy_rp::peripherals::USB; | ||
| 14 | use embassy_rp::usb::{Driver, Instance, InterruptHandler}; | ||
| 15 | use embassy_usb::class::midi::MidiClass; | ||
| 16 | use embassy_usb::driver::EndpointError; | ||
| 17 | use embassy_usb::{Builder, Config}; | ||
| 18 | use {defmt_rtt as _, panic_probe as _}; | ||
| 19 | |||
| 20 | bind_interrupts!(struct Irqs { | ||
| 21 | USBCTRL_IRQ => InterruptHandler<USB>; | ||
| 22 | }); | ||
| 23 | |||
| 24 | #[embassy_executor::main] | ||
| 25 | async fn main(_spawner: Spawner) { | ||
| 26 | info!("Hello world!"); | ||
| 27 | |||
| 28 | let p = embassy_rp::init(Default::default()); | ||
| 29 | |||
| 30 | // Create the driver, from the HAL. | ||
| 31 | let driver = Driver::new(p.USB, Irqs); | ||
| 32 | |||
| 33 | // Create embassy-usb Config | ||
| 34 | let mut config = Config::new(0xc0de, 0xcafe); | ||
| 35 | config.manufacturer = Some("Embassy"); | ||
| 36 | config.product = Some("USB-MIDI example"); | ||
| 37 | config.serial_number = Some("12345678"); | ||
| 38 | config.max_power = 100; | ||
| 39 | config.max_packet_size_0 = 64; | ||
| 40 | |||
| 41 | // Required for windows compatibility. | ||
| 42 | // https://developer.nordicsemi.com/nRF_Connect_SDK/doc/1.9.1/kconfig/CONFIG_CDC_ACM_IAD.html#help | ||
| 43 | config.device_class = 0xEF; | ||
| 44 | config.device_sub_class = 0x02; | ||
| 45 | config.device_protocol = 0x01; | ||
| 46 | config.composite_with_iads = true; | ||
| 47 | |||
| 48 | // Create embassy-usb DeviceBuilder using the driver and config. | ||
| 49 | // It needs some buffers for building the descriptors. | ||
| 50 | let mut device_descriptor = [0; 256]; | ||
| 51 | let mut config_descriptor = [0; 256]; | ||
| 52 | let mut bos_descriptor = [0; 256]; | ||
| 53 | let mut control_buf = [0; 64]; | ||
| 54 | |||
| 55 | let mut builder = Builder::new( | ||
| 56 | driver, | ||
| 57 | config, | ||
| 58 | &mut device_descriptor, | ||
| 59 | &mut config_descriptor, | ||
| 60 | &mut bos_descriptor, | ||
| 61 | &mut control_buf, | ||
| 62 | ); | ||
| 63 | |||
| 64 | // Create classes on the builder. | ||
| 65 | let mut class = MidiClass::new(&mut builder, 1, 1, 64); | ||
| 66 | |||
| 67 | // The `MidiClass` can be split into `Sender` and `Receiver`, to be used in separate tasks. | ||
| 68 | // let (sender, receiver) = class.split(); | ||
| 69 | |||
| 70 | // Build the builder. | ||
| 71 | let mut usb = builder.build(); | ||
| 72 | |||
| 73 | // Run the USB device. | ||
| 74 | let usb_fut = usb.run(); | ||
| 75 | |||
| 76 | // Use the Midi class! | ||
| 77 | let midi_fut = async { | ||
| 78 | loop { | ||
| 79 | class.wait_connection().await; | ||
| 80 | info!("Connected"); | ||
| 81 | let _ = midi_echo(&mut class).await; | ||
| 82 | info!("Disconnected"); | ||
| 83 | } | ||
| 84 | }; | ||
| 85 | |||
| 86 | // Run everything concurrently. | ||
| 87 | // If we had made everything `'static` above instead, we could do this using separate tasks instead. | ||
| 88 | join(usb_fut, midi_fut).await; | ||
| 89 | } | ||
| 90 | |||
| 91 | struct Disconnected {} | ||
| 92 | |||
| 93 | impl From<EndpointError> for Disconnected { | ||
| 94 | fn from(val: EndpointError) -> Self { | ||
| 95 | match val { | ||
| 96 | EndpointError::BufferOverflow => panic!("Buffer overflow"), | ||
| 97 | EndpointError::Disabled => Disconnected {}, | ||
| 98 | } | ||
| 99 | } | ||
| 100 | } | ||
| 101 | |||
| 102 | async fn midi_echo<'d, T: Instance + 'd>(class: &mut MidiClass<'d, Driver<'d, T>>) -> Result<(), Disconnected> { | ||
| 103 | let mut buf = [0; 64]; | ||
| 104 | loop { | ||
| 105 | let n = class.read_packet(&mut buf).await?; | ||
| 106 | let data = &buf[..n]; | ||
| 107 | info!("data: {:x}", data); | ||
| 108 | class.write_packet(data).await?; | ||
| 109 | } | ||
| 110 | } | ||
diff --git a/examples/rp/src/bin/watchdog.rs b/examples/rp/src/bin/watchdog.rs index fe5eaf926..b6af518af 100644 --- a/examples/rp/src/bin/watchdog.rs +++ b/examples/rp/src/bin/watchdog.rs | |||
| @@ -24,7 +24,7 @@ async fn main(_spawner: Spawner) { | |||
| 24 | 24 | ||
| 25 | // Set the LED high for 2 seconds so we know when we're about to start the watchdog | 25 | // Set the LED high for 2 seconds so we know when we're about to start the watchdog |
| 26 | led.set_high(); | 26 | led.set_high(); |
| 27 | Timer::after(Duration::from_secs(2)).await; | 27 | Timer::after_secs(2).await; |
| 28 | 28 | ||
| 29 | // Set to watchdog to reset if it's not fed within 1.05 seconds, and start it | 29 | // Set to watchdog to reset if it's not fed within 1.05 seconds, and start it |
| 30 | watchdog.start(Duration::from_millis(1_050)); | 30 | watchdog.start(Duration::from_millis(1_050)); |
| @@ -33,9 +33,9 @@ async fn main(_spawner: Spawner) { | |||
| 33 | // Blink once a second for 5 seconds, feed the watchdog timer once a second to avoid a reset | 33 | // Blink once a second for 5 seconds, feed the watchdog timer once a second to avoid a reset |
| 34 | for _ in 1..=5 { | 34 | for _ in 1..=5 { |
| 35 | led.set_low(); | 35 | led.set_low(); |
| 36 | Timer::after(Duration::from_millis(500)).await; | 36 | Timer::after_millis(500).await; |
| 37 | led.set_high(); | 37 | led.set_high(); |
| 38 | Timer::after(Duration::from_millis(500)).await; | 38 | Timer::after_millis(500).await; |
| 39 | info!("Feeding watchdog"); | 39 | info!("Feeding watchdog"); |
| 40 | watchdog.feed(); | 40 | watchdog.feed(); |
| 41 | } | 41 | } |
| @@ -45,8 +45,8 @@ async fn main(_spawner: Spawner) { | |||
| 45 | // The processor should reset in 1.05 seconds. | 45 | // The processor should reset in 1.05 seconds. |
| 46 | loop { | 46 | loop { |
| 47 | led.set_low(); | 47 | led.set_low(); |
| 48 | Timer::after(Duration::from_millis(100)).await; | 48 | Timer::after_millis(100).await; |
| 49 | led.set_high(); | 49 | led.set_high(); |
| 50 | Timer::after(Duration::from_millis(100)).await; | 50 | Timer::after_millis(100).await; |
| 51 | } | 51 | } |
| 52 | } | 52 | } |
diff --git a/examples/rp/src/bin/wifi_ap_tcp_server.rs b/examples/rp/src/bin/wifi_ap_tcp_server.rs index cd61ad789..98cae53f6 100644 --- a/examples/rp/src/bin/wifi_ap_tcp_server.rs +++ b/examples/rp/src/bin/wifi_ap_tcp_server.rs | |||
| @@ -52,7 +52,7 @@ async fn main(spawner: Spawner) { | |||
| 52 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: | 52 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: |
| 53 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 | 53 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 |
| 54 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 | 54 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 |
| 55 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 224190) }; | 55 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 230321) }; |
| 56 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; | 56 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; |
| 57 | 57 | ||
| 58 | let pwr = Output::new(p.PIN_23, Level::Low); | 58 | let pwr = Output::new(p.PIN_23, Level::Low); |
diff --git a/examples/rp/src/bin/wifi_blinky.rs b/examples/rp/src/bin/wifi_blinky.rs index 33d43788c..14ace74e9 100644 --- a/examples/rp/src/bin/wifi_blinky.rs +++ b/examples/rp/src/bin/wifi_blinky.rs | |||
| @@ -38,7 +38,7 @@ async fn main(spawner: Spawner) { | |||
| 38 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: | 38 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: |
| 39 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 | 39 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 |
| 40 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 | 40 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 |
| 41 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 224190) }; | 41 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 230321) }; |
| 42 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; | 42 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; |
| 43 | 43 | ||
| 44 | let pwr = Output::new(p.PIN_23, Level::Low); | 44 | let pwr = Output::new(p.PIN_23, Level::Low); |
diff --git a/examples/rp/src/bin/wifi_scan.rs b/examples/rp/src/bin/wifi_scan.rs index 743fab617..dbbbf6c81 100644 --- a/examples/rp/src/bin/wifi_scan.rs +++ b/examples/rp/src/bin/wifi_scan.rs | |||
| @@ -49,7 +49,7 @@ async fn main(spawner: Spawner) { | |||
| 49 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: | 49 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: |
| 50 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 | 50 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 |
| 51 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 | 51 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 |
| 52 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 224190) }; | 52 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 230321) }; |
| 53 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; | 53 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; |
| 54 | 54 | ||
| 55 | let pwr = Output::new(p.PIN_23, Level::Low); | 55 | let pwr = Output::new(p.PIN_23, Level::Low); |
diff --git a/examples/rp/src/bin/wifi_tcp_server.rs b/examples/rp/src/bin/wifi_tcp_server.rs index 55fcb4a6a..c00fff216 100644 --- a/examples/rp/src/bin/wifi_tcp_server.rs +++ b/examples/rp/src/bin/wifi_tcp_server.rs | |||
| @@ -18,7 +18,7 @@ use embassy_rp::bind_interrupts; | |||
| 18 | use embassy_rp::gpio::{Level, Output}; | 18 | use embassy_rp::gpio::{Level, Output}; |
| 19 | use embassy_rp::peripherals::{DMA_CH0, PIN_23, PIN_25, PIO0}; | 19 | use embassy_rp::peripherals::{DMA_CH0, PIN_23, PIN_25, PIO0}; |
| 20 | use embassy_rp::pio::{InterruptHandler, Pio}; | 20 | use embassy_rp::pio::{InterruptHandler, Pio}; |
| 21 | use embassy_time::Duration; | 21 | use embassy_time::{Duration, Timer}; |
| 22 | use embedded_io_async::Write; | 22 | use embedded_io_async::Write; |
| 23 | use static_cell::make_static; | 23 | use static_cell::make_static; |
| 24 | use {defmt_rtt as _, panic_probe as _}; | 24 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -55,7 +55,7 @@ async fn main(spawner: Spawner) { | |||
| 55 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: | 55 | // at hardcoded addresses, instead of baking them into the program with `include_bytes!`: |
| 56 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 | 56 | // probe-rs download 43439A0.bin --format bin --chip RP2040 --base-address 0x10100000 |
| 57 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 | 57 | // probe-rs download 43439A0_clm.bin --format bin --chip RP2040 --base-address 0x10140000 |
| 58 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 224190) }; | 58 | //let fw = unsafe { core::slice::from_raw_parts(0x10100000 as *const u8, 230321) }; |
| 59 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; | 59 | //let clm = unsafe { core::slice::from_raw_parts(0x10140000 as *const u8, 4752) }; |
| 60 | 60 | ||
| 61 | let pwr = Output::new(p.PIN_23, Level::Low); | 61 | let pwr = Output::new(p.PIN_23, Level::Low); |
| @@ -102,6 +102,13 @@ async fn main(spawner: Spawner) { | |||
| 102 | } | 102 | } |
| 103 | } | 103 | } |
| 104 | 104 | ||
| 105 | // Wait for DHCP, not necessary when using static IP | ||
| 106 | info!("waiting for DHCP..."); | ||
| 107 | while !stack.is_config_up() { | ||
| 108 | Timer::after_millis(100).await; | ||
| 109 | } | ||
| 110 | info!("DHCP is now up!"); | ||
| 111 | |||
| 105 | // And now we can use it! | 112 | // And now we can use it! |
| 106 | 113 | ||
| 107 | let mut rx_buffer = [0; 4096]; | 114 | let mut rx_buffer = [0; 4096]; |
diff --git a/examples/std/Cargo.toml b/examples/std/Cargo.toml index e54f36980..a5f4c8713 100644 --- a/examples/std/Cargo.toml +++ b/examples/std/Cargo.toml | |||
| @@ -7,12 +7,12 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] } | 8 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-std", "executor-thread", "log", "nightly", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-std", "executor-thread", "log", "nightly", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["log", "std", "nightly"] } | 10 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["log", "std", "nightly"] } |
| 11 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] } | 11 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features=[ "std", "nightly", "log", "medium-ethernet", "medium-ip", "tcp", "udp", "dns", "dhcpv4", "proto-ipv6"] } |
| 12 | embassy-net-tuntap = { version = "0.1.0", path = "../../embassy-net-tuntap" } | 12 | embassy-net-tuntap = { version = "0.1.0", path = "../../embassy-net-tuntap" } |
| 13 | embassy-net-ppp = { version = "0.1.0", path = "../../embassy-net-ppp", features = ["log"]} | 13 | embassy-net-ppp = { version = "0.1.0", path = "../../embassy-net-ppp", features = ["log"]} |
| 14 | embedded-io-async = { version = "0.5.0" } | 14 | embedded-io-async = { version = "0.6.0" } |
| 15 | embedded-io-adapters = { version = "0.5.0", features = ["futures-03"] } | 15 | embedded-io-adapters = { version = "0.6.0", features = ["futures-03"] } |
| 16 | critical-section = { version = "1.1", features = ["std"] } | 16 | critical-section = { version = "1.1", features = ["std"] } |
| 17 | smoltcp = { version = "0.10.0", features = ["dns-max-server-count-4"] } | 17 | smoltcp = { version = "0.10.0", features = ["dns-max-server-count-4"] } |
| 18 | 18 | ||
diff --git a/examples/std/src/bin/net_ppp.rs b/examples/std/src/bin/net_ppp.rs index 9cf6e19df..9ea07b29a 100644 --- a/examples/std/src/bin/net_ppp.rs +++ b/examples/std/src/bin/net_ppp.rs | |||
| @@ -8,7 +8,7 @@ | |||
| 8 | //! nc 192.168.7.10 1234 | 8 | //! nc 192.168.7.10 1234 |
| 9 | 9 | ||
| 10 | #![feature(type_alias_impl_trait)] | 10 | #![feature(type_alias_impl_trait)] |
| 11 | #![feature(async_fn_in_trait, impl_trait_projections)] | 11 | #![feature(async_fn_in_trait)] |
| 12 | 12 | ||
| 13 | #[path = "../serial_port.rs"] | 13 | #[path = "../serial_port.rs"] |
| 14 | mod serial_port; | 14 | mod serial_port; |
diff --git a/examples/std/src/bin/tcp_accept.rs b/examples/std/src/bin/tcp_accept.rs index 199e4c9ec..79fa375cd 100644 --- a/examples/std/src/bin/tcp_accept.rs +++ b/examples/std/src/bin/tcp_accept.rs | |||
| @@ -100,7 +100,7 @@ async fn main_task(spawner: Spawner) { | |||
| 100 | return; | 100 | return; |
| 101 | } | 101 | } |
| 102 | 102 | ||
| 103 | Timer::after(Duration::from_millis(500)).await; | 103 | Timer::after_millis(500).await; |
| 104 | } | 104 | } |
| 105 | info!("Closing the connection"); | 105 | info!("Closing the connection"); |
| 106 | socket.abort(); | 106 | socket.abort(); |
diff --git a/examples/std/src/bin/tick.rs b/examples/std/src/bin/tick.rs index b9de9d873..a3f99067e 100644 --- a/examples/std/src/bin/tick.rs +++ b/examples/std/src/bin/tick.rs | |||
| @@ -1,14 +1,14 @@ | |||
| 1 | #![feature(type_alias_impl_trait)] | 1 | #![feature(type_alias_impl_trait)] |
| 2 | 2 | ||
| 3 | use embassy_executor::Spawner; | 3 | use embassy_executor::Spawner; |
| 4 | use embassy_time::{Duration, Timer}; | 4 | use embassy_time::Timer; |
| 5 | use log::*; | 5 | use log::*; |
| 6 | 6 | ||
| 7 | #[embassy_executor::task] | 7 | #[embassy_executor::task] |
| 8 | async fn run() { | 8 | async fn run() { |
| 9 | loop { | 9 | loop { |
| 10 | info!("tick"); | 10 | info!("tick"); |
| 11 | Timer::after(Duration::from_secs(1)).await; | 11 | Timer::after_secs(1).await; |
| 12 | } | 12 | } |
| 13 | } | 13 | } |
| 14 | 14 | ||
diff --git a/examples/stm32c0/Cargo.toml b/examples/stm32c0/Cargo.toml index 89ecc4995..b80ccd302 100644 --- a/examples/stm32c0/Cargo.toml +++ b/examples/stm32c0/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32c031c6", "memory-x", "unstable-pac", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32c031c6", "memory-x", "unstable-pac", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | 13 | ||
| 14 | defmt = "0.3" | 14 | defmt = "0.3" |
| 15 | defmt-rtt = "0.4" | 15 | defmt-rtt = "0.4" |
diff --git a/examples/stm32c0/src/bin/blinky.rs b/examples/stm32c0/src/bin/blinky.rs index 8a65b0692..cbeb0dee1 100644 --- a/examples/stm32c0/src/bin/blinky.rs +++ b/examples/stm32c0/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f0/Cargo.toml b/examples/stm32f0/Cargo.toml index db9a24d73..47a95ec1e 100644 --- a/examples/stm32f0/Cargo.toml +++ b/examples/stm32f0/Cargo.toml | |||
| @@ -16,7 +16,7 @@ defmt-rtt = "0.4" | |||
| 16 | panic-probe = "0.3" | 16 | panic-probe = "0.3" |
| 17 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 17 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 18 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } | 18 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } |
| 19 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 19 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 20 | static_cell = { version = "1.1", features = ["nightly"]} | 20 | static_cell = { version = "1.1", features = ["nightly"]} |
| 21 | 21 | ||
| 22 | [profile.release] | 22 | [profile.release] |
diff --git a/examples/stm32f0/src/bin/adc.rs b/examples/stm32f0/src/bin/adc.rs index 1564ecfc0..96f234402 100644 --- a/examples/stm32f0/src/bin/adc.rs +++ b/examples/stm32f0/src/bin/adc.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_stm32::adc::{Adc, SampleTime}; | 7 | use embassy_stm32::adc::{Adc, SampleTime}; |
| 8 | use embassy_stm32::peripherals::ADC; | 8 | use embassy_stm32::peripherals::ADC; |
| 9 | use embassy_stm32::{adc, bind_interrupts}; | 9 | use embassy_stm32::{adc, bind_interrupts}; |
| 10 | use embassy_time::{Delay, Duration, Timer}; | 10 | use embassy_time::{Delay, Timer}; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | bind_interrupts!(struct Irqs { | 13 | bind_interrupts!(struct Irqs { |
| @@ -36,6 +36,6 @@ async fn main(_spawner: Spawner) { | |||
| 36 | loop { | 36 | loop { |
| 37 | let v = adc.read(&mut pin).await; | 37 | let v = adc.read(&mut pin).await; |
| 38 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); | 38 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); |
| 39 | Timer::after(Duration::from_millis(100)).await; | 39 | Timer::after_millis(100).await; |
| 40 | } | 40 | } |
| 41 | } | 41 | } |
diff --git a/examples/stm32f0/src/bin/blinky.rs b/examples/stm32f0/src/bin/blinky.rs index 9f923399c..899394546 100644 --- a/examples/stm32f0/src/bin/blinky.rs +++ b/examples/stm32f0/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | // main is itself an async function. | 11 | // main is itself an async function. |
| @@ -19,10 +19,10 @@ async fn main(_spawner: Spawner) { | |||
| 19 | loop { | 19 | loop { |
| 20 | info!("high"); | 20 | info!("high"); |
| 21 | led.set_high(); | 21 | led.set_high(); |
| 22 | Timer::after(Duration::from_millis(300)).await; | 22 | Timer::after_millis(300).await; |
| 23 | 23 | ||
| 24 | info!("low"); | 24 | info!("low"); |
| 25 | led.set_low(); | 25 | led.set_low(); |
| 26 | Timer::after(Duration::from_millis(300)).await; | 26 | Timer::after_millis(300).await; |
| 27 | } | 27 | } |
| 28 | } | 28 | } |
diff --git a/examples/stm32f0/src/bin/button_controlled_blink.rs b/examples/stm32f0/src/bin/button_controlled_blink.rs index f362c53f5..306df1752 100644 --- a/examples/stm32f0/src/bin/button_controlled_blink.rs +++ b/examples/stm32f0/src/bin/button_controlled_blink.rs | |||
| @@ -10,7 +10,7 @@ use defmt::info; | |||
| 10 | use embassy_executor::Spawner; | 10 | use embassy_executor::Spawner; |
| 11 | use embassy_stm32::exti::ExtiInput; | 11 | use embassy_stm32::exti::ExtiInput; |
| 12 | use embassy_stm32::gpio::{AnyPin, Input, Level, Output, Pin, Pull, Speed}; | 12 | use embassy_stm32::gpio::{AnyPin, Input, Level, Output, Pin, Pull, Speed}; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| 16 | static BLINK_MS: AtomicU32 = AtomicU32::new(0); | 16 | static BLINK_MS: AtomicU32 = AtomicU32::new(0); |
| @@ -24,7 +24,7 @@ async fn led_task(led: AnyPin) { | |||
| 24 | loop { | 24 | loop { |
| 25 | let del = BLINK_MS.load(Ordering::Relaxed); | 25 | let del = BLINK_MS.load(Ordering::Relaxed); |
| 26 | info!("Value of del is {}", del); | 26 | info!("Value of del is {}", del); |
| 27 | Timer::after(Duration::from_millis(del.into())).await; | 27 | Timer::after_millis(del.into()).await; |
| 28 | info!("LED toggling"); | 28 | info!("LED toggling"); |
| 29 | led.toggle(); | 29 | led.toggle(); |
| 30 | } | 30 | } |
diff --git a/examples/stm32f0/src/bin/hello.rs b/examples/stm32f0/src/bin/hello.rs index db78233ea..0f98d9865 100644 --- a/examples/stm32f0/src/bin/hello.rs +++ b/examples/stm32f0/src/bin/hello.rs | |||
| @@ -4,14 +4,14 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::info; | 5 | use defmt::info; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_time::{Duration, Timer}; | 7 | use embassy_time::Timer; |
| 8 | use {defmt_rtt as _, panic_probe as _}; | 8 | use {defmt_rtt as _, panic_probe as _}; |
| 9 | 9 | ||
| 10 | #[embassy_executor::main] | 10 | #[embassy_executor::main] |
| 11 | async fn main(_spawner: Spawner) -> ! { | 11 | async fn main(_spawner: Spawner) -> ! { |
| 12 | let _p = embassy_stm32::init(Default::default()); | 12 | let _p = embassy_stm32::init(Default::default()); |
| 13 | loop { | 13 | loop { |
| 14 | Timer::after(Duration::from_secs(1)).await; | 14 | Timer::after_secs(1).await; |
| 15 | info!("Hello"); | 15 | info!("Hello"); |
| 16 | } | 16 | } |
| 17 | } | 17 | } |
diff --git a/examples/stm32f0/src/bin/multiprio.rs b/examples/stm32f0/src/bin/multiprio.rs index 988ffeef1..870c7c45b 100644 --- a/examples/stm32f0/src/bin/multiprio.rs +++ b/examples/stm32f0/src/bin/multiprio.rs | |||
| @@ -62,7 +62,7 @@ use defmt::*; | |||
| 62 | use embassy_executor::{Executor, InterruptExecutor}; | 62 | use embassy_executor::{Executor, InterruptExecutor}; |
| 63 | use embassy_stm32::interrupt; | 63 | use embassy_stm32::interrupt; |
| 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; | 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; |
| 65 | use embassy_time::{Duration, Instant, Timer}; | 65 | use embassy_time::{Instant, Timer}; |
| 66 | use static_cell::StaticCell; | 66 | use static_cell::StaticCell; |
| 67 | use {defmt_rtt as _, panic_probe as _}; | 67 | use {defmt_rtt as _, panic_probe as _}; |
| 68 | 68 | ||
| @@ -70,7 +70,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 70 | async fn run_high() { | 70 | async fn run_high() { |
| 71 | loop { | 71 | loop { |
| 72 | // info!(" [high] tick!"); | 72 | // info!(" [high] tick!"); |
| 73 | Timer::after(Duration::from_ticks(27374)).await; | 73 | Timer::after_ticks(27374).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -87,7 +87,7 @@ async fn run_med() { | |||
| 87 | let ms = end.duration_since(start).as_ticks() / 33; | 87 | let ms = end.duration_since(start).as_ticks() / 33; |
| 88 | info!(" [med] done in {} ms", ms); | 88 | info!(" [med] done in {} ms", ms); |
| 89 | 89 | ||
| 90 | Timer::after(Duration::from_ticks(23421)).await; | 90 | Timer::after_ticks(23421).await; |
| 91 | } | 91 | } |
| 92 | } | 92 | } |
| 93 | 93 | ||
| @@ -104,7 +104,7 @@ async fn run_low() { | |||
| 104 | let ms = end.duration_since(start).as_ticks() / 33; | 104 | let ms = end.duration_since(start).as_ticks() / 33; |
| 105 | info!("[low] done in {} ms", ms); | 105 | info!("[low] done in {} ms", ms); |
| 106 | 106 | ||
| 107 | Timer::after(Duration::from_ticks(32983)).await; | 107 | Timer::after_ticks(32983).await; |
| 108 | } | 108 | } |
| 109 | } | 109 | } |
| 110 | 110 | ||
diff --git a/examples/stm32f0/src/bin/wdg.rs b/examples/stm32f0/src/bin/wdg.rs index a44b17528..b51dee8ee 100644 --- a/examples/stm32f0/src/bin/wdg.rs +++ b/examples/stm32f0/src/bin/wdg.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::wdg::IndependentWatchdog; | 7 | use embassy_stm32::wdg::IndependentWatchdog; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -19,7 +19,7 @@ async fn main(_spawner: Spawner) { | |||
| 19 | wdg.unleash(); | 19 | wdg.unleash(); |
| 20 | 20 | ||
| 21 | loop { | 21 | loop { |
| 22 | Timer::after(Duration::from_secs(1)).await; | 22 | Timer::after_secs(1).await; |
| 23 | wdg.pet(); | 23 | wdg.pet(); |
| 24 | } | 24 | } |
| 25 | } | 25 | } |
diff --git a/examples/stm32f1/Cargo.toml b/examples/stm32f1/Cargo.toml index b032ba817..34319fbd8 100644 --- a/examples/stm32f1/Cargo.toml +++ b/examples/stm32f1/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f103c8", "unstable-pac", "memory-x", "time-driver-any", "unstable-traits" ] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f103c8", "unstable-pac", "memory-x", "time-driver-any", "unstable-traits" ] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 15 | 15 | ||
diff --git a/examples/stm32f1/src/bin/adc.rs b/examples/stm32f1/src/bin/adc.rs index 30947c3c2..1edac3d83 100644 --- a/examples/stm32f1/src/bin/adc.rs +++ b/examples/stm32f1/src/bin/adc.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_stm32::adc::Adc; | 7 | use embassy_stm32::adc::Adc; |
| 8 | use embassy_stm32::peripherals::ADC1; | 8 | use embassy_stm32::peripherals::ADC1; |
| 9 | use embassy_stm32::{adc, bind_interrupts}; | 9 | use embassy_stm32::{adc, bind_interrupts}; |
| 10 | use embassy_time::{Delay, Duration, Timer}; | 10 | use embassy_time::{Delay, Timer}; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | bind_interrupts!(struct Irqs { | 13 | bind_interrupts!(struct Irqs { |
| @@ -35,6 +35,6 @@ async fn main(_spawner: Spawner) { | |||
| 35 | loop { | 35 | loop { |
| 36 | let v = adc.read(&mut pin).await; | 36 | let v = adc.read(&mut pin).await; |
| 37 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); | 37 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); |
| 38 | Timer::after(Duration::from_millis(100)).await; | 38 | Timer::after_millis(100).await; |
| 39 | } | 39 | } |
| 40 | } | 40 | } |
diff --git a/examples/stm32f1/src/bin/blinky.rs b/examples/stm32f1/src/bin/blinky.rs index b9b0ac238..3425b0536 100644 --- a/examples/stm32f1/src/bin/blinky.rs +++ b/examples/stm32f1/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f1/src/bin/hello.rs b/examples/stm32f1/src/bin/hello.rs index 180b6aabd..e63bcaae0 100644 --- a/examples/stm32f1/src/bin/hello.rs +++ b/examples/stm32f1/src/bin/hello.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::Hertz; | 7 | use embassy_stm32::time::Hertz; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -17,6 +17,6 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 17 | 17 | ||
| 18 | loop { | 18 | loop { |
| 19 | info!("Hello World!"); | 19 | info!("Hello World!"); |
| 20 | Timer::after(Duration::from_secs(1)).await; | 20 | Timer::after_secs(1).await; |
| 21 | } | 21 | } |
| 22 | } | 22 | } |
diff --git a/examples/stm32f1/src/bin/usb_serial.rs b/examples/stm32f1/src/bin/usb_serial.rs index 663099ff7..60eb5d0e4 100644 --- a/examples/stm32f1/src/bin/usb_serial.rs +++ b/examples/stm32f1/src/bin/usb_serial.rs | |||
| @@ -9,7 +9,7 @@ use embassy_stm32::gpio::{Level, Output, Speed}; | |||
| 9 | use embassy_stm32::time::Hertz; | 9 | use embassy_stm32::time::Hertz; |
| 10 | use embassy_stm32::usb::{Driver, Instance}; | 10 | use embassy_stm32::usb::{Driver, Instance}; |
| 11 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; | 11 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; | 13 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; |
| 14 | use embassy_usb::driver::EndpointError; | 14 | use embassy_usb::driver::EndpointError; |
| 15 | use embassy_usb::Builder; | 15 | use embassy_usb::Builder; |
| @@ -35,7 +35,7 @@ async fn main(_spawner: Spawner) { | |||
| 35 | // This forced reset is needed only for development, without it host | 35 | // This forced reset is needed only for development, without it host |
| 36 | // will not reset your device when you upload new firmware. | 36 | // will not reset your device when you upload new firmware. |
| 37 | let _dp = Output::new(&mut p.PA12, Level::Low, Speed::Low); | 37 | let _dp = Output::new(&mut p.PA12, Level::Low, Speed::Low); |
| 38 | Timer::after(Duration::from_millis(10)).await; | 38 | Timer::after_millis(10).await; |
| 39 | } | 39 | } |
| 40 | 40 | ||
| 41 | // Create the driver, from the HAL. | 41 | // Create the driver, from the HAL. |
diff --git a/examples/stm32f2/Cargo.toml b/examples/stm32f2/Cargo.toml index 1314b6b12..fbf508367 100644 --- a/examples/stm32f2/Cargo.toml +++ b/examples/stm32f2/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f207zg", "unstable-pac", "memory-x", "time-driver-any", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f207zg", "unstable-pac", "memory-x", "time-driver-any", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | 13 | ||
| 14 | defmt = "0.3" | 14 | defmt = "0.3" |
| 15 | defmt-rtt = "0.4" | 15 | defmt-rtt = "0.4" |
diff --git a/examples/stm32f2/src/bin/blinky.rs b/examples/stm32f2/src/bin/blinky.rs index d8c89a519..f6d7a0005 100644 --- a/examples/stm32f2/src/bin/blinky.rs +++ b/examples/stm32f2/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(1000)).await; | 21 | Timer::after_millis(1000).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(1000)).await; | 25 | Timer::after_millis(1000).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f2/src/bin/pll.rs b/examples/stm32f2/src/bin/pll.rs index 894937614..56591b527 100644 --- a/examples/stm32f2/src/bin/pll.rs +++ b/examples/stm32f2/src/bin/pll.rs | |||
| @@ -7,11 +7,11 @@ use core::convert::TryFrom; | |||
| 7 | use defmt::*; | 7 | use defmt::*; |
| 8 | use embassy_executor::Spawner; | 8 | use embassy_executor::Spawner; |
| 9 | use embassy_stm32::rcc::{ | 9 | use embassy_stm32::rcc::{ |
| 10 | APBPrescaler, ClockSrc, HSEConfig, HSESrc, PLL48Div, PLLConfig, PLLMainDiv, PLLMul, PLLPreDiv, PLLSrc, | 10 | APBPrescaler, ClockSrc, HSEConfig, HSESrc, PLLConfig, PLLMul, PLLPDiv, PLLPreDiv, PLLQDiv, PLLSrc, |
| 11 | }; | 11 | }; |
| 12 | use embassy_stm32::time::Hertz; | 12 | use embassy_stm32::time::Hertz; |
| 13 | use embassy_stm32::Config; | 13 | use embassy_stm32::Config; |
| 14 | use embassy_time::{Duration, Timer}; | 14 | use embassy_time::Timer; |
| 15 | use {defmt_rtt as _, panic_probe as _}; | 15 | use {defmt_rtt as _, panic_probe as _}; |
| 16 | 16 | ||
| 17 | #[embassy_executor::main] | 17 | #[embassy_executor::main] |
| @@ -32,9 +32,9 @@ async fn main(_spawner: Spawner) { | |||
| 32 | // 1 MHz PLL input * 240 = 240 MHz PLL VCO | 32 | // 1 MHz PLL input * 240 = 240 MHz PLL VCO |
| 33 | mul: unwrap!(PLLMul::try_from(240)), | 33 | mul: unwrap!(PLLMul::try_from(240)), |
| 34 | // 240 MHz PLL VCO / 2 = 120 MHz main PLL output | 34 | // 240 MHz PLL VCO / 2 = 120 MHz main PLL output |
| 35 | main_div: PLLMainDiv::Div2, | 35 | p_div: PLLPDiv::DIV2, |
| 36 | // 240 MHz PLL VCO / 5 = 48 MHz PLL48 output | 36 | // 240 MHz PLL VCO / 5 = 48 MHz PLL48 output |
| 37 | pll48_div: unwrap!(PLL48Div::try_from(5)), | 37 | q_div: PLLQDiv::DIV5, |
| 38 | }; | 38 | }; |
| 39 | // System clock comes from PLL (= the 120 MHz main PLL output) | 39 | // System clock comes from PLL (= the 120 MHz main PLL output) |
| 40 | config.rcc.mux = ClockSrc::PLL; | 40 | config.rcc.mux = ClockSrc::PLL; |
| @@ -46,7 +46,7 @@ async fn main(_spawner: Spawner) { | |||
| 46 | let _p = embassy_stm32::init(config); | 46 | let _p = embassy_stm32::init(config); |
| 47 | 47 | ||
| 48 | loop { | 48 | loop { |
| 49 | Timer::after(Duration::from_millis(1000)).await; | 49 | Timer::after_millis(1000).await; |
| 50 | info!("1s elapsed"); | 50 | info!("1s elapsed"); |
| 51 | } | 51 | } |
| 52 | } | 52 | } |
diff --git a/examples/stm32f3/Cargo.toml b/examples/stm32f3/Cargo.toml index 534e783de..b3b2b1233 100644 --- a/examples/stm32f3/Cargo.toml +++ b/examples/stm32f3/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f303ze", "unstable-pac", "memory-x", "time-driver-any", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f303ze", "unstable-pac", "memory-x", "time-driver-any", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 15 | 15 | ||
diff --git a/examples/stm32f3/src/bin/blinky.rs b/examples/stm32f3/src/bin/blinky.rs index 185785ceb..e71031b30 100644 --- a/examples/stm32f3/src/bin/blinky.rs +++ b/examples/stm32f3/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(1000)).await; | 21 | Timer::after_millis(1000).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(1000)).await; | 25 | Timer::after_millis(1000).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f3/src/bin/button_events.rs b/examples/stm32f3/src/bin/button_events.rs index 8e97e85eb..9df6d680d 100644 --- a/examples/stm32f3/src/bin/button_events.rs +++ b/examples/stm32f3/src/bin/button_events.rs | |||
| @@ -65,11 +65,11 @@ impl<'a> Leds<'a> { | |||
| 65 | for led in &mut self.leds { | 65 | for led in &mut self.leds { |
| 66 | led.set_high(); | 66 | led.set_high(); |
| 67 | } | 67 | } |
| 68 | Timer::after(Duration::from_millis(500)).await; | 68 | Timer::after_millis(500).await; |
| 69 | for led in &mut self.leds { | 69 | for led in &mut self.leds { |
| 70 | led.set_low(); | 70 | led.set_low(); |
| 71 | } | 71 | } |
| 72 | Timer::after(Duration::from_millis(200)).await; | 72 | Timer::after_millis(200).await; |
| 73 | } | 73 | } |
| 74 | } | 74 | } |
| 75 | 75 | ||
diff --git a/examples/stm32f3/src/bin/hello.rs b/examples/stm32f3/src/bin/hello.rs index 65773210d..b3285f3c1 100644 --- a/examples/stm32f3/src/bin/hello.rs +++ b/examples/stm32f3/src/bin/hello.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::Hertz; | 7 | use embassy_stm32::time::Hertz; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -18,6 +18,6 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 18 | 18 | ||
| 19 | loop { | 19 | loop { |
| 20 | info!("Hello World!"); | 20 | info!("Hello World!"); |
| 21 | Timer::after(Duration::from_secs(1)).await; | 21 | Timer::after_secs(1).await; |
| 22 | } | 22 | } |
| 23 | } | 23 | } |
diff --git a/examples/stm32f3/src/bin/multiprio.rs b/examples/stm32f3/src/bin/multiprio.rs index 80bf59deb..74f3bb1c5 100644 --- a/examples/stm32f3/src/bin/multiprio.rs +++ b/examples/stm32f3/src/bin/multiprio.rs | |||
| @@ -62,7 +62,7 @@ use defmt::*; | |||
| 62 | use embassy_executor::{Executor, InterruptExecutor}; | 62 | use embassy_executor::{Executor, InterruptExecutor}; |
| 63 | use embassy_stm32::interrupt; | 63 | use embassy_stm32::interrupt; |
| 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; | 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; |
| 65 | use embassy_time::{Duration, Instant, Timer}; | 65 | use embassy_time::{Instant, Timer}; |
| 66 | use static_cell::StaticCell; | 66 | use static_cell::StaticCell; |
| 67 | use {defmt_rtt as _, panic_probe as _}; | 67 | use {defmt_rtt as _, panic_probe as _}; |
| 68 | 68 | ||
| @@ -70,7 +70,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 70 | async fn run_high() { | 70 | async fn run_high() { |
| 71 | loop { | 71 | loop { |
| 72 | info!(" [high] tick!"); | 72 | info!(" [high] tick!"); |
| 73 | Timer::after(Duration::from_ticks(27374)).await; | 73 | Timer::after_ticks(27374).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -87,7 +87,7 @@ async fn run_med() { | |||
| 87 | let ms = end.duration_since(start).as_ticks() / 33; | 87 | let ms = end.duration_since(start).as_ticks() / 33; |
| 88 | info!(" [med] done in {} ms", ms); | 88 | info!(" [med] done in {} ms", ms); |
| 89 | 89 | ||
| 90 | Timer::after(Duration::from_ticks(23421)).await; | 90 | Timer::after_ticks(23421).await; |
| 91 | } | 91 | } |
| 92 | } | 92 | } |
| 93 | 93 | ||
| @@ -104,7 +104,7 @@ async fn run_low() { | |||
| 104 | let ms = end.duration_since(start).as_ticks() / 33; | 104 | let ms = end.duration_since(start).as_ticks() / 33; |
| 105 | info!("[low] done in {} ms", ms); | 105 | info!("[low] done in {} ms", ms); |
| 106 | 106 | ||
| 107 | Timer::after(Duration::from_ticks(32983)).await; | 107 | Timer::after_ticks(32983).await; |
| 108 | } | 108 | } |
| 109 | } | 109 | } |
| 110 | 110 | ||
diff --git a/examples/stm32f3/src/bin/usb_serial.rs b/examples/stm32f3/src/bin/usb_serial.rs index f15f333b7..a9537c77b 100644 --- a/examples/stm32f3/src/bin/usb_serial.rs +++ b/examples/stm32f3/src/bin/usb_serial.rs | |||
| @@ -9,7 +9,7 @@ use embassy_stm32::gpio::{Level, Output, Speed}; | |||
| 9 | use embassy_stm32::time::mhz; | 9 | use embassy_stm32::time::mhz; |
| 10 | use embassy_stm32::usb::{Driver, Instance}; | 10 | use embassy_stm32::usb::{Driver, Instance}; |
| 11 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; | 11 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; | 13 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; |
| 14 | use embassy_usb::driver::EndpointError; | 14 | use embassy_usb::driver::EndpointError; |
| 15 | use embassy_usb::Builder; | 15 | use embassy_usb::Builder; |
| @@ -33,7 +33,7 @@ async fn main(_spawner: Spawner) { | |||
| 33 | 33 | ||
| 34 | // Needed for nucleo-stm32f303ze | 34 | // Needed for nucleo-stm32f303ze |
| 35 | let mut dp_pullup = Output::new(p.PG6, Level::Low, Speed::Medium); | 35 | let mut dp_pullup = Output::new(p.PG6, Level::Low, Speed::Medium); |
| 36 | Timer::after(Duration::from_millis(10)).await; | 36 | Timer::after_millis(10).await; |
| 37 | dp_pullup.set_high(); | 37 | dp_pullup.set_high(); |
| 38 | 38 | ||
| 39 | // Create the driver, from the HAL. | 39 | // Create the driver, from the HAL. |
diff --git a/examples/stm32f334/src/bin/adc.rs b/examples/stm32f334/src/bin/adc.rs index ed246a7db..f259135d2 100644 --- a/examples/stm32f334/src/bin/adc.rs +++ b/examples/stm32f334/src/bin/adc.rs | |||
| @@ -6,10 +6,10 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::adc::{Adc, SampleTime}; | 7 | use embassy_stm32::adc::{Adc, SampleTime}; |
| 8 | use embassy_stm32::peripherals::ADC1; | 8 | use embassy_stm32::peripherals::ADC1; |
| 9 | use embassy_stm32::rcc::AdcClockSource; | 9 | use embassy_stm32::rcc::{AdcClockSource, Adcpres}; |
| 10 | use embassy_stm32::time::mhz; | 10 | use embassy_stm32::time::mhz; |
| 11 | use embassy_stm32::{adc, bind_interrupts, Config}; | 11 | use embassy_stm32::{adc, bind_interrupts, Config}; |
| 12 | use embassy_time::{Delay, Duration, Timer}; | 12 | use embassy_time::{Delay, Timer}; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | bind_interrupts!(struct Irqs { | 15 | bind_interrupts!(struct Irqs { |
| @@ -23,7 +23,7 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 23 | config.rcc.hclk = Some(mhz(64)); | 23 | config.rcc.hclk = Some(mhz(64)); |
| 24 | config.rcc.pclk1 = Some(mhz(32)); | 24 | config.rcc.pclk1 = Some(mhz(32)); |
| 25 | config.rcc.pclk2 = Some(mhz(64)); | 25 | config.rcc.pclk2 = Some(mhz(64)); |
| 26 | config.rcc.adc = Some(AdcClockSource::PllDiv1); | 26 | config.rcc.adc = Some(AdcClockSource::Pll(Adcpres::DIV1)); |
| 27 | 27 | ||
| 28 | let mut p = embassy_stm32::init(config); | 28 | let mut p = embassy_stm32::init(config); |
| 29 | 29 | ||
| @@ -51,6 +51,6 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 51 | let pin_mv = (pin as u32 * vrefint.value() as u32 / vref as u32) * 3300 / 4095; | 51 | let pin_mv = (pin as u32 * vrefint.value() as u32 / vref as u32) * 3300 / 4095; |
| 52 | info!("computed pin mv: {}", pin_mv); | 52 | info!("computed pin mv: {}", pin_mv); |
| 53 | 53 | ||
| 54 | Timer::after(Duration::from_millis(500)).await; | 54 | Timer::after_millis(500).await; |
| 55 | } | 55 | } |
| 56 | } | 56 | } |
diff --git a/examples/stm32f334/src/bin/button.rs b/examples/stm32f334/src/bin/button.rs index 599c0f27d..501fb080c 100644 --- a/examples/stm32f334/src/bin/button.rs +++ b/examples/stm32f334/src/bin/button.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -17,10 +17,10 @@ async fn main(_spawner: Spawner) { | |||
| 17 | let mut out1 = Output::new(p.PA8, Level::Low, Speed::High); | 17 | let mut out1 = Output::new(p.PA8, Level::Low, Speed::High); |
| 18 | 18 | ||
| 19 | out1.set_high(); | 19 | out1.set_high(); |
| 20 | Timer::after(Duration::from_millis(500)).await; | 20 | Timer::after_millis(500).await; |
| 21 | out1.set_low(); | 21 | out1.set_low(); |
| 22 | 22 | ||
| 23 | Timer::after(Duration::from_millis(500)).await; | 23 | Timer::after_millis(500).await; |
| 24 | info!("end program"); | 24 | info!("end program"); |
| 25 | 25 | ||
| 26 | cortex_m::asm::bkpt(); | 26 | cortex_m::asm::bkpt(); |
diff --git a/examples/stm32f334/src/bin/hello.rs b/examples/stm32f334/src/bin/hello.rs index 65773210d..b3285f3c1 100644 --- a/examples/stm32f334/src/bin/hello.rs +++ b/examples/stm32f334/src/bin/hello.rs | |||
| @@ -6,7 +6,7 @@ use defmt::info; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::Hertz; | 7 | use embassy_stm32::time::Hertz; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -18,6 +18,6 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 18 | 18 | ||
| 19 | loop { | 19 | loop { |
| 20 | info!("Hello World!"); | 20 | info!("Hello World!"); |
| 21 | Timer::after(Duration::from_secs(1)).await; | 21 | Timer::after_secs(1).await; |
| 22 | } | 22 | } |
| 23 | } | 23 | } |
diff --git a/examples/stm32f334/src/bin/opamp.rs b/examples/stm32f334/src/bin/opamp.rs new file mode 100644 index 000000000..128001bf2 --- /dev/null +++ b/examples/stm32f334/src/bin/opamp.rs | |||
| @@ -0,0 +1,59 @@ | |||
| 1 | #![no_std] | ||
| 2 | #![no_main] | ||
| 3 | #![feature(type_alias_impl_trait)] | ||
| 4 | |||
| 5 | use defmt::info; | ||
| 6 | use embassy_executor::Spawner; | ||
| 7 | use embassy_stm32::adc::{Adc, SampleTime}; | ||
| 8 | use embassy_stm32::opamp::{OpAmp, OpAmpGain}; | ||
| 9 | use embassy_stm32::peripherals::ADC2; | ||
| 10 | use embassy_stm32::rcc::{AdcClockSource, Adcpres}; | ||
| 11 | use embassy_stm32::time::mhz; | ||
| 12 | use embassy_stm32::{adc, bind_interrupts, Config}; | ||
| 13 | use embassy_time::{Delay, Timer}; | ||
| 14 | use {defmt_rtt as _, panic_probe as _}; | ||
| 15 | |||
| 16 | bind_interrupts!(struct Irqs { | ||
| 17 | ADC1_2 => adc::InterruptHandler<ADC2>; | ||
| 18 | }); | ||
| 19 | |||
| 20 | #[embassy_executor::main] | ||
| 21 | async fn main(_spawner: Spawner) -> ! { | ||
| 22 | let mut config = Config::default(); | ||
| 23 | config.rcc.sysclk = Some(mhz(64)); | ||
| 24 | config.rcc.hclk = Some(mhz(64)); | ||
| 25 | config.rcc.pclk1 = Some(mhz(32)); | ||
| 26 | config.rcc.pclk2 = Some(mhz(64)); | ||
| 27 | config.rcc.adc = Some(AdcClockSource::Pll(Adcpres::DIV1)); | ||
| 28 | |||
| 29 | let mut p = embassy_stm32::init(config); | ||
| 30 | |||
| 31 | info!("create adc..."); | ||
| 32 | |||
| 33 | let mut adc = Adc::new(p.ADC2, Irqs, &mut Delay); | ||
| 34 | let mut opamp = OpAmp::new(p.OPAMP2); | ||
| 35 | |||
| 36 | adc.set_sample_time(SampleTime::Cycles601_5); | ||
| 37 | |||
| 38 | info!("enable vrefint..."); | ||
| 39 | |||
| 40 | let mut vrefint = adc.enable_vref(&mut Delay); | ||
| 41 | let mut temperature = adc.enable_temperature(); | ||
| 42 | let mut buffer = opamp.buffer_for(&mut p.PA7, OpAmpGain::Mul1); | ||
| 43 | |||
| 44 | loop { | ||
| 45 | let vref = adc.read(&mut vrefint).await; | ||
| 46 | info!("read vref: {} (should be {})", vref, vrefint.value()); | ||
| 47 | |||
| 48 | let temp = adc.read(&mut temperature).await; | ||
| 49 | info!("read temperature: {}", temp); | ||
| 50 | |||
| 51 | let buffer = adc.read(&mut buffer).await; | ||
| 52 | info!("read buffer: {}", buffer); | ||
| 53 | |||
| 54 | let pin_mv = (buffer as u32 * vrefint.value() as u32 / vref as u32) * 3300 / 4095; | ||
| 55 | info!("computed pin mv: {}", pin_mv); | ||
| 56 | |||
| 57 | Timer::after_millis(500).await; | ||
| 58 | } | ||
| 59 | } | ||
diff --git a/examples/stm32f334/src/bin/pwm.rs b/examples/stm32f334/src/bin/pwm.rs index aebc421b3..8040c3f18 100644 --- a/examples/stm32f334/src/bin/pwm.rs +++ b/examples/stm32f334/src/bin/pwm.rs | |||
| @@ -8,7 +8,7 @@ use embassy_stm32::hrtim::*; | |||
| 8 | use embassy_stm32::rcc::HrtimClockSource; | 8 | use embassy_stm32::rcc::HrtimClockSource; |
| 9 | use embassy_stm32::time::{khz, mhz}; | 9 | use embassy_stm32::time::{khz, mhz}; |
| 10 | use embassy_stm32::Config; | 10 | use embassy_stm32::Config; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | #[embassy_executor::main] | 14 | #[embassy_executor::main] |
| @@ -48,7 +48,7 @@ async fn main(_spawner: Spawner) { | |||
| 48 | // .setr(0) | 48 | // .setr(0) |
| 49 | // .modify(|w| w.set_sst(Activeeffect::SETACTIVE)); | 49 | // .modify(|w| w.set_sst(Activeeffect::SETACTIVE)); |
| 50 | // | 50 | // |
| 51 | // Timer::after(Duration::from_millis(500)).await; | 51 | // Timer::after_millis(500).await; |
| 52 | // | 52 | // |
| 53 | // embassy_stm32::pac::HRTIM1 | 53 | // embassy_stm32::pac::HRTIM1 |
| 54 | // .tim(0) | 54 | // .tim(0) |
| @@ -65,7 +65,7 @@ async fn main(_spawner: Spawner) { | |||
| 65 | 65 | ||
| 66 | buck_converter.start(); | 66 | buck_converter.start(); |
| 67 | 67 | ||
| 68 | Timer::after(Duration::from_millis(500)).await; | 68 | Timer::after_millis(500).await; |
| 69 | 69 | ||
| 70 | info!("end program"); | 70 | info!("end program"); |
| 71 | 71 | ||
diff --git a/examples/stm32f4/Cargo.toml b/examples/stm32f4/Cargo.toml index 4b4fb479b..9b10e9754 100644 --- a/examples/stm32f4/Cargo.toml +++ b/examples/stm32f4/Cargo.toml | |||
| @@ -9,9 +9,9 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "unstable-traits", "defmt", "stm32f429zi", "unstable-pac", "memory-x", "time-driver-any", "exti", "embedded-sdmmc", "chrono"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "unstable-traits", "defmt", "stm32f429zi", "unstable-pac", "memory-x", "time-driver-any", "exti", "embedded-sdmmc", "chrono"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "executor-interrupt", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] } | 14 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] } |
| 15 | 15 | ||
| 16 | defmt = "0.3" | 16 | defmt = "0.3" |
| 17 | defmt-rtt = "0.4" | 17 | defmt-rtt = "0.4" |
| @@ -19,8 +19,8 @@ defmt-rtt = "0.4" | |||
| 19 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } | 19 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } |
| 20 | cortex-m-rt = "0.7.0" | 20 | cortex-m-rt = "0.7.0" |
| 21 | embedded-hal = "0.2.6" | 21 | embedded-hal = "0.2.6" |
| 22 | embedded-io = { version = "0.5.0" } | 22 | embedded-io = { version = "0.6.0" } |
| 23 | embedded-io-async = { version = "0.5.0" } | 23 | embedded-io-async = { version = "0.6.0" } |
| 24 | panic-probe = { version = "0.3", features = ["print-defmt"] } | 24 | panic-probe = { version = "0.3", features = ["print-defmt"] } |
| 25 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 25 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 26 | heapless = { version = "0.7.5", default-features = false } | 26 | heapless = { version = "0.7.5", default-features = false } |
diff --git a/examples/stm32f4/src/bin/adc.rs b/examples/stm32f4/src/bin/adc.rs index dd10385c4..f19328727 100644 --- a/examples/stm32f4/src/bin/adc.rs +++ b/examples/stm32f4/src/bin/adc.rs | |||
| @@ -6,7 +6,7 @@ use cortex_m::prelude::_embedded_hal_blocking_delay_DelayUs; | |||
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::adc::{Adc, Temperature, VrefInt}; | 8 | use embassy_stm32::adc::{Adc, Temperature, VrefInt}; |
| 9 | use embassy_time::{Delay, Duration, Timer}; | 9 | use embassy_time::{Delay, Timer}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -63,6 +63,6 @@ async fn main(_spawner: Spawner) { | |||
| 63 | let v = adc.read(&mut vrefint); | 63 | let v = adc.read(&mut vrefint); |
| 64 | info!("VrefInt: {}", v); | 64 | info!("VrefInt: {}", v); |
| 65 | 65 | ||
| 66 | Timer::after(Duration::from_millis(100)).await; | 66 | Timer::after_millis(100).await; |
| 67 | } | 67 | } |
| 68 | } | 68 | } |
diff --git a/examples/stm32f4/src/bin/blinky.rs b/examples/stm32f4/src/bin/blinky.rs index b27bee4ce..4bfc5a50d 100644 --- a/examples/stm32f4/src/bin/blinky.rs +++ b/examples/stm32f4/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f4/src/bin/eth.rs b/examples/stm32f4/src/bin/eth.rs index 16bf5d949..1747bbf4b 100644 --- a/examples/stm32f4/src/bin/eth.rs +++ b/examples/stm32f4/src/bin/eth.rs | |||
| @@ -10,9 +10,9 @@ use embassy_stm32::eth::generic_smi::GenericSMI; | |||
| 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; | 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; |
| 11 | use embassy_stm32::peripherals::ETH; | 11 | use embassy_stm32::peripherals::ETH; |
| 12 | use embassy_stm32::rng::Rng; | 12 | use embassy_stm32::rng::Rng; |
| 13 | use embassy_stm32::time::mhz; | 13 | use embassy_stm32::time::Hertz; |
| 14 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; | 14 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; |
| 15 | use embassy_time::{Duration, Timer}; | 15 | use embassy_time::Timer; |
| 16 | use embedded_io_async::Write; | 16 | use embedded_io_async::Write; |
| 17 | use static_cell::make_static; | 17 | use static_cell::make_static; |
| 18 | use {defmt_rtt as _, panic_probe as _}; | 18 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -32,7 +32,25 @@ async fn net_task(stack: &'static Stack<Device>) -> ! { | |||
| 32 | #[embassy_executor::main] | 32 | #[embassy_executor::main] |
| 33 | async fn main(spawner: Spawner) -> ! { | 33 | async fn main(spawner: Spawner) -> ! { |
| 34 | let mut config = Config::default(); | 34 | let mut config = Config::default(); |
| 35 | config.rcc.sys_ck = Some(mhz(200)); | 35 | { |
| 36 | use embassy_stm32::rcc::*; | ||
| 37 | config.rcc.hse = Some(Hse { | ||
| 38 | freq: Hertz(8_000_000), | ||
| 39 | mode: HseMode::Bypass, | ||
| 40 | }); | ||
| 41 | config.rcc.pll_src = PllSource::HSE; | ||
| 42 | config.rcc.pll = Some(Pll { | ||
| 43 | prediv: PllPreDiv::DIV4, | ||
| 44 | mul: PllMul::MUL180, | ||
| 45 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 180 / 2 = 180Mhz. | ||
| 46 | divq: None, | ||
| 47 | divr: None, | ||
| 48 | }); | ||
| 49 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 50 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 51 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 52 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 53 | } | ||
| 36 | let p = embassy_stm32::init(config); | 54 | let p = embassy_stm32::init(config); |
| 37 | 55 | ||
| 38 | info!("Hello World!"); | 56 | info!("Hello World!"); |
| @@ -58,9 +76,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 58 | p.PG13, | 76 | p.PG13, |
| 59 | p.PB13, | 77 | p.PB13, |
| 60 | p.PG11, | 78 | p.PG11, |
| 61 | GenericSMI::new(), | 79 | GenericSMI::new(0), |
| 62 | mac_addr, | 80 | mac_addr, |
| 63 | 0, | ||
| 64 | ); | 81 | ); |
| 65 | 82 | ||
| 66 | let config = embassy_net::Config::dhcpv4(Default::default()); | 83 | let config = embassy_net::Config::dhcpv4(Default::default()); |
| @@ -100,7 +117,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 100 | let r = socket.connect(remote_endpoint).await; | 117 | let r = socket.connect(remote_endpoint).await; |
| 101 | if let Err(e) = r { | 118 | if let Err(e) = r { |
| 102 | info!("connect error: {:?}", e); | 119 | info!("connect error: {:?}", e); |
| 103 | Timer::after(Duration::from_secs(1)).await; | 120 | Timer::after_secs(1).await; |
| 104 | continue; | 121 | continue; |
| 105 | } | 122 | } |
| 106 | info!("connected!"); | 123 | info!("connected!"); |
| @@ -111,7 +128,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 111 | info!("write error: {:?}", e); | 128 | info!("write error: {:?}", e); |
| 112 | break; | 129 | break; |
| 113 | } | 130 | } |
| 114 | Timer::after(Duration::from_secs(1)).await; | 131 | Timer::after_secs(1).await; |
| 115 | } | 132 | } |
| 116 | } | 133 | } |
| 117 | } | 134 | } |
diff --git a/examples/stm32f4/src/bin/flash_async.rs b/examples/stm32f4/src/bin/flash_async.rs index 6c9689d9c..f0a65a725 100644 --- a/examples/stm32f4/src/bin/flash_async.rs +++ b/examples/stm32f4/src/bin/flash_async.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_stm32::bind_interrupts; | 7 | use embassy_stm32::bind_interrupts; |
| 8 | use embassy_stm32::flash::{Flash, InterruptHandler}; | 8 | use embassy_stm32::flash::{Flash, InterruptHandler}; |
| 9 | use embassy_stm32::gpio::{AnyPin, Level, Output, Pin, Speed}; | 9 | use embassy_stm32::gpio::{AnyPin, Level, Output, Pin, Speed}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | bind_interrupts!(struct Irqs { | 13 | bind_interrupts!(struct Irqs { |
| @@ -35,11 +35,11 @@ async fn blinky(p: AnyPin) { | |||
| 35 | loop { | 35 | loop { |
| 36 | info!("high"); | 36 | info!("high"); |
| 37 | led.set_high(); | 37 | led.set_high(); |
| 38 | Timer::after(Duration::from_millis(300)).await; | 38 | Timer::after_millis(300).await; |
| 39 | 39 | ||
| 40 | info!("low"); | 40 | info!("low"); |
| 41 | led.set_low(); | 41 | led.set_low(); |
| 42 | Timer::after(Duration::from_millis(300)).await; | 42 | Timer::after_millis(300).await; |
| 43 | } | 43 | } |
| 44 | } | 44 | } |
| 45 | 45 | ||
diff --git a/examples/stm32f4/src/bin/hello.rs b/examples/stm32f4/src/bin/hello.rs index c409703f5..a2a287110 100644 --- a/examples/stm32f4/src/bin/hello.rs +++ b/examples/stm32f4/src/bin/hello.rs | |||
| @@ -4,19 +4,17 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::info; | 5 | use defmt::info; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::Hertz; | ||
| 8 | use embassy_stm32::Config; | 7 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 10 | ||
| 12 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| 13 | async fn main(_spawner: Spawner) -> ! { | 12 | async fn main(_spawner: Spawner) -> ! { |
| 14 | let mut config = Config::default(); | 13 | let config = Config::default(); |
| 15 | config.rcc.sys_ck = Some(Hertz(84_000_000)); | ||
| 16 | let _p = embassy_stm32::init(config); | 14 | let _p = embassy_stm32::init(config); |
| 17 | 15 | ||
| 18 | loop { | 16 | loop { |
| 19 | info!("Hello World!"); | 17 | info!("Hello World!"); |
| 20 | Timer::after(Duration::from_secs(1)).await; | 18 | Timer::after_secs(1).await; |
| 21 | } | 19 | } |
| 22 | } | 20 | } |
diff --git a/examples/stm32f4/src/bin/i2c.rs b/examples/stm32f4/src/bin/i2c.rs index a92957325..032bd97ee 100644 --- a/examples/stm32f4/src/bin/i2c.rs +++ b/examples/stm32f4/src/bin/i2c.rs | |||
| @@ -5,10 +5,9 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::dma::NoDma; | 7 | use embassy_stm32::dma::NoDma; |
| 8 | use embassy_stm32::i2c::{Error, I2c, TimeoutI2c}; | 8 | use embassy_stm32::i2c::{Error, I2c}; |
| 9 | use embassy_stm32::time::Hertz; | 9 | use embassy_stm32::time::Hertz; |
| 10 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; | 10 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; |
| 11 | use embassy_time::Duration; | ||
| 12 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 12 | ||
| 14 | const ADDRESS: u8 = 0x5F; | 13 | const ADDRESS: u8 = 0x5F; |
| @@ -34,13 +33,9 @@ async fn main(_spawner: Spawner) { | |||
| 34 | Default::default(), | 33 | Default::default(), |
| 35 | ); | 34 | ); |
| 36 | 35 | ||
| 37 | // I2C bus can freeze if SCL line is shorted or due to a broken device that clock stretches for too long. | ||
| 38 | // TimeoutI2c allows recovering from such errors by throwing `Error::Timeout` after a given delay. | ||
| 39 | let mut timeout_i2c = TimeoutI2c::new(&mut i2c, Duration::from_millis(1000)); | ||
| 40 | |||
| 41 | let mut data = [0u8; 1]; | 36 | let mut data = [0u8; 1]; |
| 42 | 37 | ||
| 43 | match timeout_i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { | 38 | match i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { |
| 44 | Ok(()) => info!("Whoami: {}", data[0]), | 39 | Ok(()) => info!("Whoami: {}", data[0]), |
| 45 | Err(Error::Timeout) => error!("Operation timed out"), | 40 | Err(Error::Timeout) => error!("Operation timed out"), |
| 46 | Err(e) => error!("I2c Error: {:?}", e), | 41 | Err(e) => error!("I2c Error: {:?}", e), |
diff --git a/examples/stm32f4/src/bin/mco.rs b/examples/stm32f4/src/bin/mco.rs index 2b9ceebc3..3315e7652 100644 --- a/examples/stm32f4/src/bin/mco.rs +++ b/examples/stm32f4/src/bin/mco.rs | |||
| @@ -5,8 +5,8 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_stm32::rcc::{Mco, Mco1Source, Mco2Source, McoClock}; | 8 | use embassy_stm32::rcc::{Mco, Mco1Source, Mco2Source, McoPrescaler}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -14,17 +14,17 @@ async fn main(_spawner: Spawner) { | |||
| 14 | let p = embassy_stm32::init(Default::default()); | 14 | let p = embassy_stm32::init(Default::default()); |
| 15 | info!("Hello World!"); | 15 | info!("Hello World!"); |
| 16 | 16 | ||
| 17 | let _mco1 = Mco::new(p.MCO1, p.PA8, Mco1Source::Hsi, McoClock::DIV1); | 17 | let _mco1 = Mco::new(p.MCO1, p.PA8, Mco1Source::HSI, McoPrescaler::DIV1); |
| 18 | let _mco2 = Mco::new(p.MCO2, p.PC9, Mco2Source::Pll, McoClock::DIV4); | 18 | let _mco2 = Mco::new(p.MCO2, p.PC9, Mco2Source::PLL, McoPrescaler::DIV4); |
| 19 | let mut led = Output::new(p.PB7, Level::High, Speed::Low); | 19 | let mut led = Output::new(p.PB7, Level::High, Speed::Low); |
| 20 | 20 | ||
| 21 | loop { | 21 | loop { |
| 22 | info!("high"); | 22 | info!("high"); |
| 23 | led.set_high(); | 23 | led.set_high(); |
| 24 | Timer::after(Duration::from_millis(300)).await; | 24 | Timer::after_millis(300).await; |
| 25 | 25 | ||
| 26 | info!("low"); | 26 | info!("low"); |
| 27 | led.set_low(); | 27 | led.set_low(); |
| 28 | Timer::after(Duration::from_millis(300)).await; | 28 | Timer::after_millis(300).await; |
| 29 | } | 29 | } |
| 30 | } | 30 | } |
diff --git a/examples/stm32f4/src/bin/multiprio.rs b/examples/stm32f4/src/bin/multiprio.rs index 80bf59deb..74f3bb1c5 100644 --- a/examples/stm32f4/src/bin/multiprio.rs +++ b/examples/stm32f4/src/bin/multiprio.rs | |||
| @@ -62,7 +62,7 @@ use defmt::*; | |||
| 62 | use embassy_executor::{Executor, InterruptExecutor}; | 62 | use embassy_executor::{Executor, InterruptExecutor}; |
| 63 | use embassy_stm32::interrupt; | 63 | use embassy_stm32::interrupt; |
| 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; | 64 | use embassy_stm32::interrupt::{InterruptExt, Priority}; |
| 65 | use embassy_time::{Duration, Instant, Timer}; | 65 | use embassy_time::{Instant, Timer}; |
| 66 | use static_cell::StaticCell; | 66 | use static_cell::StaticCell; |
| 67 | use {defmt_rtt as _, panic_probe as _}; | 67 | use {defmt_rtt as _, panic_probe as _}; |
| 68 | 68 | ||
| @@ -70,7 +70,7 @@ use {defmt_rtt as _, panic_probe as _}; | |||
| 70 | async fn run_high() { | 70 | async fn run_high() { |
| 71 | loop { | 71 | loop { |
| 72 | info!(" [high] tick!"); | 72 | info!(" [high] tick!"); |
| 73 | Timer::after(Duration::from_ticks(27374)).await; | 73 | Timer::after_ticks(27374).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -87,7 +87,7 @@ async fn run_med() { | |||
| 87 | let ms = end.duration_since(start).as_ticks() / 33; | 87 | let ms = end.duration_since(start).as_ticks() / 33; |
| 88 | info!(" [med] done in {} ms", ms); | 88 | info!(" [med] done in {} ms", ms); |
| 89 | 89 | ||
| 90 | Timer::after(Duration::from_ticks(23421)).await; | 90 | Timer::after_ticks(23421).await; |
| 91 | } | 91 | } |
| 92 | } | 92 | } |
| 93 | 93 | ||
| @@ -104,7 +104,7 @@ async fn run_low() { | |||
| 104 | let ms = end.duration_since(start).as_ticks() / 33; | 104 | let ms = end.duration_since(start).as_ticks() / 33; |
| 105 | info!("[low] done in {} ms", ms); | 105 | info!("[low] done in {} ms", ms); |
| 106 | 106 | ||
| 107 | Timer::after(Duration::from_ticks(32983)).await; | 107 | Timer::after_ticks(32983).await; |
| 108 | } | 108 | } |
| 109 | } | 109 | } |
| 110 | 110 | ||
diff --git a/examples/stm32f4/src/bin/pwm.rs b/examples/stm32f4/src/bin/pwm.rs index 139b8de70..8e41d0e78 100644 --- a/examples/stm32f4/src/bin/pwm.rs +++ b/examples/stm32f4/src/bin/pwm.rs | |||
| @@ -8,7 +8,7 @@ use embassy_stm32::gpio::OutputType; | |||
| 8 | use embassy_stm32::time::khz; | 8 | use embassy_stm32::time::khz; |
| 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; | 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; |
| 10 | use embassy_stm32::timer::Channel; | 10 | use embassy_stm32::timer::Channel; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | #[embassy_executor::main] | 14 | #[embassy_executor::main] |
| @@ -26,12 +26,12 @@ async fn main(_spawner: Spawner) { | |||
| 26 | 26 | ||
| 27 | loop { | 27 | loop { |
| 28 | pwm.set_duty(Channel::Ch1, 0); | 28 | pwm.set_duty(Channel::Ch1, 0); |
| 29 | Timer::after(Duration::from_millis(300)).await; | 29 | Timer::after_millis(300).await; |
| 30 | pwm.set_duty(Channel::Ch1, max / 4); | 30 | pwm.set_duty(Channel::Ch1, max / 4); |
| 31 | Timer::after(Duration::from_millis(300)).await; | 31 | Timer::after_millis(300).await; |
| 32 | pwm.set_duty(Channel::Ch1, max / 2); | 32 | pwm.set_duty(Channel::Ch1, max / 2); |
| 33 | Timer::after(Duration::from_millis(300)).await; | 33 | Timer::after_millis(300).await; |
| 34 | pwm.set_duty(Channel::Ch1, max - 1); | 34 | pwm.set_duty(Channel::Ch1, max - 1); |
| 35 | Timer::after(Duration::from_millis(300)).await; | 35 | Timer::after_millis(300).await; |
| 36 | } | 36 | } |
| 37 | } | 37 | } |
diff --git a/examples/stm32f4/src/bin/pwm_complementary.rs b/examples/stm32f4/src/bin/pwm_complementary.rs index dabbbf9ac..d925f26d9 100644 --- a/examples/stm32f4/src/bin/pwm_complementary.rs +++ b/examples/stm32f4/src/bin/pwm_complementary.rs | |||
| @@ -9,7 +9,7 @@ use embassy_stm32::time::khz; | |||
| 9 | use embassy_stm32::timer::complementary_pwm::{ComplementaryPwm, ComplementaryPwmPin}; | 9 | use embassy_stm32::timer::complementary_pwm::{ComplementaryPwm, ComplementaryPwmPin}; |
| 10 | use embassy_stm32::timer::simple_pwm::PwmPin; | 10 | use embassy_stm32::timer::simple_pwm::PwmPin; |
| 11 | use embassy_stm32::timer::Channel; | 11 | use embassy_stm32::timer::Channel; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| @@ -43,12 +43,12 @@ async fn main(_spawner: Spawner) { | |||
| 43 | 43 | ||
| 44 | loop { | 44 | loop { |
| 45 | pwm.set_duty(Channel::Ch1, 0); | 45 | pwm.set_duty(Channel::Ch1, 0); |
| 46 | Timer::after(Duration::from_millis(300)).await; | 46 | Timer::after_millis(300).await; |
| 47 | pwm.set_duty(Channel::Ch1, max / 4); | 47 | pwm.set_duty(Channel::Ch1, max / 4); |
| 48 | Timer::after(Duration::from_millis(300)).await; | 48 | Timer::after_millis(300).await; |
| 49 | pwm.set_duty(Channel::Ch1, max / 2); | 49 | pwm.set_duty(Channel::Ch1, max / 2); |
| 50 | Timer::after(Duration::from_millis(300)).await; | 50 | Timer::after_millis(300).await; |
| 51 | pwm.set_duty(Channel::Ch1, max - 1); | 51 | pwm.set_duty(Channel::Ch1, max - 1); |
| 52 | Timer::after(Duration::from_millis(300)).await; | 52 | Timer::after_millis(300).await; |
| 53 | } | 53 | } |
| 54 | } | 54 | } |
diff --git a/examples/stm32f4/src/bin/rtc.rs b/examples/stm32f4/src/bin/rtc.rs index e33746008..44b4303c0 100644 --- a/examples/stm32f4/src/bin/rtc.rs +++ b/examples/stm32f4/src/bin/rtc.rs | |||
| @@ -5,16 +5,14 @@ | |||
| 5 | use chrono::{NaiveDate, NaiveDateTime}; | 5 | use chrono::{NaiveDate, NaiveDateTime}; |
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::rtc::{Rtc, RtcClockSource, RtcConfig}; | 8 | use embassy_stm32::rtc::{Rtc, RtcConfig}; |
| 9 | use embassy_stm32::Config; | 9 | use embassy_stm32::Config; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::main] | 13 | #[embassy_executor::main] |
| 14 | async fn main(_spawner: Spawner) { | 14 | async fn main(_spawner: Spawner) { |
| 15 | let mut config = Config::default(); | 15 | let config = Config::default(); |
| 16 | config.rcc.lsi = true; | ||
| 17 | config.rcc.rtc = Option::Some(RtcClockSource::LSI); | ||
| 18 | let p = embassy_stm32::init(config); | 16 | let p = embassy_stm32::init(config); |
| 19 | 17 | ||
| 20 | info!("Hello World!"); | 18 | info!("Hello World!"); |
| @@ -33,6 +31,6 @@ async fn main(_spawner: Spawner) { | |||
| 33 | 31 | ||
| 34 | info!("{}", now.timestamp()); | 32 | info!("{}", now.timestamp()); |
| 35 | 33 | ||
| 36 | Timer::after(Duration::from_millis(1000)).await; | 34 | Timer::after_millis(1000).await; |
| 37 | } | 35 | } |
| 38 | } | 36 | } |
diff --git a/examples/stm32f4/src/bin/sdmmc.rs b/examples/stm32f4/src/bin/sdmmc.rs index 6ec7d0fec..37e42384b 100644 --- a/examples/stm32f4/src/bin/sdmmc.rs +++ b/examples/stm32f4/src/bin/sdmmc.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::sdmmc::{DataBlock, Sdmmc}; | 7 | use embassy_stm32::sdmmc::{DataBlock, Sdmmc}; |
| 8 | use embassy_stm32::time::mhz; | 8 | use embassy_stm32::time::{mhz, Hertz}; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| @@ -20,8 +20,25 @@ bind_interrupts!(struct Irqs { | |||
| 20 | #[embassy_executor::main] | 20 | #[embassy_executor::main] |
| 21 | async fn main(_spawner: Spawner) { | 21 | async fn main(_spawner: Spawner) { |
| 22 | let mut config = Config::default(); | 22 | let mut config = Config::default(); |
| 23 | config.rcc.sys_ck = Some(mhz(48)); | 23 | { |
| 24 | config.rcc.pll48 = true; | 24 | use embassy_stm32::rcc::*; |
| 25 | config.rcc.hse = Some(Hse { | ||
| 26 | freq: Hertz(8_000_000), | ||
| 27 | mode: HseMode::Bypass, | ||
| 28 | }); | ||
| 29 | config.rcc.pll_src = PllSource::HSE; | ||
| 30 | config.rcc.pll = Some(Pll { | ||
| 31 | prediv: PllPreDiv::DIV4, | ||
| 32 | mul: PllMul::MUL168, | ||
| 33 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz. | ||
| 34 | divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz. | ||
| 35 | divr: None, | ||
| 36 | }); | ||
| 37 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 38 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 39 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 40 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 41 | } | ||
| 25 | let p = embassy_stm32::init(config); | 42 | let p = embassy_stm32::init(config); |
| 26 | info!("Hello World!"); | 43 | info!("Hello World!"); |
| 27 | 44 | ||
diff --git a/examples/stm32f4/src/bin/usb_ethernet.rs b/examples/stm32f4/src/bin/usb_ethernet.rs index 763e3a9e7..7c0644aeb 100644 --- a/examples/stm32f4/src/bin/usb_ethernet.rs +++ b/examples/stm32f4/src/bin/usb_ethernet.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_net::tcp::TcpSocket; | 7 | use embassy_net::tcp::TcpSocket; |
| 8 | use embassy_net::{Stack, StackResources}; | 8 | use embassy_net::{Stack, StackResources}; |
| 9 | use embassy_stm32::rng::{self, Rng}; | 9 | use embassy_stm32::rng::{self, Rng}; |
| 10 | use embassy_stm32::time::mhz; | 10 | use embassy_stm32::time::Hertz; |
| 11 | use embassy_stm32::usb_otg::Driver; | 11 | use embassy_stm32::usb_otg::Driver; |
| 12 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; | 12 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; |
| 13 | use embassy_usb::class::cdc_ncm::embassy_net::{Device, Runner, State as NetState}; | 13 | use embassy_usb::class::cdc_ncm::embassy_net::{Device, Runner, State as NetState}; |
| @@ -46,9 +46,25 @@ async fn main(spawner: Spawner) { | |||
| 46 | info!("Hello World!"); | 46 | info!("Hello World!"); |
| 47 | 47 | ||
| 48 | let mut config = Config::default(); | 48 | let mut config = Config::default(); |
| 49 | config.rcc.pll48 = true; | 49 | { |
| 50 | config.rcc.sys_ck = Some(mhz(48)); | 50 | use embassy_stm32::rcc::*; |
| 51 | 51 | config.rcc.hse = Some(Hse { | |
| 52 | freq: Hertz(8_000_000), | ||
| 53 | mode: HseMode::Bypass, | ||
| 54 | }); | ||
| 55 | config.rcc.pll_src = PllSource::HSE; | ||
| 56 | config.rcc.pll = Some(Pll { | ||
| 57 | prediv: PllPreDiv::DIV4, | ||
| 58 | mul: PllMul::MUL168, | ||
| 59 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz. | ||
| 60 | divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz. | ||
| 61 | divr: None, | ||
| 62 | }); | ||
| 63 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 64 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 65 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 66 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 67 | } | ||
| 52 | let p = embassy_stm32::init(config); | 68 | let p = embassy_stm32::init(config); |
| 53 | 69 | ||
| 54 | // Create the driver, from the HAL. | 70 | // Create the driver, from the HAL. |
diff --git a/examples/stm32f4/src/bin/usb_serial.rs b/examples/stm32f4/src/bin/usb_serial.rs index 4ff6452ef..004ff038d 100644 --- a/examples/stm32f4/src/bin/usb_serial.rs +++ b/examples/stm32f4/src/bin/usb_serial.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{panic, *}; | 5 | use defmt::{panic, *}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::mhz; | 7 | use embassy_stm32::time::Hertz; |
| 8 | use embassy_stm32::usb_otg::{Driver, Instance}; | 8 | use embassy_stm32::usb_otg::{Driver, Instance}; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; |
| 10 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; | 10 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; |
| @@ -22,9 +22,25 @@ async fn main(_spawner: Spawner) { | |||
| 22 | info!("Hello World!"); | 22 | info!("Hello World!"); |
| 23 | 23 | ||
| 24 | let mut config = Config::default(); | 24 | let mut config = Config::default(); |
| 25 | config.rcc.pll48 = true; | 25 | { |
| 26 | config.rcc.sys_ck = Some(mhz(48)); | 26 | use embassy_stm32::rcc::*; |
| 27 | 27 | config.rcc.hse = Some(Hse { | |
| 28 | freq: Hertz(8_000_000), | ||
| 29 | mode: HseMode::Bypass, | ||
| 30 | }); | ||
| 31 | config.rcc.pll_src = PllSource::HSE; | ||
| 32 | config.rcc.pll = Some(Pll { | ||
| 33 | prediv: PllPreDiv::DIV4, | ||
| 34 | mul: PllMul::MUL168, | ||
| 35 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 168 / 2 = 168Mhz. | ||
| 36 | divq: Some(Pllq::DIV7), // 8mhz / 4 * 168 / 7 = 48Mhz. | ||
| 37 | divr: None, | ||
| 38 | }); | ||
| 39 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 40 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 41 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 42 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 43 | } | ||
| 28 | let p = embassy_stm32::init(config); | 44 | let p = embassy_stm32::init(config); |
| 29 | 45 | ||
| 30 | // Create the driver, from the HAL. | 46 | // Create the driver, from the HAL. |
diff --git a/examples/stm32f4/src/bin/wdt.rs b/examples/stm32f4/src/bin/wdt.rs index e5d122af7..0443b61c5 100644 --- a/examples/stm32f4/src/bin/wdt.rs +++ b/examples/stm32f4/src/bin/wdt.rs | |||
| @@ -6,7 +6,7 @@ use defmt::*; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_stm32::wdg::IndependentWatchdog; | 8 | use embassy_stm32::wdg::IndependentWatchdog; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -24,11 +24,11 @@ async fn main(_spawner: Spawner) { | |||
| 24 | loop { | 24 | loop { |
| 25 | info!("high"); | 25 | info!("high"); |
| 26 | led.set_high(); | 26 | led.set_high(); |
| 27 | Timer::after(Duration::from_millis(300)).await; | 27 | Timer::after_millis(300).await; |
| 28 | 28 | ||
| 29 | info!("low"); | 29 | info!("low"); |
| 30 | led.set_low(); | 30 | led.set_low(); |
| 31 | Timer::after(Duration::from_millis(300)).await; | 31 | Timer::after_millis(300).await; |
| 32 | 32 | ||
| 33 | // Pet watchdog for 5 iterations and then stop. | 33 | // Pet watchdog for 5 iterations and then stop. |
| 34 | // MCU should restart in 1 second after the last pet. | 34 | // MCU should restart in 1 second after the last pet. |
diff --git a/examples/stm32f7/Cargo.toml b/examples/stm32f7/Cargo.toml index bf8f413d8..5cbaca461 100644 --- a/examples/stm32f7/Cargo.toml +++ b/examples/stm32f7/Cargo.toml | |||
| @@ -9,9 +9,9 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f767zi", "memory-x", "unstable-pac", "time-driver-any", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32f767zi", "memory-x", "unstable-pac", "time-driver-any", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] } | 13 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] } |
| 14 | embedded-io-async = { version = "0.5.0" } | 14 | embedded-io-async = { version = "0.6.0" } |
| 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 16 | 16 | ||
| 17 | defmt = "0.3" | 17 | defmt = "0.3" |
diff --git a/examples/stm32f7/src/bin/adc.rs b/examples/stm32f7/src/bin/adc.rs index bc4ed2892..48c59eaf0 100644 --- a/examples/stm32f7/src/bin/adc.rs +++ b/examples/stm32f7/src/bin/adc.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::adc::Adc; | 7 | use embassy_stm32::adc::Adc; |
| 8 | use embassy_time::{Delay, Duration, Timer}; | 8 | use embassy_time::{Delay, Timer}; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -29,6 +29,6 @@ async fn main(_spawner: Spawner) { | |||
| 29 | loop { | 29 | loop { |
| 30 | let v = adc.read(&mut pin); | 30 | let v = adc.read(&mut pin); |
| 31 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); | 31 | info!("--> {} - {} mV", v, convert_to_millivolts(v)); |
| 32 | Timer::after(Duration::from_millis(100)).await; | 32 | Timer::after_millis(100).await; |
| 33 | } | 33 | } |
| 34 | } | 34 | } |
diff --git a/examples/stm32f7/src/bin/blinky.rs b/examples/stm32f7/src/bin/blinky.rs index b27bee4ce..4bfc5a50d 100644 --- a/examples/stm32f7/src/bin/blinky.rs +++ b/examples/stm32f7/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32f7/src/bin/can.rs b/examples/stm32f7/src/bin/can.rs index e9650f23a..78b21ceaa 100644 --- a/examples/stm32f7/src/bin/can.rs +++ b/examples/stm32f7/src/bin/can.rs | |||
| @@ -26,7 +26,7 @@ pub async fn send_can_message(tx: &'static mut CanTx<'static, 'static, CAN3>) { | |||
| 26 | loop { | 26 | loop { |
| 27 | let frame = Frame::new_data(unwrap!(StandardId::new(0 as _)), [0]); | 27 | let frame = Frame::new_data(unwrap!(StandardId::new(0 as _)), [0]); |
| 28 | tx.write(&frame).await; | 28 | tx.write(&frame).await; |
| 29 | embassy_time::Timer::after(embassy_time::Duration::from_secs(1)).await; | 29 | embassy_time::Timer::after_secs(1).await; |
| 30 | } | 30 | } |
| 31 | } | 31 | } |
| 32 | 32 | ||
diff --git a/examples/stm32f7/src/bin/eth.rs b/examples/stm32f7/src/bin/eth.rs index 93c97c8ee..7c6c419a6 100644 --- a/examples/stm32f7/src/bin/eth.rs +++ b/examples/stm32f7/src/bin/eth.rs | |||
| @@ -10,9 +10,9 @@ use embassy_stm32::eth::generic_smi::GenericSMI; | |||
| 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; | 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; |
| 11 | use embassy_stm32::peripherals::ETH; | 11 | use embassy_stm32::peripherals::ETH; |
| 12 | use embassy_stm32::rng::Rng; | 12 | use embassy_stm32::rng::Rng; |
| 13 | use embassy_stm32::time::mhz; | 13 | use embassy_stm32::time::Hertz; |
| 14 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; | 14 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; |
| 15 | use embassy_time::{Duration, Timer}; | 15 | use embassy_time::Timer; |
| 16 | use embedded_io_async::Write; | 16 | use embedded_io_async::Write; |
| 17 | use rand_core::RngCore; | 17 | use rand_core::RngCore; |
| 18 | use static_cell::make_static; | 18 | use static_cell::make_static; |
| @@ -33,7 +33,25 @@ async fn net_task(stack: &'static Stack<Device>) -> ! { | |||
| 33 | #[embassy_executor::main] | 33 | #[embassy_executor::main] |
| 34 | async fn main(spawner: Spawner) -> ! { | 34 | async fn main(spawner: Spawner) -> ! { |
| 35 | let mut config = Config::default(); | 35 | let mut config = Config::default(); |
| 36 | config.rcc.sys_ck = Some(mhz(200)); | 36 | { |
| 37 | use embassy_stm32::rcc::*; | ||
| 38 | config.rcc.hse = Some(Hse { | ||
| 39 | freq: Hertz(8_000_000), | ||
| 40 | mode: HseMode::Bypass, | ||
| 41 | }); | ||
| 42 | config.rcc.pll_src = PllSource::HSE; | ||
| 43 | config.rcc.pll = Some(Pll { | ||
| 44 | prediv: PllPreDiv::DIV4, | ||
| 45 | mul: PllMul::MUL216, | ||
| 46 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 216 / 2 = 216Mhz | ||
| 47 | divq: None, | ||
| 48 | divr: None, | ||
| 49 | }); | ||
| 50 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 51 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 52 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 53 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 54 | } | ||
| 37 | let p = embassy_stm32::init(config); | 55 | let p = embassy_stm32::init(config); |
| 38 | 56 | ||
| 39 | info!("Hello World!"); | 57 | info!("Hello World!"); |
| @@ -59,9 +77,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 59 | p.PG13, | 77 | p.PG13, |
| 60 | p.PB13, | 78 | p.PB13, |
| 61 | p.PG11, | 79 | p.PG11, |
| 62 | GenericSMI::new(), | 80 | GenericSMI::new(0), |
| 63 | mac_addr, | 81 | mac_addr, |
| 64 | 0, | ||
| 65 | ); | 82 | ); |
| 66 | 83 | ||
| 67 | let config = embassy_net::Config::dhcpv4(Default::default()); | 84 | let config = embassy_net::Config::dhcpv4(Default::default()); |
| @@ -101,7 +118,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 101 | let r = socket.connect(remote_endpoint).await; | 118 | let r = socket.connect(remote_endpoint).await; |
| 102 | if let Err(e) = r { | 119 | if let Err(e) = r { |
| 103 | info!("connect error: {:?}", e); | 120 | info!("connect error: {:?}", e); |
| 104 | Timer::after(Duration::from_secs(1)).await; | 121 | Timer::after_secs(1).await; |
| 105 | continue; | 122 | continue; |
| 106 | } | 123 | } |
| 107 | info!("connected!"); | 124 | info!("connected!"); |
| @@ -112,7 +129,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 112 | info!("write error: {:?}", e); | 129 | info!("write error: {:?}", e); |
| 113 | break; | 130 | break; |
| 114 | } | 131 | } |
| 115 | Timer::after(Duration::from_secs(1)).await; | 132 | Timer::after_secs(1).await; |
| 116 | } | 133 | } |
| 117 | } | 134 | } |
| 118 | } | 135 | } |
diff --git a/examples/stm32f7/src/bin/flash.rs b/examples/stm32f7/src/bin/flash.rs index 35d3059be..06a94f1c8 100644 --- a/examples/stm32f7/src/bin/flash.rs +++ b/examples/stm32f7/src/bin/flash.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::flash::Flash; | 7 | use embassy_stm32::flash::Flash; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -16,7 +16,7 @@ async fn main(_spawner: Spawner) { | |||
| 16 | const ADDR: u32 = 0x8_0000; // This is the offset into the third region, the absolute address is 4x32K + 128K + 0x8_0000. | 16 | const ADDR: u32 = 0x8_0000; // This is the offset into the third region, the absolute address is 4x32K + 128K + 0x8_0000. |
| 17 | 17 | ||
| 18 | // wait a bit before accessing the flash | 18 | // wait a bit before accessing the flash |
| 19 | Timer::after(Duration::from_millis(300)).await; | 19 | Timer::after_millis(300).await; |
| 20 | 20 | ||
| 21 | let mut f = Flash::new_blocking(p.FLASH).into_blocking_regions().bank1_region3; | 21 | let mut f = Flash::new_blocking(p.FLASH).into_blocking_regions().bank1_region3; |
| 22 | 22 | ||
diff --git a/examples/stm32f7/src/bin/hello.rs b/examples/stm32f7/src/bin/hello.rs index c409703f5..a2a287110 100644 --- a/examples/stm32f7/src/bin/hello.rs +++ b/examples/stm32f7/src/bin/hello.rs | |||
| @@ -4,19 +4,17 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::info; | 5 | use defmt::info; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::Hertz; | ||
| 8 | use embassy_stm32::Config; | 7 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 10 | ||
| 12 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| 13 | async fn main(_spawner: Spawner) -> ! { | 12 | async fn main(_spawner: Spawner) -> ! { |
| 14 | let mut config = Config::default(); | 13 | let config = Config::default(); |
| 15 | config.rcc.sys_ck = Some(Hertz(84_000_000)); | ||
| 16 | let _p = embassy_stm32::init(config); | 14 | let _p = embassy_stm32::init(config); |
| 17 | 15 | ||
| 18 | loop { | 16 | loop { |
| 19 | info!("Hello World!"); | 17 | info!("Hello World!"); |
| 20 | Timer::after(Duration::from_secs(1)).await; | 18 | Timer::after_secs(1).await; |
| 21 | } | 19 | } |
| 22 | } | 20 | } |
diff --git a/examples/stm32f7/src/bin/sdmmc.rs b/examples/stm32f7/src/bin/sdmmc.rs index 9d43892a0..430aa781f 100644 --- a/examples/stm32f7/src/bin/sdmmc.rs +++ b/examples/stm32f7/src/bin/sdmmc.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::sdmmc::Sdmmc; | 7 | use embassy_stm32::sdmmc::Sdmmc; |
| 8 | use embassy_stm32::time::mhz; | 8 | use embassy_stm32::time::{mhz, Hertz}; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, sdmmc, Config}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| @@ -16,8 +16,25 @@ bind_interrupts!(struct Irqs { | |||
| 16 | #[embassy_executor::main] | 16 | #[embassy_executor::main] |
| 17 | async fn main(_spawner: Spawner) { | 17 | async fn main(_spawner: Spawner) { |
| 18 | let mut config = Config::default(); | 18 | let mut config = Config::default(); |
| 19 | config.rcc.sys_ck = Some(mhz(200)); | 19 | { |
| 20 | config.rcc.pll48 = true; | 20 | use embassy_stm32::rcc::*; |
| 21 | config.rcc.hse = Some(Hse { | ||
| 22 | freq: Hertz(8_000_000), | ||
| 23 | mode: HseMode::Bypass, | ||
| 24 | }); | ||
| 25 | config.rcc.pll_src = PllSource::HSE; | ||
| 26 | config.rcc.pll = Some(Pll { | ||
| 27 | prediv: PllPreDiv::DIV4, | ||
| 28 | mul: PllMul::MUL216, | ||
| 29 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 216 / 2 = 216Mhz | ||
| 30 | divq: Some(Pllq::DIV9), // 8mhz / 4 * 216 / 9 = 48Mhz | ||
| 31 | divr: None, | ||
| 32 | }); | ||
| 33 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 34 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 35 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 36 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 37 | } | ||
| 21 | let p = embassy_stm32::init(config); | 38 | let p = embassy_stm32::init(config); |
| 22 | 39 | ||
| 23 | info!("Hello World!"); | 40 | info!("Hello World!"); |
diff --git a/examples/stm32f7/src/bin/usb_serial.rs b/examples/stm32f7/src/bin/usb_serial.rs index a2c76178b..2f832c234 100644 --- a/examples/stm32f7/src/bin/usb_serial.rs +++ b/examples/stm32f7/src/bin/usb_serial.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{panic, *}; | 5 | use defmt::{panic, *}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::time::mhz; | 7 | use embassy_stm32::time::Hertz; |
| 8 | use embassy_stm32::usb_otg::{Driver, Instance}; | 8 | use embassy_stm32::usb_otg::{Driver, Instance}; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, usb_otg, Config}; |
| 10 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; | 10 | use embassy_usb::class::cdc_acm::{CdcAcmClass, State}; |
| @@ -22,10 +22,25 @@ async fn main(_spawner: Spawner) { | |||
| 22 | info!("Hello World!"); | 22 | info!("Hello World!"); |
| 23 | 23 | ||
| 24 | let mut config = Config::default(); | 24 | let mut config = Config::default(); |
| 25 | config.rcc.hse = Some(mhz(8)); | 25 | { |
| 26 | config.rcc.pll48 = true; | 26 | use embassy_stm32::rcc::*; |
| 27 | config.rcc.sys_ck = Some(mhz(200)); | 27 | config.rcc.hse = Some(Hse { |
| 28 | 28 | freq: Hertz(8_000_000), | |
| 29 | mode: HseMode::Bypass, | ||
| 30 | }); | ||
| 31 | config.rcc.pll_src = PllSource::HSE; | ||
| 32 | config.rcc.pll = Some(Pll { | ||
| 33 | prediv: PllPreDiv::DIV4, | ||
| 34 | mul: PllMul::MUL216, | ||
| 35 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 216 / 2 = 216Mhz | ||
| 36 | divq: Some(Pllq::DIV9), // 8mhz / 4 * 216 / 9 = 48Mhz | ||
| 37 | divr: None, | ||
| 38 | }); | ||
| 39 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 40 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 41 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 42 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 43 | } | ||
| 29 | let p = embassy_stm32::init(config); | 44 | let p = embassy_stm32::init(config); |
| 30 | 45 | ||
| 31 | // Create the driver, from the HAL. | 46 | // Create the driver, from the HAL. |
diff --git a/examples/stm32g0/Cargo.toml b/examples/stm32g0/Cargo.toml index b4b423d58..d0b7d85f8 100644 --- a/examples/stm32g0/Cargo.toml +++ b/examples/stm32g0/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32g071rb", "memory-x", "unstable-pac", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32g071rb", "memory-x", "unstable-pac", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | 13 | ||
| 14 | defmt = "0.3" | 14 | defmt = "0.3" |
| 15 | defmt-rtt = "0.4" | 15 | defmt-rtt = "0.4" |
diff --git a/examples/stm32g0/src/bin/blinky.rs b/examples/stm32g0/src/bin/blinky.rs index b27bee4ce..4bfc5a50d 100644 --- a/examples/stm32g0/src/bin/blinky.rs +++ b/examples/stm32g0/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32g0/src/bin/spi_neopixel.rs b/examples/stm32g0/src/bin/spi_neopixel.rs index ee7aaf33f..214462d0e 100644 --- a/examples/stm32g0/src/bin/spi_neopixel.rs +++ b/examples/stm32g0/src/bin/spi_neopixel.rs | |||
| @@ -8,7 +8,7 @@ use embassy_stm32::dma::word::U5; | |||
| 8 | use embassy_stm32::dma::NoDma; | 8 | use embassy_stm32::dma::NoDma; |
| 9 | use embassy_stm32::spi::{Config, Spi}; | 9 | use embassy_stm32::spi::{Config, Spi}; |
| 10 | use embassy_stm32::time::Hertz; | 10 | use embassy_stm32::time::Hertz; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | const NR_PIXELS: usize = 15; | 14 | const NR_PIXELS: usize = 15; |
| @@ -96,8 +96,8 @@ async fn main(_spawner: Spawner) { | |||
| 96 | cnt += 1; | 96 | cnt += 1; |
| 97 | // start sending the neopixel bit patters over spi to the neopixel string | 97 | // start sending the neopixel bit patters over spi to the neopixel string |
| 98 | spi.write(&neopixels.bitbuffer).await.ok(); | 98 | spi.write(&neopixels.bitbuffer).await.ok(); |
| 99 | Timer::after(Duration::from_millis(500)).await; | 99 | Timer::after_millis(500).await; |
| 100 | } | 100 | } |
| 101 | Timer::after(Duration::from_millis(1000)).await; | 101 | Timer::after_millis(1000).await; |
| 102 | } | 102 | } |
| 103 | } | 103 | } |
diff --git a/examples/stm32g4/Cargo.toml b/examples/stm32g4/Cargo.toml index 59da06283..908c6d19d 100644 --- a/examples/stm32g4/Cargo.toml +++ b/examples/stm32g4/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32g491re", "memory-x", "unstable-pac", "exti"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "time-driver-any", "stm32g491re", "memory-x", "unstable-pac", "exti"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 15 | usbd-hid = "0.6.0" | 15 | usbd-hid = "0.6.0" |
diff --git a/examples/stm32g4/src/bin/adc.rs b/examples/stm32g4/src/bin/adc.rs index a792748bc..db7f6ecb5 100644 --- a/examples/stm32g4/src/bin/adc.rs +++ b/examples/stm32g4/src/bin/adc.rs | |||
| @@ -7,7 +7,7 @@ use embassy_executor::Spawner; | |||
| 7 | use embassy_stm32::adc::{Adc, SampleTime}; | 7 | use embassy_stm32::adc::{Adc, SampleTime}; |
| 8 | use embassy_stm32::rcc::{AdcClockSource, ClockSrc, Pll, PllM, PllN, PllR, PllSrc}; | 8 | use embassy_stm32::rcc::{AdcClockSource, ClockSrc, Pll, PllM, PllN, PllR, PllSrc}; |
| 9 | use embassy_stm32::Config; | 9 | use embassy_stm32::Config; |
| 10 | use embassy_time::{Delay, Duration, Timer}; | 10 | use embassy_time::{Delay, Timer}; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::main] | 13 | #[embassy_executor::main] |
| @@ -16,15 +16,15 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | config.rcc.pll = Some(Pll { | 17 | config.rcc.pll = Some(Pll { |
| 18 | source: PllSrc::HSI16, | 18 | source: PllSrc::HSI16, |
| 19 | prediv_m: PllM::Div4, | 19 | prediv_m: PllM::DIV4, |
| 20 | mul_n: PllN::Mul85, | 20 | mul_n: PllN::MUL85, |
| 21 | div_p: None, | 21 | div_p: None, |
| 22 | div_q: None, | 22 | div_q: None, |
| 23 | // Main system clock at 170 MHz | 23 | // Main system clock at 170 MHz |
| 24 | div_r: Some(PllR::Div2), | 24 | div_r: Some(PllR::DIV2), |
| 25 | }); | 25 | }); |
| 26 | 26 | ||
| 27 | config.rcc.adc12_clock_source = AdcClockSource::SysClk; | 27 | config.rcc.adc12_clock_source = AdcClockSource::SYS; |
| 28 | config.rcc.mux = ClockSrc::PLL; | 28 | config.rcc.mux = ClockSrc::PLL; |
| 29 | 29 | ||
| 30 | let mut p = embassy_stm32::init(config); | 30 | let mut p = embassy_stm32::init(config); |
| @@ -36,6 +36,6 @@ async fn main(_spawner: Spawner) { | |||
| 36 | loop { | 36 | loop { |
| 37 | let measured = adc.read(&mut p.PA7); | 37 | let measured = adc.read(&mut p.PA7); |
| 38 | info!("measured: {}", measured); | 38 | info!("measured: {}", measured); |
| 39 | Timer::after(Duration::from_millis(500)).await; | 39 | Timer::after_millis(500).await; |
| 40 | } | 40 | } |
| 41 | } | 41 | } |
diff --git a/examples/stm32g4/src/bin/blinky.rs b/examples/stm32g4/src/bin/blinky.rs index 8a65b0692..cbeb0dee1 100644 --- a/examples/stm32g4/src/bin/blinky.rs +++ b/examples/stm32g4/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32g4/src/bin/pll.rs b/examples/stm32g4/src/bin/pll.rs index ef7d4800c..43242647f 100644 --- a/examples/stm32g4/src/bin/pll.rs +++ b/examples/stm32g4/src/bin/pll.rs | |||
| @@ -6,7 +6,7 @@ use defmt::*; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::rcc::{ClockSrc, Pll, PllM, PllN, PllR, PllSrc}; | 7 | use embassy_stm32::rcc::{ClockSrc, Pll, PllM, PllN, PllR, PllSrc}; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -15,12 +15,12 @@ async fn main(_spawner: Spawner) { | |||
| 15 | 15 | ||
| 16 | config.rcc.pll = Some(Pll { | 16 | config.rcc.pll = Some(Pll { |
| 17 | source: PllSrc::HSI16, | 17 | source: PllSrc::HSI16, |
| 18 | prediv_m: PllM::Div4, | 18 | prediv_m: PllM::DIV4, |
| 19 | mul_n: PllN::Mul85, | 19 | mul_n: PllN::MUL85, |
| 20 | div_p: None, | 20 | div_p: None, |
| 21 | div_q: None, | 21 | div_q: None, |
| 22 | // Main system clock at 170 MHz | 22 | // Main system clock at 170 MHz |
| 23 | div_r: Some(PllR::Div2), | 23 | div_r: Some(PllR::DIV2), |
| 24 | }); | 24 | }); |
| 25 | 25 | ||
| 26 | config.rcc.mux = ClockSrc::PLL; | 26 | config.rcc.mux = ClockSrc::PLL; |
| @@ -29,7 +29,7 @@ async fn main(_spawner: Spawner) { | |||
| 29 | info!("Hello World!"); | 29 | info!("Hello World!"); |
| 30 | 30 | ||
| 31 | loop { | 31 | loop { |
| 32 | Timer::after(Duration::from_millis(1000)).await; | 32 | Timer::after_millis(1000).await; |
| 33 | info!("1s elapsed"); | 33 | info!("1s elapsed"); |
| 34 | } | 34 | } |
| 35 | } | 35 | } |
diff --git a/examples/stm32g4/src/bin/pwm.rs b/examples/stm32g4/src/bin/pwm.rs index c62b11d13..a84394005 100644 --- a/examples/stm32g4/src/bin/pwm.rs +++ b/examples/stm32g4/src/bin/pwm.rs | |||
| @@ -8,7 +8,7 @@ use embassy_stm32::gpio::OutputType; | |||
| 8 | use embassy_stm32::time::khz; | 8 | use embassy_stm32::time::khz; |
| 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; | 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; |
| 10 | use embassy_stm32::timer::Channel; | 10 | use embassy_stm32::timer::Channel; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | #[embassy_executor::main] | 14 | #[embassy_executor::main] |
| @@ -26,12 +26,12 @@ async fn main(_spawner: Spawner) { | |||
| 26 | 26 | ||
| 27 | loop { | 27 | loop { |
| 28 | pwm.set_duty(Channel::Ch1, 0); | 28 | pwm.set_duty(Channel::Ch1, 0); |
| 29 | Timer::after(Duration::from_millis(300)).await; | 29 | Timer::after_millis(300).await; |
| 30 | pwm.set_duty(Channel::Ch1, max / 4); | 30 | pwm.set_duty(Channel::Ch1, max / 4); |
| 31 | Timer::after(Duration::from_millis(300)).await; | 31 | Timer::after_millis(300).await; |
| 32 | pwm.set_duty(Channel::Ch1, max / 2); | 32 | pwm.set_duty(Channel::Ch1, max / 2); |
| 33 | Timer::after(Duration::from_millis(300)).await; | 33 | Timer::after_millis(300).await; |
| 34 | pwm.set_duty(Channel::Ch1, max - 1); | 34 | pwm.set_duty(Channel::Ch1, max - 1); |
| 35 | Timer::after(Duration::from_millis(300)).await; | 35 | Timer::after_millis(300).await; |
| 36 | } | 36 | } |
| 37 | } | 37 | } |
diff --git a/examples/stm32g4/src/bin/usb_serial.rs b/examples/stm32g4/src/bin/usb_serial.rs index 77cfa67d3..9099b609a 100644 --- a/examples/stm32g4/src/bin/usb_serial.rs +++ b/examples/stm32g4/src/bin/usb_serial.rs | |||
| @@ -25,16 +25,16 @@ async fn main(_spawner: Spawner) { | |||
| 25 | // Change this to `false` to use the HSE clock source for the USB. This example assumes an 8MHz HSE. | 25 | // Change this to `false` to use the HSE clock source for the USB. This example assumes an 8MHz HSE. |
| 26 | const USE_HSI48: bool = true; | 26 | const USE_HSI48: bool = true; |
| 27 | 27 | ||
| 28 | let pllq_div = if USE_HSI48 { None } else { Some(PllQ::Div6) }; | 28 | let pllq_div = if USE_HSI48 { None } else { Some(PllQ::DIV6) }; |
| 29 | 29 | ||
| 30 | config.rcc.pll = Some(Pll { | 30 | config.rcc.pll = Some(Pll { |
| 31 | source: PllSrc::HSE(Hertz(8_000_000)), | 31 | source: PllSrc::HSE(Hertz(8_000_000)), |
| 32 | prediv_m: PllM::Div2, | 32 | prediv_m: PllM::DIV2, |
| 33 | mul_n: PllN::Mul72, | 33 | mul_n: PllN::MUL72, |
| 34 | div_p: None, | 34 | div_p: None, |
| 35 | div_q: pllq_div, | 35 | div_q: pllq_div, |
| 36 | // Main system clock at 144 MHz | 36 | // Main system clock at 144 MHz |
| 37 | div_r: Some(PllR::Div2), | 37 | div_r: Some(PllR::DIV2), |
| 38 | }); | 38 | }); |
| 39 | 39 | ||
| 40 | config.rcc.mux = ClockSrc::PLL; | 40 | config.rcc.mux = ClockSrc::PLL; |
diff --git a/examples/stm32h5/Cargo.toml b/examples/stm32h5/Cargo.toml index 42a426185..f5980d87a 100644 --- a/examples/stm32h5/Cargo.toml +++ b/examples/stm32h5/Cargo.toml | |||
| @@ -9,9 +9,9 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32h563zi", "memory-x", "time-driver-any", "exti", "unstable-pac", "unstable-traits"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32h563zi", "memory-x", "time-driver-any", "exti", "unstable-pac", "unstable-traits"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } |
| 13 | embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] } | 13 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] } |
| 14 | embedded-io-async = { version = "0.5.0" } | 14 | embedded-io-async = { version = "0.6.0" } |
| 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 16 | 16 | ||
| 17 | defmt = "0.3" | 17 | defmt = "0.3" |
| @@ -22,7 +22,7 @@ cortex-m-rt = "0.7.0" | |||
| 22 | embedded-hal = "0.2.6" | 22 | embedded-hal = "0.2.6" |
| 23 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } | 23 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } |
| 24 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 24 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
| 25 | embedded-nal-async = { version = "0.5.0" } | 25 | embedded-nal-async = { version = "0.6.0" } |
| 26 | panic-probe = { version = "0.3", features = ["print-defmt"] } | 26 | panic-probe = { version = "0.3", features = ["print-defmt"] } |
| 27 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 27 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 28 | heapless = { version = "0.7.5", default-features = false } | 28 | heapless = { version = "0.7.5", default-features = false } |
diff --git a/examples/stm32h5/src/bin/blinky.rs b/examples/stm32h5/src/bin/blinky.rs index f9bf90d2e..1394f03fa 100644 --- a/examples/stm32h5/src/bin/blinky.rs +++ b/examples/stm32h5/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(500)).await; | 25 | Timer::after_millis(500).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32h5/src/bin/eth.rs b/examples/stm32h5/src/bin/eth.rs index 4e92d0647..6e40f0ac0 100644 --- a/examples/stm32h5/src/bin/eth.rs +++ b/examples/stm32h5/src/bin/eth.rs | |||
| @@ -9,11 +9,13 @@ use embassy_net::{Ipv4Address, Stack, StackResources}; | |||
| 9 | use embassy_stm32::eth::generic_smi::GenericSMI; | 9 | use embassy_stm32::eth::generic_smi::GenericSMI; |
| 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; | 10 | use embassy_stm32::eth::{Ethernet, PacketQueue}; |
| 11 | use embassy_stm32::peripherals::ETH; | 11 | use embassy_stm32::peripherals::ETH; |
| 12 | use embassy_stm32::rcc::{AHBPrescaler, APBPrescaler, Hse, HseMode, Pll, PllSource, Sysclk, VoltageScale}; | 12 | use embassy_stm32::rcc::{ |
| 13 | AHBPrescaler, APBPrescaler, Hse, HseMode, Pll, PllDiv, PllMul, PllPreDiv, PllSource, Sysclk, VoltageScale, | ||
| 14 | }; | ||
| 13 | use embassy_stm32::rng::Rng; | 15 | use embassy_stm32::rng::Rng; |
| 14 | use embassy_stm32::time::Hertz; | 16 | use embassy_stm32::time::Hertz; |
| 15 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; | 17 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; |
| 16 | use embassy_time::{Duration, Timer}; | 18 | use embassy_time::Timer; |
| 17 | use embedded_io_async::Write; | 19 | use embedded_io_async::Write; |
| 18 | use rand_core::RngCore; | 20 | use rand_core::RngCore; |
| 19 | use static_cell::make_static; | 21 | use static_cell::make_static; |
| @@ -42,10 +44,10 @@ async fn main(spawner: Spawner) -> ! { | |||
| 42 | }); | 44 | }); |
| 43 | config.rcc.pll1 = Some(Pll { | 45 | config.rcc.pll1 = Some(Pll { |
| 44 | source: PllSource::Hse, | 46 | source: PllSource::Hse, |
| 45 | prediv: 2, | 47 | prediv: PllPreDiv::DIV2, |
| 46 | mul: 125, | 48 | mul: PllMul::MUL125, |
| 47 | divp: Some(2), | 49 | divp: Some(PllDiv::DIV2), |
| 48 | divq: Some(2), | 50 | divq: Some(PllDiv::DIV2), |
| 49 | divr: None, | 51 | divr: None, |
| 50 | }); | 52 | }); |
| 51 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | 53 | config.rcc.ahb_pre = AHBPrescaler::DIV1; |
| @@ -78,9 +80,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 78 | p.PG13, | 80 | p.PG13, |
| 79 | p.PB15, | 81 | p.PB15, |
| 80 | p.PG11, | 82 | p.PG11, |
| 81 | GenericSMI::new(), | 83 | GenericSMI::new(0), |
| 82 | mac_addr, | 84 | mac_addr, |
| 83 | 0, | ||
| 84 | ); | 85 | ); |
| 85 | 86 | ||
| 86 | let config = embassy_net::Config::dhcpv4(Default::default()); | 87 | let config = embassy_net::Config::dhcpv4(Default::default()); |
| @@ -120,7 +121,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 120 | let r = socket.connect(remote_endpoint).await; | 121 | let r = socket.connect(remote_endpoint).await; |
| 121 | if let Err(e) = r { | 122 | if let Err(e) = r { |
| 122 | info!("connect error: {:?}", e); | 123 | info!("connect error: {:?}", e); |
| 123 | Timer::after(Duration::from_secs(3)).await; | 124 | Timer::after_secs(3).await; |
| 124 | continue; | 125 | continue; |
| 125 | } | 126 | } |
| 126 | info!("connected!"); | 127 | info!("connected!"); |
| @@ -130,7 +131,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 130 | info!("write error: {:?}", e); | 131 | info!("write error: {:?}", e); |
| 131 | break; | 132 | break; |
| 132 | } | 133 | } |
| 133 | Timer::after(Duration::from_secs(1)).await; | 134 | Timer::after_secs(1).await; |
| 134 | } | 135 | } |
| 135 | } | 136 | } |
| 136 | } | 137 | } |
diff --git a/examples/stm32h5/src/bin/i2c.rs b/examples/stm32h5/src/bin/i2c.rs index 8b6fe71ae..8b1662f39 100644 --- a/examples/stm32h5/src/bin/i2c.rs +++ b/examples/stm32h5/src/bin/i2c.rs | |||
| @@ -4,10 +4,9 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::i2c::{Error, I2c, TimeoutI2c}; | 7 | use embassy_stm32::i2c::{Error, I2c}; |
| 8 | use embassy_stm32::time::Hertz; | 8 | use embassy_stm32::time::Hertz; |
| 9 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; | 9 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; |
| 10 | use embassy_time::Duration; | ||
| 11 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 11 | ||
| 13 | const ADDRESS: u8 = 0x5F; | 12 | const ADDRESS: u8 = 0x5F; |
| @@ -33,13 +32,9 @@ async fn main(_spawner: Spawner) { | |||
| 33 | Default::default(), | 32 | Default::default(), |
| 34 | ); | 33 | ); |
| 35 | 34 | ||
| 36 | // I2C bus can freeze if SCL line is shorted or due to a broken device that clock stretches for too long. | ||
| 37 | // TimeoutI2c allows recovering from such errors by throwing `Error::Timeout` after a given delay. | ||
| 38 | let mut timeout_i2c = TimeoutI2c::new(&mut i2c, Duration::from_millis(1000)); | ||
| 39 | |||
| 40 | let mut data = [0u8; 1]; | 35 | let mut data = [0u8; 1]; |
| 41 | 36 | ||
| 42 | match timeout_i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { | 37 | match i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { |
| 43 | Ok(()) => info!("Whoami: {}", data[0]), | 38 | Ok(()) => info!("Whoami: {}", data[0]), |
| 44 | Err(Error::Timeout) => error!("Operation timed out"), | 39 | Err(Error::Timeout) => error!("Operation timed out"), |
| 45 | Err(e) => error!("I2c Error: {:?}", e), | 40 | Err(e) => error!("I2c Error: {:?}", e), |
diff --git a/examples/stm32h5/src/bin/usb_serial.rs b/examples/stm32h5/src/bin/usb_serial.rs index cbe540a06..3b3c38e17 100644 --- a/examples/stm32h5/src/bin/usb_serial.rs +++ b/examples/stm32h5/src/bin/usb_serial.rs | |||
| @@ -4,7 +4,9 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::{panic, *}; | 5 | use defmt::{panic, *}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::rcc::{AHBPrescaler, APBPrescaler, Hse, HseMode, Pll, PllSource, Sysclk, VoltageScale}; | 7 | use embassy_stm32::rcc::{ |
| 8 | AHBPrescaler, APBPrescaler, Hse, HseMode, Pll, PllDiv, PllMul, PllPreDiv, PllSource, Sysclk, VoltageScale, | ||
| 9 | }; | ||
| 8 | use embassy_stm32::time::Hertz; | 10 | use embassy_stm32::time::Hertz; |
| 9 | use embassy_stm32::usb::{Driver, Instance}; | 11 | use embassy_stm32::usb::{Driver, Instance}; |
| 10 | use embassy_stm32::{bind_interrupts, pac, peripherals, usb, Config}; | 12 | use embassy_stm32::{bind_interrupts, pac, peripherals, usb, Config}; |
| @@ -29,9 +31,9 @@ async fn main(_spawner: Spawner) { | |||
| 29 | }); | 31 | }); |
| 30 | config.rcc.pll1 = Some(Pll { | 32 | config.rcc.pll1 = Some(Pll { |
| 31 | source: PllSource::Hse, | 33 | source: PllSource::Hse, |
| 32 | prediv: 2, | 34 | prediv: PllPreDiv::DIV2, |
| 33 | mul: 125, | 35 | mul: PllMul::MUL125, |
| 34 | divp: Some(2), // 250mhz | 36 | divp: Some(PllDiv::DIV2), // 250mhz |
| 35 | divq: None, | 37 | divq: None, |
| 36 | divr: None, | 38 | divr: None, |
| 37 | }); | 39 | }); |
diff --git a/examples/stm32h7/Cargo.toml b/examples/stm32h7/Cargo.toml index c1d49963c..0855bdfc7 100644 --- a/examples/stm32h7/Cargo.toml +++ b/examples/stm32h7/Cargo.toml | |||
| @@ -6,12 +6,12 @@ license = "MIT OR Apache-2.0" | |||
| 6 | 6 | ||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | # Change stm32h743bi to your chip name, if necessary. | 8 | # Change stm32h743bi to your chip name, if necessary. |
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32h743bi", "time-driver-any", "exti", "memory-x", "unstable-pac", "unstable-traits"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32h743bi", "time-driver-any", "exti", "memory-x", "unstable-pac", "unstable-traits", "chrono"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "unstable-traits", "tick-hz-32_768"] } |
| 13 | embassy-net = { path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] } | 13 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet", "proto-ipv6"] } |
| 14 | embedded-io-async = { version = "0.5.0" } | 14 | embedded-io-async = { version = "0.6.0" } |
| 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 15 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 16 | 16 | ||
| 17 | defmt = "0.3" | 17 | defmt = "0.3" |
| @@ -22,7 +22,7 @@ cortex-m-rt = "0.7.0" | |||
| 22 | embedded-hal = "0.2.6" | 22 | embedded-hal = "0.2.6" |
| 23 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } | 23 | embedded-hal-1 = { package = "embedded-hal", version = "=1.0.0-rc.1" } |
| 24 | embedded-hal-async = { version = "=1.0.0-rc.1" } | 24 | embedded-hal-async = { version = "=1.0.0-rc.1" } |
| 25 | embedded-nal-async = { version = "0.5.0" } | 25 | embedded-nal-async = { version = "0.6.0" } |
| 26 | panic-probe = { version = "0.3", features = ["print-defmt"] } | 26 | panic-probe = { version = "0.3", features = ["print-defmt"] } |
| 27 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 27 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 28 | heapless = { version = "0.7.5", default-features = false } | 28 | heapless = { version = "0.7.5", default-features = false } |
| @@ -32,6 +32,7 @@ micromath = "2.0.0" | |||
| 32 | stm32-fmc = "0.3.0" | 32 | stm32-fmc = "0.3.0" |
| 33 | embedded-storage = "0.3.0" | 33 | embedded-storage = "0.3.0" |
| 34 | static_cell = { version = "1.1", features = ["nightly"]} | 34 | static_cell = { version = "1.1", features = ["nightly"]} |
| 35 | chrono = { version = "^0.4", default-features = false } | ||
| 35 | 36 | ||
| 36 | # cargo build/run | 37 | # cargo build/run |
| 37 | [profile.dev] | 38 | [profile.dev] |
diff --git a/examples/stm32h7/src/bin/adc.rs b/examples/stm32h7/src/bin/adc.rs index 77922d4bc..4a358a35f 100644 --- a/examples/stm32h7/src/bin/adc.rs +++ b/examples/stm32h7/src/bin/adc.rs | |||
| @@ -6,7 +6,7 @@ use defmt::*; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::adc::{Adc, SampleTime}; | 7 | use embassy_stm32::adc::{Adc, SampleTime}; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Delay, Duration, Timer}; | 9 | use embassy_time::{Delay, Timer}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -18,16 +18,16 @@ async fn main(_spawner: Spawner) { | |||
| 18 | config.rcc.csi = true; | 18 | config.rcc.csi = true; |
| 19 | config.rcc.pll_src = PllSource::Hsi; | 19 | config.rcc.pll_src = PllSource::Hsi; |
| 20 | config.rcc.pll1 = Some(Pll { | 20 | config.rcc.pll1 = Some(Pll { |
| 21 | prediv: 4, | 21 | prediv: PllPreDiv::DIV4, |
| 22 | mul: 50, | 22 | mul: PllMul::MUL50, |
| 23 | divp: Some(2), | 23 | divp: Some(PllDiv::DIV2), |
| 24 | divq: Some(8), // SPI1 cksel defaults to pll1_q | 24 | divq: Some(PllDiv::DIV8), // SPI1 cksel defaults to pll1_q |
| 25 | divr: None, | 25 | divr: None, |
| 26 | }); | 26 | }); |
| 27 | config.rcc.pll2 = Some(Pll { | 27 | config.rcc.pll2 = Some(Pll { |
| 28 | prediv: 4, | 28 | prediv: PllPreDiv::DIV4, |
| 29 | mul: 50, | 29 | mul: PllMul::MUL50, |
| 30 | divp: Some(8), // 100mhz | 30 | divp: Some(PllDiv::DIV8), // 100mhz |
| 31 | divq: None, | 31 | divq: None, |
| 32 | divr: None, | 32 | divr: None, |
| 33 | }); | 33 | }); |
| @@ -55,6 +55,6 @@ async fn main(_spawner: Spawner) { | |||
| 55 | info!("vrefint: {}", vrefint); | 55 | info!("vrefint: {}", vrefint); |
| 56 | let measured = adc.read(&mut p.PC0); | 56 | let measured = adc.read(&mut p.PC0); |
| 57 | info!("measured: {}", measured); | 57 | info!("measured: {}", measured); |
| 58 | Timer::after(Duration::from_millis(500)).await; | 58 | Timer::after_millis(500).await; |
| 59 | } | 59 | } |
| 60 | } | 60 | } |
diff --git a/examples/stm32h7/src/bin/blinky.rs b/examples/stm32h7/src/bin/blinky.rs index 12f08c0fd..a9cab1ff4 100644 --- a/examples/stm32h7/src/bin/blinky.rs +++ b/examples/stm32h7/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(500)).await; | 25 | Timer::after_millis(500).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32h7/src/bin/camera.rs b/examples/stm32h7/src/bin/camera.rs index de8ddc292..8195430b2 100644 --- a/examples/stm32h7/src/bin/camera.rs +++ b/examples/stm32h7/src/bin/camera.rs | |||
| @@ -6,10 +6,10 @@ use embassy_executor::Spawner; | |||
| 6 | use embassy_stm32::dcmi::{self, *}; | 6 | use embassy_stm32::dcmi::{self, *}; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_stm32::i2c::I2c; | 8 | use embassy_stm32::i2c::I2c; |
| 9 | use embassy_stm32::rcc::{Mco, Mco1Source}; | 9 | use embassy_stm32::rcc::{Mco, Mco1Source, McoPrescaler}; |
| 10 | use embassy_stm32::time::khz; | 10 | use embassy_stm32::time::khz; |
| 11 | use embassy_stm32::{bind_interrupts, i2c, peripherals, Config}; | 11 | use embassy_stm32::{bind_interrupts, i2c, peripherals, Config}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use ov7725::*; | 13 | use ov7725::*; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| @@ -32,10 +32,10 @@ async fn main(_spawner: Spawner) { | |||
| 32 | config.rcc.csi = true; | 32 | config.rcc.csi = true; |
| 33 | config.rcc.pll_src = PllSource::Hsi; | 33 | config.rcc.pll_src = PllSource::Hsi; |
| 34 | config.rcc.pll1 = Some(Pll { | 34 | config.rcc.pll1 = Some(Pll { |
| 35 | prediv: 4, | 35 | prediv: PllPreDiv::DIV4, |
| 36 | mul: 50, | 36 | mul: PllMul::MUL50, |
| 37 | divp: Some(2), | 37 | divp: Some(PllDiv::DIV2), |
| 38 | divq: Some(8), // 100mhz | 38 | divq: Some(PllDiv::DIV8), // 100mhz |
| 39 | divr: None, | 39 | divr: None, |
| 40 | }); | 40 | }); |
| 41 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 41 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
| @@ -49,7 +49,7 @@ async fn main(_spawner: Spawner) { | |||
| 49 | let p = embassy_stm32::init(config); | 49 | let p = embassy_stm32::init(config); |
| 50 | 50 | ||
| 51 | defmt::info!("Hello World!"); | 51 | defmt::info!("Hello World!"); |
| 52 | let mco = Mco::new(p.MCO1, p.PA8, Mco1Source::HSI, 3); | 52 | let mco = Mco::new(p.MCO1, p.PA8, Mco1Source::HSI, McoPrescaler::DIV3); |
| 53 | 53 | ||
| 54 | let mut led = Output::new(p.PE3, Level::High, Speed::Low); | 54 | let mut led = Output::new(p.PE3, Level::High, Speed::Low); |
| 55 | let cam_i2c = I2c::new( | 55 | let cam_i2c = I2c::new( |
| @@ -86,11 +86,11 @@ async fn main(_spawner: Spawner) { | |||
| 86 | loop { | 86 | loop { |
| 87 | defmt::info!("high"); | 87 | defmt::info!("high"); |
| 88 | led.set_high(); | 88 | led.set_high(); |
| 89 | Timer::after(Duration::from_millis(500)).await; | 89 | Timer::after_millis(500).await; |
| 90 | 90 | ||
| 91 | defmt::info!("low"); | 91 | defmt::info!("low"); |
| 92 | led.set_low(); | 92 | led.set_low(); |
| 93 | Timer::after(Duration::from_millis(500)).await; | 93 | Timer::after_millis(500).await; |
| 94 | } | 94 | } |
| 95 | } | 95 | } |
| 96 | 96 | ||
| @@ -99,7 +99,7 @@ mod ov7725 { | |||
| 99 | 99 | ||
| 100 | use defmt::Format; | 100 | use defmt::Format; |
| 101 | use embassy_stm32::rcc::{Mco, McoInstance}; | 101 | use embassy_stm32::rcc::{Mco, McoInstance}; |
| 102 | use embassy_time::{Duration, Timer}; | 102 | use embassy_time::Timer; |
| 103 | use embedded_hal_async::i2c::I2c; | 103 | use embedded_hal_async::i2c::I2c; |
| 104 | 104 | ||
| 105 | #[repr(u8)] | 105 | #[repr(u8)] |
| @@ -184,7 +184,7 @@ mod ov7725 { | |||
| 184 | 184 | ||
| 185 | const CAM_ADDR: u8 = 0x21; | 185 | const CAM_ADDR: u8 = 0x21; |
| 186 | 186 | ||
| 187 | #[derive(Format)] | 187 | #[derive(Format, PartialEq, Eq)] |
| 188 | pub enum Error<I2cError: Format> { | 188 | pub enum Error<I2cError: Format> { |
| 189 | I2c(I2cError), | 189 | I2c(I2cError), |
| 190 | } | 190 | } |
| @@ -210,9 +210,9 @@ mod ov7725 { | |||
| 210 | } | 210 | } |
| 211 | 211 | ||
| 212 | pub async fn init(&mut self) -> Result<(), Error<Bus::Error>> { | 212 | pub async fn init(&mut self) -> Result<(), Error<Bus::Error>> { |
| 213 | Timer::after(Duration::from_millis(500)).await; | 213 | Timer::after_millis(500).await; |
| 214 | self.reset_regs().await?; | 214 | self.reset_regs().await?; |
| 215 | Timer::after(Duration::from_millis(500)).await; | 215 | Timer::after_millis(500).await; |
| 216 | self.set_pixformat().await?; | 216 | self.set_pixformat().await?; |
| 217 | self.set_resolution().await?; | 217 | self.set_resolution().await?; |
| 218 | Ok(()) | 218 | Ok(()) |
diff --git a/examples/stm32h7/src/bin/dac.rs b/examples/stm32h7/src/bin/dac.rs index 93df7a319..821221897 100644 --- a/examples/stm32h7/src/bin/dac.rs +++ b/examples/stm32h7/src/bin/dac.rs | |||
| @@ -20,16 +20,16 @@ fn main() -> ! { | |||
| 20 | config.rcc.csi = true; | 20 | config.rcc.csi = true; |
| 21 | config.rcc.pll_src = PllSource::Hsi; | 21 | config.rcc.pll_src = PllSource::Hsi; |
| 22 | config.rcc.pll1 = Some(Pll { | 22 | config.rcc.pll1 = Some(Pll { |
| 23 | prediv: 4, | 23 | prediv: PllPreDiv::DIV4, |
| 24 | mul: 50, | 24 | mul: PllMul::MUL50, |
| 25 | divp: Some(2), | 25 | divp: Some(PllDiv::DIV2), |
| 26 | divq: Some(8), // SPI1 cksel defaults to pll1_q | 26 | divq: Some(PllDiv::DIV8), // 100mhz |
| 27 | divr: None, | 27 | divr: None, |
| 28 | }); | 28 | }); |
| 29 | config.rcc.pll2 = Some(Pll { | 29 | config.rcc.pll2 = Some(Pll { |
| 30 | prediv: 4, | 30 | prediv: PllPreDiv::DIV4, |
| 31 | mul: 50, | 31 | mul: PllMul::MUL50, |
| 32 | divp: Some(8), // 100mhz | 32 | divp: Some(PllDiv::DIV8), // 100mhz |
| 33 | divq: None, | 33 | divq: None, |
| 34 | divr: None, | 34 | divr: None, |
| 35 | }); | 35 | }); |
diff --git a/examples/stm32h7/src/bin/dac_dma.rs b/examples/stm32h7/src/bin/dac_dma.rs index 8c921abca..334986a05 100644 --- a/examples/stm32h7/src/bin/dac_dma.rs +++ b/examples/stm32h7/src/bin/dac_dma.rs | |||
| @@ -28,16 +28,16 @@ async fn main(spawner: Spawner) { | |||
| 28 | config.rcc.csi = true; | 28 | config.rcc.csi = true; |
| 29 | config.rcc.pll_src = PllSource::Hsi; | 29 | config.rcc.pll_src = PllSource::Hsi; |
| 30 | config.rcc.pll1 = Some(Pll { | 30 | config.rcc.pll1 = Some(Pll { |
| 31 | prediv: 4, | 31 | prediv: PllPreDiv::DIV4, |
| 32 | mul: 50, | 32 | mul: PllMul::MUL50, |
| 33 | divp: Some(2), | 33 | divp: Some(PllDiv::DIV2), |
| 34 | divq: Some(8), // SPI1 cksel defaults to pll1_q | 34 | divq: Some(PllDiv::DIV8), // 100mhz |
| 35 | divr: None, | 35 | divr: None, |
| 36 | }); | 36 | }); |
| 37 | config.rcc.pll2 = Some(Pll { | 37 | config.rcc.pll2 = Some(Pll { |
| 38 | prediv: 4, | 38 | prediv: PllPreDiv::DIV4, |
| 39 | mul: 50, | 39 | mul: PllMul::MUL50, |
| 40 | divp: Some(8), // 100mhz | 40 | divp: Some(PllDiv::DIV8), // 100mhz |
| 41 | divq: None, | 41 | divq: None, |
| 42 | divr: None, | 42 | divr: None, |
| 43 | }); | 43 | }); |
| @@ -79,7 +79,7 @@ async fn dac_task1(mut dac: Dac1Type) { | |||
| 79 | dac.select_trigger(embassy_stm32::dac::Ch1Trigger::Tim6).unwrap(); | 79 | dac.select_trigger(embassy_stm32::dac::Ch1Trigger::Tim6).unwrap(); |
| 80 | dac.enable_channel().unwrap(); | 80 | dac.enable_channel().unwrap(); |
| 81 | 81 | ||
| 82 | TIM6::enable(); | 82 | TIM6::enable_and_reset(); |
| 83 | TIM6::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); | 83 | TIM6::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); |
| 84 | TIM6::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); | 84 | TIM6::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); |
| 85 | TIM6::regs().cr1().modify(|w| { | 85 | TIM6::regs().cr1().modify(|w| { |
| @@ -118,7 +118,7 @@ async fn dac_task2(mut dac: Dac2Type) { | |||
| 118 | error!("Reload value {} below threshold!", reload); | 118 | error!("Reload value {} below threshold!", reload); |
| 119 | } | 119 | } |
| 120 | 120 | ||
| 121 | TIM7::enable(); | 121 | TIM7::enable_and_reset(); |
| 122 | TIM7::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); | 122 | TIM7::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); |
| 123 | TIM7::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); | 123 | TIM7::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); |
| 124 | TIM7::regs().cr1().modify(|w| { | 124 | TIM7::regs().cr1().modify(|w| { |
diff --git a/examples/stm32h7/src/bin/eth.rs b/examples/stm32h7/src/bin/eth.rs index 1b5d71ed3..81d9c7347 100644 --- a/examples/stm32h7/src/bin/eth.rs +++ b/examples/stm32h7/src/bin/eth.rs | |||
| @@ -11,7 +11,7 @@ use embassy_stm32::eth::{Ethernet, PacketQueue}; | |||
| 11 | use embassy_stm32::peripherals::ETH; | 11 | use embassy_stm32::peripherals::ETH; |
| 12 | use embassy_stm32::rng::Rng; | 12 | use embassy_stm32::rng::Rng; |
| 13 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; | 13 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; |
| 14 | use embassy_time::{Duration, Timer}; | 14 | use embassy_time::Timer; |
| 15 | use embedded_io_async::Write; | 15 | use embedded_io_async::Write; |
| 16 | use rand_core::RngCore; | 16 | use rand_core::RngCore; |
| 17 | use static_cell::make_static; | 17 | use static_cell::make_static; |
| @@ -39,9 +39,9 @@ async fn main(spawner: Spawner) -> ! { | |||
| 39 | config.rcc.hsi48 = true; // needed for RNG | 39 | config.rcc.hsi48 = true; // needed for RNG |
| 40 | config.rcc.pll_src = PllSource::Hsi; | 40 | config.rcc.pll_src = PllSource::Hsi; |
| 41 | config.rcc.pll1 = Some(Pll { | 41 | config.rcc.pll1 = Some(Pll { |
| 42 | prediv: 4, | 42 | prediv: PllPreDiv::DIV4, |
| 43 | mul: 50, | 43 | mul: PllMul::MUL50, |
| 44 | divp: Some(2), | 44 | divp: Some(PllDiv::DIV2), |
| 45 | divq: None, | 45 | divq: None, |
| 46 | divr: None, | 46 | divr: None, |
| 47 | }); | 47 | }); |
| @@ -77,9 +77,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 77 | p.PG13, | 77 | p.PG13, |
| 78 | p.PB13, | 78 | p.PB13, |
| 79 | p.PG11, | 79 | p.PG11, |
| 80 | GenericSMI::new(), | 80 | GenericSMI::new(0), |
| 81 | mac_addr, | 81 | mac_addr, |
| 82 | 0, | ||
| 83 | ); | 82 | ); |
| 84 | 83 | ||
| 85 | let config = embassy_net::Config::dhcpv4(Default::default()); | 84 | let config = embassy_net::Config::dhcpv4(Default::default()); |
| @@ -119,7 +118,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 119 | let r = socket.connect(remote_endpoint).await; | 118 | let r = socket.connect(remote_endpoint).await; |
| 120 | if let Err(e) = r { | 119 | if let Err(e) = r { |
| 121 | info!("connect error: {:?}", e); | 120 | info!("connect error: {:?}", e); |
| 122 | Timer::after(Duration::from_secs(1)).await; | 121 | Timer::after_secs(1).await; |
| 123 | continue; | 122 | continue; |
| 124 | } | 123 | } |
| 125 | info!("connected!"); | 124 | info!("connected!"); |
| @@ -129,7 +128,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 129 | info!("write error: {:?}", e); | 128 | info!("write error: {:?}", e); |
| 130 | break; | 129 | break; |
| 131 | } | 130 | } |
| 132 | Timer::after(Duration::from_secs(1)).await; | 131 | Timer::after_secs(1).await; |
| 133 | } | 132 | } |
| 134 | } | 133 | } |
| 135 | } | 134 | } |
diff --git a/examples/stm32h7/src/bin/eth_client.rs b/examples/stm32h7/src/bin/eth_client.rs index 3abd31c73..338137069 100644 --- a/examples/stm32h7/src/bin/eth_client.rs +++ b/examples/stm32h7/src/bin/eth_client.rs | |||
| @@ -11,7 +11,7 @@ use embassy_stm32::eth::{Ethernet, PacketQueue}; | |||
| 11 | use embassy_stm32::peripherals::ETH; | 11 | use embassy_stm32::peripherals::ETH; |
| 12 | use embassy_stm32::rng::Rng; | 12 | use embassy_stm32::rng::Rng; |
| 13 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; | 13 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng, Config}; |
| 14 | use embassy_time::{Duration, Timer}; | 14 | use embassy_time::Timer; |
| 15 | use embedded_io_async::Write; | 15 | use embedded_io_async::Write; |
| 16 | use embedded_nal_async::{Ipv4Addr, SocketAddr, SocketAddrV4, TcpConnect}; | 16 | use embedded_nal_async::{Ipv4Addr, SocketAddr, SocketAddrV4, TcpConnect}; |
| 17 | use rand_core::RngCore; | 17 | use rand_core::RngCore; |
| @@ -40,9 +40,9 @@ async fn main(spawner: Spawner) -> ! { | |||
| 40 | config.rcc.hsi48 = true; // needed for RNG | 40 | config.rcc.hsi48 = true; // needed for RNG |
| 41 | config.rcc.pll_src = PllSource::Hsi; | 41 | config.rcc.pll_src = PllSource::Hsi; |
| 42 | config.rcc.pll1 = Some(Pll { | 42 | config.rcc.pll1 = Some(Pll { |
| 43 | prediv: 4, | 43 | prediv: PllPreDiv::DIV4, |
| 44 | mul: 50, | 44 | mul: PllMul::MUL50, |
| 45 | divp: Some(2), | 45 | divp: Some(PllDiv::DIV2), |
| 46 | divq: None, | 46 | divq: None, |
| 47 | divr: None, | 47 | divr: None, |
| 48 | }); | 48 | }); |
| @@ -78,9 +78,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 78 | p.PG13, | 78 | p.PG13, |
| 79 | p.PB13, | 79 | p.PB13, |
| 80 | p.PG11, | 80 | p.PG11, |
| 81 | GenericSMI::new(), | 81 | GenericSMI::new(0), |
| 82 | mac_addr, | 82 | mac_addr, |
| 83 | 0, | ||
| 84 | ); | 83 | ); |
| 85 | 84 | ||
| 86 | let config = embassy_net::Config::dhcpv4(Default::default()); | 85 | let config = embassy_net::Config::dhcpv4(Default::default()); |
| @@ -106,8 +105,8 @@ async fn main(spawner: Spawner) -> ! { | |||
| 106 | 105 | ||
| 107 | info!("Network task initialized"); | 106 | info!("Network task initialized"); |
| 108 | 107 | ||
| 109 | static STATE: TcpClientState<1, 1024, 1024> = TcpClientState::new(); | 108 | let state: TcpClientState<1, 1024, 1024> = TcpClientState::new(); |
| 110 | let client = TcpClient::new(&stack, &STATE); | 109 | let client = TcpClient::new(&stack, &state); |
| 111 | 110 | ||
| 112 | loop { | 111 | loop { |
| 113 | let addr = SocketAddr::V4(SocketAddrV4::new(Ipv4Addr::new(10, 42, 0, 1), 8000)); | 112 | let addr = SocketAddr::V4(SocketAddrV4::new(Ipv4Addr::new(10, 42, 0, 1), 8000)); |
| @@ -116,7 +115,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 116 | let r = client.connect(addr).await; | 115 | let r = client.connect(addr).await; |
| 117 | if let Err(e) = r { | 116 | if let Err(e) = r { |
| 118 | info!("connect error: {:?}", e); | 117 | info!("connect error: {:?}", e); |
| 119 | Timer::after(Duration::from_secs(1)).await; | 118 | Timer::after_secs(1).await; |
| 120 | continue; | 119 | continue; |
| 121 | } | 120 | } |
| 122 | let mut connection = r.unwrap(); | 121 | let mut connection = r.unwrap(); |
| @@ -127,7 +126,7 @@ async fn main(spawner: Spawner) -> ! { | |||
| 127 | info!("write error: {:?}", e); | 126 | info!("write error: {:?}", e); |
| 128 | break; | 127 | break; |
| 129 | } | 128 | } |
| 130 | Timer::after(Duration::from_secs(1)).await; | 129 | Timer::after_secs(1).await; |
| 131 | } | 130 | } |
| 132 | } | 131 | } |
| 133 | } | 132 | } |
diff --git a/examples/stm32h7/src/bin/flash.rs b/examples/stm32h7/src/bin/flash.rs index f66df770b..89c0c8a66 100644 --- a/examples/stm32h7/src/bin/flash.rs +++ b/examples/stm32h7/src/bin/flash.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::{info, unwrap}; | 5 | use defmt::{info, unwrap}; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::flash::Flash; | 7 | use embassy_stm32::flash::Flash; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -16,7 +16,7 @@ async fn main(_spawner: Spawner) { | |||
| 16 | const ADDR: u32 = 0; // This is the offset into bank 2, the absolute address is 0x8_0000 | 16 | const ADDR: u32 = 0; // This is the offset into bank 2, the absolute address is 0x8_0000 |
| 17 | 17 | ||
| 18 | // wait a bit before accessing the flash | 18 | // wait a bit before accessing the flash |
| 19 | Timer::after(Duration::from_millis(300)).await; | 19 | Timer::after_millis(300).await; |
| 20 | 20 | ||
| 21 | let mut f = Flash::new_blocking(p.FLASH).into_blocking_regions().bank2_region; | 21 | let mut f = Flash::new_blocking(p.FLASH).into_blocking_regions().bank2_region; |
| 22 | 22 | ||
diff --git a/examples/stm32h7/src/bin/fmc.rs b/examples/stm32h7/src/bin/fmc.rs index de0b351df..cffd47093 100644 --- a/examples/stm32h7/src/bin/fmc.rs +++ b/examples/stm32h7/src/bin/fmc.rs | |||
| @@ -6,7 +6,7 @@ use defmt::*; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::fmc::Fmc; | 7 | use embassy_stm32::fmc::Fmc; |
| 8 | use embassy_stm32::Config; | 8 | use embassy_stm32::Config; |
| 9 | use embassy_time::{Delay, Duration, Timer}; | 9 | use embassy_time::{Delay, Timer}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | config.rcc.csi = true; | 18 | config.rcc.csi = true; |
| 19 | config.rcc.pll_src = PllSource::Hsi; | 19 | config.rcc.pll_src = PllSource::Hsi; |
| 20 | config.rcc.pll1 = Some(Pll { | 20 | config.rcc.pll1 = Some(Pll { |
| 21 | prediv: 4, | 21 | prediv: PllPreDiv::DIV4, |
| 22 | mul: 50, | 22 | mul: PllMul::MUL50, |
| 23 | divp: Some(2), | 23 | divp: Some(PllDiv::DIV2), |
| 24 | divq: Some(8), // 100mhz | 24 | divq: Some(PllDiv::DIV8), // 100mhz |
| 25 | divr: None, | 25 | divr: None, |
| 26 | }); | 26 | }); |
| 27 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 27 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
| @@ -212,6 +212,6 @@ async fn main(_spawner: Spawner) { | |||
| 212 | info!("Assertions succeeded."); | 212 | info!("Assertions succeeded."); |
| 213 | 213 | ||
| 214 | loop { | 214 | loop { |
| 215 | Timer::after(Duration::from_millis(1000)).await; | 215 | Timer::after_millis(1000).await; |
| 216 | } | 216 | } |
| 217 | } | 217 | } |
diff --git a/examples/stm32h7/src/bin/i2c.rs b/examples/stm32h7/src/bin/i2c.rs index c2979c59b..9aa0ca08b 100644 --- a/examples/stm32h7/src/bin/i2c.rs +++ b/examples/stm32h7/src/bin/i2c.rs | |||
| @@ -4,10 +4,9 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::i2c::{Error, I2c, TimeoutI2c}; | 7 | use embassy_stm32::i2c::{Error, I2c}; |
| 8 | use embassy_stm32::time::Hertz; | 8 | use embassy_stm32::time::Hertz; |
| 9 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; | 9 | use embassy_stm32::{bind_interrupts, i2c, peripherals}; |
| 10 | use embassy_time::Duration; | ||
| 11 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 11 | ||
| 13 | const ADDRESS: u8 = 0x5F; | 12 | const ADDRESS: u8 = 0x5F; |
| @@ -33,13 +32,9 @@ async fn main(_spawner: Spawner) { | |||
| 33 | Default::default(), | 32 | Default::default(), |
| 34 | ); | 33 | ); |
| 35 | 34 | ||
| 36 | // I2C bus can freeze if SCL line is shorted or due to a broken device that clock stretches for too long. | ||
| 37 | // TimeoutI2c allows recovering from such errors by throwing `Error::Timeout` after a given delay. | ||
| 38 | let mut timeout_i2c = TimeoutI2c::new(&mut i2c, Duration::from_millis(1000)); | ||
| 39 | |||
| 40 | let mut data = [0u8; 1]; | 35 | let mut data = [0u8; 1]; |
| 41 | 36 | ||
| 42 | match timeout_i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { | 37 | match i2c.blocking_write_read(ADDRESS, &[WHOAMI], &mut data) { |
| 43 | Ok(()) => info!("Whoami: {}", data[0]), | 38 | Ok(()) => info!("Whoami: {}", data[0]), |
| 44 | Err(Error::Timeout) => error!("Operation timed out"), | 39 | Err(Error::Timeout) => error!("Operation timed out"), |
| 45 | Err(e) => error!("I2c Error: {:?}", e), | 40 | Err(e) => error!("I2c Error: {:?}", e), |
diff --git a/examples/stm32h7/src/bin/low_level_timer_api.rs b/examples/stm32h7/src/bin/low_level_timer_api.rs index a1e955c39..0355ac073 100644 --- a/examples/stm32h7/src/bin/low_level_timer_api.rs +++ b/examples/stm32h7/src/bin/low_level_timer_api.rs | |||
| @@ -9,7 +9,7 @@ use embassy_stm32::gpio::Speed; | |||
| 9 | use embassy_stm32::time::{khz, Hertz}; | 9 | use embassy_stm32::time::{khz, Hertz}; |
| 10 | use embassy_stm32::timer::*; | 10 | use embassy_stm32::timer::*; |
| 11 | use embassy_stm32::{into_ref, Config, Peripheral, PeripheralRef}; | 11 | use embassy_stm32::{into_ref, Config, Peripheral, PeripheralRef}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| @@ -22,10 +22,10 @@ async fn main(_spawner: Spawner) { | |||
| 22 | config.rcc.hsi48 = true; // needed for RNG | 22 | config.rcc.hsi48 = true; // needed for RNG |
| 23 | config.rcc.pll_src = PllSource::Hsi; | 23 | config.rcc.pll_src = PllSource::Hsi; |
| 24 | config.rcc.pll1 = Some(Pll { | 24 | config.rcc.pll1 = Some(Pll { |
| 25 | prediv: 4, | 25 | prediv: PllPreDiv::DIV4, |
| 26 | mul: 50, | 26 | mul: PllMul::MUL50, |
| 27 | divp: Some(2), | 27 | divp: Some(PllDiv::DIV2), |
| 28 | divq: Some(8), // 100 Mhz | 28 | divq: Some(PllDiv::DIV8), // 100mhz |
| 29 | divr: None, | 29 | divr: None, |
| 30 | }); | 30 | }); |
| 31 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 31 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
| @@ -49,13 +49,13 @@ async fn main(_spawner: Spawner) { | |||
| 49 | 49 | ||
| 50 | loop { | 50 | loop { |
| 51 | pwm.set_duty(Channel::Ch1, 0); | 51 | pwm.set_duty(Channel::Ch1, 0); |
| 52 | Timer::after(Duration::from_millis(300)).await; | 52 | Timer::after_millis(300).await; |
| 53 | pwm.set_duty(Channel::Ch1, max / 4); | 53 | pwm.set_duty(Channel::Ch1, max / 4); |
| 54 | Timer::after(Duration::from_millis(300)).await; | 54 | Timer::after_millis(300).await; |
| 55 | pwm.set_duty(Channel::Ch1, max / 2); | 55 | pwm.set_duty(Channel::Ch1, max / 2); |
| 56 | Timer::after(Duration::from_millis(300)).await; | 56 | Timer::after_millis(300).await; |
| 57 | pwm.set_duty(Channel::Ch1, max - 1); | 57 | pwm.set_duty(Channel::Ch1, max - 1); |
| 58 | Timer::after(Duration::from_millis(300)).await; | 58 | Timer::after_millis(300).await; |
| 59 | } | 59 | } |
| 60 | } | 60 | } |
| 61 | pub struct SimplePwm32<'d, T: CaptureCompare32bitInstance> { | 61 | pub struct SimplePwm32<'d, T: CaptureCompare32bitInstance> { |
| @@ -73,8 +73,7 @@ impl<'d, T: CaptureCompare32bitInstance> SimplePwm32<'d, T> { | |||
| 73 | ) -> Self { | 73 | ) -> Self { |
| 74 | into_ref!(tim, ch1, ch2, ch3, ch4); | 74 | into_ref!(tim, ch1, ch2, ch3, ch4); |
| 75 | 75 | ||
| 76 | T::enable(); | 76 | T::enable_and_reset(); |
| 77 | <T as embassy_stm32::rcc::low_level::RccPeripheral>::reset(); | ||
| 78 | 77 | ||
| 79 | ch1.set_speed(Speed::VeryHigh); | 78 | ch1.set_speed(Speed::VeryHigh); |
| 80 | ch1.set_as_af(ch1.af_num(), AFType::OutputPushPull); | 79 | ch1.set_as_af(ch1.af_num(), AFType::OutputPushPull); |
diff --git a/examples/stm32h7/src/bin/mco.rs b/examples/stm32h7/src/bin/mco.rs index 9d6d805ae..c023f4584 100644 --- a/examples/stm32h7/src/bin/mco.rs +++ b/examples/stm32h7/src/bin/mco.rs | |||
| @@ -5,8 +5,8 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_stm32::rcc::{Mco, Mco1Source}; | 8 | use embassy_stm32::rcc::{Mco, Mco1Source, McoPrescaler}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -16,15 +16,15 @@ async fn main(_spawner: Spawner) { | |||
| 16 | 16 | ||
| 17 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); | 17 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); |
| 18 | 18 | ||
| 19 | let _mco = Mco::new(p.MCO1, p.PA8, Mco1Source::HSI, 8); | 19 | let _mco = Mco::new(p.MCO1, p.PA8, Mco1Source::HSI, McoPrescaler::DIV8); |
| 20 | 20 | ||
| 21 | loop { | 21 | loop { |
| 22 | info!("high"); | 22 | info!("high"); |
| 23 | led.set_high(); | 23 | led.set_high(); |
| 24 | Timer::after(Duration::from_millis(500)).await; | 24 | Timer::after_millis(500).await; |
| 25 | 25 | ||
| 26 | info!("low"); | 26 | info!("low"); |
| 27 | led.set_low(); | 27 | led.set_low(); |
| 28 | Timer::after(Duration::from_millis(500)).await; | 28 | Timer::after_millis(500).await; |
| 29 | } | 29 | } |
| 30 | } | 30 | } |
diff --git a/examples/stm32h7/src/bin/pwm.rs b/examples/stm32h7/src/bin/pwm.rs index 84e7df267..973a10cdd 100644 --- a/examples/stm32h7/src/bin/pwm.rs +++ b/examples/stm32h7/src/bin/pwm.rs | |||
| @@ -9,7 +9,7 @@ use embassy_stm32::time::khz; | |||
| 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; | 9 | use embassy_stm32::timer::simple_pwm::{PwmPin, SimplePwm}; |
| 10 | use embassy_stm32::timer::Channel; | 10 | use embassy_stm32::timer::Channel; |
| 11 | use embassy_stm32::Config; | 11 | use embassy_stm32::Config; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| @@ -21,9 +21,9 @@ async fn main(_spawner: Spawner) { | |||
| 21 | config.rcc.csi = true; | 21 | config.rcc.csi = true; |
| 22 | config.rcc.pll_src = PllSource::Hsi; | 22 | config.rcc.pll_src = PllSource::Hsi; |
| 23 | config.rcc.pll1 = Some(Pll { | 23 | config.rcc.pll1 = Some(Pll { |
| 24 | prediv: 4, | 24 | prediv: PllPreDiv::DIV4, |
| 25 | mul: 50, | 25 | mul: PllMul::MUL50, |
| 26 | divp: Some(2), | 26 | divp: Some(PllDiv::DIV2), |
| 27 | divq: None, | 27 | divq: None, |
| 28 | divr: None, | 28 | divr: None, |
| 29 | }); | 29 | }); |
| @@ -48,12 +48,12 @@ async fn main(_spawner: Spawner) { | |||
| 48 | 48 | ||
| 49 | loop { | 49 | loop { |
| 50 | pwm.set_duty(Channel::Ch1, 0); | 50 | pwm.set_duty(Channel::Ch1, 0); |
| 51 | Timer::after(Duration::from_millis(300)).await; | 51 | Timer::after_millis(300).await; |
| 52 | pwm.set_duty(Channel::Ch1, max / 4); | 52 | pwm.set_duty(Channel::Ch1, max / 4); |
| 53 | Timer::after(Duration::from_millis(300)).await; | 53 | Timer::after_millis(300).await; |
| 54 | pwm.set_duty(Channel::Ch1, max / 2); | 54 | pwm.set_duty(Channel::Ch1, max / 2); |
| 55 | Timer::after(Duration::from_millis(300)).await; | 55 | Timer::after_millis(300).await; |
| 56 | pwm.set_duty(Channel::Ch1, max - 1); | 56 | pwm.set_duty(Channel::Ch1, max - 1); |
| 57 | Timer::after(Duration::from_millis(300)).await; | 57 | Timer::after_millis(300).await; |
| 58 | } | 58 | } |
| 59 | } | 59 | } |
diff --git a/examples/stm32h7/src/bin/rtc.rs b/examples/stm32h7/src/bin/rtc.rs new file mode 100644 index 000000000..78cea9c89 --- /dev/null +++ b/examples/stm32h7/src/bin/rtc.rs | |||
| @@ -0,0 +1,37 @@ | |||
| 1 | #![no_std] | ||
| 2 | #![no_main] | ||
| 3 | #![feature(type_alias_impl_trait)] | ||
| 4 | |||
| 5 | use chrono::{NaiveDate, NaiveDateTime}; | ||
| 6 | use defmt::*; | ||
| 7 | use embassy_executor::Spawner; | ||
| 8 | use embassy_stm32::rcc::LsConfig; | ||
| 9 | use embassy_stm32::rtc::{Rtc, RtcConfig}; | ||
| 10 | use embassy_stm32::Config; | ||
| 11 | use embassy_time::Timer; | ||
| 12 | use {defmt_rtt as _, panic_probe as _}; | ||
| 13 | |||
| 14 | #[embassy_executor::main] | ||
| 15 | async fn main(_spawner: Spawner) { | ||
| 16 | let mut config = Config::default(); | ||
| 17 | config.rcc.ls = LsConfig::default_lse(); | ||
| 18 | |||
| 19 | let p = embassy_stm32::init(config); | ||
| 20 | info!("Hello World!"); | ||
| 21 | |||
| 22 | let now = NaiveDate::from_ymd_opt(2020, 5, 15) | ||
| 23 | .unwrap() | ||
| 24 | .and_hms_opt(10, 30, 15) | ||
| 25 | .unwrap(); | ||
| 26 | |||
| 27 | let mut rtc = Rtc::new(p.RTC, RtcConfig::default()); | ||
| 28 | info!("Got RTC! {:?}", now.timestamp()); | ||
| 29 | |||
| 30 | rtc.set_datetime(now.into()).expect("datetime not set"); | ||
| 31 | |||
| 32 | // In reality the delay would be much longer | ||
| 33 | Timer::after_millis(20000).await; | ||
| 34 | |||
| 35 | let then: NaiveDateTime = rtc.now().unwrap().into(); | ||
| 36 | info!("Got RTC! {:?}", then.timestamp()); | ||
| 37 | } | ||
diff --git a/examples/stm32h7/src/bin/sdmmc.rs b/examples/stm32h7/src/bin/sdmmc.rs index 752aefdf7..ecb8d6542 100644 --- a/examples/stm32h7/src/bin/sdmmc.rs +++ b/examples/stm32h7/src/bin/sdmmc.rs | |||
| @@ -22,10 +22,10 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 22 | config.rcc.csi = true; | 22 | config.rcc.csi = true; |
| 23 | config.rcc.pll_src = PllSource::Hsi; | 23 | config.rcc.pll_src = PllSource::Hsi; |
| 24 | config.rcc.pll1 = Some(Pll { | 24 | config.rcc.pll1 = Some(Pll { |
| 25 | prediv: 4, | 25 | prediv: PllPreDiv::DIV4, |
| 26 | mul: 50, | 26 | mul: PllMul::MUL50, |
| 27 | divp: Some(2), | 27 | divp: Some(PllDiv::DIV2), |
| 28 | divq: Some(4), // default clock chosen by SDMMCSEL. 200 Mhz | 28 | divq: Some(PllDiv::DIV4), // default clock chosen by SDMMCSEL. 200 Mhz |
| 29 | divr: None, | 29 | divr: None, |
| 30 | }); | 30 | }); |
| 31 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 31 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
diff --git a/examples/stm32h7/src/bin/signal.rs b/examples/stm32h7/src/bin/signal.rs index 6d7c168d5..b5f583289 100644 --- a/examples/stm32h7/src/bin/signal.rs +++ b/examples/stm32h7/src/bin/signal.rs | |||
| @@ -6,7 +6,7 @@ use defmt::{info, unwrap}; | |||
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; | 7 | use embassy_sync::blocking_mutex::raw::CriticalSectionRawMutex; |
| 8 | use embassy_sync::signal::Signal; | 8 | use embassy_sync::signal::Signal; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | static SIGNAL: Signal<CriticalSectionRawMutex, u32> = Signal::new(); | 12 | static SIGNAL: Signal<CriticalSectionRawMutex, u32> = Signal::new(); |
| @@ -16,7 +16,7 @@ async fn my_sending_task() { | |||
| 16 | let mut counter: u32 = 0; | 16 | let mut counter: u32 = 0; |
| 17 | 17 | ||
| 18 | loop { | 18 | loop { |
| 19 | Timer::after(Duration::from_secs(1)).await; | 19 | Timer::after_secs(1).await; |
| 20 | 20 | ||
| 21 | SIGNAL.signal(counter); | 21 | SIGNAL.signal(counter); |
| 22 | 22 | ||
diff --git a/examples/stm32h7/src/bin/spi.rs b/examples/stm32h7/src/bin/spi.rs index 9fe46f031..f128d4a56 100644 --- a/examples/stm32h7/src/bin/spi.rs +++ b/examples/stm32h7/src/bin/spi.rs | |||
| @@ -44,10 +44,10 @@ fn main() -> ! { | |||
| 44 | config.rcc.csi = true; | 44 | config.rcc.csi = true; |
| 45 | config.rcc.pll_src = PllSource::Hsi; | 45 | config.rcc.pll_src = PllSource::Hsi; |
| 46 | config.rcc.pll1 = Some(Pll { | 46 | config.rcc.pll1 = Some(Pll { |
| 47 | prediv: 4, | 47 | prediv: PllPreDiv::DIV4, |
| 48 | mul: 50, | 48 | mul: PllMul::MUL50, |
| 49 | divp: Some(2), | 49 | divp: Some(PllDiv::DIV2), |
| 50 | divq: Some(4), // used by SPI3. 100Mhz. | 50 | divq: Some(PllDiv::DIV8), // used by SPI3. 100Mhz. |
| 51 | divr: None, | 51 | divr: None, |
| 52 | }); | 52 | }); |
| 53 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 53 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
diff --git a/examples/stm32h7/src/bin/spi_dma.rs b/examples/stm32h7/src/bin/spi_dma.rs index 88d65d5be..d4c0bcdbd 100644 --- a/examples/stm32h7/src/bin/spi_dma.rs +++ b/examples/stm32h7/src/bin/spi_dma.rs | |||
| @@ -40,10 +40,10 @@ fn main() -> ! { | |||
| 40 | config.rcc.csi = true; | 40 | config.rcc.csi = true; |
| 41 | config.rcc.pll_src = PllSource::Hsi; | 41 | config.rcc.pll_src = PllSource::Hsi; |
| 42 | config.rcc.pll1 = Some(Pll { | 42 | config.rcc.pll1 = Some(Pll { |
| 43 | prediv: 4, | 43 | prediv: PllPreDiv::DIV4, |
| 44 | mul: 50, | 44 | mul: PllMul::MUL50, |
| 45 | divp: Some(2), | 45 | divp: Some(PllDiv::DIV2), |
| 46 | divq: Some(4), // used by SPI3. 100Mhz. | 46 | divq: Some(PllDiv::DIV8), // used by SPI3. 100Mhz. |
| 47 | divr: None, | 47 | divr: None, |
| 48 | }); | 48 | }); |
| 49 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz | 49 | config.rcc.sys = Sysclk::Pll1P; // 400 Mhz |
diff --git a/examples/stm32h7/src/bin/usb_serial.rs b/examples/stm32h7/src/bin/usb_serial.rs index 14de43568..c1e5144be 100644 --- a/examples/stm32h7/src/bin/usb_serial.rs +++ b/examples/stm32h7/src/bin/usb_serial.rs | |||
| @@ -28,9 +28,9 @@ async fn main(_spawner: Spawner) { | |||
| 28 | config.rcc.hsi48 = true; // needed for USB | 28 | config.rcc.hsi48 = true; // needed for USB |
| 29 | config.rcc.pll_src = PllSource::Hsi; | 29 | config.rcc.pll_src = PllSource::Hsi; |
| 30 | config.rcc.pll1 = Some(Pll { | 30 | config.rcc.pll1 = Some(Pll { |
| 31 | prediv: 4, | 31 | prediv: PllPreDiv::DIV4, |
| 32 | mul: 50, | 32 | mul: PllMul::MUL50, |
| 33 | divp: Some(2), | 33 | divp: Some(PllDiv::DIV2), |
| 34 | divq: None, | 34 | divq: None, |
| 35 | divr: None, | 35 | divr: None, |
| 36 | }); | 36 | }); |
diff --git a/examples/stm32h7/src/bin/wdg.rs b/examples/stm32h7/src/bin/wdg.rs index 9181dfd67..76fd9dfc0 100644 --- a/examples/stm32h7/src/bin/wdg.rs +++ b/examples/stm32h7/src/bin/wdg.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::wdg::IndependentWatchdog; | 7 | use embassy_stm32::wdg::IndependentWatchdog; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,7 +18,7 @@ async fn main(_spawner: Spawner) { | |||
| 18 | wdg.unleash(); | 18 | wdg.unleash(); |
| 19 | 19 | ||
| 20 | loop { | 20 | loop { |
| 21 | Timer::after(Duration::from_secs(1)).await; | 21 | Timer::after_secs(1).await; |
| 22 | wdg.pet(); | 22 | wdg.pet(); |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/stm32l0/Cargo.toml b/examples/stm32l0/Cargo.toml index 502ebfc8d..03b6d600b 100644 --- a/examples/stm32l0/Cargo.toml +++ b/examples/stm32l0/Cargo.toml | |||
| @@ -14,7 +14,7 @@ nightly = ["embassy-stm32/nightly", "embassy-time/nightly", "embassy-time/unstab | |||
| 14 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["defmt", "stm32l072cz", "time-driver-any", "exti", "unstable-traits", "memory-x"] } | 14 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["defmt", "stm32l072cz", "time-driver-any", "exti", "unstable-traits", "memory-x"] } |
| 15 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 15 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 16 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 16 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 17 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 17 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 18 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["time", "defmt"], optional = true } | 18 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["time", "defmt"], optional = true } |
| 19 | lora-phy = { version = "2", optional = true } | 19 | lora-phy = { version = "2", optional = true } |
| 20 | lorawan-device = { version = "0.11.0", default-features = false, features = ["async", "external-lora-phy"], optional = true } | 20 | lorawan-device = { version = "0.11.0", default-features = false, features = ["async", "external-lora-phy"], optional = true } |
| @@ -24,8 +24,8 @@ defmt = "0.3" | |||
| 24 | defmt-rtt = "0.4" | 24 | defmt-rtt = "0.4" |
| 25 | 25 | ||
| 26 | embedded-storage = "0.3.0" | 26 | embedded-storage = "0.3.0" |
| 27 | embedded-io = { version = "0.5.0" } | 27 | embedded-io = { version = "0.6.0" } |
| 28 | embedded-io-async = { version = "0.5.0", optional = true } | 28 | embedded-io-async = { version = "0.6.0", optional = true } |
| 29 | 29 | ||
| 30 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } | 30 | cortex-m = { version = "0.7.6", features = ["inline-asm", "critical-section-single-core"] } |
| 31 | cortex-m-rt = "0.7.0" | 31 | cortex-m-rt = "0.7.0" |
diff --git a/examples/stm32l0/src/bin/blinky.rs b/examples/stm32l0/src/bin/blinky.rs index 07fad07c6..ea40bfc48 100644 --- a/examples/stm32l0/src/bin/blinky.rs +++ b/examples/stm32l0/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(300)).await; | 21 | Timer::after_millis(300).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32l0/src/bin/lora_cad.rs b/examples/stm32l0/src/bin/lora_cad.rs index 900848fd8..987cdba01 100644 --- a/examples/stm32l0/src/bin/lora_cad.rs +++ b/examples/stm32l0/src/bin/lora_cad.rs | |||
| @@ -12,7 +12,7 @@ use embassy_stm32::exti::{Channel, ExtiInput}; | |||
| 12 | use embassy_stm32::gpio::{Input, Level, Output, Pin, Pull, Speed}; | 12 | use embassy_stm32::gpio::{Input, Level, Output, Pin, Pull, Speed}; |
| 13 | use embassy_stm32::spi; | 13 | use embassy_stm32::spi; |
| 14 | use embassy_stm32::time::khz; | 14 | use embassy_stm32::time::khz; |
| 15 | use embassy_time::{Delay, Duration, Timer}; | 15 | use embassy_time::{Delay, Timer}; |
| 16 | use lora_phy::mod_params::*; | 16 | use lora_phy::mod_params::*; |
| 17 | use lora_phy::sx1276_7_8_9::SX1276_7_8_9; | 17 | use lora_phy::sx1276_7_8_9::SX1276_7_8_9; |
| 18 | use lora_phy::LoRa; | 18 | use lora_phy::LoRa; |
| @@ -55,7 +55,7 @@ async fn main(_spawner: Spawner) { | |||
| 55 | let mut start_indicator = Output::new(p.PB6, Level::Low, Speed::Low); | 55 | let mut start_indicator = Output::new(p.PB6, Level::Low, Speed::Low); |
| 56 | 56 | ||
| 57 | start_indicator.set_high(); | 57 | start_indicator.set_high(); |
| 58 | Timer::after(Duration::from_secs(5)).await; | 58 | Timer::after_secs(5).await; |
| 59 | start_indicator.set_low(); | 59 | start_indicator.set_low(); |
| 60 | 60 | ||
| 61 | let mdltn_params = { | 61 | let mdltn_params = { |
| @@ -89,7 +89,7 @@ async fn main(_spawner: Spawner) { | |||
| 89 | info!("cad successful without activity detected") | 89 | info!("cad successful without activity detected") |
| 90 | } | 90 | } |
| 91 | debug_indicator.set_high(); | 91 | debug_indicator.set_high(); |
| 92 | Timer::after(Duration::from_secs(5)).await; | 92 | Timer::after_secs(5).await; |
| 93 | debug_indicator.set_low(); | 93 | debug_indicator.set_low(); |
| 94 | } | 94 | } |
| 95 | Err(err) => info!("cad unsuccessful = {}", err), | 95 | Err(err) => info!("cad unsuccessful = {}", err), |
diff --git a/examples/stm32l0/src/bin/lora_p2p_receive.rs b/examples/stm32l0/src/bin/lora_p2p_receive.rs index edd14bb81..06e2744a4 100644 --- a/examples/stm32l0/src/bin/lora_p2p_receive.rs +++ b/examples/stm32l0/src/bin/lora_p2p_receive.rs | |||
| @@ -12,7 +12,7 @@ use embassy_stm32::exti::{Channel, ExtiInput}; | |||
| 12 | use embassy_stm32::gpio::{Input, Level, Output, Pin, Pull, Speed}; | 12 | use embassy_stm32::gpio::{Input, Level, Output, Pin, Pull, Speed}; |
| 13 | use embassy_stm32::spi; | 13 | use embassy_stm32::spi; |
| 14 | use embassy_stm32::time::khz; | 14 | use embassy_stm32::time::khz; |
| 15 | use embassy_time::{Delay, Duration, Timer}; | 15 | use embassy_time::{Delay, Timer}; |
| 16 | use lora_phy::mod_params::*; | 16 | use lora_phy::mod_params::*; |
| 17 | use lora_phy::sx1276_7_8_9::SX1276_7_8_9; | 17 | use lora_phy::sx1276_7_8_9::SX1276_7_8_9; |
| 18 | use lora_phy::LoRa; | 18 | use lora_phy::LoRa; |
| @@ -55,7 +55,7 @@ async fn main(_spawner: Spawner) { | |||
| 55 | let mut start_indicator = Output::new(p.PB6, Level::Low, Speed::Low); | 55 | let mut start_indicator = Output::new(p.PB6, Level::Low, Speed::Low); |
| 56 | 56 | ||
| 57 | start_indicator.set_high(); | 57 | start_indicator.set_high(); |
| 58 | Timer::after(Duration::from_secs(5)).await; | 58 | Timer::after_secs(5).await; |
| 59 | start_indicator.set_low(); | 59 | start_indicator.set_low(); |
| 60 | 60 | ||
| 61 | let mut receiving_buffer = [00u8; 100]; | 61 | let mut receiving_buffer = [00u8; 100]; |
| @@ -107,7 +107,7 @@ async fn main(_spawner: Spawner) { | |||
| 107 | { | 107 | { |
| 108 | info!("rx successful"); | 108 | info!("rx successful"); |
| 109 | debug_indicator.set_high(); | 109 | debug_indicator.set_high(); |
| 110 | Timer::after(Duration::from_secs(5)).await; | 110 | Timer::after_secs(5).await; |
| 111 | debug_indicator.set_low(); | 111 | debug_indicator.set_low(); |
| 112 | } else { | 112 | } else { |
| 113 | info!("rx unknown packet"); | 113 | info!("rx unknown packet"); |
diff --git a/examples/stm32l0/src/bin/raw_spawn.rs b/examples/stm32l0/src/bin/raw_spawn.rs index edc17304a..29c7e0dc7 100644 --- a/examples/stm32l0/src/bin/raw_spawn.rs +++ b/examples/stm32l0/src/bin/raw_spawn.rs | |||
| @@ -7,21 +7,21 @@ use cortex_m_rt::entry; | |||
| 7 | use defmt::*; | 7 | use defmt::*; |
| 8 | use embassy_executor::raw::TaskStorage; | 8 | use embassy_executor::raw::TaskStorage; |
| 9 | use embassy_executor::Executor; | 9 | use embassy_executor::Executor; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use static_cell::StaticCell; | 11 | use static_cell::StaticCell; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | async fn run1() { | 14 | async fn run1() { |
| 15 | loop { | 15 | loop { |
| 16 | info!("BIG INFREQUENT TICK"); | 16 | info!("BIG INFREQUENT TICK"); |
| 17 | Timer::after(Duration::from_ticks(64000)).await; | 17 | Timer::after_ticks(64000).await; |
| 18 | } | 18 | } |
| 19 | } | 19 | } |
| 20 | 20 | ||
| 21 | async fn run2() { | 21 | async fn run2() { |
| 22 | loop { | 22 | loop { |
| 23 | info!("tick"); | 23 | info!("tick"); |
| 24 | Timer::after(Duration::from_ticks(13000)).await; | 24 | Timer::after_ticks(13000).await; |
| 25 | } | 25 | } |
| 26 | } | 26 | } |
| 27 | 27 | ||
diff --git a/examples/stm32l1/Cargo.toml b/examples/stm32l1/Cargo.toml index a75275a0b..70058d49b 100644 --- a/examples/stm32l1/Cargo.toml +++ b/examples/stm32l1/Cargo.toml | |||
| @@ -7,7 +7,7 @@ license = "MIT OR Apache-2.0" | |||
| 7 | [dependencies] | 7 | [dependencies] |
| 8 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 8 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 9 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 9 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 10 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 11 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32l151cb-a", "time-driver-any", "memory-x"] } | 11 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32l151cb-a", "time-driver-any", "memory-x"] } |
| 12 | 12 | ||
| 13 | defmt = "0.3" | 13 | defmt = "0.3" |
diff --git a/examples/stm32l1/src/bin/blinky.rs b/examples/stm32l1/src/bin/blinky.rs index 8a345d235..06f732eb7 100644 --- a/examples/stm32l1/src/bin/blinky.rs +++ b/examples/stm32l1/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(1000)).await; | 21 | Timer::after_millis(1000).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(1000)).await; | 25 | Timer::after_millis(1000).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32l4/Cargo.toml b/examples/stm32l4/Cargo.toml index 59e89c537..b420ad563 100644 --- a/examples/stm32l4/Cargo.toml +++ b/examples/stm32l4/Cargo.toml | |||
| @@ -9,14 +9,14 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32l4s5qi", "memory-x", "time-driver-any", "exti", "unstable-traits", "chrono"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32l4s5qi", "memory-x", "time-driver-any", "exti", "unstable-traits", "chrono"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768", "unstable-traits", "nightly"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768", "unstable-traits", "nightly"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal" } |
| 14 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 14 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 15 | embassy-net-adin1110 = { version = "0.2.0", path = "../../embassy-net-adin1110" } | 15 | embassy-net-adin1110 = { version = "0.2.0", path = "../../embassy-net-adin1110" } |
| 16 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "udp", "tcp", "dhcpv4", "medium-ethernet"] } | 16 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "udp", "tcp", "dhcpv4", "medium-ethernet"] } |
| 17 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 17 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 18 | embedded-io-async = { version = "0.5.0", features = ["defmt-03"] } | 18 | embedded-io-async = { version = "0.6.0", features = ["defmt-03"] } |
| 19 | embedded-io = { version = "0.5.0", features = ["defmt-03"] } | 19 | embedded-io = { version = "0.6.0", features = ["defmt-03"] } |
| 20 | 20 | ||
| 21 | defmt = "0.3" | 21 | defmt = "0.3" |
| 22 | defmt-rtt = "0.4" | 22 | defmt-rtt = "0.4" |
diff --git a/examples/stm32l4/src/bin/adc.rs b/examples/stm32l4/src/bin/adc.rs index 1771e5202..a0ec5c33e 100644 --- a/examples/stm32l4/src/bin/adc.rs +++ b/examples/stm32l4/src/bin/adc.rs | |||
| @@ -13,7 +13,7 @@ fn main() -> ! { | |||
| 13 | info!("Hello World!"); | 13 | info!("Hello World!"); |
| 14 | 14 | ||
| 15 | pac::RCC.ccipr().modify(|w| { | 15 | pac::RCC.ccipr().modify(|w| { |
| 16 | w.set_adcsel(0b11); | 16 | w.set_adcsel(pac::rcc::vals::Adcsel::SYS); |
| 17 | }); | 17 | }); |
| 18 | pac::RCC.ahb2enr().modify(|w| w.set_adcen(true)); | 18 | pac::RCC.ahb2enr().modify(|w| w.set_adcen(true)); |
| 19 | 19 | ||
diff --git a/examples/stm32l4/src/bin/blinky.rs b/examples/stm32l4/src/bin/blinky.rs index 033292fff..6202fe2f7 100644 --- a/examples/stm32l4/src/bin/blinky.rs +++ b/examples/stm32l4/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -17,8 +17,8 @@ async fn main(_spawner: Spawner) { | |||
| 17 | 17 | ||
| 18 | loop { | 18 | loop { |
| 19 | led.set_high(); | 19 | led.set_high(); |
| 20 | Timer::after(Duration::from_millis(300)).await; | 20 | Timer::after_millis(300).await; |
| 21 | led.set_low(); | 21 | led.set_low(); |
| 22 | Timer::after(Duration::from_millis(300)).await; | 22 | Timer::after_millis(300).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
diff --git a/examples/stm32l4/src/bin/dac_dma.rs b/examples/stm32l4/src/bin/dac_dma.rs index c27cc03e1..98f37f906 100644 --- a/examples/stm32l4/src/bin/dac_dma.rs +++ b/examples/stm32l4/src/bin/dac_dma.rs | |||
| @@ -51,7 +51,7 @@ async fn dac_task1(mut dac: Dac1Type) { | |||
| 51 | dac.select_trigger(embassy_stm32::dac::Ch1Trigger::Tim6).unwrap(); | 51 | dac.select_trigger(embassy_stm32::dac::Ch1Trigger::Tim6).unwrap(); |
| 52 | dac.enable_channel().unwrap(); | 52 | dac.enable_channel().unwrap(); |
| 53 | 53 | ||
| 54 | TIM6::enable(); | 54 | TIM6::enable_and_reset(); |
| 55 | TIM6::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); | 55 | TIM6::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); |
| 56 | TIM6::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); | 56 | TIM6::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); |
| 57 | TIM6::regs().cr1().modify(|w| { | 57 | TIM6::regs().cr1().modify(|w| { |
| @@ -90,7 +90,7 @@ async fn dac_task2(mut dac: Dac2Type) { | |||
| 90 | error!("Reload value {} below threshold!", reload); | 90 | error!("Reload value {} below threshold!", reload); |
| 91 | } | 91 | } |
| 92 | 92 | ||
| 93 | TIM7::enable(); | 93 | TIM7::enable_and_reset(); |
| 94 | TIM7::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); | 94 | TIM7::regs().arr().modify(|w| w.set_arr(reload as u16 - 1)); |
| 95 | TIM7::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); | 95 | TIM7::regs().cr2().modify(|w| w.set_mms(Mms::UPDATE)); |
| 96 | TIM7::regs().cr1().modify(|w| { | 96 | TIM7::regs().cr1().modify(|w| { |
diff --git a/examples/stm32l4/src/bin/mco.rs b/examples/stm32l4/src/bin/mco.rs index dea0c66e0..504879887 100644 --- a/examples/stm32l4/src/bin/mco.rs +++ b/examples/stm32l4/src/bin/mco.rs | |||
| @@ -5,8 +5,8 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_stm32::rcc::{Mco, Mco1Source, McoClock}; | 8 | use embassy_stm32::rcc::{Mco, McoPrescaler, McoSource}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -14,14 +14,14 @@ async fn main(_spawner: Spawner) { | |||
| 14 | let p = embassy_stm32::init(Default::default()); | 14 | let p = embassy_stm32::init(Default::default()); |
| 15 | info!("Hello World!"); | 15 | info!("Hello World!"); |
| 16 | 16 | ||
| 17 | let _mco = Mco::new(p.MCO, p.PA8, Mco1Source::Hsi16, McoClock::DIV1); | 17 | let _mco = Mco::new(p.MCO, p.PA8, McoSource::HSI, McoPrescaler::DIV1); |
| 18 | 18 | ||
| 19 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); | 19 | let mut led = Output::new(p.PB14, Level::High, Speed::Low); |
| 20 | 20 | ||
| 21 | loop { | 21 | loop { |
| 22 | led.set_high(); | 22 | led.set_high(); |
| 23 | Timer::after(Duration::from_millis(300)).await; | 23 | Timer::after_millis(300).await; |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(300)).await; | 25 | Timer::after_millis(300).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32l4/src/bin/rng.rs b/examples/stm32l4/src/bin/rng.rs index 806e49f59..d8a4e825f 100644 --- a/examples/stm32l4/src/bin/rng.rs +++ b/examples/stm32l4/src/bin/rng.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::rcc::{ClockSrc, PLLClkDiv, PLLMul, PLLSource, PLLSrcDiv}; | 7 | use embassy_stm32::rcc::{ClockSrc, PLLSource, Pll, PllMul, PllPreDiv, PllQDiv, PllRDiv}; |
| 8 | use embassy_stm32::rng::Rng; | 8 | use embassy_stm32::rng::Rng; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, rng, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, rng, Config}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -16,14 +16,16 @@ bind_interrupts!(struct Irqs { | |||
| 16 | #[embassy_executor::main] | 16 | #[embassy_executor::main] |
| 17 | async fn main(_spawner: Spawner) { | 17 | async fn main(_spawner: Spawner) { |
| 18 | let mut config = Config::default(); | 18 | let mut config = Config::default(); |
| 19 | // 72Mhz clock (16 / 1 * 18 / 4) | 19 | config.rcc.mux = ClockSrc::PLL1_R; |
| 20 | config.rcc.mux = ClockSrc::PLL( | 20 | config.rcc.hsi16 = true; |
| 21 | PLLSource::HSI16, | 21 | config.rcc.pll = Some(Pll { |
| 22 | PLLClkDiv::Div4, | 22 | source: PLLSource::HSI, |
| 23 | PLLSrcDiv::Div1, | 23 | prediv: PllPreDiv::DIV1, |
| 24 | PLLMul::Mul18, | 24 | mul: PllMul::MUL18, |
| 25 | Some(PLLClkDiv::Div6), // 48Mhz (16 / 1 * 18 / 6) | 25 | divp: None, |
| 26 | ); | 26 | divq: Some(PllQDiv::DIV6), // 48Mhz (16 / 1 * 18 / 6) |
| 27 | divr: Some(PllRDiv::DIV4), // sysclk 72Mhz clock (16 / 1 * 18 / 4) | ||
| 28 | }); | ||
| 27 | let p = embassy_stm32::init(config); | 29 | let p = embassy_stm32::init(config); |
| 28 | 30 | ||
| 29 | info!("Hello World!"); | 31 | info!("Hello World!"); |
diff --git a/examples/stm32l4/src/bin/rtc.rs b/examples/stm32l4/src/bin/rtc.rs index eb1eed012..fec0a349d 100644 --- a/examples/stm32l4/src/bin/rtc.rs +++ b/examples/stm32l4/src/bin/rtc.rs | |||
| @@ -5,28 +5,29 @@ | |||
| 5 | use chrono::{NaiveDate, NaiveDateTime}; | 5 | use chrono::{NaiveDate, NaiveDateTime}; |
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::rcc::{self, ClockSrc, PLLClkDiv, PLLMul, PLLSource, PLLSrcDiv}; | 8 | use embassy_stm32::rcc::{ClockSrc, LsConfig, PLLSource, Pll, PllMul, PllPreDiv, PllRDiv}; |
| 9 | use embassy_stm32::rtc::{Rtc, RtcConfig}; | 9 | use embassy_stm32::rtc::{Rtc, RtcConfig}; |
| 10 | use embassy_stm32::time::Hertz; | 10 | use embassy_stm32::time::Hertz; |
| 11 | use embassy_stm32::Config; | 11 | use embassy_stm32::Config; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | #[embassy_executor::main] | 15 | #[embassy_executor::main] |
| 16 | async fn main(_spawner: Spawner) { | 16 | async fn main(_spawner: Spawner) { |
| 17 | let p = { | 17 | let mut config = Config::default(); |
| 18 | let mut config = Config::default(); | 18 | config.rcc.mux = ClockSrc::PLL1_R; |
| 19 | config.rcc.mux = ClockSrc::PLL( | 19 | config.rcc.hse = Some(Hertz::mhz(8)); |
| 20 | PLLSource::HSE(Hertz::mhz(8)), | 20 | config.rcc.pll = Some(Pll { |
| 21 | PLLClkDiv::Div2, | 21 | source: PLLSource::HSE, |
| 22 | PLLSrcDiv::Div1, | 22 | prediv: PllPreDiv::DIV1, |
| 23 | PLLMul::Mul20, | 23 | mul: PllMul::MUL20, |
| 24 | None, | 24 | divp: None, |
| 25 | ); | 25 | divq: None, |
| 26 | config.rcc.lse = Some(Hertz(32_768)); | 26 | divr: Some(PllRDiv::DIV2), // sysclk 80Mhz clock (8 / 1 * 20 / 2) |
| 27 | config.rcc.rtc_mux = rcc::RtcClockSource::LSE; | 27 | }); |
| 28 | embassy_stm32::init(config) | 28 | config.rcc.ls = LsConfig::default_lse(); |
| 29 | }; | 29 | let p = embassy_stm32::init(config); |
| 30 | |||
| 30 | info!("Hello World!"); | 31 | info!("Hello World!"); |
| 31 | 32 | ||
| 32 | let now = NaiveDate::from_ymd_opt(2020, 5, 15) | 33 | let now = NaiveDate::from_ymd_opt(2020, 5, 15) |
| @@ -40,7 +41,7 @@ async fn main(_spawner: Spawner) { | |||
| 40 | rtc.set_datetime(now.into()).expect("datetime not set"); | 41 | rtc.set_datetime(now.into()).expect("datetime not set"); |
| 41 | 42 | ||
| 42 | // In reality the delay would be much longer | 43 | // In reality the delay would be much longer |
| 43 | Timer::after(Duration::from_millis(20000)).await; | 44 | Timer::after_millis(20000).await; |
| 44 | 45 | ||
| 45 | let then: NaiveDateTime = rtc.now().unwrap().into(); | 46 | let then: NaiveDateTime = rtc.now().unwrap().into(); |
| 46 | info!("Got RTC! {:?}", then.timestamp()); | 47 | info!("Got RTC! {:?}", then.timestamp()); |
diff --git a/examples/stm32l4/src/bin/spe_adin1110_http_server.rs b/examples/stm32l4/src/bin/spe_adin1110_http_server.rs index 287521582..3c9d2cfc0 100644 --- a/examples/stm32l4/src/bin/spe_adin1110_http_server.rs +++ b/examples/stm32l4/src/bin/spe_adin1110_http_server.rs | |||
| @@ -32,7 +32,6 @@ use embedded_io::Write as bWrite; | |||
| 32 | use embedded_io_async::Write; | 32 | use embedded_io_async::Write; |
| 33 | use hal::gpio::{Input, Level, Output, Speed}; | 33 | use hal::gpio::{Input, Level, Output, Speed}; |
| 34 | use hal::i2c::{self, I2c}; | 34 | use hal::i2c::{self, I2c}; |
| 35 | use hal::rcc::{self}; | ||
| 36 | use hal::rng::{self, Rng}; | 35 | use hal::rng::{self, Rng}; |
| 37 | use hal::{bind_interrupts, exti, pac, peripherals}; | 36 | use hal::{bind_interrupts, exti, pac, peripherals}; |
| 38 | use heapless::Vec; | 37 | use heapless::Vec; |
| @@ -49,7 +48,7 @@ use embassy_net_adin1110::{self, Device, Runner, ADIN1110}; | |||
| 49 | use embedded_hal_bus::spi::ExclusiveDevice; | 48 | use embedded_hal_bus::spi::ExclusiveDevice; |
| 50 | use hal::gpio::Pull; | 49 | use hal::gpio::Pull; |
| 51 | use hal::i2c::Config as I2C_Config; | 50 | use hal::i2c::Config as I2C_Config; |
| 52 | use hal::rcc::{ClockSrc, PLLClkDiv, PLLMul, PLLSource, PLLSrcDiv}; | 51 | use hal::rcc::{ClockSrc, PLLSource, Pll, PllMul, PllPreDiv, PllRDiv}; |
| 53 | use hal::spi::{Config as SPI_Config, Spi}; | 52 | use hal::spi::{Config as SPI_Config, Spi}; |
| 54 | use hal::time::Hertz; | 53 | use hal::time::Hertz; |
| 55 | 54 | ||
| @@ -78,15 +77,17 @@ async fn main(spawner: Spawner) { | |||
| 78 | 77 | ||
| 79 | // 80Mhz clock (Source: 8 / SrcDiv: 1 * PLLMul 20 / ClkDiv 2) | 78 | // 80Mhz clock (Source: 8 / SrcDiv: 1 * PLLMul 20 / ClkDiv 2) |
| 80 | // 80MHz highest frequency for flash 0 wait. | 79 | // 80MHz highest frequency for flash 0 wait. |
| 81 | config.rcc.mux = ClockSrc::PLL( | 80 | config.rcc.mux = ClockSrc::PLL1_R; |
| 82 | PLLSource::HSE(Hertz(8_000_000)), | 81 | config.rcc.hse = Some(Hertz::mhz(8)); |
| 83 | PLLClkDiv::Div2, | 82 | config.rcc.pll = Some(Pll { |
| 84 | PLLSrcDiv::Div1, | 83 | source: PLLSource::HSE, |
| 85 | PLLMul::Mul20, | 84 | prediv: PllPreDiv::DIV1, |
| 86 | None, | 85 | mul: PllMul::MUL20, |
| 87 | ); | 86 | divp: None, |
| 87 | divq: None, | ||
| 88 | divr: Some(PllRDiv::DIV2), // sysclk 80Mhz clock (8 / 1 * 20 / 2) | ||
| 89 | }); | ||
| 88 | config.rcc.hsi48 = true; // needed for rng | 90 | config.rcc.hsi48 = true; // needed for rng |
| 89 | config.rcc.rtc_mux = rcc::RtcClockSource::LSI; | ||
| 90 | 91 | ||
| 91 | let dp = embassy_stm32::init(config); | 92 | let dp = embassy_stm32::init(config); |
| 92 | 93 | ||
| @@ -308,7 +309,7 @@ async fn temp_task(temp_dev_i2c: TempSensI2c, mut led: Output<'static, periphera | |||
| 308 | 309 | ||
| 309 | loop { | 310 | loop { |
| 310 | led.set_low(); | 311 | led.set_low(); |
| 311 | match select(temp_sens.read_temp(), Timer::after(Duration::from_millis(500))).await { | 312 | match select(temp_sens.read_temp(), Timer::after_millis(500)).await { |
| 312 | Either::First(i2c_ret) => match i2c_ret { | 313 | Either::First(i2c_ret) => match i2c_ret { |
| 313 | Ok(value) => { | 314 | Ok(value) => { |
| 314 | led.set_high(); | 315 | led.set_high(); |
| @@ -366,7 +367,7 @@ pub struct ADT7422<'d, BUS: I2cBus> { | |||
| 366 | bus: BUS, | 367 | bus: BUS, |
| 367 | } | 368 | } |
| 368 | 369 | ||
| 369 | #[derive(Debug, Format)] | 370 | #[derive(Debug, Format, PartialEq, Eq)] |
| 370 | pub enum Error<I2cError: Format> { | 371 | pub enum Error<I2cError: Format> { |
| 371 | I2c(I2cError), | 372 | I2c(I2cError), |
| 372 | Address, | 373 | Address, |
| @@ -426,7 +427,7 @@ where | |||
| 426 | // Start: One shot | 427 | // Start: One shot |
| 427 | let cfg = 0b01 << 5; | 428 | let cfg = 0b01 << 5; |
| 428 | self.write_cfg(cfg).await?; | 429 | self.write_cfg(cfg).await?; |
| 429 | Timer::after(Duration::from_millis(250)).await; | 430 | Timer::after_millis(250).await; |
| 430 | self.bus | 431 | self.bus |
| 431 | .write_read(self.addr, &[Registers::Temp_MSB as u8], &mut buffer) | 432 | .write_read(self.addr, &[Registers::Temp_MSB as u8], &mut buffer) |
| 432 | .await | 433 | .await |
diff --git a/examples/stm32l4/src/bin/usb_serial.rs b/examples/stm32l4/src/bin/usb_serial.rs index 410d6891b..282476547 100644 --- a/examples/stm32l4/src/bin/usb_serial.rs +++ b/examples/stm32l4/src/bin/usb_serial.rs | |||
| @@ -23,8 +23,17 @@ async fn main(_spawner: Spawner) { | |||
| 23 | info!("Hello World!"); | 23 | info!("Hello World!"); |
| 24 | 24 | ||
| 25 | let mut config = Config::default(); | 25 | let mut config = Config::default(); |
| 26 | config.rcc.mux = ClockSrc::PLL(PLLSource::HSI16, PLLClkDiv::Div2, PLLSrcDiv::Div1, PLLMul::Mul10, None); | ||
| 27 | config.rcc.hsi48 = true; | 26 | config.rcc.hsi48 = true; |
| 27 | config.rcc.mux = ClockSrc::PLL1_R; | ||
| 28 | config.rcc.hsi16 = true; | ||
| 29 | config.rcc.pll = Some(Pll { | ||
| 30 | source: PLLSource::HSI, | ||
| 31 | prediv: PllPreDiv::DIV1, | ||
| 32 | mul: PllMul::MUL10, | ||
| 33 | divp: None, | ||
| 34 | divq: None, | ||
| 35 | divr: Some(PllRDiv::DIV2), // sysclk 80Mhz (16 / 1 * 10 / 2) | ||
| 36 | }); | ||
| 28 | 37 | ||
| 29 | let p = embassy_stm32::init(config); | 38 | let p = embassy_stm32::init(config); |
| 30 | 39 | ||
diff --git a/examples/stm32l5/Cargo.toml b/examples/stm32l5/Cargo.toml index 583e1a776..ecf88d7e6 100644 --- a/examples/stm32l5/Cargo.toml +++ b/examples/stm32l5/Cargo.toml | |||
| @@ -9,9 +9,9 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32l552ze", "time-driver-any", "exti", "unstable-traits", "memory-x"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32l552ze", "time-driver-any", "exti", "unstable-traits", "memory-x"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] } | 14 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "dhcpv4", "medium-ethernet"] } |
| 15 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 15 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 16 | usbd-hid = "0.6.0" | 16 | usbd-hid = "0.6.0" |
| 17 | 17 | ||
| @@ -25,7 +25,7 @@ embedded-hal = "0.2.6" | |||
| 25 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 25 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 26 | heapless = { version = "0.7.5", default-features = false } | 26 | heapless = { version = "0.7.5", default-features = false } |
| 27 | rand_core = { version = "0.6.3", default-features = false } | 27 | rand_core = { version = "0.6.3", default-features = false } |
| 28 | embedded-io-async = { version = "0.5.0" } | 28 | embedded-io-async = { version = "0.6.0" } |
| 29 | static_cell = { version = "1.1", features = ["nightly"]} | 29 | static_cell = { version = "1.1", features = ["nightly"]} |
| 30 | 30 | ||
| 31 | [profile.release] | 31 | [profile.release] |
diff --git a/examples/stm32l5/src/bin/rng.rs b/examples/stm32l5/src/bin/rng.rs index 9549d64d8..b57f438ff 100644 --- a/examples/stm32l5/src/bin/rng.rs +++ b/examples/stm32l5/src/bin/rng.rs | |||
| @@ -4,7 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::rcc::{ClockSrc, PLLClkDiv, PLLMul, PLLSource, PLLSrcDiv}; | 7 | use embassy_stm32::rcc::{ClockSrc, PLLSource, Pll, PllMul, PllPreDiv, PllRDiv}; |
| 8 | use embassy_stm32::rng::Rng; | 8 | use embassy_stm32::rng::Rng; |
| 9 | use embassy_stm32::{bind_interrupts, peripherals, rng, Config}; | 9 | use embassy_stm32::{bind_interrupts, peripherals, rng, Config}; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -16,13 +16,17 @@ bind_interrupts!(struct Irqs { | |||
| 16 | #[embassy_executor::main] | 16 | #[embassy_executor::main] |
| 17 | async fn main(_spawner: Spawner) { | 17 | async fn main(_spawner: Spawner) { |
| 18 | let mut config = Config::default(); | 18 | let mut config = Config::default(); |
| 19 | config.rcc.mux = ClockSrc::PLL( | 19 | config.rcc.hsi16 = true; |
| 20 | PLLSource::HSI16, | 20 | config.rcc.mux = ClockSrc::PLL1_R; |
| 21 | PLLClkDiv::Div2, | 21 | config.rcc.pll = Some(Pll { |
| 22 | PLLSrcDiv::Div1, | 22 | // 64Mhz clock (16 / 1 * 8 / 2) |
| 23 | PLLMul::Mul8, | 23 | source: PLLSource::HSI, |
| 24 | Some(PLLClkDiv::Div2), | 24 | prediv: PllPreDiv::DIV1, |
| 25 | ); | 25 | mul: PllMul::MUL8, |
| 26 | divp: None, | ||
| 27 | divq: None, | ||
| 28 | divr: Some(PllRDiv::DIV2), | ||
| 29 | }); | ||
| 26 | let p = embassy_stm32::init(config); | 30 | let p = embassy_stm32::init(config); |
| 27 | 31 | ||
| 28 | info!("Hello World!"); | 32 | info!("Hello World!"); |
diff --git a/examples/stm32l5/src/bin/usb_ethernet.rs b/examples/stm32l5/src/bin/usb_ethernet.rs index 15b84761b..bbe44642b 100644 --- a/examples/stm32l5/src/bin/usb_ethernet.rs +++ b/examples/stm32l5/src/bin/usb_ethernet.rs | |||
| @@ -45,8 +45,17 @@ async fn net_task(stack: &'static Stack<Device<'static, MTU>>) -> ! { | |||
| 45 | #[embassy_executor::main] | 45 | #[embassy_executor::main] |
| 46 | async fn main(spawner: Spawner) { | 46 | async fn main(spawner: Spawner) { |
| 47 | let mut config = Config::default(); | 47 | let mut config = Config::default(); |
| 48 | config.rcc.mux = ClockSrc::PLL(PLLSource::HSI16, PLLClkDiv::Div2, PLLSrcDiv::Div1, PLLMul::Mul10, None); | 48 | config.rcc.hsi16 = true; |
| 49 | config.rcc.hsi48 = true; | 49 | config.rcc.mux = ClockSrc::PLL1_R; |
| 50 | config.rcc.pll = Some(Pll { | ||
| 51 | // 80Mhz clock (16 / 1 * 10 / 2) | ||
| 52 | source: PLLSource::HSI, | ||
| 53 | prediv: PllPreDiv::DIV1, | ||
| 54 | mul: PllMul::MUL10, | ||
| 55 | divp: None, | ||
| 56 | divq: None, | ||
| 57 | divr: Some(PllRDiv::DIV2), | ||
| 58 | }); | ||
| 50 | let p = embassy_stm32::init(config); | 59 | let p = embassy_stm32::init(config); |
| 51 | 60 | ||
| 52 | // Create the driver, from the HAL. | 61 | // Create the driver, from the HAL. |
diff --git a/examples/stm32l5/src/bin/usb_hid_mouse.rs b/examples/stm32l5/src/bin/usb_hid_mouse.rs index 7e894e407..44e29ee9c 100644 --- a/examples/stm32l5/src/bin/usb_hid_mouse.rs +++ b/examples/stm32l5/src/bin/usb_hid_mouse.rs | |||
| @@ -8,7 +8,7 @@ use embassy_futures::join::join; | |||
| 8 | use embassy_stm32::rcc::*; | 8 | use embassy_stm32::rcc::*; |
| 9 | use embassy_stm32::usb::Driver; | 9 | use embassy_stm32::usb::Driver; |
| 10 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; | 10 | use embassy_stm32::{bind_interrupts, peripherals, usb, Config}; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use embassy_usb::class::hid::{HidWriter, ReportId, RequestHandler, State}; | 12 | use embassy_usb::class::hid::{HidWriter, ReportId, RequestHandler, State}; |
| 13 | use embassy_usb::control::OutResponse; | 13 | use embassy_usb::control::OutResponse; |
| 14 | use embassy_usb::Builder; | 14 | use embassy_usb::Builder; |
| @@ -22,8 +22,17 @@ bind_interrupts!(struct Irqs { | |||
| 22 | #[embassy_executor::main] | 22 | #[embassy_executor::main] |
| 23 | async fn main(_spawner: Spawner) { | 23 | async fn main(_spawner: Spawner) { |
| 24 | let mut config = Config::default(); | 24 | let mut config = Config::default(); |
| 25 | config.rcc.mux = ClockSrc::PLL(PLLSource::HSI16, PLLClkDiv::Div2, PLLSrcDiv::Div1, PLLMul::Mul10, None); | 25 | config.rcc.hsi16 = true; |
| 26 | config.rcc.hsi48 = true; | 26 | config.rcc.mux = ClockSrc::PLL1_R; |
| 27 | config.rcc.pll = Some(Pll { | ||
| 28 | // 80Mhz clock (16 / 1 * 10 / 2) | ||
| 29 | source: PLLSource::HSI, | ||
| 30 | prediv: PllPreDiv::DIV1, | ||
| 31 | mul: PllMul::MUL10, | ||
| 32 | divp: None, | ||
| 33 | divq: None, | ||
| 34 | divr: Some(PllRDiv::DIV2), | ||
| 35 | }); | ||
| 27 | let p = embassy_stm32::init(config); | 36 | let p = embassy_stm32::init(config); |
| 28 | 37 | ||
| 29 | // Create the driver, from the HAL. | 38 | // Create the driver, from the HAL. |
| @@ -76,7 +85,7 @@ async fn main(_spawner: Spawner) { | |||
| 76 | let hid_fut = async { | 85 | let hid_fut = async { |
| 77 | let mut y: i8 = 5; | 86 | let mut y: i8 = 5; |
| 78 | loop { | 87 | loop { |
| 79 | Timer::after(Duration::from_millis(500)).await; | 88 | Timer::after_millis(500).await; |
| 80 | 89 | ||
| 81 | y = -y; | 90 | y = -y; |
| 82 | let report = MouseReport { | 91 | let report = MouseReport { |
diff --git a/examples/stm32l5/src/bin/usb_serial.rs b/examples/stm32l5/src/bin/usb_serial.rs index 0c719560f..612b891ac 100644 --- a/examples/stm32l5/src/bin/usb_serial.rs +++ b/examples/stm32l5/src/bin/usb_serial.rs | |||
| @@ -20,8 +20,17 @@ bind_interrupts!(struct Irqs { | |||
| 20 | #[embassy_executor::main] | 20 | #[embassy_executor::main] |
| 21 | async fn main(_spawner: Spawner) { | 21 | async fn main(_spawner: Spawner) { |
| 22 | let mut config = Config::default(); | 22 | let mut config = Config::default(); |
| 23 | config.rcc.mux = ClockSrc::PLL(PLLSource::HSI16, PLLClkDiv::Div2, PLLSrcDiv::Div1, PLLMul::Mul10, None); | 23 | config.rcc.hsi16 = true; |
| 24 | config.rcc.hsi48 = true; | 24 | config.rcc.mux = ClockSrc::PLL1_R; |
| 25 | config.rcc.pll = Some(Pll { | ||
| 26 | // 80Mhz clock (16 / 1 * 10 / 2) | ||
| 27 | source: PLLSource::HSI, | ||
| 28 | prediv: PllPreDiv::DIV1, | ||
| 29 | mul: PllMul::MUL10, | ||
| 30 | divp: None, | ||
| 31 | divq: None, | ||
| 32 | divr: Some(PllRDiv::DIV2), | ||
| 33 | }); | ||
| 25 | let p = embassy_stm32::init(config); | 34 | let p = embassy_stm32::init(config); |
| 26 | 35 | ||
| 27 | info!("Hello World!"); | 36 | info!("Hello World!"); |
diff --git a/examples/stm32u5/Cargo.toml b/examples/stm32u5/Cargo.toml index e361856c5..de60b3b19 100644 --- a/examples/stm32u5/Cargo.toml +++ b/examples/stm32u5/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32u585ai", "time-driver-any", "memory-x" ] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "stm32u585ai", "time-driver-any", "memory-x" ] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } | 13 | embassy-usb = { version = "0.1.0", path = "../../embassy-usb", features = ["defmt"] } |
| 14 | 14 | ||
| 15 | defmt = "0.3" | 15 | defmt = "0.3" |
diff --git a/examples/stm32u5/src/bin/blinky.rs b/examples/stm32u5/src/bin/blinky.rs index 976fb0b9a..4b44cb12b 100644 --- a/examples/stm32u5/src/bin/blinky.rs +++ b/examples/stm32u5/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) -> ! { | |||
| 18 | loop { | 18 | loop { |
| 19 | defmt::info!("on!"); | 19 | defmt::info!("on!"); |
| 20 | led.set_low(); | 20 | led.set_low(); |
| 21 | Timer::after(Duration::from_millis(200)).await; | 21 | Timer::after_millis(200).await; |
| 22 | 22 | ||
| 23 | defmt::info!("off!"); | 23 | defmt::info!("off!"); |
| 24 | led.set_high(); | 24 | led.set_high(); |
| 25 | Timer::after(Duration::from_millis(200)).await; | 25 | Timer::after_millis(200).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32u5/src/bin/usb_serial.rs b/examples/stm32u5/src/bin/usb_serial.rs index 9e47fb18a..9b2adb0ac 100644 --- a/examples/stm32u5/src/bin/usb_serial.rs +++ b/examples/stm32u5/src/bin/usb_serial.rs | |||
| @@ -23,7 +23,12 @@ async fn main(_spawner: Spawner) { | |||
| 23 | info!("Hello World!"); | 23 | info!("Hello World!"); |
| 24 | 24 | ||
| 25 | let mut config = Config::default(); | 25 | let mut config = Config::default(); |
| 26 | config.rcc.mux = ClockSrc::PLL1R(PllSrc::HSI16, PllM::Div2, PllN::Mul10, PllClkDiv::NotDivided); | 26 | config.rcc.mux = ClockSrc::PLL1R(PllConfig { |
| 27 | source: PllSrc::HSI16, | ||
| 28 | m: Pllm::DIV2, | ||
| 29 | n: Plln::MUL10, | ||
| 30 | r: Plldiv::DIV1, | ||
| 31 | }); | ||
| 27 | //config.rcc.mux = ClockSrc::MSI(MSIRange::Range48mhz); | 32 | //config.rcc.mux = ClockSrc::MSI(MSIRange::Range48mhz); |
| 28 | config.rcc.hsi48 = true; | 33 | config.rcc.hsi48 = true; |
| 29 | 34 | ||
diff --git a/examples/stm32wb/Cargo.toml b/examples/stm32wb/Cargo.toml index 320678ddc..fa2cc63fa 100644 --- a/examples/stm32wb/Cargo.toml +++ b/examples/stm32wb/Cargo.toml | |||
| @@ -10,8 +10,8 @@ embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = [" | |||
| 10 | embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", features = ["defmt", "stm32wb55rg"] } | 10 | embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", features = ["defmt", "stm32wb55rg"] } |
| 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 13 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 13 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 14 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true } | 14 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true } |
| 15 | 15 | ||
| 16 | defmt = "0.3" | 16 | defmt = "0.3" |
| 17 | defmt-rtt = "0.4" | 17 | defmt-rtt = "0.4" |
diff --git a/examples/stm32wb/src/bin/blinky.rs b/examples/stm32wb/src/bin/blinky.rs index f9bf90d2e..1394f03fa 100644 --- a/examples/stm32wb/src/bin/blinky.rs +++ b/examples/stm32wb/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(500)).await; | 25 | Timer::after_millis(500).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32wb/src/bin/tl_mbox.rs b/examples/stm32wb/src/bin/tl_mbox.rs index 2f53f5df8..9d0e0070c 100644 --- a/examples/stm32wb/src/bin/tl_mbox.rs +++ b/examples/stm32wb/src/bin/tl_mbox.rs | |||
| @@ -8,7 +8,7 @@ use embassy_stm32::bind_interrupts; | |||
| 8 | use embassy_stm32::ipcc::{Config, ReceiveInterruptHandler, TransmitInterruptHandler}; | 8 | use embassy_stm32::ipcc::{Config, ReceiveInterruptHandler, TransmitInterruptHandler}; |
| 9 | use embassy_stm32::rcc::WPAN_DEFAULT; | 9 | use embassy_stm32::rcc::WPAN_DEFAULT; |
| 10 | use embassy_stm32_wpan::TlMbox; | 10 | use embassy_stm32_wpan::TlMbox; |
| 11 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 12 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 13 | 13 | ||
| 14 | bind_interrupts!(struct Irqs{ | 14 | bind_interrupts!(struct Irqs{ |
| @@ -71,7 +71,7 @@ async fn main(_spawner: Spawner) { | |||
| 71 | } | 71 | } |
| 72 | } | 72 | } |
| 73 | 73 | ||
| 74 | Timer::after(Duration::from_millis(50)).await; | 74 | Timer::after_millis(50).await; |
| 75 | } | 75 | } |
| 76 | 76 | ||
| 77 | info!("Test OK"); | 77 | info!("Test OK"); |
diff --git a/examples/stm32wba/Cargo.toml b/examples/stm32wba/Cargo.toml index 26fcce26b..68ab5a468 100644 --- a/examples/stm32wba/Cargo.toml +++ b/examples/stm32wba/Cargo.toml | |||
| @@ -8,8 +8,8 @@ license = "MIT OR Apache-2.0" | |||
| 8 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32wba52cg", "time-driver-any", "memory-x", "exti"] } | 8 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "stm32wba52cg", "time-driver-any", "memory-x", "exti"] } |
| 9 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 9 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 10 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 10 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 11 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 11 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 12 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true } | 12 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "udp", "proto-ipv6", "medium-ieee802154", "nightly"], optional=true } |
| 13 | 13 | ||
| 14 | defmt = "0.3" | 14 | defmt = "0.3" |
| 15 | defmt-rtt = "0.4" | 15 | defmt-rtt = "0.4" |
diff --git a/examples/stm32wba/src/bin/blinky.rs b/examples/stm32wba/src/bin/blinky.rs index 530746296..6b9635e66 100644 --- a/examples/stm32wba/src/bin/blinky.rs +++ b/examples/stm32wba/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(500)).await; | 25 | Timer::after_millis(500).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32wl/Cargo.toml b/examples/stm32wl/Cargo.toml index f47a9a906..6a338af40 100644 --- a/examples/stm32wl/Cargo.toml +++ b/examples/stm32wl/Cargo.toml | |||
| @@ -9,7 +9,7 @@ license = "MIT OR Apache-2.0" | |||
| 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "unstable-traits", "defmt", "stm32wl55jc-cm4", "time-driver-any", "memory-x", "unstable-pac", "exti", "chrono"] } | 9 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "unstable-traits", "defmt", "stm32wl55jc-cm4", "time-driver-any", "memory-x", "unstable-pac", "exti", "chrono"] } |
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["nightly", "unstable-traits", "defmt", "defmt-timestamp-uptime", "tick-hz-32_768"] } |
| 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal" } | 13 | embassy-embedded-hal = { version = "0.1.0", path = "../../embassy-embedded-hal" } |
| 14 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["stm32wl", "time", "defmt"] } | 14 | embassy-lora = { version = "0.1.0", path = "../../embassy-lora", features = ["stm32wl", "time", "defmt"] } |
| 15 | lora-phy = { version = "2" } | 15 | lora-phy = { version = "2" } |
diff --git a/examples/stm32wl/src/bin/blinky.rs b/examples/stm32wl/src/bin/blinky.rs index 6af5099ce..5bd5745f0 100644 --- a/examples/stm32wl/src/bin/blinky.rs +++ b/examples/stm32wl/src/bin/blinky.rs | |||
| @@ -5,7 +5,7 @@ | |||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::gpio::{Level, Output, Speed}; | 7 | use embassy_stm32::gpio::{Level, Output, Speed}; |
| 8 | use embassy_time::{Duration, Timer}; | 8 | use embassy_time::Timer; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -18,10 +18,10 @@ async fn main(_spawner: Spawner) { | |||
| 18 | loop { | 18 | loop { |
| 19 | info!("high"); | 19 | info!("high"); |
| 20 | led.set_high(); | 20 | led.set_high(); |
| 21 | Timer::after(Duration::from_millis(500)).await; | 21 | Timer::after_millis(500).await; |
| 22 | 22 | ||
| 23 | info!("low"); | 23 | info!("low"); |
| 24 | led.set_low(); | 24 | led.set_low(); |
| 25 | Timer::after(Duration::from_millis(500)).await; | 25 | Timer::after_millis(500).await; |
| 26 | } | 26 | } |
| 27 | } | 27 | } |
diff --git a/examples/stm32wl/src/bin/lora_lorawan.rs b/examples/stm32wl/src/bin/lora_lorawan.rs index fb2495326..8c789afbc 100644 --- a/examples/stm32wl/src/bin/lora_lorawan.rs +++ b/examples/stm32wl/src/bin/lora_lorawan.rs | |||
| @@ -33,8 +33,7 @@ bind_interrupts!(struct Irqs{ | |||
| 33 | #[embassy_executor::main] | 33 | #[embassy_executor::main] |
| 34 | async fn main(_spawner: Spawner) { | 34 | async fn main(_spawner: Spawner) { |
| 35 | let mut config = embassy_stm32::Config::default(); | 35 | let mut config = embassy_stm32::Config::default(); |
| 36 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE32; | 36 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE; |
| 37 | config.rcc.rtc_mux = embassy_stm32::rcc::RtcClockSource::LSI; | ||
| 38 | let p = embassy_stm32::init(config); | 37 | let p = embassy_stm32::init(config); |
| 39 | 38 | ||
| 40 | pac::RCC.ccipr().modify(|w| w.set_rngsel(0b01)); | 39 | pac::RCC.ccipr().modify(|w| w.set_rngsel(0b01)); |
diff --git a/examples/stm32wl/src/bin/lora_p2p_receive.rs b/examples/stm32wl/src/bin/lora_p2p_receive.rs index 3d8c31ff3..be33f39c1 100644 --- a/examples/stm32wl/src/bin/lora_p2p_receive.rs +++ b/examples/stm32wl/src/bin/lora_p2p_receive.rs | |||
| @@ -11,7 +11,7 @@ use embassy_lora::iv::{InterruptHandler, Stm32wlInterfaceVariant}; | |||
| 11 | use embassy_stm32::bind_interrupts; | 11 | use embassy_stm32::bind_interrupts; |
| 12 | use embassy_stm32::gpio::{Level, Output, Pin, Speed}; | 12 | use embassy_stm32::gpio::{Level, Output, Pin, Speed}; |
| 13 | use embassy_stm32::spi::Spi; | 13 | use embassy_stm32::spi::Spi; |
| 14 | use embassy_time::{Delay, Duration, Timer}; | 14 | use embassy_time::{Delay, Timer}; |
| 15 | use lora_phy::mod_params::*; | 15 | use lora_phy::mod_params::*; |
| 16 | use lora_phy::sx1261_2::SX1261_2; | 16 | use lora_phy::sx1261_2::SX1261_2; |
| 17 | use lora_phy::LoRa; | 17 | use lora_phy::LoRa; |
| @@ -26,7 +26,7 @@ bind_interrupts!(struct Irqs{ | |||
| 26 | #[embassy_executor::main] | 26 | #[embassy_executor::main] |
| 27 | async fn main(_spawner: Spawner) { | 27 | async fn main(_spawner: Spawner) { |
| 28 | let mut config = embassy_stm32::Config::default(); | 28 | let mut config = embassy_stm32::Config::default(); |
| 29 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE32; | 29 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE; |
| 30 | let p = embassy_stm32::init(config); | 30 | let p = embassy_stm32::init(config); |
| 31 | 31 | ||
| 32 | let spi = Spi::new_subghz(p.SUBGHZSPI, p.DMA1_CH1, p.DMA1_CH2); | 32 | let spi = Spi::new_subghz(p.SUBGHZSPI, p.DMA1_CH1, p.DMA1_CH2); |
| @@ -51,7 +51,7 @@ async fn main(_spawner: Spawner) { | |||
| 51 | let mut start_indicator = Output::new(p.PB15, Level::Low, Speed::Low); | 51 | let mut start_indicator = Output::new(p.PB15, Level::Low, Speed::Low); |
| 52 | 52 | ||
| 53 | start_indicator.set_high(); | 53 | start_indicator.set_high(); |
| 54 | Timer::after(Duration::from_secs(5)).await; | 54 | Timer::after_secs(5).await; |
| 55 | start_indicator.set_low(); | 55 | start_indicator.set_low(); |
| 56 | 56 | ||
| 57 | let mut receiving_buffer = [00u8; 100]; | 57 | let mut receiving_buffer = [00u8; 100]; |
| @@ -103,7 +103,7 @@ async fn main(_spawner: Spawner) { | |||
| 103 | { | 103 | { |
| 104 | info!("rx successful"); | 104 | info!("rx successful"); |
| 105 | debug_indicator.set_high(); | 105 | debug_indicator.set_high(); |
| 106 | Timer::after(Duration::from_secs(5)).await; | 106 | Timer::after_secs(5).await; |
| 107 | debug_indicator.set_low(); | 107 | debug_indicator.set_low(); |
| 108 | } else { | 108 | } else { |
| 109 | info!("rx unknown packet"); | 109 | info!("rx unknown packet"); |
diff --git a/examples/stm32wl/src/bin/lora_p2p_send.rs b/examples/stm32wl/src/bin/lora_p2p_send.rs index fbd0b0320..85f6a84b7 100644 --- a/examples/stm32wl/src/bin/lora_p2p_send.rs +++ b/examples/stm32wl/src/bin/lora_p2p_send.rs | |||
| @@ -26,7 +26,7 @@ bind_interrupts!(struct Irqs{ | |||
| 26 | #[embassy_executor::main] | 26 | #[embassy_executor::main] |
| 27 | async fn main(_spawner: Spawner) { | 27 | async fn main(_spawner: Spawner) { |
| 28 | let mut config = embassy_stm32::Config::default(); | 28 | let mut config = embassy_stm32::Config::default(); |
| 29 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE32; | 29 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE; |
| 30 | let p = embassy_stm32::init(config); | 30 | let p = embassy_stm32::init(config); |
| 31 | 31 | ||
| 32 | let spi = Spi::new_subghz(p.SUBGHZSPI, p.DMA1_CH1, p.DMA1_CH2); | 32 | let spi = Spi::new_subghz(p.SUBGHZSPI, p.DMA1_CH1, p.DMA1_CH2); |
diff --git a/examples/stm32wl/src/bin/random.rs b/examples/stm32wl/src/bin/random.rs index 18eeac4fa..70676c704 100644 --- a/examples/stm32wl/src/bin/random.rs +++ b/examples/stm32wl/src/bin/random.rs | |||
| @@ -4,6 +4,7 @@ | |||
| 4 | 4 | ||
| 5 | use defmt::*; | 5 | use defmt::*; |
| 6 | use embassy_executor::Spawner; | 6 | use embassy_executor::Spawner; |
| 7 | use embassy_stm32::rcc::{ClockSrc, MSIRange}; | ||
| 7 | use embassy_stm32::rng::{self, Rng}; | 8 | use embassy_stm32::rng::{self, Rng}; |
| 8 | use embassy_stm32::{bind_interrupts, pac, peripherals}; | 9 | use embassy_stm32::{bind_interrupts, pac, peripherals}; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| @@ -15,13 +16,10 @@ bind_interrupts!(struct Irqs{ | |||
| 15 | #[embassy_executor::main] | 16 | #[embassy_executor::main] |
| 16 | async fn main(_spawner: Spawner) { | 17 | async fn main(_spawner: Spawner) { |
| 17 | let mut config = embassy_stm32::Config::default(); | 18 | let mut config = embassy_stm32::Config::default(); |
| 18 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE32; | 19 | config.rcc.mux = ClockSrc::MSI(MSIRange::RANGE32M); |
| 19 | config.rcc.rtc_mux = embassy_stm32::rcc::RtcClockSource::LSI; | ||
| 20 | |||
| 21 | let p = embassy_stm32::init(config); | 20 | let p = embassy_stm32::init(config); |
| 22 | pac::RCC.ccipr().modify(|w| { | 21 | |
| 23 | w.set_rngsel(0b01); | 22 | pac::RCC.ccipr().modify(|w| w.set_rngsel(0b11)); // msi |
| 24 | }); | ||
| 25 | 23 | ||
| 26 | info!("Hello World!"); | 24 | info!("Hello World!"); |
| 27 | 25 | ||
diff --git a/examples/stm32wl/src/bin/rtc.rs b/examples/stm32wl/src/bin/rtc.rs index 11734e4b6..9ebb05f22 100644 --- a/examples/stm32wl/src/bin/rtc.rs +++ b/examples/stm32wl/src/bin/rtc.rs | |||
| @@ -5,20 +5,18 @@ | |||
| 5 | use chrono::{NaiveDate, NaiveDateTime}; | 5 | use chrono::{NaiveDate, NaiveDateTime}; |
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_stm32::rcc::ClockSrc; | 8 | use embassy_stm32::rcc::{ClockSrc, LsConfig}; |
| 9 | use embassy_stm32::rtc::{Rtc, RtcClockSource, RtcConfig}; | 9 | use embassy_stm32::rtc::{Rtc, RtcConfig}; |
| 10 | use embassy_stm32::time::Hertz; | ||
| 11 | use embassy_stm32::Config; | 10 | use embassy_stm32::Config; |
| 12 | use embassy_time::{Duration, Timer}; | 11 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 12 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 13 | ||
| 15 | #[embassy_executor::main] | 14 | #[embassy_executor::main] |
| 16 | async fn main(_spawner: Spawner) { | 15 | async fn main(_spawner: Spawner) { |
| 17 | let p = { | 16 | let p = { |
| 18 | let mut config = Config::default(); | 17 | let mut config = Config::default(); |
| 19 | config.rcc.mux = ClockSrc::HSE32; | 18 | config.rcc.mux = ClockSrc::HSE; |
| 20 | config.rcc.lse = Some(Hertz(32_768)); | 19 | config.rcc.ls = LsConfig::default_lse(); |
| 21 | config.rcc.rtc_mux = RtcClockSource::LSE; | ||
| 22 | embassy_stm32::init(config) | 20 | embassy_stm32::init(config) |
| 23 | }; | 21 | }; |
| 24 | info!("Hello World!"); | 22 | info!("Hello World!"); |
| @@ -34,7 +32,7 @@ async fn main(_spawner: Spawner) { | |||
| 34 | rtc.set_datetime(now.into()).expect("datetime not set"); | 32 | rtc.set_datetime(now.into()).expect("datetime not set"); |
| 35 | 33 | ||
| 36 | // In reality the delay would be much longer | 34 | // In reality the delay would be much longer |
| 37 | Timer::after(Duration::from_millis(20000)).await; | 35 | Timer::after_millis(20000).await; |
| 38 | 36 | ||
| 39 | let then: NaiveDateTime = rtc.now().unwrap().into(); | 37 | let then: NaiveDateTime = rtc.now().unwrap().into(); |
| 40 | info!("Got RTC! {:?}", then.timestamp()); | 38 | info!("Got RTC! {:?}", then.timestamp()); |
diff --git a/examples/stm32wl/src/bin/uart_async.rs b/examples/stm32wl/src/bin/uart_async.rs index 2c9b7c691..44e8f83a2 100644 --- a/examples/stm32wl/src/bin/uart_async.rs +++ b/examples/stm32wl/src/bin/uart_async.rs | |||
| @@ -21,7 +21,7 @@ but can be surely changed for your needs. | |||
| 21 | #[embassy_executor::main] | 21 | #[embassy_executor::main] |
| 22 | async fn main(_spawner: Spawner) { | 22 | async fn main(_spawner: Spawner) { |
| 23 | let mut config = embassy_stm32::Config::default(); | 23 | let mut config = embassy_stm32::Config::default(); |
| 24 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE32; | 24 | config.rcc.mux = embassy_stm32::rcc::ClockSrc::HSE; |
| 25 | let p = embassy_stm32::init(config); | 25 | let p = embassy_stm32::init(config); |
| 26 | 26 | ||
| 27 | defmt::info!("Starting system"); | 27 | defmt::info!("Starting system"); |
diff --git a/examples/wasm/Cargo.toml b/examples/wasm/Cargo.toml index 12b2e2bd4..29339295a 100644 --- a/examples/wasm/Cargo.toml +++ b/examples/wasm/Cargo.toml | |||
| @@ -10,7 +10,7 @@ crate-type = ["cdylib"] | |||
| 10 | [dependencies] | 10 | [dependencies] |
| 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] } | 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["log"] } |
| 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-wasm", "executor-thread", "log", "nightly", "integrated-timers"] } | 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-wasm", "executor-thread", "log", "nightly", "integrated-timers"] } |
| 13 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["log", "wasm", "nightly"] } | 13 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["log", "wasm", "nightly"] } |
| 14 | 14 | ||
| 15 | wasm-logger = "0.2.0" | 15 | wasm-logger = "0.2.0" |
| 16 | wasm-bindgen = "0.2" | 16 | wasm-bindgen = "0.2" |
diff --git a/examples/wasm/src/lib.rs b/examples/wasm/src/lib.rs index edfe8bafc..1141096fb 100644 --- a/examples/wasm/src/lib.rs +++ b/examples/wasm/src/lib.rs | |||
| @@ -1,7 +1,7 @@ | |||
| 1 | #![feature(type_alias_impl_trait)] | 1 | #![feature(type_alias_impl_trait)] |
| 2 | 2 | ||
| 3 | use embassy_executor::Spawner; | 3 | use embassy_executor::Spawner; |
| 4 | use embassy_time::{Duration, Timer}; | 4 | use embassy_time::Timer; |
| 5 | 5 | ||
| 6 | #[embassy_executor::task] | 6 | #[embassy_executor::task] |
| 7 | async fn ticker() { | 7 | async fn ticker() { |
| @@ -19,7 +19,7 @@ async fn ticker() { | |||
| 19 | log::info!("tick {}", counter); | 19 | log::info!("tick {}", counter); |
| 20 | counter += 1; | 20 | counter += 1; |
| 21 | 21 | ||
| 22 | Timer::after(Duration::from_secs(1)).await; | 22 | Timer::after_secs(1).await; |
| 23 | } | 23 | } |
| 24 | } | 24 | } |
| 25 | 25 | ||
diff --git a/rust-toolchain.toml b/rust-toolchain.toml index 7b34afa2b..755a92075 100644 --- a/rust-toolchain.toml +++ b/rust-toolchain.toml | |||
| @@ -1,8 +1,8 @@ | |||
| 1 | # Before upgrading check that everything is available on all tier1 targets here: | 1 | # Before upgrading check that everything is available on all tier1 targets here: |
| 2 | # https://rust-lang.github.io/rustup-components-history | 2 | # https://rust-lang.github.io/rustup-components-history |
| 3 | [toolchain] | 3 | [toolchain] |
| 4 | channel = "nightly-2023-08-19" | 4 | channel = "nightly-2023-10-02" |
| 5 | components = [ "rust-src", "rustfmt", "llvm-tools-preview" ] | 5 | components = [ "rust-src", "rustfmt", "llvm-tools" ] |
| 6 | targets = [ | 6 | targets = [ |
| 7 | "thumbv7em-none-eabi", | 7 | "thumbv7em-none-eabi", |
| 8 | "thumbv7m-none-eabi", | 8 | "thumbv7m-none-eabi", |
diff --git a/tests/nrf/Cargo.toml b/tests/nrf/Cargo.toml index 08fe1a4b5..96a5871e3 100644 --- a/tests/nrf/Cargo.toml +++ b/tests/nrf/Cargo.toml | |||
| @@ -10,10 +10,10 @@ teleprobe-meta = "1" | |||
| 10 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 10 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt", "nightly"] } | 11 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt", "nightly"] } |
| 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "defmt", "nightly", "integrated-timers"] } | 12 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-cortex-m", "executor-thread", "defmt", "nightly", "integrated-timers"] } |
| 13 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits", "defmt-timestamp-uptime"] } | 13 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits", "defmt-timestamp-uptime"] } |
| 14 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nightly", "unstable-traits", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac"] } | 14 | embassy-nrf = { version = "0.1.0", path = "../../embassy-nrf", features = ["defmt", "nightly", "unstable-traits", "nrf52840", "time-driver-rtc1", "gpiote", "unstable-pac"] } |
| 15 | embedded-io-async = { version = "0.5.0" } | 15 | embedded-io-async = { version = "0.6.0" } |
| 16 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] } | 16 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4", "medium-ethernet", "nightly"] } |
| 17 | embassy-net-esp-hosted = { version = "0.1.0", path = "../../embassy-net-esp-hosted", features = ["defmt"] } | 17 | embassy-net-esp-hosted = { version = "0.1.0", path = "../../embassy-net-esp-hosted", features = ["defmt"] } |
| 18 | embassy-net-enc28j60 = { version = "0.1.0", path = "../../embassy-net-enc28j60", features = ["defmt"] } | 18 | embassy-net-enc28j60 = { version = "0.1.0", path = "../../embassy-net-enc28j60", features = ["defmt"] } |
| 19 | embedded-hal-async = { version = "1.0.0-rc.1" } | 19 | embedded-hal-async = { version = "1.0.0-rc.1" } |
diff --git a/tests/nrf/src/bin/buffered_uart_spam.rs b/tests/nrf/src/bin/buffered_uart_spam.rs index 8abeae6d4..65b9d76d1 100644 --- a/tests/nrf/src/bin/buffered_uart_spam.rs +++ b/tests/nrf/src/bin/buffered_uart_spam.rs | |||
| @@ -13,7 +13,7 @@ use embassy_nrf::gpio::{Level, Output, OutputDrive}; | |||
| 13 | use embassy_nrf::ppi::{Event, Ppi, Task}; | 13 | use embassy_nrf::ppi::{Event, Ppi, Task}; |
| 14 | use embassy_nrf::uarte::Uarte; | 14 | use embassy_nrf::uarte::Uarte; |
| 15 | use embassy_nrf::{bind_interrupts, pac, peripherals, uarte}; | 15 | use embassy_nrf::{bind_interrupts, pac, peripherals, uarte}; |
| 16 | use embassy_time::{Duration, Timer}; | 16 | use embassy_time::Timer; |
| 17 | use {defmt_rtt as _, panic_probe as _}; | 17 | use {defmt_rtt as _, panic_probe as _}; |
| 18 | 18 | ||
| 19 | bind_interrupts!(struct Irqs { | 19 | bind_interrupts!(struct Irqs { |
| @@ -50,7 +50,7 @@ async fn main(_spawner: Spawner) { | |||
| 50 | info!("uarte initialized!"); | 50 | info!("uarte initialized!"); |
| 51 | 51 | ||
| 52 | // uarte needs some quiet time to start rxing properly. | 52 | // uarte needs some quiet time to start rxing properly. |
| 53 | Timer::after(Duration::from_millis(10)).await; | 53 | Timer::after_millis(10).await; |
| 54 | 54 | ||
| 55 | // Tx spam in a loop. | 55 | // Tx spam in a loop. |
| 56 | const NSPAM: usize = 17; | 56 | const NSPAM: usize = 17; |
diff --git a/tests/nrf/src/bin/timer.rs b/tests/nrf/src/bin/timer.rs index c00f35fd1..5723acb01 100644 --- a/tests/nrf/src/bin/timer.rs +++ b/tests/nrf/src/bin/timer.rs | |||
| @@ -5,7 +5,7 @@ teleprobe_meta::target!(b"nrf52840-dk"); | |||
| 5 | 5 | ||
| 6 | use defmt::{assert, info}; | 6 | use defmt::{assert, info}; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_time::{Duration, Instant, Timer}; | 8 | use embassy_time::{Instant, Timer}; |
| 9 | use {defmt_rtt as _, panic_probe as _}; | 9 | use {defmt_rtt as _, panic_probe as _}; |
| 10 | 10 | ||
| 11 | #[embassy_executor::main] | 11 | #[embassy_executor::main] |
| @@ -14,7 +14,7 @@ async fn main(_spawner: Spawner) { | |||
| 14 | info!("Hello World!"); | 14 | info!("Hello World!"); |
| 15 | 15 | ||
| 16 | let start = Instant::now(); | 16 | let start = Instant::now(); |
| 17 | Timer::after(Duration::from_millis(100)).await; | 17 | Timer::after_millis(100).await; |
| 18 | let end = Instant::now(); | 18 | let end = Instant::now(); |
| 19 | let ms = (end - start).as_millis(); | 19 | let ms = (end - start).as_millis(); |
| 20 | info!("slept for {} ms", ms); | 20 | info!("slept for {} ms", ms); |
diff --git a/tests/perf-client/Cargo.toml b/tests/perf-client/Cargo.toml index 3284664d9..bab5ac492 100644 --- a/tests/perf-client/Cargo.toml +++ b/tests/perf-client/Cargo.toml | |||
| @@ -6,7 +6,7 @@ edition = "2021" | |||
| 6 | # See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html | 6 | # See more keys and their definitions at https://doc.rust-lang.org/cargo/reference/manifest.html |
| 7 | 7 | ||
| 8 | [dependencies] | 8 | [dependencies] |
| 9 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4"] } | 9 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "tcp", "dhcpv4"] } |
| 10 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] } | 10 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] } |
| 11 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 11 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 12 | defmt = "0.3.0" | 12 | defmt = "0.3.0" |
diff --git a/tests/perf-client/src/lib.rs b/tests/perf-client/src/lib.rs index a36147dbb..54762379a 100644 --- a/tests/perf-client/src/lib.rs +++ b/tests/perf-client/src/lib.rs | |||
| @@ -16,7 +16,7 @@ pub struct Expected { | |||
| 16 | pub async fn run<D: Driver>(stack: &Stack<D>, expected: Expected) { | 16 | pub async fn run<D: Driver>(stack: &Stack<D>, expected: Expected) { |
| 17 | info!("Waiting for DHCP up..."); | 17 | info!("Waiting for DHCP up..."); |
| 18 | while stack.config_v4().is_none() { | 18 | while stack.config_v4().is_none() { |
| 19 | Timer::after(Duration::from_millis(100)).await; | 19 | Timer::after_millis(100).await; |
| 20 | } | 20 | } |
| 21 | info!("IP addressing up!"); | 21 | info!("IP addressing up!"); |
| 22 | 22 | ||
| @@ -30,6 +30,7 @@ pub async fn run<D: Driver>(stack: &Stack<D>, expected: Expected) { | |||
| 30 | } | 30 | } |
| 31 | 31 | ||
| 32 | const TEST_DURATION: usize = 10; | 32 | const TEST_DURATION: usize = 10; |
| 33 | const IO_BUFFER_SIZE: usize = 1024; | ||
| 33 | const RX_BUFFER_SIZE: usize = 4096; | 34 | const RX_BUFFER_SIZE: usize = 4096; |
| 34 | const TX_BUFFER_SIZE: usize = 4096; | 35 | const TX_BUFFER_SIZE: usize = 4096; |
| 35 | const SERVER_ADDRESS: Ipv4Address = Ipv4Address::new(192, 168, 2, 2); | 36 | const SERVER_ADDRESS: Ipv4Address = Ipv4Address::new(192, 168, 2, 2); |
| @@ -52,7 +53,7 @@ async fn test_download<D: Driver>(stack: &Stack<D>) -> usize { | |||
| 52 | } | 53 | } |
| 53 | info!("connected, testing..."); | 54 | info!("connected, testing..."); |
| 54 | 55 | ||
| 55 | let mut rx_buf = [0; 4096]; | 56 | let mut rx_buf = [0; IO_BUFFER_SIZE]; |
| 56 | let mut total: usize = 0; | 57 | let mut total: usize = 0; |
| 57 | with_timeout(Duration::from_secs(TEST_DURATION as _), async { | 58 | with_timeout(Duration::from_secs(TEST_DURATION as _), async { |
| 58 | loop { | 59 | loop { |
| @@ -92,7 +93,7 @@ async fn test_upload<D: Driver>(stack: &Stack<D>) -> usize { | |||
| 92 | } | 93 | } |
| 93 | info!("connected, testing..."); | 94 | info!("connected, testing..."); |
| 94 | 95 | ||
| 95 | let buf = [0; 4096]; | 96 | let buf = [0; IO_BUFFER_SIZE]; |
| 96 | let mut total: usize = 0; | 97 | let mut total: usize = 0; |
| 97 | with_timeout(Duration::from_secs(TEST_DURATION as _), async { | 98 | with_timeout(Duration::from_secs(TEST_DURATION as _), async { |
| 98 | loop { | 99 | loop { |
| @@ -134,8 +135,8 @@ async fn test_upload_download<D: Driver>(stack: &Stack<D>) -> usize { | |||
| 134 | 135 | ||
| 135 | let (mut reader, mut writer) = socket.split(); | 136 | let (mut reader, mut writer) = socket.split(); |
| 136 | 137 | ||
| 137 | let tx_buf = [0; 4096]; | 138 | let tx_buf = [0; IO_BUFFER_SIZE]; |
| 138 | let mut rx_buf = [0; 4096]; | 139 | let mut rx_buf = [0; IO_BUFFER_SIZE]; |
| 139 | let mut total: usize = 0; | 140 | let mut total: usize = 0; |
| 140 | let tx_fut = async { | 141 | let tx_fut = async { |
| 141 | loop { | 142 | loop { |
diff --git a/tests/riscv32/Cargo.toml b/tests/riscv32/Cargo.toml index 490f037b9..3bb46d37d 100644 --- a/tests/riscv32/Cargo.toml +++ b/tests/riscv32/Cargo.toml | |||
| @@ -8,7 +8,7 @@ license = "MIT OR Apache-2.0" | |||
| 8 | critical-section = { version = "1.1.1", features = ["restore-state-bool"] } | 8 | critical-section = { version = "1.1.1", features = ["restore-state-bool"] } |
| 9 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync" } | 9 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync" } |
| 10 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-riscv32", "nightly", "executor-thread"] } | 10 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["arch-riscv32", "nightly", "executor-thread"] } |
| 11 | embassy-time = { version = "0.1.3", path = "../../embassy-time" } | 11 | embassy-time = { version = "0.1.5", path = "../../embassy-time" } |
| 12 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 12 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 13 | 13 | ||
| 14 | riscv-rt = "0.11" | 14 | riscv-rt = "0.11" |
diff --git a/tests/rp/Cargo.toml b/tests/rp/Cargo.toml index 8bb0de6c6..1fb73857a 100644 --- a/tests/rp/Cargo.toml +++ b/tests/rp/Cargo.toml | |||
| @@ -9,10 +9,10 @@ teleprobe-meta = "1.1" | |||
| 9 | 9 | ||
| 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 10 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 11 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 12 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] } | 12 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "nightly", "unstable-traits"] } |
| 13 | embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["nightly", "defmt", "unstable-pac", "unstable-traits", "time-driver", "critical-section-impl", "intrinsics", "rom-v2-intrinsics", "run-from-ram"] } | 13 | embassy-rp = { version = "0.1.0", path = "../../embassy-rp", features = ["nightly", "defmt", "unstable-pac", "unstable-traits", "time-driver", "critical-section-impl", "intrinsics", "rom-v2-intrinsics", "run-from-ram"] } |
| 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 14 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 15 | embassy-net = { version = "0.1.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } | 15 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } |
| 16 | embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] } | 16 | embassy-net-wiznet = { version = "0.1.0", path = "../../embassy-net-wiznet", features = ["defmt"] } |
| 17 | cyw43 = { path = "../../cyw43", features = ["defmt", "firmware-logs"] } | 17 | cyw43 = { path = "../../cyw43", features = ["defmt", "firmware-logs"] } |
| 18 | cyw43-pio = { path = "../../cyw43-pio", features = ["defmt", "overclock"] } | 18 | cyw43-pio = { path = "../../cyw43-pio", features = ["defmt", "overclock"] } |
| @@ -29,7 +29,7 @@ embedded-hal-async = { version = "=1.0.0-rc.1" } | |||
| 29 | embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] } | 29 | embedded-hal-bus = { version = "=0.1.0-rc.1", features = ["async"] } |
| 30 | panic-probe = { version = "0.3.0", features = ["print-defmt"] } | 30 | panic-probe = { version = "0.3.0", features = ["print-defmt"] } |
| 31 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } | 31 | futures = { version = "0.3.17", default-features = false, features = ["async-await"] } |
| 32 | embedded-io-async = { version = "0.5.0" } | 32 | embedded-io-async = { version = "0.6.0" } |
| 33 | embedded-storage = { version = "0.3" } | 33 | embedded-storage = { version = "0.3" } |
| 34 | static_cell = { version = "1.1", features = ["nightly"]} | 34 | static_cell = { version = "1.1", features = ["nightly"]} |
| 35 | pio = "0.2" | 35 | pio = "0.2" |
diff --git a/tests/rp/src/bin/adc.rs b/tests/rp/src/bin/adc.rs index 0250fd5f4..0c04a55f9 100644 --- a/tests/rp/src/bin/adc.rs +++ b/tests/rp/src/bin/adc.rs | |||
| @@ -93,6 +93,7 @@ async fn main(_spawner: Spawner) { | |||
| 93 | adc.read_many( | 93 | adc.read_many( |
| 94 | &mut Channel::new_pin(&mut p.PIN_29, Pull::Down), | 94 | &mut Channel::new_pin(&mut p.PIN_29, Pull::Down), |
| 95 | &mut low, | 95 | &mut low, |
| 96 | 1, | ||
| 96 | &mut p.DMA_CH0, | 97 | &mut p.DMA_CH0, |
| 97 | ) | 98 | ) |
| 98 | .await | 99 | .await |
| @@ -100,12 +101,18 @@ async fn main(_spawner: Spawner) { | |||
| 100 | adc.read_many( | 101 | adc.read_many( |
| 101 | &mut Channel::new_pin(&mut p.PIN_29, Pull::None), | 102 | &mut Channel::new_pin(&mut p.PIN_29, Pull::None), |
| 102 | &mut none, | 103 | &mut none, |
| 104 | 1, | ||
| 103 | &mut p.DMA_CH0, | 105 | &mut p.DMA_CH0, |
| 104 | ) | 106 | ) |
| 105 | .await | 107 | .await |
| 106 | .unwrap(); | 108 | .unwrap(); |
| 107 | adc.read_many_raw(&mut Channel::new_pin(&mut p.PIN_29, Pull::Up), &mut up, &mut p.DMA_CH0) | 109 | adc.read_many_raw( |
| 108 | .await; | 110 | &mut Channel::new_pin(&mut p.PIN_29, Pull::Up), |
| 111 | &mut up, | ||
| 112 | 1, | ||
| 113 | &mut p.DMA_CH0, | ||
| 114 | ) | ||
| 115 | .await; | ||
| 109 | defmt::assert!(low.iter().zip(none.iter()).all(|(l, n)| *l >> 4 < *n as u16)); | 116 | defmt::assert!(low.iter().zip(none.iter()).all(|(l, n)| *l >> 4 < *n as u16)); |
| 110 | defmt::assert!(up.iter().all(|s| s.good())); | 117 | defmt::assert!(up.iter().all(|s| s.good())); |
| 111 | defmt::assert!(none.iter().zip(up.iter()).all(|(n, u)| (*n as u16) < u.value())); | 118 | defmt::assert!(none.iter().zip(up.iter()).all(|(n, u)| (*n as u16) < u.value())); |
| @@ -115,6 +122,7 @@ async fn main(_spawner: Spawner) { | |||
| 115 | adc.read_many( | 122 | adc.read_many( |
| 116 | &mut Channel::new_temp_sensor(&mut p.ADC_TEMP_SENSOR), | 123 | &mut Channel::new_temp_sensor(&mut p.ADC_TEMP_SENSOR), |
| 117 | &mut temp, | 124 | &mut temp, |
| 125 | 1, | ||
| 118 | &mut p.DMA_CH0, | 126 | &mut p.DMA_CH0, |
| 119 | ) | 127 | ) |
| 120 | .await | 128 | .await |
diff --git a/tests/rp/src/bin/bootsel.rs b/tests/rp/src/bin/bootsel.rs new file mode 100644 index 000000000..4678775eb --- /dev/null +++ b/tests/rp/src/bin/bootsel.rs | |||
| @@ -0,0 +1,26 @@ | |||
| 1 | #![no_std] | ||
| 2 | #![no_main] | ||
| 3 | #![feature(type_alias_impl_trait)] | ||
| 4 | teleprobe_meta::target!(b"rpi-pico"); | ||
| 5 | |||
| 6 | use defmt::{assert_eq, *}; | ||
| 7 | use embassy_executor::Spawner; | ||
| 8 | use embassy_time::Timer; | ||
| 9 | use {defmt_rtt as _, panic_probe as _}; | ||
| 10 | |||
| 11 | #[embassy_executor::main] | ||
| 12 | async fn main(_spawner: Spawner) { | ||
| 13 | let mut p = embassy_rp::init(Default::default()); | ||
| 14 | info!("Hello World!"); | ||
| 15 | |||
| 16 | // add some delay to give an attached debug probe time to parse the | ||
| 17 | // defmt RTT header. Reading that header might touch flash memory, which | ||
| 18 | // interferes with flash write operations. | ||
| 19 | // https://github.com/knurling-rs/defmt/pull/683 | ||
| 20 | Timer::after_millis(10).await; | ||
| 21 | |||
| 22 | assert_eq!(p.BOOTSEL.is_pressed(), false); | ||
| 23 | |||
| 24 | info!("Test OK"); | ||
| 25 | cortex_m::asm::bkpt(); | ||
| 26 | } | ||
diff --git a/tests/rp/src/bin/flash.rs b/tests/rp/src/bin/flash.rs index 75be2bf06..2d85135de 100644 --- a/tests/rp/src/bin/flash.rs +++ b/tests/rp/src/bin/flash.rs | |||
| @@ -6,7 +6,7 @@ teleprobe_meta::target!(b"rpi-pico"); | |||
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_rp::flash::{Async, ERASE_SIZE, FLASH_BASE}; | 8 | use embassy_rp::flash::{Async, ERASE_SIZE, FLASH_BASE}; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | const ADDR_OFFSET: u32 = 0x8000; | 12 | const ADDR_OFFSET: u32 = 0x8000; |
| @@ -20,7 +20,7 @@ async fn main(_spawner: Spawner) { | |||
| 20 | // defmt RTT header. Reading that header might touch flash memory, which | 20 | // defmt RTT header. Reading that header might touch flash memory, which |
| 21 | // interferes with flash write operations. | 21 | // interferes with flash write operations. |
| 22 | // https://github.com/knurling-rs/defmt/pull/683 | 22 | // https://github.com/knurling-rs/defmt/pull/683 |
| 23 | Timer::after(Duration::from_millis(10)).await; | 23 | Timer::after_millis(10).await; |
| 24 | 24 | ||
| 25 | let mut flash = embassy_rp::flash::Flash::<_, Async, { 2 * 1024 * 1024 }>::new(p.FLASH, p.DMA_CH0); | 25 | let mut flash = embassy_rp::flash::Flash::<_, Async, { 2 * 1024 * 1024 }>::new(p.FLASH, p.DMA_CH0); |
| 26 | 26 | ||
diff --git a/tests/rp/src/bin/float.rs b/tests/rp/src/bin/float.rs index 2874aa910..1e89c10f8 100644 --- a/tests/rp/src/bin/float.rs +++ b/tests/rp/src/bin/float.rs | |||
| @@ -6,7 +6,7 @@ teleprobe_meta::target!(b"rpi-pico"); | |||
| 6 | use defmt::*; | 6 | use defmt::*; |
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_rp::pac; | 8 | use embassy_rp::pac; |
| 9 | use embassy_time::{Duration, Timer}; | 9 | use embassy_time::Timer; |
| 10 | use {defmt_rtt as _, panic_probe as _}; | 10 | use {defmt_rtt as _, panic_probe as _}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| @@ -40,7 +40,7 @@ async fn main(_spawner: Spawner) { | |||
| 40 | rad_d + PI_D, | 40 | rad_d + PI_D, |
| 41 | rad_d % PI_D | 41 | rad_d % PI_D |
| 42 | ); | 42 | ); |
| 43 | Timer::after(Duration::from_millis(10)).await; | 43 | Timer::after_millis(10).await; |
| 44 | } | 44 | } |
| 45 | 45 | ||
| 46 | let rom_accesses = pac::BUSCTRL.perfctr(0).read().perfctr(); | 46 | let rom_accesses = pac::BUSCTRL.perfctr(0).read().perfctr(); |
diff --git a/tests/rp/src/bin/gpio_async.rs b/tests/rp/src/bin/gpio_async.rs index 60c65b7a0..26582f74b 100644 --- a/tests/rp/src/bin/gpio_async.rs +++ b/tests/rp/src/bin/gpio_async.rs | |||
| @@ -27,7 +27,7 @@ async fn main(_spawner: Spawner) { | |||
| 27 | 27 | ||
| 28 | let set_high_future = async { | 28 | let set_high_future = async { |
| 29 | // Allow time for wait_for_high_future to await wait_for_high(). | 29 | // Allow time for wait_for_high_future to await wait_for_high(). |
| 30 | Timer::after(Duration::from_millis(10)).await; | 30 | Timer::after_millis(10).await; |
| 31 | output.set_high(); | 31 | output.set_high(); |
| 32 | }; | 32 | }; |
| 33 | let wait_for_high_future = async { | 33 | let wait_for_high_future = async { |
| @@ -47,7 +47,7 @@ async fn main(_spawner: Spawner) { | |||
| 47 | assert!(input.is_high(), "input was expected to be high"); | 47 | assert!(input.is_high(), "input was expected to be high"); |
| 48 | 48 | ||
| 49 | let set_low_future = async { | 49 | let set_low_future = async { |
| 50 | Timer::after(Duration::from_millis(10)).await; | 50 | Timer::after_millis(10).await; |
| 51 | output.set_low(); | 51 | output.set_low(); |
| 52 | }; | 52 | }; |
| 53 | let wait_for_low_future = async { | 53 | let wait_for_low_future = async { |
| @@ -67,7 +67,7 @@ async fn main(_spawner: Spawner) { | |||
| 67 | assert!(input.is_low(), "input was expected to be low"); | 67 | assert!(input.is_low(), "input was expected to be low"); |
| 68 | 68 | ||
| 69 | let set_high_future = async { | 69 | let set_high_future = async { |
| 70 | Timer::after(Duration::from_millis(10)).await; | 70 | Timer::after_millis(10).await; |
| 71 | output.set_high(); | 71 | output.set_high(); |
| 72 | }; | 72 | }; |
| 73 | let wait_for_rising_edge_future = async { | 73 | let wait_for_rising_edge_future = async { |
| @@ -87,7 +87,7 @@ async fn main(_spawner: Spawner) { | |||
| 87 | assert!(input.is_high(), "input was expected to be high"); | 87 | assert!(input.is_high(), "input was expected to be high"); |
| 88 | 88 | ||
| 89 | let set_low_future = async { | 89 | let set_low_future = async { |
| 90 | Timer::after(Duration::from_millis(10)).await; | 90 | Timer::after_millis(10).await; |
| 91 | output.set_low(); | 91 | output.set_low(); |
| 92 | }; | 92 | }; |
| 93 | let wait_for_falling_edge_future = async { | 93 | let wait_for_falling_edge_future = async { |
| @@ -107,7 +107,7 @@ async fn main(_spawner: Spawner) { | |||
| 107 | assert!(input.is_high(), "input was expected to be high"); | 107 | assert!(input.is_high(), "input was expected to be high"); |
| 108 | 108 | ||
| 109 | let set_low_future = async { | 109 | let set_low_future = async { |
| 110 | Timer::after(Duration::from_millis(10)).await; | 110 | Timer::after_millis(10).await; |
| 111 | output.set_low(); | 111 | output.set_low(); |
| 112 | }; | 112 | }; |
| 113 | let wait_for_any_edge_future = async { | 113 | let wait_for_any_edge_future = async { |
| @@ -127,7 +127,7 @@ async fn main(_spawner: Spawner) { | |||
| 127 | assert!(input.is_low(), "input was expected to be low"); | 127 | assert!(input.is_low(), "input was expected to be low"); |
| 128 | 128 | ||
| 129 | let set_high_future = async { | 129 | let set_high_future = async { |
| 130 | Timer::after(Duration::from_millis(10)).await; | 130 | Timer::after_millis(10).await; |
| 131 | output.set_high(); | 131 | output.set_high(); |
| 132 | }; | 132 | }; |
| 133 | let wait_for_any_edge_future = async { | 133 | let wait_for_any_edge_future = async { |
diff --git a/tests/rp/src/bin/pwm.rs b/tests/rp/src/bin/pwm.rs index 8c02b8441..8c9db1158 100644 --- a/tests/rp/src/bin/pwm.rs +++ b/tests/rp/src/bin/pwm.rs | |||
| @@ -7,7 +7,7 @@ use defmt::{assert, assert_eq, assert_ne, *}; | |||
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_rp::gpio::{Input, Level, Output, Pull}; | 8 | use embassy_rp::gpio::{Input, Level, Output, Pull}; |
| 9 | use embassy_rp::pwm::{Config, InputMode, Pwm}; | 9 | use embassy_rp::pwm::{Config, InputMode, Pwm}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | #[embassy_executor::main] | 13 | #[embassy_executor::main] |
| @@ -48,13 +48,13 @@ async fn main(_spawner: Spawner) { | |||
| 48 | { | 48 | { |
| 49 | let pin1 = Input::new(&mut p9, Pull::None); | 49 | let pin1 = Input::new(&mut p9, Pull::None); |
| 50 | let _pwm = Pwm::new_output_a(&mut p.PWM_CH3, &mut p6, cfg.clone()); | 50 | let _pwm = Pwm::new_output_a(&mut p.PWM_CH3, &mut p6, cfg.clone()); |
| 51 | Timer::after(Duration::from_millis(1)).await; | 51 | Timer::after_millis(1).await; |
| 52 | assert_eq!(pin1.is_low(), invert_a); | 52 | assert_eq!(pin1.is_low(), invert_a); |
| 53 | Timer::after(Duration::from_millis(5)).await; | 53 | Timer::after_millis(5).await; |
| 54 | assert_eq!(pin1.is_high(), invert_a); | 54 | assert_eq!(pin1.is_high(), invert_a); |
| 55 | Timer::after(Duration::from_millis(5)).await; | 55 | Timer::after_millis(5).await; |
| 56 | assert_eq!(pin1.is_low(), invert_a); | 56 | assert_eq!(pin1.is_low(), invert_a); |
| 57 | Timer::after(Duration::from_millis(5)).await; | 57 | Timer::after_millis(5).await; |
| 58 | assert_eq!(pin1.is_high(), invert_a); | 58 | assert_eq!(pin1.is_high(), invert_a); |
| 59 | } | 59 | } |
| 60 | 60 | ||
| @@ -62,13 +62,13 @@ async fn main(_spawner: Spawner) { | |||
| 62 | { | 62 | { |
| 63 | let pin2 = Input::new(&mut p11, Pull::None); | 63 | let pin2 = Input::new(&mut p11, Pull::None); |
| 64 | let _pwm = Pwm::new_output_b(&mut p.PWM_CH3, &mut p7, cfg.clone()); | 64 | let _pwm = Pwm::new_output_b(&mut p.PWM_CH3, &mut p7, cfg.clone()); |
| 65 | Timer::after(Duration::from_millis(1)).await; | 65 | Timer::after_millis(1).await; |
| 66 | assert_ne!(pin2.is_low(), invert_a); | 66 | assert_ne!(pin2.is_low(), invert_a); |
| 67 | Timer::after(Duration::from_millis(5)).await; | 67 | Timer::after_millis(5).await; |
| 68 | assert_ne!(pin2.is_high(), invert_a); | 68 | assert_ne!(pin2.is_high(), invert_a); |
| 69 | Timer::after(Duration::from_millis(5)).await; | 69 | Timer::after_millis(5).await; |
| 70 | assert_ne!(pin2.is_low(), invert_a); | 70 | assert_ne!(pin2.is_low(), invert_a); |
| 71 | Timer::after(Duration::from_millis(5)).await; | 71 | Timer::after_millis(5).await; |
| 72 | assert_ne!(pin2.is_high(), invert_a); | 72 | assert_ne!(pin2.is_high(), invert_a); |
| 73 | } | 73 | } |
| 74 | 74 | ||
| @@ -77,16 +77,16 @@ async fn main(_spawner: Spawner) { | |||
| 77 | let pin1 = Input::new(&mut p9, Pull::None); | 77 | let pin1 = Input::new(&mut p9, Pull::None); |
| 78 | let pin2 = Input::new(&mut p11, Pull::None); | 78 | let pin2 = Input::new(&mut p11, Pull::None); |
| 79 | let _pwm = Pwm::new_output_ab(&mut p.PWM_CH3, &mut p6, &mut p7, cfg.clone()); | 79 | let _pwm = Pwm::new_output_ab(&mut p.PWM_CH3, &mut p6, &mut p7, cfg.clone()); |
| 80 | Timer::after(Duration::from_millis(1)).await; | 80 | Timer::after_millis(1).await; |
| 81 | assert_eq!(pin1.is_low(), invert_a); | 81 | assert_eq!(pin1.is_low(), invert_a); |
| 82 | assert_ne!(pin2.is_low(), invert_a); | 82 | assert_ne!(pin2.is_low(), invert_a); |
| 83 | Timer::after(Duration::from_millis(5)).await; | 83 | Timer::after_millis(5).await; |
| 84 | assert_eq!(pin1.is_high(), invert_a); | 84 | assert_eq!(pin1.is_high(), invert_a); |
| 85 | assert_ne!(pin2.is_high(), invert_a); | 85 | assert_ne!(pin2.is_high(), invert_a); |
| 86 | Timer::after(Duration::from_millis(5)).await; | 86 | Timer::after_millis(5).await; |
| 87 | assert_eq!(pin1.is_low(), invert_a); | 87 | assert_eq!(pin1.is_low(), invert_a); |
| 88 | assert_ne!(pin2.is_low(), invert_a); | 88 | assert_ne!(pin2.is_low(), invert_a); |
| 89 | Timer::after(Duration::from_millis(5)).await; | 89 | Timer::after_millis(5).await; |
| 90 | assert_eq!(pin1.is_high(), invert_a); | 90 | assert_eq!(pin1.is_high(), invert_a); |
| 91 | assert_ne!(pin2.is_high(), invert_a); | 91 | assert_ne!(pin2.is_high(), invert_a); |
| 92 | } | 92 | } |
| @@ -97,14 +97,14 @@ async fn main(_spawner: Spawner) { | |||
| 97 | let mut pin2 = Output::new(&mut p11, Level::Low); | 97 | let mut pin2 = Output::new(&mut p11, Level::Low); |
| 98 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::Level, cfg.clone()); | 98 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::Level, cfg.clone()); |
| 99 | assert_eq!(pwm.counter(), 0); | 99 | assert_eq!(pwm.counter(), 0); |
| 100 | Timer::after(Duration::from_millis(5)).await; | 100 | Timer::after_millis(5).await; |
| 101 | assert_eq!(pwm.counter(), 0); | 101 | assert_eq!(pwm.counter(), 0); |
| 102 | pin2.set_high(); | 102 | pin2.set_high(); |
| 103 | Timer::after(Duration::from_millis(1)).await; | 103 | Timer::after_millis(1).await; |
| 104 | pin2.set_low(); | 104 | pin2.set_low(); |
| 105 | let ctr = pwm.counter(); | 105 | let ctr = pwm.counter(); |
| 106 | assert!(ctr >= 1000); | 106 | assert!(ctr >= 1000); |
| 107 | Timer::after(Duration::from_millis(1)).await; | 107 | Timer::after_millis(1).await; |
| 108 | assert_eq!(pwm.counter(), ctr); | 108 | assert_eq!(pwm.counter(), ctr); |
| 109 | } | 109 | } |
| 110 | 110 | ||
| @@ -113,13 +113,13 @@ async fn main(_spawner: Spawner) { | |||
| 113 | let mut pin2 = Output::new(&mut p11, Level::Low); | 113 | let mut pin2 = Output::new(&mut p11, Level::Low); |
| 114 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::RisingEdge, cfg.clone()); | 114 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::RisingEdge, cfg.clone()); |
| 115 | assert_eq!(pwm.counter(), 0); | 115 | assert_eq!(pwm.counter(), 0); |
| 116 | Timer::after(Duration::from_millis(5)).await; | 116 | Timer::after_millis(5).await; |
| 117 | assert_eq!(pwm.counter(), 0); | 117 | assert_eq!(pwm.counter(), 0); |
| 118 | pin2.set_high(); | 118 | pin2.set_high(); |
| 119 | Timer::after(Duration::from_millis(1)).await; | 119 | Timer::after_millis(1).await; |
| 120 | pin2.set_low(); | 120 | pin2.set_low(); |
| 121 | assert_eq!(pwm.counter(), 1); | 121 | assert_eq!(pwm.counter(), 1); |
| 122 | Timer::after(Duration::from_millis(1)).await; | 122 | Timer::after_millis(1).await; |
| 123 | assert_eq!(pwm.counter(), 1); | 123 | assert_eq!(pwm.counter(), 1); |
| 124 | } | 124 | } |
| 125 | 125 | ||
| @@ -128,13 +128,13 @@ async fn main(_spawner: Spawner) { | |||
| 128 | let mut pin2 = Output::new(&mut p11, Level::High); | 128 | let mut pin2 = Output::new(&mut p11, Level::High); |
| 129 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::FallingEdge, cfg.clone()); | 129 | let pwm = Pwm::new_input(&mut p.PWM_CH3, &mut p7, InputMode::FallingEdge, cfg.clone()); |
| 130 | assert_eq!(pwm.counter(), 0); | 130 | assert_eq!(pwm.counter(), 0); |
| 131 | Timer::after(Duration::from_millis(5)).await; | 131 | Timer::after_millis(5).await; |
| 132 | assert_eq!(pwm.counter(), 0); | 132 | assert_eq!(pwm.counter(), 0); |
| 133 | pin2.set_low(); | 133 | pin2.set_low(); |
| 134 | Timer::after(Duration::from_millis(1)).await; | 134 | Timer::after_millis(1).await; |
| 135 | pin2.set_high(); | 135 | pin2.set_high(); |
| 136 | assert_eq!(pwm.counter(), 1); | 136 | assert_eq!(pwm.counter(), 1); |
| 137 | Timer::after(Duration::from_millis(1)).await; | 137 | Timer::after_millis(1).await; |
| 138 | assert_eq!(pwm.counter(), 1); | 138 | assert_eq!(pwm.counter(), 1); |
| 139 | } | 139 | } |
| 140 | 140 | ||
diff --git a/tests/rp/src/bin/uart.rs b/tests/rp/src/bin/uart.rs index 00f3e1949..8d351a3a7 100644 --- a/tests/rp/src/bin/uart.rs +++ b/tests/rp/src/bin/uart.rs | |||
| @@ -7,7 +7,7 @@ use defmt::{assert_eq, *}; | |||
| 7 | use embassy_executor::Spawner; | 7 | use embassy_executor::Spawner; |
| 8 | use embassy_rp::gpio::{Level, Output}; | 8 | use embassy_rp::gpio::{Level, Output}; |
| 9 | use embassy_rp::uart::{Blocking, Config, Error, Instance, Parity, Uart, UartRx}; | 9 | use embassy_rp::uart::{Blocking, Config, Error, Instance, Parity, Uart, UartRx}; |
| 10 | use embassy_time::{Duration, Timer}; | 10 | use embassy_time::Timer; |
| 11 | use {defmt_rtt as _, panic_probe as _}; | 11 | use {defmt_rtt as _, panic_probe as _}; |
| 12 | 12 | ||
| 13 | fn read<const N: usize>(uart: &mut Uart<'_, impl Instance, Blocking>) -> Result<[u8; N], Error> { | 13 | fn read<const N: usize>(uart: &mut Uart<'_, impl Instance, Blocking>) -> Result<[u8; N], Error> { |
| @@ -24,14 +24,14 @@ fn read1<const N: usize>(uart: &mut UartRx<'_, impl Instance, Blocking>) -> Resu | |||
| 24 | 24 | ||
| 25 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { | 25 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { |
| 26 | pin.set_low(); | 26 | pin.set_low(); |
| 27 | Timer::after(Duration::from_millis(1)).await; | 27 | Timer::after_millis(1).await; |
| 28 | for i in 0..8 { | 28 | for i in 0..8 { |
| 29 | if v & (1 << i) == 0 { | 29 | if v & (1 << i) == 0 { |
| 30 | pin.set_low(); | 30 | pin.set_low(); |
| 31 | } else { | 31 | } else { |
| 32 | pin.set_high(); | 32 | pin.set_high(); |
| 33 | } | 33 | } |
| 34 | Timer::after(Duration::from_millis(1)).await; | 34 | Timer::after_millis(1).await; |
| 35 | } | 35 | } |
| 36 | if let Some(b) = parity { | 36 | if let Some(b) = parity { |
| 37 | if b { | 37 | if b { |
| @@ -39,10 +39,10 @@ async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: O | |||
| 39 | } else { | 39 | } else { |
| 40 | pin.set_low(); | 40 | pin.set_low(); |
| 41 | } | 41 | } |
| 42 | Timer::after(Duration::from_millis(1)).await; | 42 | Timer::after_millis(1).await; |
| 43 | } | 43 | } |
| 44 | pin.set_high(); | 44 | pin.set_high(); |
| 45 | Timer::after(Duration::from_millis(1)).await; | 45 | Timer::after_millis(1).await; |
| 46 | } | 46 | } |
| 47 | 47 | ||
| 48 | #[embassy_executor::main] | 48 | #[embassy_executor::main] |
diff --git a/tests/rp/src/bin/uart_buffered.rs b/tests/rp/src/bin/uart_buffered.rs index 6ab7de29e..6a9c910ff 100644 --- a/tests/rp/src/bin/uart_buffered.rs +++ b/tests/rp/src/bin/uart_buffered.rs | |||
| @@ -9,7 +9,7 @@ use embassy_rp::bind_interrupts; | |||
| 9 | use embassy_rp::gpio::{Level, Output}; | 9 | use embassy_rp::gpio::{Level, Output}; |
| 10 | use embassy_rp::peripherals::UART0; | 10 | use embassy_rp::peripherals::UART0; |
| 11 | use embassy_rp::uart::{BufferedInterruptHandler, BufferedUart, BufferedUartRx, Config, Error, Instance, Parity}; | 11 | use embassy_rp::uart::{BufferedInterruptHandler, BufferedUart, BufferedUartRx, Config, Error, Instance, Parity}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use embedded_io_async::{Read, ReadExactError, Write}; | 13 | use embedded_io_async::{Read, ReadExactError, Write}; |
| 14 | use {defmt_rtt as _, panic_probe as _}; | 14 | use {defmt_rtt as _, panic_probe as _}; |
| 15 | 15 | ||
| @@ -39,14 +39,14 @@ async fn read1<const N: usize>(uart: &mut BufferedUartRx<'_, impl Instance>) -> | |||
| 39 | 39 | ||
| 40 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { | 40 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { |
| 41 | pin.set_low(); | 41 | pin.set_low(); |
| 42 | Timer::after(Duration::from_millis(1)).await; | 42 | Timer::after_millis(1).await; |
| 43 | for i in 0..8 { | 43 | for i in 0..8 { |
| 44 | if v & (1 << i) == 0 { | 44 | if v & (1 << i) == 0 { |
| 45 | pin.set_low(); | 45 | pin.set_low(); |
| 46 | } else { | 46 | } else { |
| 47 | pin.set_high(); | 47 | pin.set_high(); |
| 48 | } | 48 | } |
| 49 | Timer::after(Duration::from_millis(1)).await; | 49 | Timer::after_millis(1).await; |
| 50 | } | 50 | } |
| 51 | if let Some(b) = parity { | 51 | if let Some(b) = parity { |
| 52 | if b { | 52 | if b { |
| @@ -54,10 +54,10 @@ async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: O | |||
| 54 | } else { | 54 | } else { |
| 55 | pin.set_low(); | 55 | pin.set_low(); |
| 56 | } | 56 | } |
| 57 | Timer::after(Duration::from_millis(1)).await; | 57 | Timer::after_millis(1).await; |
| 58 | } | 58 | } |
| 59 | pin.set_high(); | 59 | pin.set_high(); |
| 60 | Timer::after(Duration::from_millis(1)).await; | 60 | Timer::after_millis(1).await; |
| 61 | } | 61 | } |
| 62 | 62 | ||
| 63 | #[embassy_executor::main] | 63 | #[embassy_executor::main] |
diff --git a/tests/rp/src/bin/uart_dma.rs b/tests/rp/src/bin/uart_dma.rs index cd4af1ef2..e79fcde60 100644 --- a/tests/rp/src/bin/uart_dma.rs +++ b/tests/rp/src/bin/uart_dma.rs | |||
| @@ -9,7 +9,7 @@ use embassy_rp::bind_interrupts; | |||
| 9 | use embassy_rp::gpio::{Level, Output}; | 9 | use embassy_rp::gpio::{Level, Output}; |
| 10 | use embassy_rp::peripherals::UART0; | 10 | use embassy_rp::peripherals::UART0; |
| 11 | use embassy_rp::uart::{Async, Config, Error, Instance, InterruptHandler, Parity, Uart, UartRx}; | 11 | use embassy_rp::uart::{Async, Config, Error, Instance, InterruptHandler, Parity, Uart, UartRx}; |
| 12 | use embassy_time::{Duration, Timer}; | 12 | use embassy_time::Timer; |
| 13 | use {defmt_rtt as _, panic_probe as _}; | 13 | use {defmt_rtt as _, panic_probe as _}; |
| 14 | 14 | ||
| 15 | bind_interrupts!(struct Irqs { | 15 | bind_interrupts!(struct Irqs { |
| @@ -30,14 +30,14 @@ async fn read1<const N: usize>(uart: &mut UartRx<'_, impl Instance, Async>) -> R | |||
| 30 | 30 | ||
| 31 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { | 31 | async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: Option<bool>) { |
| 32 | pin.set_low(); | 32 | pin.set_low(); |
| 33 | Timer::after(Duration::from_millis(1)).await; | 33 | Timer::after_millis(1).await; |
| 34 | for i in 0..8 { | 34 | for i in 0..8 { |
| 35 | if v & (1 << i) == 0 { | 35 | if v & (1 << i) == 0 { |
| 36 | pin.set_low(); | 36 | pin.set_low(); |
| 37 | } else { | 37 | } else { |
| 38 | pin.set_high(); | 38 | pin.set_high(); |
| 39 | } | 39 | } |
| 40 | Timer::after(Duration::from_millis(1)).await; | 40 | Timer::after_millis(1).await; |
| 41 | } | 41 | } |
| 42 | if let Some(b) = parity { | 42 | if let Some(b) = parity { |
| 43 | if b { | 43 | if b { |
| @@ -45,10 +45,10 @@ async fn send(pin: &mut Output<'_, impl embassy_rp::gpio::Pin>, v: u8, parity: O | |||
| 45 | } else { | 45 | } else { |
| 46 | pin.set_low(); | 46 | pin.set_low(); |
| 47 | } | 47 | } |
| 48 | Timer::after(Duration::from_millis(1)).await; | 48 | Timer::after_millis(1).await; |
| 49 | } | 49 | } |
| 50 | pin.set_high(); | 50 | pin.set_high(); |
| 51 | Timer::after(Duration::from_millis(1)).await; | 51 | Timer::after_millis(1).await; |
| 52 | } | 52 | } |
| 53 | 53 | ||
| 54 | #[embassy_executor::main] | 54 | #[embassy_executor::main] |
| @@ -105,7 +105,7 @@ async fn main(_spawner: Spawner) { | |||
| 105 | // new data is accepted, latest overrunning byte first | 105 | // new data is accepted, latest overrunning byte first |
| 106 | assert_eq!(read(&mut uart).await, Ok([3])); | 106 | assert_eq!(read(&mut uart).await, Ok([3])); |
| 107 | uart.blocking_write(&[8, 9]).unwrap(); | 107 | uart.blocking_write(&[8, 9]).unwrap(); |
| 108 | Timer::after(Duration::from_millis(1)).await; | 108 | Timer::after_millis(1).await; |
| 109 | assert_eq!(read(&mut uart).await, Ok([8, 9])); | 109 | assert_eq!(read(&mut uart).await, Ok([8, 9])); |
| 110 | } | 110 | } |
| 111 | 111 | ||
diff --git a/tests/stm32/Cargo.toml b/tests/stm32/Cargo.toml index bfe5bc823..b1b2f55c3 100644 --- a/tests/stm32/Cargo.toml +++ b/tests/stm32/Cargo.toml | |||
| @@ -6,21 +6,28 @@ license = "MIT OR Apache-2.0" | |||
| 6 | autobins = false | 6 | autobins = false |
| 7 | 7 | ||
| 8 | [features] | 8 | [features] |
| 9 | stm32f103c8 = ["embassy-stm32/stm32f103c8", "not-gpdma"] # Blue Pill | 9 | stm32f103c8 = ["embassy-stm32/stm32f103c8", "not-gpdma"] |
| 10 | stm32f429zi = ["embassy-stm32/stm32f429zi", "chrono", "stop", "can", "not-gpdma", "dac-adc-pin"] # Nucleo "sdmmc" | 10 | stm32f429zi = ["embassy-stm32/stm32f429zi", "chrono", "eth", "stop", "can", "not-gpdma", "dac-adc-pin", "rng"] |
| 11 | stm32g071rb = ["embassy-stm32/stm32g071rb", "not-gpdma", "dac-adc-pin"] # Nucleo | 11 | stm32g071rb = ["embassy-stm32/stm32g071rb", "not-gpdma", "dac-adc-pin"] |
| 12 | stm32c031c6 = ["embassy-stm32/stm32c031c6", "not-gpdma"] # Nucleo | 12 | stm32c031c6 = ["embassy-stm32/stm32c031c6", "not-gpdma"] |
| 13 | stm32g491re = ["embassy-stm32/stm32g491re", "not-gpdma"] # Nucleo | 13 | stm32g491re = ["embassy-stm32/stm32g491re", "chrono", "not-gpdma", "rng"] |
| 14 | stm32h755zi = ["embassy-stm32/stm32h755zi-cm7", "not-gpdma", "dac-adc-pin"] # Nucleo | 14 | stm32h755zi = ["embassy-stm32/stm32h755zi-cm7", "chrono", "not-gpdma", "eth", "dac-adc-pin", "rng"] |
| 15 | stm32wb55rg = ["embassy-stm32/stm32wb55rg", "not-gpdma", "ble", "mac" ] # Nucleo | 15 | stm32wb55rg = ["embassy-stm32/stm32wb55rg", "chrono", "not-gpdma", "ble", "mac" , "rng"] |
| 16 | stm32h563zi = ["embassy-stm32/stm32h563zi"] # Nucleo | 16 | stm32h563zi = ["embassy-stm32/stm32h563zi", "chrono", "eth", "rng"] |
| 17 | stm32u585ai = ["embassy-stm32/stm32u585ai"] # IoT board | 17 | stm32u585ai = ["embassy-stm32/stm32u585ai", "chrono", "rng"] |
| 18 | stm32l073rz = ["embassy-stm32/stm32l073rz", "not-gpdma"] # Nucleo | 18 | stm32l073rz = ["embassy-stm32/stm32l073rz", "not-gpdma", "rng"] |
| 19 | stm32l152re = ["embassy-stm32/stm32l152re", "not-gpdma"] # Nucleo | 19 | stm32l152re = ["embassy-stm32/stm32l152re", "chrono", "not-gpdma"] |
| 20 | stm32l4a6zg = ["embassy-stm32/stm32l4a6zg", "not-gpdma"] # Nucleo | 20 | stm32l4a6zg = ["embassy-stm32/stm32l4a6zg", "chrono", "not-gpdma", "rng"] |
| 21 | stm32l4r5zi = ["embassy-stm32/stm32l4r5zi", "not-gpdma"] # Nucleo | 21 | stm32l4r5zi = ["embassy-stm32/stm32l4r5zi", "chrono", "not-gpdma", "rng"] |
| 22 | stm32l552ze = ["embassy-stm32/stm32l552ze", "not-gpdma"] # Nucleo | 22 | stm32l552ze = ["embassy-stm32/stm32l552ze", "not-gpdma", "rng"] |
| 23 | 23 | stm32f767zi = ["embassy-stm32/stm32f767zi", "chrono", "not-gpdma", "eth", "rng"] | |
| 24 | stm32f207zg = ["embassy-stm32/stm32f207zg", "chrono", "not-gpdma", "eth", "rng"] | ||
| 25 | stm32f303ze = ["embassy-stm32/stm32f303ze", "chrono", "not-gpdma"] | ||
| 26 | stm32l496zg = ["embassy-stm32/stm32l496zg", "not-gpdma", "rng"] | ||
| 27 | stm32wl55jc = ["embassy-stm32/stm32wl55jc-cm4", "not-gpdma", "rng", "chrono"] | ||
| 28 | |||
| 29 | eth = [] | ||
| 30 | rng = [] | ||
| 24 | sdmmc = [] | 31 | sdmmc = [] |
| 25 | stop = ["embassy-stm32/low-power"] | 32 | stop = ["embassy-stm32/low-power"] |
| 26 | chrono = ["embassy-stm32/chrono", "dep:chrono"] | 33 | chrono = ["embassy-stm32/chrono", "dep:chrono"] |
| @@ -36,10 +43,12 @@ teleprobe-meta = "1" | |||
| 36 | 43 | ||
| 37 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } | 44 | embassy-sync = { version = "0.3.0", path = "../../embassy-sync", features = ["defmt"] } |
| 38 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } | 45 | embassy-executor = { version = "0.3.0", path = "../../embassy-executor", features = ["nightly", "arch-cortex-m", "executor-thread", "defmt", "integrated-timers"] } |
| 39 | embassy-time = { version = "0.1.3", path = "../../embassy-time", features = ["defmt", "tick-hz-32_768", "defmt-timestamp-uptime"] } | 46 | embassy-time = { version = "0.1.5", path = "../../embassy-time", features = ["defmt", "tick-hz-131_072", "defmt-timestamp-uptime"] } |
| 40 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "memory-x", "time-driver-any"] } | 47 | embassy-stm32 = { version = "0.1.0", path = "../../embassy-stm32", features = ["nightly", "defmt", "unstable-pac", "memory-x", "time-driver-any"] } |
| 41 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } | 48 | embassy-futures = { version = "0.1.0", path = "../../embassy-futures" } |
| 42 | embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", optional = true, features = ["defmt", "stm32wb55rg", "ble"] } | 49 | embassy-stm32-wpan = { version = "0.1.0", path = "../../embassy-stm32-wpan", optional = true, features = ["defmt", "stm32wb55rg", "ble"] } |
| 50 | embassy-net = { version = "0.2.0", path = "../../embassy-net", features = ["defmt", "nightly", "tcp", "udp", "dhcpv4", "medium-ethernet"] } | ||
| 51 | perf-client = { path = "../perf-client" } | ||
| 43 | 52 | ||
| 44 | defmt = "0.3.0" | 53 | defmt = "0.3.0" |
| 45 | defmt-rtt = "0.4" | 54 | defmt-rtt = "0.4" |
| @@ -70,11 +79,21 @@ path = "src/bin/dac.rs" | |||
| 70 | required-features = [ "dac-adc-pin",] | 79 | required-features = [ "dac-adc-pin",] |
| 71 | 80 | ||
| 72 | [[bin]] | 81 | [[bin]] |
| 82 | name = "eth" | ||
| 83 | path = "src/bin/eth.rs" | ||
| 84 | required-features = [ "eth",] | ||
| 85 | |||
| 86 | [[bin]] | ||
| 73 | name = "gpio" | 87 | name = "gpio" |
| 74 | path = "src/bin/gpio.rs" | 88 | path = "src/bin/gpio.rs" |
| 75 | required-features = [] | 89 | required-features = [] |
| 76 | 90 | ||
| 77 | [[bin]] | 91 | [[bin]] |
| 92 | name = "rng" | ||
| 93 | path = "src/bin/rng.rs" | ||
| 94 | required-features = [ "rng",] | ||
| 95 | |||
| 96 | [[bin]] | ||
| 78 | name = "rtc" | 97 | name = "rtc" |
| 79 | path = "src/bin/rtc.rs" | 98 | path = "src/bin/rtc.rs" |
| 80 | required-features = [ "chrono",] | 99 | required-features = [ "chrono",] |
diff --git a/tests/stm32/build.rs b/tests/stm32/build.rs index 9aabf8541..c5d0e40d6 100644 --- a/tests/stm32/build.rs +++ b/tests/stm32/build.rs | |||
| @@ -8,12 +8,14 @@ fn main() -> Result<(), Box<dyn Error>> { | |||
| 8 | println!("cargo:rustc-link-search={}", out.display()); | 8 | println!("cargo:rustc-link-search={}", out.display()); |
| 9 | println!("cargo:rustc-link-arg-bins=--nmagic"); | 9 | println!("cargo:rustc-link-arg-bins=--nmagic"); |
| 10 | 10 | ||
| 11 | // too little RAM to run from RAM. | ||
| 12 | if cfg!(any( | 11 | if cfg!(any( |
| 12 | // too little RAM to run from RAM. | ||
| 13 | feature = "stm32f103c8", | 13 | feature = "stm32f103c8", |
| 14 | feature = "stm32c031c6", | 14 | feature = "stm32c031c6", |
| 15 | feature = "stm32wb55rg", | 15 | feature = "stm32wb55rg", |
| 16 | feature = "stm32l073rz", | 16 | feature = "stm32l073rz", |
| 17 | // wrong ram size in stm32-data | ||
| 18 | feature = "stm32wl55jc", | ||
| 17 | )) { | 19 | )) { |
| 18 | println!("cargo:rustc-link-arg-bins=-Tlink.x"); | 20 | println!("cargo:rustc-link-arg-bins=-Tlink.x"); |
| 19 | println!("cargo:rerun-if-changed=link.x"); | 21 | println!("cargo:rerun-if-changed=link.x"); |
diff --git a/tests/stm32/src/bin/dac.rs b/tests/stm32/src/bin/dac.rs index 67a7d5b59..10e3c3e81 100644 --- a/tests/stm32/src/bin/dac.rs +++ b/tests/stm32/src/bin/dac.rs | |||
| @@ -12,7 +12,7 @@ use embassy_executor::Spawner; | |||
| 12 | use embassy_stm32::adc::Adc; | 12 | use embassy_stm32::adc::Adc; |
| 13 | use embassy_stm32::dac::{DacCh1, DacChannel, Value}; | 13 | use embassy_stm32::dac::{DacCh1, DacChannel, Value}; |
| 14 | use embassy_stm32::dma::NoDma; | 14 | use embassy_stm32::dma::NoDma; |
| 15 | use embassy_time::{Delay, Duration, Timer}; | 15 | use embassy_time::{Delay, Timer}; |
| 16 | use {defmt_rtt as _, panic_probe as _}; | 16 | use {defmt_rtt as _, panic_probe as _}; |
| 17 | 17 | ||
| 18 | #[embassy_executor::main] | 18 | #[embassy_executor::main] |
| @@ -38,7 +38,7 @@ async fn main(_spawner: Spawner) { | |||
| 38 | 38 | ||
| 39 | unwrap!(dac.set(Value::Bit8(0))); | 39 | unwrap!(dac.set(Value::Bit8(0))); |
| 40 | // Now wait a little to obtain a stable value | 40 | // Now wait a little to obtain a stable value |
| 41 | Timer::after(Duration::from_millis(30)).await; | 41 | Timer::after_millis(30).await; |
| 42 | let offset = adc.read(&mut unsafe { embassy_stm32::Peripherals::steal() }.PA4); | 42 | let offset = adc.read(&mut unsafe { embassy_stm32::Peripherals::steal() }.PA4); |
| 43 | 43 | ||
| 44 | for v in 0..=255 { | 44 | for v in 0..=255 { |
| @@ -47,14 +47,14 @@ async fn main(_spawner: Spawner) { | |||
| 47 | unwrap!(dac.set(Value::Bit8(dac_output_val))); | 47 | unwrap!(dac.set(Value::Bit8(dac_output_val))); |
| 48 | 48 | ||
| 49 | // Now wait a little to obtain a stable value | 49 | // Now wait a little to obtain a stable value |
| 50 | Timer::after(Duration::from_millis(30)).await; | 50 | Timer::after_millis(30).await; |
| 51 | 51 | ||
| 52 | // Need to steal the peripherals here because PA4 is obviously in use already | 52 | // Need to steal the peripherals here because PA4 is obviously in use already |
| 53 | let measured = adc.read(&mut unsafe { embassy_stm32::Peripherals::steal() }.PA4); | 53 | let measured = adc.read(&mut unsafe { embassy_stm32::Peripherals::steal() }.PA4); |
| 54 | // Calibrate and normalize the measurement to get close to the dac_output_val | 54 | // Calibrate and normalize the measurement to get close to the dac_output_val |
| 55 | let measured_normalized = ((measured as i32 - offset as i32) / normalization_factor) as i16; | 55 | let measured_normalized = ((measured as i32 - offset as i32) / normalization_factor) as i16; |
| 56 | 56 | ||
| 57 | info!("value / measured: {} / {}", dac_output_val, measured_normalized); | 57 | //info!("value / measured: {} / {}", dac_output_val, measured_normalized); |
| 58 | 58 | ||
| 59 | // The deviations are quite enormous but that does not matter since this is only a quick test | 59 | // The deviations are quite enormous but that does not matter since this is only a quick test |
| 60 | assert!((dac_output_val as i16 - measured_normalized).abs() < 15); | 60 | assert!((dac_output_val as i16 - measured_normalized).abs() < 15); |
diff --git a/tests/stm32/src/bin/eth.rs b/tests/stm32/src/bin/eth.rs new file mode 100644 index 000000000..6d5e05cd6 --- /dev/null +++ b/tests/stm32/src/bin/eth.rs | |||
| @@ -0,0 +1,122 @@ | |||
| 1 | // required-features: eth | ||
| 2 | #![no_std] | ||
| 3 | #![no_main] | ||
| 4 | #![feature(type_alias_impl_trait)] | ||
| 5 | |||
| 6 | #[path = "../common.rs"] | ||
| 7 | mod common; | ||
| 8 | use common::*; | ||
| 9 | use embassy_executor::Spawner; | ||
| 10 | use embassy_net::{Stack, StackResources}; | ||
| 11 | use embassy_stm32::eth::generic_smi::GenericSMI; | ||
| 12 | use embassy_stm32::eth::{Ethernet, PacketQueue}; | ||
| 13 | use embassy_stm32::peripherals::ETH; | ||
| 14 | use embassy_stm32::rng::Rng; | ||
| 15 | use embassy_stm32::{bind_interrupts, eth, peripherals, rng}; | ||
| 16 | use rand_core::RngCore; | ||
| 17 | use static_cell::make_static; | ||
| 18 | use {defmt_rtt as _, panic_probe as _}; | ||
| 19 | |||
| 20 | teleprobe_meta::timeout!(120); | ||
| 21 | |||
| 22 | #[cfg(not(any(feature = "stm32h563zi", feature = "stm32f767zi", feature = "stm32f207zg")))] | ||
| 23 | bind_interrupts!(struct Irqs { | ||
| 24 | ETH => eth::InterruptHandler; | ||
| 25 | HASH_RNG => rng::InterruptHandler<peripherals::RNG>; | ||
| 26 | }); | ||
| 27 | #[cfg(any(feature = "stm32h563zi", feature = "stm32f767zi", feature = "stm32f207zg"))] | ||
| 28 | bind_interrupts!(struct Irqs { | ||
| 29 | ETH => eth::InterruptHandler; | ||
| 30 | RNG => rng::InterruptHandler<peripherals::RNG>; | ||
| 31 | }); | ||
| 32 | |||
| 33 | type Device = Ethernet<'static, ETH, GenericSMI>; | ||
| 34 | |||
| 35 | #[embassy_executor::task] | ||
| 36 | async fn net_task(stack: &'static Stack<Device>) -> ! { | ||
| 37 | stack.run().await | ||
| 38 | } | ||
| 39 | |||
| 40 | #[embassy_executor::main] | ||
| 41 | async fn main(spawner: Spawner) { | ||
| 42 | let p = embassy_stm32::init(config()); | ||
| 43 | info!("Hello World!"); | ||
| 44 | |||
| 45 | // Generate random seed. | ||
| 46 | let mut rng = Rng::new(p.RNG, Irqs); | ||
| 47 | let mut seed = [0; 8]; | ||
| 48 | rng.fill_bytes(&mut seed); | ||
| 49 | let seed = u64::from_le_bytes(seed); | ||
| 50 | |||
| 51 | // Ensure different boards get different MAC | ||
| 52 | // so running tests concurrently doesn't break (they're all in the same LAN) | ||
| 53 | #[cfg(feature = "stm32f429zi")] | ||
| 54 | let n = 1; | ||
| 55 | #[cfg(feature = "stm32h755zi")] | ||
| 56 | let n = 2; | ||
| 57 | #[cfg(feature = "stm32h563zi")] | ||
| 58 | let n = 3; | ||
| 59 | #[cfg(feature = "stm32f767zi")] | ||
| 60 | let n = 4; | ||
| 61 | #[cfg(feature = "stm32f207zg")] | ||
| 62 | let n = 5; | ||
| 63 | |||
| 64 | let mac_addr = [0x00, n, 0xDE, 0xAD, 0xBE, 0xEF]; | ||
| 65 | |||
| 66 | // F2 runs out of RAM | ||
| 67 | #[cfg(feature = "stm32f207zg")] | ||
| 68 | const PACKET_QUEUE_SIZE: usize = 2; | ||
| 69 | #[cfg(not(feature = "stm32f207zg"))] | ||
| 70 | const PACKET_QUEUE_SIZE: usize = 4; | ||
| 71 | |||
| 72 | let device = Ethernet::new( | ||
| 73 | make_static!(PacketQueue::<PACKET_QUEUE_SIZE, PACKET_QUEUE_SIZE>::new()), | ||
| 74 | p.ETH, | ||
| 75 | Irqs, | ||
| 76 | p.PA1, | ||
| 77 | p.PA2, | ||
| 78 | p.PC1, | ||
| 79 | p.PA7, | ||
| 80 | p.PC4, | ||
| 81 | p.PC5, | ||
| 82 | p.PG13, | ||
| 83 | #[cfg(not(feature = "stm32h563zi"))] | ||
| 84 | p.PB13, | ||
| 85 | #[cfg(feature = "stm32h563zi")] | ||
| 86 | p.PB15, | ||
| 87 | p.PG11, | ||
| 88 | GenericSMI::new(0), | ||
| 89 | mac_addr, | ||
| 90 | ); | ||
| 91 | |||
| 92 | let config = embassy_net::Config::dhcpv4(Default::default()); | ||
| 93 | //let config = embassy_net::Config::ipv4_static(embassy_net::StaticConfigV4 { | ||
| 94 | // address: Ipv4Cidr::new(Ipv4Address::new(10, 42, 0, 61), 24), | ||
| 95 | // dns_servers: Vec::new(), | ||
| 96 | // gateway: Some(Ipv4Address::new(10, 42, 0, 1)), | ||
| 97 | //}); | ||
| 98 | |||
| 99 | // Init network stack | ||
| 100 | let stack = &*make_static!(Stack::new( | ||
| 101 | device, | ||
| 102 | config, | ||
| 103 | make_static!(StackResources::<2>::new()), | ||
| 104 | seed | ||
| 105 | )); | ||
| 106 | |||
| 107 | // Launch network task | ||
| 108 | unwrap!(spawner.spawn(net_task(&stack))); | ||
| 109 | |||
| 110 | perf_client::run( | ||
| 111 | stack, | ||
| 112 | perf_client::Expected { | ||
| 113 | down_kbps: 1000, | ||
| 114 | up_kbps: 1000, | ||
| 115 | updown_kbps: 1000, | ||
| 116 | }, | ||
| 117 | ) | ||
| 118 | .await; | ||
| 119 | |||
| 120 | info!("Test OK"); | ||
| 121 | cortex_m::asm::bkpt(); | ||
| 122 | } | ||
diff --git a/tests/stm32/src/bin/rng.rs b/tests/stm32/src/bin/rng.rs new file mode 100644 index 000000000..65da737d0 --- /dev/null +++ b/tests/stm32/src/bin/rng.rs | |||
| @@ -0,0 +1,50 @@ | |||
| 1 | // required-features: rng | ||
| 2 | #![no_std] | ||
| 3 | #![no_main] | ||
| 4 | #![feature(type_alias_impl_trait)] | ||
| 5 | |||
| 6 | #[path = "../common.rs"] | ||
| 7 | mod common; | ||
| 8 | use common::*; | ||
| 9 | use embassy_executor::Spawner; | ||
| 10 | use embassy_stm32::rng::Rng; | ||
| 11 | use embassy_stm32::{bind_interrupts, peripherals, rng}; | ||
| 12 | use {defmt_rtt as _, panic_probe as _}; | ||
| 13 | |||
| 14 | #[cfg(any(feature = "stm32l4a6zg", feature = "stm32h755zi", feature = "stm32f429zi"))] | ||
| 15 | bind_interrupts!(struct Irqs { | ||
| 16 | HASH_RNG => rng::InterruptHandler<peripherals::RNG>; | ||
| 17 | }); | ||
| 18 | #[cfg(any(feature = "stm32l073rz"))] | ||
| 19 | bind_interrupts!(struct Irqs { | ||
| 20 | RNG_LPUART1 => rng::InterruptHandler<peripherals::RNG>; | ||
| 21 | }); | ||
| 22 | #[cfg(not(any( | ||
| 23 | feature = "stm32l4a6zg", | ||
| 24 | feature = "stm32l073rz", | ||
| 25 | feature = "stm32h755zi", | ||
| 26 | feature = "stm32f429zi" | ||
| 27 | )))] | ||
| 28 | bind_interrupts!(struct Irqs { | ||
| 29 | RNG => rng::InterruptHandler<peripherals::RNG>; | ||
| 30 | }); | ||
| 31 | |||
| 32 | #[embassy_executor::main] | ||
| 33 | async fn main(_spawner: Spawner) { | ||
| 34 | let p: embassy_stm32::Peripherals = embassy_stm32::init(config()); | ||
| 35 | |||
| 36 | let mut rng = Rng::new(p.RNG, Irqs); | ||
| 37 | |||
| 38 | let mut buf1 = [0u8; 16]; | ||
| 39 | unwrap!(rng.async_fill_bytes(&mut buf1).await); | ||
| 40 | info!("random bytes: {:02x}", buf1); | ||
| 41 | |||
| 42 | let mut buf2 = [0u8; 16]; | ||
| 43 | unwrap!(rng.async_fill_bytes(&mut buf2).await); | ||
| 44 | info!("random bytes: {:02x}", buf2); | ||
| 45 | |||
| 46 | defmt::assert!(buf1 != buf2); | ||
| 47 | |||
| 48 | info!("Test OK"); | ||
| 49 | cortex_m::asm::bkpt(); | ||
| 50 | } | ||
diff --git a/tests/stm32/src/bin/rtc.rs b/tests/stm32/src/bin/rtc.rs index 22be6fac5..64f1122a6 100644 --- a/tests/stm32/src/bin/rtc.rs +++ b/tests/stm32/src/bin/rtc.rs | |||
| @@ -10,17 +10,14 @@ use chrono::{NaiveDate, NaiveDateTime}; | |||
| 10 | use common::*; | 10 | use common::*; |
| 11 | use defmt::assert; | 11 | use defmt::assert; |
| 12 | use embassy_executor::Spawner; | 12 | use embassy_executor::Spawner; |
| 13 | use embassy_stm32::rcc::RtcClockSource; | 13 | use embassy_stm32::rcc::LsConfig; |
| 14 | use embassy_stm32::rtc::{Rtc, RtcConfig}; | 14 | use embassy_stm32::rtc::{Rtc, RtcConfig}; |
| 15 | use embassy_stm32::time::Hertz; | 15 | use embassy_time::Timer; |
| 16 | use embassy_time::{Duration, Timer}; | ||
| 17 | 16 | ||
| 18 | #[embassy_executor::main] | 17 | #[embassy_executor::main] |
| 19 | async fn main(_spawner: Spawner) { | 18 | async fn main(_spawner: Spawner) { |
| 20 | let mut config = config(); | 19 | let mut config = config(); |
| 21 | 20 | config.rcc.ls = LsConfig::default_lse(); | |
| 22 | config.rcc.lse = Some(Hertz(32_768)); | ||
| 23 | config.rcc.rtc = Some(RtcClockSource::LSE); | ||
| 24 | 21 | ||
| 25 | let p = embassy_stm32::init(config); | 22 | let p = embassy_stm32::init(config); |
| 26 | info!("Hello World!"); | 23 | info!("Hello World!"); |
| @@ -35,12 +32,12 @@ async fn main(_spawner: Spawner) { | |||
| 35 | rtc.set_datetime(now.into()).expect("datetime not set"); | 32 | rtc.set_datetime(now.into()).expect("datetime not set"); |
| 36 | 33 | ||
| 37 | info!("Waiting 5 seconds"); | 34 | info!("Waiting 5 seconds"); |
| 38 | Timer::after(Duration::from_millis(5000)).await; | 35 | Timer::after_millis(5000).await; |
| 39 | 36 | ||
| 40 | let then: NaiveDateTime = rtc.now().unwrap().into(); | 37 | let then: NaiveDateTime = rtc.now().unwrap().into(); |
| 41 | let seconds = (then - now).num_seconds(); | 38 | let seconds = (then - now).num_seconds(); |
| 42 | 39 | ||
| 43 | defmt::info!("measured = {}", seconds); | 40 | info!("measured = {}", seconds); |
| 44 | 41 | ||
| 45 | assert!(seconds > 3 && seconds < 7); | 42 | assert!(seconds > 3 && seconds < 7); |
| 46 | 43 | ||
diff --git a/tests/stm32/src/bin/stop.rs b/tests/stm32/src/bin/stop.rs index 48d59b794..f38924c90 100644 --- a/tests/stm32/src/bin/stop.rs +++ b/tests/stm32/src/bin/stop.rs | |||
| @@ -11,10 +11,10 @@ use common::*; | |||
| 11 | use cortex_m_rt::entry; | 11 | use cortex_m_rt::entry; |
| 12 | use embassy_executor::Spawner; | 12 | use embassy_executor::Spawner; |
| 13 | use embassy_stm32::low_power::{stop_with_rtc, Executor}; | 13 | use embassy_stm32::low_power::{stop_with_rtc, Executor}; |
| 14 | use embassy_stm32::rcc::RtcClockSource; | 14 | use embassy_stm32::rcc::LsConfig; |
| 15 | use embassy_stm32::rtc::{Rtc, RtcConfig}; | 15 | use embassy_stm32::rtc::{Rtc, RtcConfig}; |
| 16 | use embassy_stm32::time::Hertz; | 16 | use embassy_stm32::Config; |
| 17 | use embassy_time::{Duration, Timer}; | 17 | use embassy_time::Timer; |
| 18 | use static_cell::make_static; | 18 | use static_cell::make_static; |
| 19 | 19 | ||
| 20 | #[entry] | 20 | #[entry] |
| @@ -28,7 +28,7 @@ fn main() -> ! { | |||
| 28 | async fn task_1() { | 28 | async fn task_1() { |
| 29 | for _ in 0..9 { | 29 | for _ in 0..9 { |
| 30 | info!("task 1: waiting for 500ms..."); | 30 | info!("task 1: waiting for 500ms..."); |
| 31 | Timer::after(Duration::from_millis(500)).await; | 31 | Timer::after_millis(500).await; |
| 32 | } | 32 | } |
| 33 | } | 33 | } |
| 34 | 34 | ||
| @@ -36,7 +36,7 @@ async fn task_1() { | |||
| 36 | async fn task_2() { | 36 | async fn task_2() { |
| 37 | for _ in 0..5 { | 37 | for _ in 0..5 { |
| 38 | info!("task 2: waiting for 1000ms..."); | 38 | info!("task 2: waiting for 1000ms..."); |
| 39 | Timer::after(Duration::from_millis(1000)).await; | 39 | Timer::after_millis(1000).await; |
| 40 | } | 40 | } |
| 41 | 41 | ||
| 42 | info!("Test OK"); | 42 | info!("Test OK"); |
| @@ -45,10 +45,10 @@ async fn task_2() { | |||
| 45 | 45 | ||
| 46 | #[embassy_executor::task] | 46 | #[embassy_executor::task] |
| 47 | async fn async_main(spawner: Spawner) { | 47 | async fn async_main(spawner: Spawner) { |
| 48 | let mut config = config(); | 48 | let _ = config(); |
| 49 | 49 | ||
| 50 | config.rcc.lse = Some(Hertz(32_768)); | 50 | let mut config = Config::default(); |
| 51 | config.rcc.rtc = Some(RtcClockSource::LSE); | 51 | config.rcc.ls = LsConfig::default_lse(); |
| 52 | 52 | ||
| 53 | let p = embassy_stm32::init(config); | 53 | let p = embassy_stm32::init(config); |
| 54 | info!("Hello World!"); | 54 | info!("Hello World!"); |
diff --git a/tests/stm32/src/bin/timer.rs b/tests/stm32/src/bin/timer.rs index f8b453cda..4efeb0a49 100644 --- a/tests/stm32/src/bin/timer.rs +++ b/tests/stm32/src/bin/timer.rs | |||
| @@ -7,7 +7,7 @@ mod common; | |||
| 7 | use common::*; | 7 | use common::*; |
| 8 | use defmt::assert; | 8 | use defmt::assert; |
| 9 | use embassy_executor::Spawner; | 9 | use embassy_executor::Spawner; |
| 10 | use embassy_time::{Duration, Instant, Timer}; | 10 | use embassy_time::{Instant, Timer}; |
| 11 | 11 | ||
| 12 | #[embassy_executor::main] | 12 | #[embassy_executor::main] |
| 13 | async fn main(_spawner: Spawner) { | 13 | async fn main(_spawner: Spawner) { |
| @@ -15,7 +15,7 @@ async fn main(_spawner: Spawner) { | |||
| 15 | info!("Hello World!"); | 15 | info!("Hello World!"); |
| 16 | 16 | ||
| 17 | let start = Instant::now(); | 17 | let start = Instant::now(); |
| 18 | Timer::after(Duration::from_millis(100)).await; | 18 | Timer::after_millis(100).await; |
| 19 | let end = Instant::now(); | 19 | let end = Instant::now(); |
| 20 | let ms = (end - start).as_millis(); | 20 | let ms = (end - start).as_millis(); |
| 21 | info!("slept for {} ms", ms); | 21 | info!("slept for {} ms", ms); |
diff --git a/tests/stm32/src/bin/usart_rx_ringbuffered.rs b/tests/stm32/src/bin/usart_rx_ringbuffered.rs index 1ee7e596d..7e15f64b6 100644 --- a/tests/stm32/src/bin/usart_rx_ringbuffered.rs +++ b/tests/stm32/src/bin/usart_rx_ringbuffered.rs | |||
| @@ -10,7 +10,7 @@ use common::*; | |||
| 10 | use defmt::{assert_eq, panic}; | 10 | use defmt::{assert_eq, panic}; |
| 11 | use embassy_executor::Spawner; | 11 | use embassy_executor::Spawner; |
| 12 | use embassy_stm32::usart::{Config, DataBits, Parity, RingBufferedUartRx, StopBits, Uart, UartTx}; | 12 | use embassy_stm32::usart::{Config, DataBits, Parity, RingBufferedUartRx, StopBits, Uart, UartTx}; |
| 13 | use embassy_time::{Duration, Timer}; | 13 | use embassy_time::Timer; |
| 14 | use rand_chacha::ChaCha8Rng; | 14 | use rand_chacha::ChaCha8Rng; |
| 15 | use rand_core::{RngCore, SeedableRng}; | 15 | use rand_core::{RngCore, SeedableRng}; |
| 16 | 16 | ||
| @@ -54,7 +54,7 @@ async fn main(spawner: Spawner) { | |||
| 54 | #[embassy_executor::task] | 54 | #[embassy_executor::task] |
| 55 | async fn transmit_task(mut tx: UartTx<'static, peris::UART, peris::UART_TX_DMA>) { | 55 | async fn transmit_task(mut tx: UartTx<'static, peris::UART, peris::UART_TX_DMA>) { |
| 56 | // workaround https://github.com/embassy-rs/embassy/issues/1426 | 56 | // workaround https://github.com/embassy-rs/embassy/issues/1426 |
| 57 | Timer::after(Duration::from_millis(100) as _).await; | 57 | Timer::after_millis(100).await; |
| 58 | 58 | ||
| 59 | let mut rng = ChaCha8Rng::seed_from_u64(1337); | 59 | let mut rng = ChaCha8Rng::seed_from_u64(1337); |
| 60 | 60 | ||
| @@ -70,7 +70,7 @@ async fn transmit_task(mut tx: UartTx<'static, peris::UART, peris::UART_TX_DMA>) | |||
| 70 | } | 70 | } |
| 71 | 71 | ||
| 72 | tx.write(&buf[..len]).await.unwrap(); | 72 | tx.write(&buf[..len]).await.unwrap(); |
| 73 | Timer::after(Duration::from_micros((rng.next_u32() % 1000) as _)).await; | 73 | Timer::after_micros((rng.next_u32() % 1000) as _).await; |
| 74 | } | 74 | } |
| 75 | } | 75 | } |
| 76 | 76 | ||
| @@ -98,7 +98,7 @@ async fn receive_task(mut rx: RingBufferedUartRx<'static, peris::UART, peris::UA | |||
| 98 | } | 98 | } |
| 99 | 99 | ||
| 100 | if received < max_len { | 100 | if received < max_len { |
| 101 | Timer::after(Duration::from_micros((rng.next_u32() % 1000) as _)).await; | 101 | Timer::after_micros((rng.next_u32() % 1000) as _).await; |
| 102 | } | 102 | } |
| 103 | 103 | ||
| 104 | i += received; | 104 | i += received; |
diff --git a/tests/stm32/src/common.rs b/tests/stm32/src/common.rs index 9c0b8c39e..8dde71fb3 100644 --- a/tests/stm32/src/common.rs +++ b/tests/stm32/src/common.rs | |||
| @@ -34,6 +34,16 @@ teleprobe_meta::target!(b"nucleo-stm32l4a6zg"); | |||
| 34 | teleprobe_meta::target!(b"nucleo-stm32l4r5zi"); | 34 | teleprobe_meta::target!(b"nucleo-stm32l4r5zi"); |
| 35 | #[cfg(feature = "stm32l552ze")] | 35 | #[cfg(feature = "stm32l552ze")] |
| 36 | teleprobe_meta::target!(b"nucleo-stm32l552ze"); | 36 | teleprobe_meta::target!(b"nucleo-stm32l552ze"); |
| 37 | #[cfg(feature = "stm32f767zi")] | ||
| 38 | teleprobe_meta::target!(b"nucleo-stm32f767zi"); | ||
| 39 | #[cfg(feature = "stm32f207zg")] | ||
| 40 | teleprobe_meta::target!(b"nucleo-stm32f207zg"); | ||
| 41 | #[cfg(feature = "stm32f303ze")] | ||
| 42 | teleprobe_meta::target!(b"nucleo-stm32f303ze"); | ||
| 43 | #[cfg(feature = "stm32l496zg")] | ||
| 44 | teleprobe_meta::target!(b"nucleo-stm32l496zg"); | ||
| 45 | #[cfg(feature = "stm32wl55jc")] | ||
| 46 | teleprobe_meta::target!(b"nucleo-stm32wl55jc"); | ||
| 37 | 47 | ||
| 38 | macro_rules! define_peris { | 48 | macro_rules! define_peris { |
| 39 | ($($name:ident = $peri:ident,)* $(@irq $irq_name:ident = $irq_code:tt,)*) => { | 49 | ($($name:ident = $peri:ident,)* $(@irq $irq_name:ident = $irq_code:tt,)*) => { |
| @@ -119,6 +129,12 @@ define_peris!( | |||
| 119 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH1, SPI_RX_DMA = DMA1_CH2, | 129 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH1, SPI_RX_DMA = DMA1_CH2, |
| 120 | @irq UART = {USART1 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART1>;}, | 130 | @irq UART = {USART1 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART1>;}, |
| 121 | ); | 131 | ); |
| 132 | #[cfg(feature = "stm32l496zg")] | ||
| 133 | define_peris!( | ||
| 134 | UART = USART3, UART_TX = PD8, UART_RX = PD9, UART_TX_DMA = DMA1_CH2, UART_RX_DMA = DMA1_CH3, | ||
| 135 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH3, SPI_RX_DMA = DMA1_CH2, | ||
| 136 | @irq UART = {USART3 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART3>;}, | ||
| 137 | ); | ||
| 122 | #[cfg(feature = "stm32l4a6zg")] | 138 | #[cfg(feature = "stm32l4a6zg")] |
| 123 | define_peris!( | 139 | define_peris!( |
| 124 | UART = USART3, UART_TX = PD8, UART_RX = PD9, UART_TX_DMA = DMA1_CH2, UART_RX_DMA = DMA1_CH3, | 140 | UART = USART3, UART_TX = PD8, UART_RX = PD9, UART_TX_DMA = DMA1_CH2, UART_RX_DMA = DMA1_CH3, |
| @@ -149,28 +165,148 @@ define_peris!( | |||
| 149 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH1, SPI_RX_DMA = DMA1_CH2, | 165 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH1, SPI_RX_DMA = DMA1_CH2, |
| 150 | @irq UART = {USART3 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART3>;}, | 166 | @irq UART = {USART3 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART3>;}, |
| 151 | ); | 167 | ); |
| 168 | #[cfg(feature = "stm32f767zi")] | ||
| 169 | define_peris!( | ||
| 170 | UART = USART6, UART_TX = PG14, UART_RX = PG9, UART_TX_DMA = DMA2_CH6, UART_RX_DMA = DMA2_CH1, | ||
| 171 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA2_CH3, SPI_RX_DMA = DMA2_CH2, | ||
| 172 | @irq UART = {USART6 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART6>;}, | ||
| 173 | ); | ||
| 174 | #[cfg(feature = "stm32f207zg")] | ||
| 175 | define_peris!( | ||
| 176 | UART = USART6, UART_TX = PG14, UART_RX = PG9, UART_TX_DMA = DMA2_CH6, UART_RX_DMA = DMA2_CH1, | ||
| 177 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA2_CH3, SPI_RX_DMA = DMA2_CH2, | ||
| 178 | @irq UART = {USART6 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART6>;}, | ||
| 179 | ); | ||
| 180 | #[cfg(feature = "stm32f303ze")] | ||
| 181 | define_peris!( | ||
| 182 | UART = USART1, UART_TX = PC4, UART_RX = PC5, UART_TX_DMA = DMA1_CH4, UART_RX_DMA = DMA1_CH5, | ||
| 183 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH3, SPI_RX_DMA = DMA1_CH2, | ||
| 184 | @irq UART = {USART1 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART1>;}, | ||
| 185 | ); | ||
| 186 | #[cfg(feature = "stm32wl55jc")] | ||
| 187 | define_peris!( | ||
| 188 | UART = USART1, UART_TX = PB6, UART_RX = PB7, UART_TX_DMA = DMA1_CH4, UART_RX_DMA = DMA1_CH5, | ||
| 189 | SPI = SPI1, SPI_SCK = PA5, SPI_MOSI = PA7, SPI_MISO = PA6, SPI_TX_DMA = DMA1_CH3, SPI_RX_DMA = DMA1_CH2, | ||
| 190 | @irq UART = {USART1 => embassy_stm32::usart::InterruptHandler<embassy_stm32::peripherals::USART1>;}, | ||
| 191 | ); | ||
| 152 | 192 | ||
| 153 | pub fn config() -> Config { | 193 | pub fn config() -> Config { |
| 154 | #[allow(unused_mut)] | 194 | #[allow(unused_mut)] |
| 155 | let mut config = Config::default(); | 195 | let mut config = Config::default(); |
| 156 | 196 | ||
| 197 | #[cfg(feature = "stm32f207zg")] | ||
| 198 | { | ||
| 199 | use embassy_stm32::rcc::*; | ||
| 200 | // By default, HSE on the board comes from a 8 MHz clock signal (not a crystal) | ||
| 201 | config.rcc.hse = Some(HSEConfig { | ||
| 202 | frequency: Hertz(8_000_000), | ||
| 203 | source: HSESrc::Bypass, | ||
| 204 | }); | ||
| 205 | // PLL uses HSE as the clock source | ||
| 206 | config.rcc.pll_mux = PLLSrc::HSE; | ||
| 207 | config.rcc.pll = PLLConfig { | ||
| 208 | // 8 MHz clock source / 8 = 1 MHz PLL input | ||
| 209 | pre_div: unwrap!(PLLPreDiv::try_from(8)), | ||
| 210 | // 1 MHz PLL input * 240 = 240 MHz PLL VCO | ||
| 211 | mul: unwrap!(PLLMul::try_from(240)), | ||
| 212 | // 240 MHz PLL VCO / 2 = 120 MHz main PLL output | ||
| 213 | p_div: PLLPDiv::DIV2, | ||
| 214 | // 240 MHz PLL VCO / 5 = 48 MHz PLL48 output | ||
| 215 | q_div: PLLQDiv::DIV5, | ||
| 216 | }; | ||
| 217 | // System clock comes from PLL (= the 120 MHz main PLL output) | ||
| 218 | config.rcc.mux = ClockSrc::PLL; | ||
| 219 | // 120 MHz / 4 = 30 MHz APB1 frequency | ||
| 220 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 221 | // 120 MHz / 2 = 60 MHz APB2 frequency | ||
| 222 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 223 | } | ||
| 224 | |||
| 225 | #[cfg(feature = "stm32f429zi")] | ||
| 226 | { | ||
| 227 | use embassy_stm32::rcc::*; | ||
| 228 | config.rcc.hse = Some(Hse { | ||
| 229 | freq: Hertz(8_000_000), | ||
| 230 | mode: HseMode::Bypass, | ||
| 231 | }); | ||
| 232 | config.rcc.pll_src = PllSource::HSE; | ||
| 233 | config.rcc.pll = Some(Pll { | ||
| 234 | prediv: PllPreDiv::DIV4, | ||
| 235 | mul: PllMul::MUL180, | ||
| 236 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 180 / 2 = 180Mhz. | ||
| 237 | divq: None, | ||
| 238 | divr: None, | ||
| 239 | }); | ||
| 240 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 241 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 242 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 243 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 244 | } | ||
| 245 | |||
| 246 | #[cfg(feature = "stm32f767zi")] | ||
| 247 | { | ||
| 248 | use embassy_stm32::rcc::*; | ||
| 249 | config.rcc.hse = Some(Hse { | ||
| 250 | freq: Hertz(8_000_000), | ||
| 251 | mode: HseMode::Bypass, | ||
| 252 | }); | ||
| 253 | config.rcc.pll_src = PllSource::HSE; | ||
| 254 | config.rcc.pll = Some(Pll { | ||
| 255 | prediv: PllPreDiv::DIV4, | ||
| 256 | mul: PllMul::MUL216, | ||
| 257 | divp: Some(Pllp::DIV2), // 8mhz / 4 * 216 / 2 = 216Mhz. | ||
| 258 | divq: None, | ||
| 259 | divr: None, | ||
| 260 | }); | ||
| 261 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 262 | config.rcc.apb1_pre = APBPrescaler::DIV4; | ||
| 263 | config.rcc.apb2_pre = APBPrescaler::DIV2; | ||
| 264 | config.rcc.sys = Sysclk::PLL1_P; | ||
| 265 | } | ||
| 266 | |||
| 267 | #[cfg(feature = "stm32h563zi")] | ||
| 268 | { | ||
| 269 | use embassy_stm32::rcc::*; | ||
| 270 | config.rcc.hsi = None; | ||
| 271 | config.rcc.hsi48 = true; // needed for rng | ||
| 272 | config.rcc.hse = Some(Hse { | ||
| 273 | freq: Hertz(8_000_000), | ||
| 274 | mode: HseMode::BypassDigital, | ||
| 275 | }); | ||
| 276 | config.rcc.pll1 = Some(Pll { | ||
| 277 | source: PllSource::Hse, | ||
| 278 | prediv: PllPreDiv::DIV2, | ||
| 279 | mul: PllMul::MUL125, | ||
| 280 | divp: Some(PllDiv::DIV2), | ||
| 281 | divq: Some(PllDiv::DIV2), | ||
| 282 | divr: None, | ||
| 283 | }); | ||
| 284 | config.rcc.ahb_pre = AHBPrescaler::DIV1; | ||
| 285 | config.rcc.apb1_pre = APBPrescaler::DIV1; | ||
| 286 | config.rcc.apb2_pre = APBPrescaler::DIV1; | ||
| 287 | config.rcc.apb3_pre = APBPrescaler::DIV1; | ||
| 288 | config.rcc.sys = Sysclk::Pll1P; | ||
| 289 | config.rcc.voltage_scale = VoltageScale::Scale0; | ||
| 290 | } | ||
| 291 | |||
| 157 | #[cfg(feature = "stm32h755zi")] | 292 | #[cfg(feature = "stm32h755zi")] |
| 158 | { | 293 | { |
| 159 | use embassy_stm32::rcc::*; | 294 | use embassy_stm32::rcc::*; |
| 160 | config.rcc.hsi = Some(Hsi::Mhz64); | 295 | config.rcc.hsi = Some(Hsi::Mhz64); |
| 161 | config.rcc.csi = true; | 296 | config.rcc.csi = true; |
| 297 | config.rcc.hsi48 = true; // needed for RNG | ||
| 162 | config.rcc.pll_src = PllSource::Hsi; | 298 | config.rcc.pll_src = PllSource::Hsi; |
| 163 | config.rcc.pll1 = Some(Pll { | 299 | config.rcc.pll1 = Some(Pll { |
| 164 | prediv: 4, | 300 | prediv: PllPreDiv::DIV4, |
| 165 | mul: 50, | 301 | mul: PllMul::MUL50, |
| 166 | divp: Some(2), | 302 | divp: Some(PllDiv::DIV2), |
| 167 | divq: Some(8), // SPI1 cksel defaults to pll1_q | 303 | divq: Some(PllDiv::DIV8), // SPI1 cksel defaults to pll1_q |
| 168 | divr: None, | 304 | divr: None, |
| 169 | }); | 305 | }); |
| 170 | config.rcc.pll2 = Some(Pll { | 306 | config.rcc.pll2 = Some(Pll { |
| 171 | prediv: 4, | 307 | prediv: PllPreDiv::DIV4, |
| 172 | mul: 50, | 308 | mul: PllMul::MUL50, |
| 173 | divp: Some(8), // 100mhz | 309 | divp: Some(PllDiv::DIV8), // 100mhz |
| 174 | divq: None, | 310 | divq: None, |
| 175 | divr: None, | 311 | divr: None, |
| 176 | }); | 312 | }); |
| @@ -184,36 +320,57 @@ pub fn config() -> Config { | |||
| 184 | config.rcc.adc_clock_source = AdcClockSource::PLL2_P; | 320 | config.rcc.adc_clock_source = AdcClockSource::PLL2_P; |
| 185 | } | 321 | } |
| 186 | 322 | ||
| 187 | #[cfg(any(feature = "stm32l4a6zg", feature = "stm32l4r5zi"))] | 323 | #[cfg(any(feature = "stm32l496zg", feature = "stm32l4a6zg", feature = "stm32l4r5zi"))] |
| 188 | { | 324 | { |
| 189 | use embassy_stm32::rcc::*; | 325 | use embassy_stm32::rcc::*; |
| 190 | config.rcc.mux = ClockSrc::PLL( | 326 | #[cfg(feature = "stm32l4r5zi")] |
| 191 | // 72Mhz clock (16 / 1 * 18 / 4) | 327 | { |
| 192 | PLLSource::HSI16, | 328 | config.rcc.mux = ClockSrc::PLL1_R; |
| 193 | PLLClkDiv::Div4, | 329 | } |
| 194 | PLLSrcDiv::Div1, | 330 | #[cfg(not(feature = "stm32l4r5zi"))] |
| 195 | PLLMul::Mul18, | 331 | { |
| 196 | Some(PLLClkDiv::Div6), // 48Mhz (16 / 1 * 18 / 6) | 332 | config.rcc.mux = ClockSrc::PLL1_P; |
| 197 | ); | 333 | } |
| 334 | config.rcc.hsi16 = true; | ||
| 335 | config.rcc.pll = Some(Pll { | ||
| 336 | source: PLLSource::HSI, | ||
| 337 | prediv: PllPreDiv::DIV1, | ||
| 338 | mul: PllMul::MUL18, | ||
| 339 | divp: None, | ||
| 340 | divq: Some(PllQDiv::DIV6), // 48Mhz (16 / 1 * 18 / 6) | ||
| 341 | divr: Some(PllRDiv::DIV4), // sysclk 72Mhz clock (16 / 1 * 18 / 4) | ||
| 342 | }); | ||
| 343 | } | ||
| 344 | |||
| 345 | #[cfg(feature = "stm32wl55jc")] | ||
| 346 | { | ||
| 347 | use embassy_stm32::rcc::*; | ||
| 348 | config.rcc.mux = ClockSrc::MSI(MSIRange::RANGE32M); | ||
| 349 | embassy_stm32::pac::RCC.ccipr().modify(|w| { | ||
| 350 | w.set_rngsel(0b11); // msi | ||
| 351 | }); | ||
| 198 | } | 352 | } |
| 199 | 353 | ||
| 200 | #[cfg(any(feature = "stm32l552ze"))] | 354 | #[cfg(any(feature = "stm32l552ze"))] |
| 201 | { | 355 | { |
| 202 | use embassy_stm32::rcc::*; | 356 | use embassy_stm32::rcc::*; |
| 203 | config.rcc.mux = ClockSrc::PLL( | 357 | config.rcc.hsi16 = true; |
| 358 | config.rcc.mux = ClockSrc::PLL1_R; | ||
| 359 | config.rcc.pll = Some(Pll { | ||
| 204 | // 110Mhz clock (16 / 4 * 55 / 2) | 360 | // 110Mhz clock (16 / 4 * 55 / 2) |
| 205 | PLLSource::HSI16, | 361 | source: PLLSource::HSI, |
| 206 | PLLClkDiv::Div2, | 362 | prediv: PllPreDiv::DIV4, |
| 207 | PLLSrcDiv::Div4, | 363 | mul: PllMul::MUL55, |
| 208 | PLLMul::Mul55, | 364 | divp: None, |
| 209 | None, | 365 | divq: None, |
| 210 | ); | 366 | divr: Some(PllRDiv::DIV2), |
| 367 | }); | ||
| 211 | } | 368 | } |
| 212 | 369 | ||
| 213 | #[cfg(feature = "stm32u585ai")] | 370 | #[cfg(feature = "stm32u585ai")] |
| 214 | { | 371 | { |
| 215 | use embassy_stm32::rcc::*; | 372 | use embassy_stm32::rcc::*; |
| 216 | config.rcc.mux = ClockSrc::MSI(MSIRange::Range48mhz); | 373 | config.rcc.mux = ClockSrc::MSI(Msirange::RANGE_48MHZ); |
| 217 | } | 374 | } |
| 218 | 375 | ||
| 219 | #[cfg(feature = "stm32l073rz")] | 376 | #[cfg(feature = "stm32l073rz")] |
| @@ -222,8 +379,8 @@ pub fn config() -> Config { | |||
| 222 | config.rcc.mux = ClockSrc::PLL( | 379 | config.rcc.mux = ClockSrc::PLL( |
| 223 | // 32Mhz clock (16 * 4 / 2) | 380 | // 32Mhz clock (16 * 4 / 2) |
| 224 | PLLSource::HSI16, | 381 | PLLSource::HSI16, |
| 225 | PLLMul::Mul4, | 382 | PLLMul::MUL4, |
| 226 | PLLDiv::Div2, | 383 | PLLDiv::DIV2, |
| 227 | ); | 384 | ); |
| 228 | } | 385 | } |
| 229 | 386 | ||
| @@ -232,9 +389,9 @@ pub fn config() -> Config { | |||
| 232 | use embassy_stm32::rcc::*; | 389 | use embassy_stm32::rcc::*; |
| 233 | config.rcc.mux = ClockSrc::PLL( | 390 | config.rcc.mux = ClockSrc::PLL( |
| 234 | // 32Mhz clock (16 * 4 / 2) | 391 | // 32Mhz clock (16 * 4 / 2) |
| 235 | PLLSource::HSI, | 392 | PLLSource::HSI16, |
| 236 | PLLMul::Mul4, | 393 | PLLMul::MUL4, |
| 237 | PLLDiv::Div2, | 394 | PLLDiv::DIV2, |
| 238 | ); | 395 | ); |
| 239 | } | 396 | } |
| 240 | 397 | ||
